# devops-stages/stage-build.sh
#
-FROM ubuntu:18.04
+FROM ubuntu:22.04
+
+ARG APT_PROXY
+RUN if [ ! -z $APT_PROXY ] ; then \
+ echo "Acquire::http::Proxy \"$APT_PROXY\";" > /etc/apt/apt.conf.d/proxy.conf ;\
+ echo "Acquire::https::Proxy \"$APT_PROXY\";" >> /etc/apt/apt.conf.d/proxy.conf ;\
+ fi
RUN DEBIAN_FRONTEND=noninteractive apt-get update && \
DEBIAN_FRONTEND=noninteractive apt-get -y install \
debhelper \
+ dh-python \
git \
python3 \
python3-all \
python3-dev \
- python3-setuptools
+ python3-setuptools \
+ python3-pip \
+ tox
-RUN python3 -m easy_install pip==21.0.1
-RUN pip3 install tox==3.22.0
+ENV LC_ALL C.UTF-8
+ENV LANG C.UTF-8
-/*
- Licensed under the Apache License, Version 2.0 (the "License");
- you may not use this file except in compliance with the License.
- You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
- Unless required by applicable law or agreed to in writing, software
- distributed under the License is distributed on an "AS IS" BASIS,
- WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
- implied.
- See the License for the specific language governing permissions and
- limitations under the License.
-*/
+/* Copyright ETSI OSM and others
+ *
+ * All Rights Reserved.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ */
properties([
parameters([
}
}
-node('docker') {
+node('stage_2') {
checkout scm
devops_checkout()
rm -rf dists
mkdir -p pool/$MDG
mv deb_dist/*.deb pool/$MDG/
-mkdir -p dists/unstable/$MDG/binary-amd64/
-apt-ftparchive packages pool/$MDG > dists/unstable/$MDG/binary-amd64/Packages
-gzip -9fk dists/unstable/$MDG/binary-amd64/Packages
-echo "dists/**,pool/$MDG/*.deb"
+
--- /dev/null
+# Copyright 2021 Canonical Ltd.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+from typing import NoReturn
+
+from n2vc.utils import get_ee_id_components
+
+
+class RelationEndpoint:
+ """Represents an endpoint of an application"""
+
+ def __init__(self, ee_id: str, vca_id: str, endpoint_name: str) -> NoReturn:
+ """
+ Args:
+ ee_id: Execution environment id.
+ Format: "<model>.<application_name>.<machine_id>".
+ vca_id: Id of the VCA. Identifies the Juju Controller
+ where the application is deployed
+ endpoint_name: Name of the endpoint for the relation
+ """
+ ee_components = get_ee_id_components(ee_id)
+ self._model_name = ee_components[0]
+ self._application_name = ee_components[1]
+ self._vca_id = vca_id
+ self._endpoint_name = endpoint_name
+
+ @property
+ def application_name(self) -> str:
+ """Returns the application name"""
+ return self._application_name
+
+ @property
+ def endpoint(self) -> str:
+ """Returns the application name and the endpoint. Format: <application>:<endpoint>"""
+ return f"{self.application_name}:{self._endpoint_name}"
+
+ @property
+ def endpoint_name(self) -> str:
+ """Returns the endpoint name"""
+ return self._endpoint_name
+
+ @property
+ def model_name(self) -> str:
+ """Returns the model name"""
+ return self._model_name
+
+ @property
+ def vca_id(self) -> str:
+ """Returns the vca id"""
+ return self._vca_id
+
+ def __str__(self) -> str:
+ app = self.application_name
+ endpoint = self.endpoint_name
+ model = self.model_name
+ vca = self.vca_id
+ return f"{app}:{endpoint} (model: {model}, vca: {vca})"
+
+
+class Offer:
+ """Represents a juju offer"""
+
+ def __init__(self, url: str, vca_id: str = None) -> NoReturn:
+ """
+ Args:
+ url: Offer url. Format: <user>/<model>.<offer-name>.
+ """
+ self._url = url
+ self._username = url.split(".")[0].split("/")[0]
+ self._model_name = url.split(".")[0].split("/")[1]
+ self._name = url.split(".")[1]
+ self._vca_id = vca_id
+
+ @property
+ def model_name(self) -> str:
+ """Returns the model name"""
+ return self._model_name
+
+ @property
+ def name(self) -> str:
+ """Returns the offer name"""
+ return self._name
+
+ @property
+ def username(self) -> str:
+ """Returns the username"""
+ return self._username
+
+ @property
+ def url(self) -> str:
+ """Returns the offer url"""
+ return self._url
+
+ @property
+ def vca_id(self) -> str:
+ """Returns the vca id"""
+ return self._vca_id
import asyncio
import time
+
from juju.client import client
from n2vc.exceptions import EntityInvalidException
from n2vc.n2vc_conn import N2VCConnector
:returns: boolean saying if the entity is ready or not
"""
+
entity_type = entity.entity_type
if entity_type == "machine":
return entity.agent_status in ["started"]
elif entity_type == "application":
# Workaround for bug: https://github.com/juju/python-libjuju/issues/441
return entity.status in ["active", "blocked"]
+ elif entity_type == "unit":
+ return entity.agent_status in ["idle"]
else:
raise EntityInvalidException("Unknown entity type: {}".format(entity_type))
total_timeout = 3600.0
entity_type = entity.entity_type
- if entity_type not in ["application", "action", "machine"]:
+ if entity_type not in ["application", "action", "machine", "unit"]:
raise EntityInvalidException("Unknown entity type: {}".format(entity_type))
# Coroutine to wait until the entity reaches the final state
for task in tasks:
task.cancel()
+ @staticmethod
+ async def wait_for_units_idle(
+ model: Model, application: Application, timeout: float = 60
+ ):
+ """
+ Waits for the application and all its units to transition back to idle
+
+ :param: model: Model to observe
+ :param: application: The application to be observed
+ :param: timeout: Maximum time between two updates in the model
+
+ :raises: asyncio.TimeoutError when timeout reaches
+ """
+
+ ensure_units_idle = asyncio.ensure_future(
+ asyncio.wait_for(
+ JujuModelWatcher.ensure_units_idle(model, application), timeout
+ )
+ )
+ tasks = [
+ ensure_units_idle,
+ ]
+ (done, pending) = await asyncio.wait(
+ tasks, timeout=timeout, return_when=asyncio.FIRST_COMPLETED
+ )
+
+ if ensure_units_idle in pending:
+ ensure_units_idle.cancel()
+ raise TimeoutError(
+ "Application's units failed to return to idle after {} seconds".format(
+ timeout
+ )
+ )
+ if ensure_units_idle.result():
+ pass
+
+ @staticmethod
+ async def ensure_units_idle(model: Model, application: Application):
+ """
+ Waits forever until the application's units to transition back to idle
+
+ :param: model: Model to observe
+ :param: application: The application to be observed
+ """
+
+ try:
+ allwatcher = client.AllWatcherFacade.from_connection(model.connection())
+ unit_wanted_state = "executing"
+ final_state_reached = False
+
+ units = application.units
+ final_state_seen = {unit.entity_id: False for unit in units}
+ agent_state_seen = {unit.entity_id: False for unit in units}
+ workload_state = {unit.entity_id: False for unit in units}
+
+ try:
+ while not final_state_reached:
+ change = await allwatcher.Next()
+
+ # Keep checking to see if new units were added during the change
+ for unit in units:
+ if unit.entity_id not in final_state_seen:
+ final_state_seen[unit.entity_id] = False
+ agent_state_seen[unit.entity_id] = False
+ workload_state[unit.entity_id] = False
+
+ for delta in change.deltas:
+ await asyncio.sleep(0)
+ if delta.entity != units[0].entity_type:
+ continue
+
+ final_state_reached = True
+ for unit in units:
+ if delta.data["name"] == unit.entity_id:
+ status = delta.data["agent-status"]["current"]
+ workload_state[unit.entity_id] = delta.data[
+ "workload-status"
+ ]["current"]
+
+ if status == unit_wanted_state:
+ agent_state_seen[unit.entity_id] = True
+ final_state_seen[unit.entity_id] = False
+
+ if (
+ status == "idle"
+ and agent_state_seen[unit.entity_id]
+ ):
+ final_state_seen[unit.entity_id] = True
+
+ final_state_reached = (
+ final_state_reached
+ and final_state_seen[unit.entity_id]
+ and workload_state[unit.entity_id]
+ in [
+ "active",
+ "error",
+ ]
+ )
+
+ except ConnectionClosed:
+ pass
+ # This is expected to happen when the
+ # entity reaches its final state, because
+ # the model connection is closed afterwards
+ except Exception as e:
+ raise e
+
@staticmethod
async def model_watcher(
model: Model,
:raises: asyncio.TimeoutError when timeout reaches
"""
- allwatcher = client.AllWatcherFacade.from_connection(model.connection())
+ try:
+ allwatcher = client.AllWatcherFacade.from_connection(model.connection())
- # Genenerate array with entity types to listen
- entity_types = (
- [entity_type, "unit"]
- if entity_type == "application" # TODO: Add "action" too
- else [entity_type]
- )
+ # Genenerate array with entity types to listen
+ entity_types = (
+ [entity_type, "unit"]
+ if entity_type == "application" # TODO: Add "action" too
+ else [entity_type]
+ )
- # Get time when it should timeout
- timeout_end = time.time() + timeout
+ # Get time when it should timeout
+ timeout_end = time.time() + timeout
- try:
- while True:
- change = await allwatcher.Next()
- for delta in change.deltas:
- write = False
- delta_entity = None
-
- # Get delta EntityType
- delta_entity = delta.entity
-
- if delta_entity in entity_types:
- # Get entity id
- if entity_type == "application":
- id = (
- delta.data["application"]
- if delta_entity == "unit"
- else delta.data["name"]
- )
- else:
- id = delta.data["id"]
-
- # Write if the entity id match
- write = True if id == entity_id else False
-
- # Update timeout
- timeout_end = time.time() + timeout
- (
- status,
- status_message,
- vca_status,
- ) = JujuModelWatcher.get_status(delta)
-
- if write and n2vc is not None and db_dict:
- # Write status to DB
- status = n2vc.osm_status(delta_entity, status)
- await n2vc.write_app_status_to_db(
- db_dict=db_dict,
- status=status,
- detailed_status=status_message,
- vca_status=vca_status,
- entity_type=delta_entity,
- vca_id=vca_id,
- )
- # Check if timeout
- if time.time() > timeout_end:
- raise asyncio.TimeoutError()
- except ConnectionClosed:
- pass
- # This is expected to happen when the
- # entity reaches its final state, because
- # the model connection is closed afterwards
+ try:
+ while True:
+ change = await allwatcher.Next()
+ for delta in change.deltas:
+ write = False
+ delta_entity = None
+
+ # Get delta EntityType
+ delta_entity = delta.entity
+
+ if delta_entity in entity_types:
+ # Get entity id
+ id = None
+ if entity_type == "application":
+ id = (
+ delta.data["application"]
+ if delta_entity == "unit"
+ else delta.data["name"]
+ )
+ else:
+ if "id" in delta.data:
+ id = delta.data["id"]
+ else:
+ print("No id {}".format(delta.data))
+
+ # Write if the entity id match
+ write = True if id == entity_id else False
+
+ # Update timeout
+ timeout_end = time.time() + timeout
+ (
+ status,
+ status_message,
+ vca_status,
+ ) = JujuModelWatcher.get_status(delta)
+
+ if write and n2vc is not None and db_dict:
+ # Write status to DB
+ status = n2vc.osm_status(delta_entity, status)
+ await n2vc.write_app_status_to_db(
+ db_dict=db_dict,
+ status=status,
+ detailed_status=status_message,
+ vca_status=vca_status,
+ entity_type=delta_entity,
+ vca_id=vca_id,
+ )
+ # Check if timeout
+ if time.time() > timeout_end:
+ raise asyncio.TimeoutError()
+ except ConnectionClosed:
+ pass
+ # This is expected to happen when the
+ # entity reaches its final state, because
+ # the model connection is closed afterwards
+ except Exception as e:
+ raise e
@staticmethod
def get_status(delta: Delta) -> (str, str, str):
import abc
import asyncio
+from typing import Union
import time
from n2vc.loggable import Loggable
@abc.abstractmethod
async def repo_add(
- self, cluster_uuid: str, name: str, url: str, repo_type: str = "chart"
+ self,
+ cluster_uuid: str,
+ name: str,
+ url: str,
+ repo_type: str = "chart",
+ cert: str = None,
+ user: str = None,
+ password: str = None,
):
"""
Add a new repository to OSM database
timeout: float = 300,
params: dict = None,
db_dict: dict = None,
+ force: bool = False,
):
"""
Upgrades an existing KDU instance. It would implicitly use the `upgrade` call
path: <str>},
e.g. {collection: "nsrs", filter:
{_id: <nsd-id>, path: "_admin.deployed.K8S.3"}
+ :param force: force recreation of resources if necessary
:return: reference to the new revision number of the KDU instance
"""
scale: int,
resource_name: str,
total_timeout: float = 1800,
+ cluster_uuid: str = None,
+ kdu_model: str = None,
+ atomic: bool = True,
+ db_dict: dict = None,
**kwargs,
) -> bool:
- """
- Scales an application in KDU instance.
-
- :param: kdu_instance str: KDU instance name
- :param: scale int: Scale to which to set this application
- :param: resource_name str: Resource name (Application name)
- :param: timeout float: The time, in seconds, to wait for the install
- to finish
- :param kwargs: Additional parameters
-
- :return: If successful, returns True
+ """Scale a resource in a KDU instance.
+
+ Args:
+ kdu_instance: KDU instance name
+ scale: Scale to which to set the resource
+ resource_name: Resource name
+ total_timeout: The time, in seconds, to wait for the install
+ to finish
+ cluster_uuid: The UUID of the cluster
+ kdu_model: The chart/bundle reference
+ atomic: if set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ db_dict: Dictionary for any additional data
+ kwargs: Additional parameters
+ vca_id (str): VCA ID
+
+ Returns:
+ True if successful, False otherwise
"""
@abc.abstractmethod
self,
resource_name: str,
kdu_instance: str,
+ cluster_uuid: str,
+ kdu_model: str,
+ timeout: float = 300,
**kwargs,
) -> int:
- """
- Get an application scale count.
+ """Get a resource scale count in a KDU instance.
- :param: resource_name str: Resource name (Application name)
- :param: kdu_instance str: KDU instance name
- :param kwargs: Additional parameters
+ Args:
+ resource_name: Resource name
+ kdu_instance: KDU instance name
+ cluster_uuid: The UUID of the cluster
+ kdu_model: chart/bundle reference
+ timeout: The time, in seconds, to wait
+ kwargs: Additional parameters
- :return: Return application instance count
+ Returns:
+ Resource instance count
"""
@abc.abstractmethod
:return: Returns the output of the action
"""
+ @abc.abstractmethod
+ async def upgrade_charm(
+ self,
+ ee_id: str = None,
+ path: str = None,
+ charm_id: str = None,
+ charm_type: str = None,
+ timeout: float = None,
+ ) -> str:
+ """This method upgrade charms in VNFs
+
+ Args:
+ ee_id: Execution environment id
+ path: Local path to the charm
+ charm_id: charm-id
+ charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm
+ timeout: (Float) Timeout for the ns update operation
+
+ Returns:
+ The output of the update operation if status equals to "completed"
+ """
+
@abc.abstractmethod
async def inspect_kdu(self, kdu_model: str, repo_url: str = None) -> str:
"""
"""
@abc.abstractmethod
- async def status_kdu(self, cluster_uuid: str, kdu_instance: str) -> str:
+ async def status_kdu(
+ self, cluster_uuid: str, kdu_instance: str, yaml_format: str
+ ) -> Union[str, dict]:
"""
This call would retrieve tha current state of a given KDU instance. It would be
would allow to retrieve the _composition_ (i.e. K8s objects) and _specific
:param cluster_uuid: UUID of a K8s cluster known by OSM
:param kdu_instance: unique name for the KDU instance
+ :param yaml_format: if the return shall be returned as an YAML string or as a
+ dictionary
:return: If successful, it will return the following vector of arguments:
- K8s `namespace` in the cluster where the KDU lives
- `state` of the KDU instance. It can be:
async def write_app_status_to_db(
self, db_dict: dict, status: str, detailed_status: str, operation: str
) -> bool:
+ """
+ This method will write the status of the application to the database.
+
+ :param db_dict: A dictionary with the database necessary information. It shall contain the values for the keys:
+ - "collection": The Mongo DB collection to write to
+ - "filter": The query filter to use in the update process
+ - "path": The dot separated keys which targets the object to be updated
+ :param status: Status of the application
+ :param detailed_status: Detailed status of the application
+ :param operation: Operation that is being performed on the application
+ :return: True if successful
+ """
if not self.db:
self.warning("No db => No database write")
self.log.debug("status={}".format(status))
try:
-
the_table = db_dict["collection"]
the_filter = db_dict["filter"]
the_path = db_dict["path"]
# For those usages not covered by the Apache License, Version 2.0 please
# contact with: nfvlabs@tid.es
##
+from typing import Union
+from shlex import quote
import os
import yaml
"""Install a helm chart
:param cluster_uuid str: The UUID of the cluster to install to
- :param kdu_model str: The name or path of a bundle to install
+ :param kdu_model str: chart/reference (string), which can be either
+ of these options:
+ - a name of chart available via the repos known by OSM
+ (e.g. stable/openldap, stable/openldap:1.2.4)
+ - a path to a packaged chart (e.g. mychart.tgz)
+ - a path to an unpacked chart directory or a URL (e.g. mychart)
:param kdu_instance: Kdu instance name
:param atomic bool: If set, waits until the model is active and resets
the cluster on failure.
:return: True if successful
"""
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("installing {} in cluster {}".format(kdu_model, cluster_id))
+
+ self.log.debug("installing {} in cluster {}".format(kdu_model, cluster_uuid))
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# init env, paths
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
# for helm3 if namespace does not exist must create it
if namespace and namespace != "kube-system":
- if not await self._namespace_exists(cluster_id, namespace):
+ if not await self._namespace_exists(cluster_uuid, namespace):
try:
- await self._create_namespace(cluster_id, namespace)
+ # TODO: refactor to use kubernetes API client
+ await self._create_namespace(cluster_uuid, namespace)
except Exception as e:
- if not await self._namespace_exists(cluster_id, namespace):
+ if not await self._namespace_exists(cluster_uuid, namespace):
err_msg = (
"namespace {} does not exist in cluster_id {} "
"error message: ".format(namespace, e)
raise K8sException(err_msg)
await self._install_impl(
- cluster_id,
+ cluster_uuid,
kdu_model,
paths,
env,
)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
self.log.debug("Returning kdu_instance {}".format(kdu_instance))
return True
async def inspect_kdu(self, kdu_model: str, repo_url: str = None) -> str:
-
self.log.debug(
"inspect kdu_model {} from (optional) repo: {}".format(kdu_model, repo_url)
)
- return await self._exec_inspect_comand(
+ return await self._exec_inspect_command(
inspect_command="all", kdu_model=kdu_model, repo_url=repo_url
)
return namespace in namespaces if namespaces else False
async def _get_namespaces(self, cluster_id: str):
-
self.log.debug("get namespaces cluster_id {}".format(cluster_id))
# init config, env
)
command = "{} --kubeconfig={} get namespaces -o=yaml".format(
- self.kubectl_command, paths["kube_config"]
+ self.kubectl_command, quote(paths["kube_config"])
)
output, _rc = await self._local_async_exec(
command=command, raise_exception_on_error=True, env=env
return namespaces
async def _create_namespace(self, cluster_id: str, namespace: str):
-
self.log.debug(f"create namespace: {cluster_id} for cluster_id: {namespace}")
# init config, env
)
command = "{} --kubeconfig={} create namespace {}".format(
- self.kubectl_command, paths["kube_config"], namespace
+ self.kubectl_command, quote(paths["kube_config"]), quote(namespace)
)
_, _rc = await self._local_async_exec(
command=command, raise_exception_on_error=True, env=env
return _rc
- async def _get_services(self, cluster_id: str, kdu_instance: str, namespace: str):
-
+ async def _get_services(
+ self, cluster_id: str, kdu_instance: str, namespace: str, kubeconfig: str
+ ):
# init config, env
paths, env = self._init_paths_env(
cluster_name=cluster_id, create_if_not_exist=True
)
- command1 = "{} get manifest {} --namespace={}".format(
- self._helm_command, kdu_instance, namespace
+ command1 = "env KUBECONFIG={} {} get manifest {} --namespace={}".format(
+ kubeconfig, self._helm_command, quote(kdu_instance), quote(namespace)
+ )
+ command2 = "{} get --namespace={} -f -".format(
+ self.kubectl_command, quote(namespace)
)
- command2 = "{} get --namespace={} -f -".format(self.kubectl_command, namespace)
output, _rc = await self._local_async_exec_pipe(
command1, command2, env=env, raise_exception_on_error=True
)
if namespace != "kube-system":
namespaces = await self._get_namespaces(cluster_id)
if namespace not in namespaces:
+ # TODO: refactor to use kubernetes API client
await self._create_namespace(cluster_id, namespace)
- # If default repo is not included add
- cluster_uuid = "{}:{}".format(namespace, cluster_id)
- repo_list = await self.repo_list(cluster_uuid)
+ repo_list = await self.repo_list(cluster_id)
stable_repo = [repo for repo in repo_list if repo["name"] == "stable"]
if not stable_repo and self._stable_repo_url:
- await self.repo_add(cluster_uuid, "stable", self._stable_repo_url)
+ await self.repo_add(cluster_id, "stable", self._stable_repo_url)
# Returns False as no software needs to be uninstalled
return False
pass
async def _instances_list(self, cluster_id: str):
-
# init paths, env
paths, env = self._init_paths_env(
cluster_name=cluster_id, create_if_not_exist=True
return []
def _get_inspect_command(
- self, inspect_command: str, kdu_model: str, repo_str: str, version: str
+ self, show_command: str, kdu_model: str, repo_str: str, version: str
):
+ """Generates the command to obtain the information about an Helm Chart package
+ (´helm show ...´ command)
+
+ Args:
+ show_command: the second part of the command (`helm show <show_command>`)
+ kdu_model: The name or path of a Helm Chart
+ repo_str: Helm Chart repository url
+ version: constraint with specific version of the Chart to use
+
+ Returns:
+ str: the generated Helm Chart command
+ """
+
inspect_command = "{} show {} {}{} {}".format(
- self._helm_command, inspect_command, kdu_model, repo_str, version
+ self._helm_command, show_command, quote(kdu_model), repo_str, version
)
return inspect_command
+ def _get_get_command(
+ self, get_command: str, kdu_instance: str, namespace: str, kubeconfig: str
+ ):
+ get_command = (
+ "env KUBECONFIG={} {} get {} {} --namespace={} --output yaml".format(
+ kubeconfig,
+ self._helm_command,
+ get_command,
+ quote(kdu_instance),
+ quote(namespace),
+ )
+ )
+ return get_command
+
async def _status_kdu(
self,
cluster_id: str,
kdu_instance: str,
namespace: str = None,
+ yaml_format: bool = False,
show_error_log: bool = False,
- return_text: bool = False,
- ):
-
+ ) -> Union[str, dict]:
self.log.debug(
"status of kdu_instance: {}, namespace: {} ".format(kdu_instance, namespace)
)
paths, env = self._init_paths_env(
cluster_name=cluster_id, create_if_not_exist=True
)
- command = "{} status {} --namespace={} --output yaml".format(
- self._helm_command, kdu_instance, namespace
+ command = "env KUBECONFIG={} {} status {} --namespace={} --output yaml".format(
+ paths["kube_config"],
+ self._helm_command,
+ quote(kdu_instance),
+ quote(namespace),
)
output, rc = await self._local_async_exec(
env=env,
)
- if return_text:
+ if yaml_format:
return str(output)
if rc != 0:
# remove field 'notes' and manifest
try:
del data.get("info")["notes"]
- del data["manifest"]
except KeyError:
pass
- # unable to parse 'resources' as currently it is not included in helm3
+ # parse the manifest to a list of dictionaries
+ if "manifest" in data:
+ manifest_str = data.get("manifest")
+ manifest_docs = yaml.load_all(manifest_str, Loader=yaml.SafeLoader)
+
+ data["manifest"] = []
+ for doc in manifest_docs:
+ data["manifest"].append(doc)
+
return data
def _get_install_command(
version: str,
atomic: bool,
timeout: float,
+ kubeconfig: str,
) -> str:
-
timeout_str = ""
if timeout:
timeout_str = "--timeout {}s".format(timeout)
# namespace
namespace_str = ""
if namespace:
- namespace_str = "--namespace {}".format(namespace)
+ namespace_str = "--namespace {}".format(quote(namespace))
# version
version_str = ""
version_str = "--version {}".format(version)
command = (
- "{helm} install {name} {atomic} --output yaml "
+ "env KUBECONFIG={kubeconfig} {helm} install {name} {atomic} --output yaml "
"{params} {timeout} {ns} {model} {ver}".format(
+ kubeconfig=kubeconfig,
helm=self._helm_command,
- name=kdu_instance,
+ name=quote(kdu_instance),
atomic=atomic_str,
params=params_str,
timeout=timeout_str,
ns=namespace_str,
- model=kdu_model,
+ model=quote(kdu_model),
ver=version_str,
)
)
return command
+ def _get_upgrade_scale_command(
+ self,
+ kdu_model: str,
+ kdu_instance: str,
+ namespace: str,
+ scale: int,
+ version: str,
+ atomic: bool,
+ replica_str: str,
+ timeout: float,
+ resource_name: str,
+ kubeconfig: str,
+ ) -> str:
+ """Generates the command to scale a Helm Chart release
+
+ Args:
+ kdu_model (str): Kdu model name, corresponding to the Helm local location or repository
+ kdu_instance (str): KDU instance, corresponding to the Helm Chart release in question
+ namespace (str): Namespace where this KDU instance is deployed
+ scale (int): Scale count
+ version (str): Constraint with specific version of the Chart to use
+ atomic (bool): If set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ replica_str (str): The key under resource_name key where the scale count is stored
+ timeout (float): The time, in seconds, to wait
+ resource_name (str): The KDU's resource to scale
+ kubeconfig (str): Kubeconfig file path
+
+ Returns:
+ str: command to scale a Helm Chart release
+ """
+
+ # scale
+ if resource_name:
+ scale_dict = {"{}.{}".format(resource_name, replica_str): scale}
+ else:
+ scale_dict = {replica_str: scale}
+
+ scale_str = self._params_to_set_option(scale_dict)
+
+ return self._get_upgrade_command(
+ kdu_model=kdu_model,
+ kdu_instance=kdu_instance,
+ namespace=namespace,
+ params_str=scale_str,
+ version=version,
+ atomic=atomic,
+ timeout=timeout,
+ kubeconfig=kubeconfig,
+ )
+
def _get_upgrade_command(
self,
kdu_model: str,
version: str,
atomic: bool,
timeout: float,
+ kubeconfig: str,
+ force: bool = False,
) -> str:
+ """Generates the command to upgrade a Helm Chart release
+
+ Args:
+ kdu_model (str): Kdu model name, corresponding to the Helm local location or repository
+ kdu_instance (str): KDU instance, corresponding to the Helm Chart release in question
+ namespace (str): Namespace where this KDU instance is deployed
+ params_str (str): Params used to upgrade the Helm Chart release
+ version (str): Constraint with specific version of the Chart to use
+ atomic (bool): If set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ timeout (float): The time, in seconds, to wait
+ kubeconfig (str): Kubeconfig file path
+ force (bool): If set, helm forces resource updates through a replacement strategy. This may recreate pods.
+ Returns:
+ str: command to upgrade a Helm Chart release
+ """
timeout_str = ""
if timeout:
if atomic:
atomic_str = "--atomic"
+ # force
+ force_str = ""
+ if force:
+ force_str = "--force "
+
# version
version_str = ""
if version:
- version_str = "--version {}".format(version)
+ version_str = "--version {}".format(quote(version))
# namespace
namespace_str = ""
if namespace:
- namespace_str = "--namespace {}".format(namespace)
+ namespace_str = "--namespace {}".format(quote(namespace))
command = (
- "{helm} upgrade {name} {model} {namespace} {atomic} --output yaml {params} "
- "{timeout} {ver}".format(
- helm=self._helm_command,
- name=kdu_instance,
- namespace=namespace_str,
- atomic=atomic_str,
- params=params_str,
- timeout=timeout_str,
- model=kdu_model,
- ver=version_str,
- )
+ "env KUBECONFIG={kubeconfig} {helm} upgrade {name} {model} {namespace} {atomic} {force}"
+ "--output yaml {params} {timeout} --reuse-values {ver}"
+ ).format(
+ kubeconfig=kubeconfig,
+ helm=self._helm_command,
+ name=quote(kdu_instance),
+ namespace=namespace_str,
+ atomic=atomic_str,
+ force=force_str,
+ params=params_str,
+ timeout=timeout_str,
+ model=quote(kdu_model),
+ ver=version_str,
)
return command
def _get_rollback_command(
- self, kdu_instance: str, namespace: str, revision: float
+ self, kdu_instance: str, namespace: str, revision: float, kubeconfig: str
) -> str:
- return "{} rollback {} {} --namespace={} --wait".format(
- self._helm_command, kdu_instance, revision, namespace
+ return "env KUBECONFIG={} {} rollback {} {} --namespace={} --wait".format(
+ kubeconfig,
+ self._helm_command,
+ quote(kdu_instance),
+ revision,
+ quote(namespace),
)
- def _get_uninstall_command(self, kdu_instance: str, namespace: str) -> str:
-
- return "{} uninstall {} --namespace={}".format(
- self._helm_command, kdu_instance, namespace
+ def _get_uninstall_command(
+ self, kdu_instance: str, namespace: str, kubeconfig: str
+ ) -> str:
+ return "env KUBECONFIG={} {} uninstall {} --namespace={}".format(
+ kubeconfig, self._helm_command, quote(kdu_instance), quote(namespace)
)
def _get_helm_chart_repos_ids(self, cluster_uuid) -> list:
##
import abc
import asyncio
+from typing import Union
+from shlex import quote
import random
import time
import shlex
import os
import yaml
from uuid import uuid4
+from urllib.parse import urlparse
from n2vc.config import EnvironConfig
from n2vc.exceptions import K8sException
from n2vc.k8s_conn import K8sConnector
+from n2vc.kubectl import Kubectl
class K8sHelmBaseConnector(K8sConnector):
if self._stable_repo_url == "None":
self._stable_repo_url = None
- @staticmethod
- def _get_namespace_cluster_id(cluster_uuid: str) -> (str, str):
+ # Lock to avoid concurrent execution of helm commands
+ self.cmd_lock = asyncio.Lock()
+
+ def _get_namespace(self, cluster_uuid: str) -> str:
"""
- Parses cluster_uuid stored at database that can be either 'namespace:cluster_id' or only
- cluster_id for backward compatibility
+ Obtains the namespace used by the cluster with the uuid passed by argument
+
+ param: cluster_uuid: cluster's uuid
"""
- namespace, _, cluster_id = cluster_uuid.rpartition(":")
- return namespace, cluster_id
+
+ # first, obtain the cluster corresponding to the uuid passed by argument
+ k8scluster = self.db.get_one(
+ "k8sclusters", q_filter={"_id": cluster_uuid}, fail_on_empty=False
+ )
+ return k8scluster.get("namespace")
async def init_env(
self,
namespace: str = "kube-system",
reuse_cluster_uuid=None,
**kwargs,
- ) -> (str, bool):
+ ) -> tuple[str, bool]:
"""
It prepares a given K8s cluster environment to run Charts
"""
if reuse_cluster_uuid:
- namespace_, cluster_id = self._get_namespace_cluster_id(reuse_cluster_uuid)
- namespace = namespace_ or namespace
+ cluster_id = reuse_cluster_uuid
else:
cluster_id = str(uuid4())
- cluster_uuid = "{}:{}".format(namespace, cluster_id)
self.log.debug(
"Initializing K8S Cluster {}. namespace: {}".format(cluster_id, namespace)
self.log.info("Cluster {} initialized".format(cluster_id))
- return cluster_uuid, n2vc_installed_sw
+ return cluster_id, n2vc_installed_sw
async def repo_add(
- self, cluster_uuid: str, name: str, url: str, repo_type: str = "chart"
+ self,
+ cluster_uuid: str,
+ name: str,
+ url: str,
+ repo_type: str = "chart",
+ cert: str = None,
+ user: str = None,
+ password: str = None,
+ oci: bool = False,
):
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
self.log.debug(
"Cluster {}, adding {} repository {}. URL: {}".format(
- cluster_id, repo_type, name, url
+ cluster_uuid, repo_type, name, url
)
)
+ # init_env
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
+
+ if oci:
+ if user and password:
+ host_port = urlparse(url).netloc if url.startswith("oci://") else url
+ # helm registry login url
+ command = "env KUBECONFIG={} {} registry login {}".format(
+ paths["kube_config"], self._helm_command, quote(host_port)
+ )
+ else:
+ self.log.debug(
+ "OCI registry login is not needed for repo: {}".format(name)
+ )
+ return
+ else:
+ # helm repo add name url
+ command = "env KUBECONFIG={} {} repo add {} {}".format(
+ paths["kube_config"], self._helm_command, quote(name), quote(url)
+ )
+
+ if cert:
+ temp_cert_file = os.path.join(
+ self.fs.path, "{}/helmcerts/".format(cluster_uuid), "temp.crt"
+ )
+ os.makedirs(os.path.dirname(temp_cert_file), exist_ok=True)
+ with open(temp_cert_file, "w") as the_cert:
+ the_cert.write(cert)
+ command += " --ca-file {}".format(quote(temp_cert_file))
+
+ if user:
+ command += " --username={}".format(quote(user))
+
+ if password:
+ command += " --password={}".format(quote(password))
+
+ self.log.debug("adding repo: {}".format(command))
+ await self._local_async_exec(
+ command=command, raise_exception_on_error=True, env=env
+ )
+
+ if not oci:
+ # helm repo update
+ command = "env KUBECONFIG={} {} repo update {}".format(
+ paths["kube_config"], self._helm_command, quote(name)
+ )
+ self.log.debug("updating repo: {}".format(command))
+ await self._local_async_exec(
+ command=command, raise_exception_on_error=False, env=env
+ )
+
+ # sync fs
+ self.fs.reverse_sync(from_path=cluster_uuid)
+
+ async def repo_update(self, cluster_uuid: str, name: str, repo_type: str = "chart"):
+ self.log.debug(
+ "Cluster {}, updating {} repository {}".format(
+ cluster_uuid, repo_type, name
+ )
+ )
# init_env
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
# helm repo update
- command = "{} repo update".format(self._helm_command)
+ command = "{} repo update {}".format(self._helm_command, quote(name))
self.log.debug("updating repo: {}".format(command))
await self._local_async_exec(
command=command, raise_exception_on_error=False, env=env
)
- # helm repo add name url
- command = "{} repo add {} {}".format(self._helm_command, name, url)
- self.log.debug("adding repo: {}".format(command))
- await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
-
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
async def repo_list(self, cluster_uuid: str) -> list:
"""
:return: list of registered repositories: [ (name, url) .... ]
"""
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("list repositories for cluster {}".format(cluster_id))
-
- # sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.log.debug("list repositories for cluster {}".format(cluster_uuid))
# config filename
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
- command = "{} repo list --output yaml".format(self._helm_command)
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
+ command = "env KUBECONFIG={} {} repo list --output yaml".format(
+ paths["kube_config"], self._helm_command
+ )
# Set exception to false because if there are no repos just want an empty list
output, _rc = await self._local_async_exec(
)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
if _rc == 0:
if output and len(output) > 0:
return []
async def repo_remove(self, cluster_uuid: str, name: str):
-
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("remove {} repositories for cluster {}".format(name, cluster_id))
-
- # sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.log.debug(
+ "remove {} repositories for cluster {}".format(name, cluster_uuid)
+ )
# init env, paths
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
- command = "{} repo remove {}".format(self._helm_command, name)
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
+ command = "env KUBECONFIG={} {} repo remove {}".format(
+ paths["kube_config"], self._helm_command, quote(name)
+ )
await self._local_async_exec(
command=command, raise_exception_on_error=True, env=env
)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
async def reset(
self,
:param kwargs: Additional parameters (None yet)
:return: Returns True if successful or raises an exception.
"""
- namespace, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
+ namespace = self._get_namespace(cluster_uuid=cluster_uuid)
self.log.debug(
"Resetting K8s environment. cluster uuid: {} uninstall={}".format(
- cluster_id, uninstall_sw
+ cluster_uuid, uninstall_sw
)
)
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# uninstall releases if needed.
if uninstall_sw:
else:
msg = (
"Cluster uuid: {} has releases and not force. Leaving K8s helm environment"
- ).format(cluster_id)
+ ).format(cluster_uuid)
self.log.warn(msg)
uninstall_sw = (
False # Allow to remove k8s cluster without removing Tiller
)
if uninstall_sw:
- await self._uninstall_sw(cluster_id, namespace)
+ await self._uninstall_sw(cluster_id=cluster_uuid, namespace=namespace)
# delete cluster directory
- self.log.debug("Removing directory {}".format(cluster_id))
- self.fs.file_delete(cluster_id, ignore_non_exist=True)
+ self.log.debug("Removing directory {}".format(cluster_uuid))
+ self.fs.file_delete(cluster_uuid, ignore_non_exist=True)
# Remove also local directorio if still exist
- direct = self.fs.path + "/" + cluster_id
+ direct = self.fs.path + "/" + cluster_uuid
shutil.rmtree(direct, ignore_errors=True)
return True
+ def _is_helm_chart_a_file(self, chart_name: str):
+ return chart_name.count("/") > 1
+
+ @staticmethod
+ def _is_helm_chart_a_url(chart_name: str):
+ result = urlparse(chart_name)
+ return all([result.scheme, result.netloc])
+
async def _install_impl(
self,
cluster_id: str,
kdu_name: str = None,
namespace: str = None,
):
+ # init env, paths
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_id, create_if_not_exist=True
+ )
+
# params to str
params_str, file_to_delete = self._params_to_file_option(
cluster_id=cluster_id, params=params
)
- # version
- version = None
- if ":" in kdu_model:
- parts = kdu_model.split(sep=":")
- if len(parts) == 2:
- version = str(parts[1])
- kdu_model = parts[0]
+ kdu_model, version = await self._prepare_helm_chart(kdu_model, cluster_id)
command = self._get_install_command(
- kdu_model, kdu_instance, namespace, params_str, version, atomic, timeout
+ kdu_model,
+ kdu_instance,
+ namespace,
+ params_str,
+ version,
+ atomic,
+ timeout,
+ paths["kube_config"],
)
self.log.debug("installing: {}".format(command))
namespace=namespace,
db_dict=db_dict,
operation="install",
- run_once=False,
)
)
output, rc = exec_task.result()
else:
-
output, rc = await self._local_async_exec(
command=command, raise_exception_on_error=False, env=env
)
namespace=namespace,
db_dict=db_dict,
operation="install",
- run_once=True,
- check_every=0,
)
if rc != 0:
timeout: float = 300,
params: dict = None,
db_dict: dict = None,
+ namespace: str = None,
+ force: bool = False,
):
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("upgrading {} in cluster {}".format(kdu_model, cluster_id))
+ self.log.debug("upgrading {} in cluster {}".format(kdu_model, cluster_uuid))
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# look for instance to obtain namespace
- instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
- if not instance_info:
- raise K8sException("kdu_instance {} not found".format(kdu_instance))
+
+ # set namespace
+ if not namespace:
+ instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
+ if not instance_info:
+ raise K8sException("kdu_instance {} not found".format(kdu_instance))
+ namespace = instance_info["namespace"]
# init env, paths
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
# params to str
params_str, file_to_delete = self._params_to_file_option(
- cluster_id=cluster_id, params=params
+ cluster_id=cluster_uuid, params=params
)
- # version
- version = None
- if ":" in kdu_model:
- parts = kdu_model.split(sep=":")
- if len(parts) == 2:
- version = str(parts[1])
- kdu_model = parts[0]
+ kdu_model, version = await self._prepare_helm_chart(kdu_model, cluster_uuid)
command = self._get_upgrade_command(
kdu_model,
kdu_instance,
- instance_info["namespace"],
+ namespace,
params_str,
version,
atomic,
timeout,
+ paths["kube_config"],
+ force,
)
self.log.debug("upgrading: {}".format(command))
if atomic:
-
# exec helm in a task
exec_task = asyncio.ensure_future(
coro_or_future=self._local_async_exec(
# write status in another task
status_task = asyncio.ensure_future(
coro_or_future=self._store_status(
- cluster_id=cluster_id,
+ cluster_id=cluster_uuid,
kdu_instance=kdu_instance,
- namespace=instance_info["namespace"],
+ namespace=namespace,
db_dict=db_dict,
operation="upgrade",
- run_once=False,
)
)
output, rc = exec_task.result()
else:
-
output, rc = await self._local_async_exec(
command=command, raise_exception_on_error=False, env=env
)
# write final status
await self._store_status(
- cluster_id=cluster_id,
+ cluster_id=cluster_uuid,
kdu_instance=kdu_instance,
- namespace=instance_info["namespace"],
+ namespace=namespace,
db_dict=db_dict,
operation="upgrade",
- run_once=True,
- check_every=0,
)
if rc != 0:
raise K8sException(msg)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
# return new revision number
instance = await self.get_instance_info(
scale: int,
resource_name: str,
total_timeout: float = 1800,
+ cluster_uuid: str = None,
+ kdu_model: str = None,
+ atomic: bool = True,
+ db_dict: dict = None,
**kwargs,
):
- raise NotImplementedError("Method not implemented")
+ """Scale a resource in a Helm Chart.
+
+ Args:
+ kdu_instance: KDU instance name
+ scale: Scale to which to set the resource
+ resource_name: Resource name
+ total_timeout: The time, in seconds, to wait
+ cluster_uuid: The UUID of the cluster
+ kdu_model: The chart reference
+ atomic: if set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ db_dict: Dictionary for any additional data
+ kwargs: Additional parameters
+
+ Returns:
+ True if successful, False otherwise
+ """
+
+ debug_mgs = "scaling {} in cluster {}".format(kdu_model, cluster_uuid)
+ if resource_name:
+ debug_mgs = "scaling resource {} in model {} (cluster {})".format(
+ resource_name, kdu_model, cluster_uuid
+ )
+
+ self.log.debug(debug_mgs)
+
+ # look for instance to obtain namespace
+ # get_instance_info function calls the sync command
+ instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
+ if not instance_info:
+ raise K8sException("kdu_instance {} not found".format(kdu_instance))
+
+ # init env, paths
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+
+ # version
+ kdu_model, version = await self._prepare_helm_chart(kdu_model, cluster_uuid)
+
+ repo_url = await self._find_repo(kdu_model, cluster_uuid)
+
+ _, replica_str = await self._get_replica_count_url(
+ kdu_model, repo_url, resource_name
+ )
+
+ command = self._get_upgrade_scale_command(
+ kdu_model,
+ kdu_instance,
+ instance_info["namespace"],
+ scale,
+ version,
+ atomic,
+ replica_str,
+ total_timeout,
+ resource_name,
+ paths["kube_config"],
+ )
+
+ self.log.debug("scaling: {}".format(command))
+
+ if atomic:
+ # exec helm in a task
+ exec_task = asyncio.ensure_future(
+ coro_or_future=self._local_async_exec(
+ command=command, raise_exception_on_error=False, env=env
+ )
+ )
+ # write status in another task
+ status_task = asyncio.ensure_future(
+ coro_or_future=self._store_status(
+ cluster_id=cluster_uuid,
+ kdu_instance=kdu_instance,
+ namespace=instance_info["namespace"],
+ db_dict=db_dict,
+ operation="scale",
+ )
+ )
+
+ # wait for execution task
+ await asyncio.wait([exec_task])
+
+ # cancel status task
+ status_task.cancel()
+ output, rc = exec_task.result()
+
+ else:
+ output, rc = await self._local_async_exec(
+ command=command, raise_exception_on_error=False, env=env
+ )
+
+ # write final status
+ await self._store_status(
+ cluster_id=cluster_uuid,
+ kdu_instance=kdu_instance,
+ namespace=instance_info["namespace"],
+ db_dict=db_dict,
+ operation="scale",
+ )
+
+ if rc != 0:
+ msg = "Error executing command: {}\nOutput: {}".format(command, output)
+ self.log.error(msg)
+ raise K8sException(msg)
+
+ # sync fs
+ self.fs.reverse_sync(from_path=cluster_uuid)
+
+ return True
async def get_scale_count(
self,
resource_name: str,
kdu_instance: str,
+ cluster_uuid: str,
+ kdu_model: str,
**kwargs,
- ):
- raise NotImplementedError("Method not implemented")
+ ) -> int:
+ """Get a resource scale count.
+
+ Args:
+ cluster_uuid: The UUID of the cluster
+ resource_name: Resource name
+ kdu_instance: KDU instance name
+ kdu_model: The name or path of an Helm Chart
+ kwargs: Additional parameters
+
+ Returns:
+ Resource instance count
+ """
+
+ self.log.debug(
+ "getting scale count for {} in cluster {}".format(kdu_model, cluster_uuid)
+ )
+
+ # look for instance to obtain namespace
+ instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
+ if not instance_info:
+ raise K8sException("kdu_instance {} not found".format(kdu_instance))
+
+ # init env, paths
+ paths, _ = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+
+ replicas = await self._get_replica_count_instance(
+ kdu_instance=kdu_instance,
+ namespace=instance_info["namespace"],
+ kubeconfig=paths["kube_config"],
+ resource_name=resource_name,
+ )
+
+ self.log.debug(
+ f"Number of replicas of the KDU instance {kdu_instance} and resource {resource_name} obtained: {replicas}"
+ )
+
+ # Get default value if scale count is not found from provided values
+ # Important note: this piece of code shall only be executed in the first scaling operation,
+ # since it is expected that the _get_replica_count_instance is able to obtain the number of
+ # replicas when a scale operation was already conducted previously for this KDU/resource!
+ if replicas is None:
+ repo_url = await self._find_repo(
+ kdu_model=kdu_model, cluster_uuid=cluster_uuid
+ )
+ replicas, _ = await self._get_replica_count_url(
+ kdu_model=kdu_model, repo_url=repo_url, resource_name=resource_name
+ )
+
+ self.log.debug(
+ f"Number of replicas of the Helm Chart package for KDU instance {kdu_instance} and resource "
+ f"{resource_name} obtained: {replicas}"
+ )
+
+ if replicas is None:
+ msg = "Replica count not found. Cannot be scaled"
+ self.log.error(msg)
+ raise K8sException(msg)
+
+ return int(replicas)
async def rollback(
self, cluster_uuid: str, kdu_instance: str, revision=0, db_dict: dict = None
):
-
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
self.log.debug(
"rollback kdu_instance {} to revision {} from cluster {}".format(
- kdu_instance, revision, cluster_id
+ kdu_instance, revision, cluster_uuid
)
)
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# look for instance to obtain namespace
instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
# init env, paths
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
command = self._get_rollback_command(
- kdu_instance, instance_info["namespace"], revision
+ kdu_instance, instance_info["namespace"], revision, paths["kube_config"]
)
self.log.debug("rolling_back: {}".format(command))
# write status in another task
status_task = asyncio.ensure_future(
coro_or_future=self._store_status(
- cluster_id=cluster_id,
+ cluster_id=cluster_uuid,
kdu_instance=kdu_instance,
namespace=instance_info["namespace"],
db_dict=db_dict,
operation="rollback",
- run_once=False,
)
)
# write final status
await self._store_status(
- cluster_id=cluster_id,
+ cluster_id=cluster_uuid,
kdu_instance=kdu_instance,
namespace=instance_info["namespace"],
db_dict=db_dict,
operation="rollback",
- run_once=True,
- check_every=0,
)
if rc != 0:
raise K8sException(msg)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
# return new revision number
instance = await self.get_instance_info(
:return: True if successful
"""
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
self.log.debug(
- "uninstall kdu_instance {} from cluster {}".format(kdu_instance, cluster_id)
+ "uninstall kdu_instance {} from cluster {}".format(
+ kdu_instance, cluster_uuid
+ )
)
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# look for instance to obtain namespace
instance_info = await self.get_instance_info(cluster_uuid, kdu_instance)
return True
# init env, paths
paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
+ cluster_name=cluster_uuid, create_if_not_exist=True
)
- command = self._get_uninstall_command(kdu_instance, instance_info["namespace"])
+ # sync local dir
+ self.fs.sync(from_path=cluster_uuid)
+
+ command = self._get_uninstall_command(
+ kdu_instance, instance_info["namespace"], paths["kube_config"]
+ )
output, _rc = await self._local_async_exec(
command=command, raise_exception_on_error=True, env=env
)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
return self._output_to_table(output)
:return:
"""
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("list releases for cluster {}".format(cluster_id))
+ self.log.debug("list releases for cluster {}".format(cluster_uuid))
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# execute internal command
- result = await self._instances_list(cluster_id)
+ result = await self._instances_list(cluster_uuid)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
return result
self.log.debug("Instance {} not found".format(kdu_instance))
return None
+ async def upgrade_charm(
+ self,
+ ee_id: str = None,
+ path: str = None,
+ charm_id: str = None,
+ charm_type: str = None,
+ timeout: float = None,
+ ) -> str:
+ """This method upgrade charms in VNFs
+
+ Args:
+ ee_id: Execution environment id
+ path: Local path to the charm
+ charm_id: charm-id
+ charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm
+ timeout: (Float) Timeout for the ns update operation
+
+ Returns:
+ The output of the update operation if status equals to "completed"
+ """
+ raise K8sException("KDUs deployed with Helm do not support charm upgrade")
+
async def exec_primitive(
self,
cluster_uuid: str = None,
- `external_ip` List of external ips (in case they are available)
"""
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
self.log.debug(
"get_services: cluster_uuid: {}, kdu_instance: {}".format(
cluster_uuid, kdu_instance
)
)
+ # init env, paths
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# get list of services names for kdu
- service_names = await self._get_services(cluster_id, kdu_instance, namespace)
+ service_names = await self._get_services(
+ cluster_uuid, kdu_instance, namespace, paths["kube_config"]
+ )
service_list = []
for service in service_names:
- service = await self._get_service(cluster_id, service, namespace)
+ service = await self._get_service(cluster_uuid, service, namespace)
service_list.append(service)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
return service_list
async def get_service(
self, cluster_uuid: str, service_name: str, namespace: str
) -> object:
-
self.log.debug(
"get service, service_name: {}, namespace: {}, cluster_uuid: {}".format(
service_name, namespace, cluster_uuid
)
)
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
-
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
- service = await self._get_service(cluster_id, service_name, namespace)
+ service = await self._get_service(cluster_uuid, service_name, namespace)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
return service
- async def status_kdu(self, cluster_uuid: str, kdu_instance: str, **kwargs) -> str:
+ async def status_kdu(
+ self, cluster_uuid: str, kdu_instance: str, yaml_format: str = False, **kwargs
+ ) -> Union[str, dict]:
"""
This call would retrieve tha current state of a given KDU instance. It would be
would allow to retrieve the _composition_ (i.e. K8s objects) and _specific
:param cluster_uuid: UUID of a K8s cluster known by OSM
:param kdu_instance: unique name for the KDU instance
:param kwargs: Additional parameters (None yet)
+ :param yaml_format: if the return shall be returned as an YAML string or as a
+ dictionary
:return: If successful, it will return the following vector of arguments:
- K8s `namespace` in the cluster where the KDU lives
- `state` of the KDU instance. It can be:
)
)
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
-
# sync local dir
- self.fs.sync(from_path=cluster_id)
+ self.fs.sync(from_path=cluster_uuid)
# get instance: needed to obtain namespace
- instances = await self._instances_list(cluster_id=cluster_id)
+ instances = await self._instances_list(cluster_id=cluster_uuid)
for instance in instances:
if instance.get("name") == kdu_instance:
break
# instance does not exist
raise K8sException(
"Instance name: {} not found in cluster: {}".format(
- kdu_instance, cluster_id
+ kdu_instance, cluster_uuid
)
)
status = await self._status_kdu(
- cluster_id=cluster_id,
+ cluster_id=cluster_uuid,
kdu_instance=kdu_instance,
namespace=instance["namespace"],
+ yaml_format=yaml_format,
show_error_log=True,
- return_text=True,
)
# sync fs
- self.fs.reverse_sync(from_path=cluster_id)
+ self.fs.reverse_sync(from_path=cluster_uuid)
return status
+ async def get_values_kdu(
+ self, kdu_instance: str, namespace: str, kubeconfig: str
+ ) -> str:
+ self.log.debug("get kdu_instance values {}".format(kdu_instance))
+
+ return await self._exec_get_command(
+ get_command="values",
+ kdu_instance=kdu_instance,
+ namespace=namespace,
+ kubeconfig=kubeconfig,
+ )
+
async def values_kdu(self, kdu_model: str, repo_url: str = None) -> str:
+ """Method to obtain the Helm Chart package's values
+
+ Args:
+ kdu_model: The name or path of an Helm Chart
+ repo_url: Helm Chart repository url
+
+ Returns:
+ str: the values of the Helm Chart package
+ """
self.log.debug(
"inspect kdu_model values {} from (optional) repo: {}".format(
)
)
- return await self._exec_inspect_comand(
+ return await self._exec_inspect_command(
inspect_command="values", kdu_model=kdu_model, repo_url=repo_url
)
async def help_kdu(self, kdu_model: str, repo_url: str = None) -> str:
-
self.log.debug(
"inspect kdu_model {} readme.md from repo: {}".format(kdu_model, repo_url)
)
- return await self._exec_inspect_comand(
+ return await self._exec_inspect_command(
inspect_command="readme", kdu_model=kdu_model, repo_url=repo_url
)
async def synchronize_repos(self, cluster_uuid: str):
-
self.log.debug("synchronize repos for cluster helm-id: {}".format(cluster_uuid))
try:
db_repo_ids = self._get_helm_chart_repos_ids(cluster_uuid)
# add repo
self.log.debug("add repo {}".format(db_repo["name"]))
await self.repo_add(
- cluster_uuid, db_repo["name"], db_repo["url"]
+ cluster_uuid,
+ db_repo["name"],
+ db_repo["url"],
+ cert=db_repo.get("ca_cert"),
+ user=db_repo.get("user"),
+ password=db_repo.get("password"),
+ oci=db_repo.get("oci", False),
)
added_repo_dict[repo_id] = db_repo["name"]
except Exception as e:
"""
@abc.abstractmethod
- async def _get_services(self, cluster_id, kdu_instance, namespace):
+ async def _get_services(self, cluster_id, kdu_instance, namespace, kubeconfig):
"""
Implements the helm version dependent method to obtain services from a helm instance
"""
cluster_id: str,
kdu_instance: str,
namespace: str = None,
+ yaml_format: bool = False,
show_error_log: bool = False,
- return_text: bool = False,
- ):
+ ) -> Union[str, dict]:
"""
Implements the helm version dependent method to obtain status of a helm instance
"""
@abc.abstractmethod
def _get_install_command(
- self, kdu_model, kdu_instance, namespace, params_str, version, atomic, timeout
+ self,
+ kdu_model,
+ kdu_instance,
+ namespace,
+ params_str,
+ version,
+ atomic,
+ timeout,
+ kubeconfig,
) -> str:
"""
Obtain command to be executed to delete the indicated instance
"""
@abc.abstractmethod
- def _get_upgrade_command(
- self, kdu_model, kdu_instance, namespace, params_str, version, atomic, timeout
+ def _get_upgrade_scale_command(
+ self,
+ kdu_model,
+ kdu_instance,
+ namespace,
+ count,
+ version,
+ atomic,
+ replicas,
+ timeout,
+ resource_name,
+ kubeconfig,
) -> str:
+ """Generates the command to scale a Helm Chart release
+
+ Args:
+ kdu_model (str): Kdu model name, corresponding to the Helm local location or repository
+ kdu_instance (str): KDU instance, corresponding to the Helm Chart release in question
+ namespace (str): Namespace where this KDU instance is deployed
+ scale (int): Scale count
+ version (str): Constraint with specific version of the Chart to use
+ atomic (bool): If set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ replica_str (str): The key under resource_name key where the scale count is stored
+ timeout (float): The time, in seconds, to wait
+ resource_name (str): The KDU's resource to scale
+ kubeconfig (str): Kubeconfig file path
+
+ Returns:
+ str: command to scale a Helm Chart release
"""
- Obtain command to be executed to upgrade the indicated instance
+
+ @abc.abstractmethod
+ def _get_upgrade_command(
+ self,
+ kdu_model,
+ kdu_instance,
+ namespace,
+ params_str,
+ version,
+ atomic,
+ timeout,
+ kubeconfig,
+ force,
+ ) -> str:
+ """Generates the command to upgrade a Helm Chart release
+
+ Args:
+ kdu_model (str): Kdu model name, corresponding to the Helm local location or repository
+ kdu_instance (str): KDU instance, corresponding to the Helm Chart release in question
+ namespace (str): Namespace where this KDU instance is deployed
+ params_str (str): Params used to upgrade the Helm Chart release
+ version (str): Constraint with specific version of the Chart to use
+ atomic (bool): If set, upgrade process rolls back changes made in case of failed upgrade.
+ The --wait flag will be set automatically if --atomic is used
+ timeout (float): The time, in seconds, to wait
+ kubeconfig (str): Kubeconfig file path
+ force (bool): If set, helm forces resource updates through a replacement strategy. This may recreate pods.
+ Returns:
+ str: command to upgrade a Helm Chart release
"""
@abc.abstractmethod
- def _get_rollback_command(self, kdu_instance, namespace, revision) -> str:
+ def _get_rollback_command(
+ self, kdu_instance, namespace, revision, kubeconfig
+ ) -> str:
"""
Obtain command to be executed to rollback the indicated instance
"""
@abc.abstractmethod
- def _get_uninstall_command(self, kdu_instance: str, namespace: str) -> str:
+ def _get_uninstall_command(
+ self, kdu_instance: str, namespace: str, kubeconfig: str
+ ) -> str:
"""
Obtain command to be executed to delete the indicated instance
"""
def _get_inspect_command(
self, show_command: str, kdu_model: str, repo_str: str, version: str
):
- """
- Obtain command to be executed to obtain information about the kdu
+ """Generates the command to obtain the information about an Helm Chart package
+ (´helm show ...´ command)
+
+ Args:
+ show_command: the second part of the command (`helm show <show_command>`)
+ kdu_model: The name or path of an Helm Chart
+ repo_url: Helm Chart repository url
+ version: constraint with specific version of the Chart to use
+
+ Returns:
+ str: the generated Helm Chart command
"""
+ @abc.abstractmethod
+ def _get_get_command(
+ self, get_command: str, kdu_instance: str, namespace: str, kubeconfig: str
+ ):
+ """Obtain command to be executed to get information about the kdu instance."""
+
@abc.abstractmethod
async def _uninstall_sw(self, cluster_id: str, namespace: str):
"""
show_error_log: bool = True,
encode_utf8: bool = False,
env: dict = None,
- ) -> (str, int):
-
+ ) -> tuple[str, int]:
command = K8sHelmBaseConnector._remove_multiple_spaces(command)
self.log.debug(
"Executing async local command: {}, env: {}".format(command, env)
environ.update(env)
try:
- process = await asyncio.create_subprocess_exec(
- *command,
- stdout=asyncio.subprocess.PIPE,
- stderr=asyncio.subprocess.PIPE,
- env=environ,
- )
+ async with self.cmd_lock:
+ process = await asyncio.create_subprocess_exec(
+ *command,
+ stdout=asyncio.subprocess.PIPE,
+ stderr=asyncio.subprocess.PIPE,
+ env=environ,
+ )
- # wait for command terminate
- stdout, stderr = await process.communicate()
+ # wait for command terminate
+ stdout, stderr = await process.communicate()
- return_code = process.returncode
+ return_code = process.returncode
output = ""
if stdout:
return output, return_code
except asyncio.CancelledError:
+ # first, kill the process if it is still running
+ if process.returncode is None:
+ process.kill()
raise
except K8sException:
raise
encode_utf8: bool = False,
env: dict = None,
):
-
command1 = K8sHelmBaseConnector._remove_multiple_spaces(command1)
command2 = K8sHelmBaseConnector._remove_multiple_spaces(command2)
command = "{} | {}".format(command1, command2)
environ.update(env)
try:
- read, write = os.pipe()
- await asyncio.create_subprocess_exec(*command1, stdout=write, env=environ)
- os.close(write)
- process_2 = await asyncio.create_subprocess_exec(
- *command2, stdin=read, stdout=asyncio.subprocess.PIPE, env=environ
- )
- os.close(read)
- stdout, stderr = await process_2.communicate()
+ async with self.cmd_lock:
+ read, write = os.pipe()
+ process_1 = await asyncio.create_subprocess_exec(
+ *command1, stdout=write, env=environ
+ )
+ os.close(write)
+ process_2 = await asyncio.create_subprocess_exec(
+ *command2, stdin=read, stdout=asyncio.subprocess.PIPE, env=environ
+ )
+ os.close(read)
+ stdout, stderr = await process_2.communicate()
- return_code = process_2.returncode
+ return_code = process_2.returncode
output = ""
if stdout:
return output, return_code
except asyncio.CancelledError:
+ # first, kill the processes if they are still running
+ for process in (process_1, process_2):
+ if process.returncode is None:
+ process.kill()
raise
except K8sException:
raise
)
command = "{} --kubeconfig={} --namespace={} get service {} -o=yaml".format(
- self.kubectl_command, paths["kube_config"], namespace, service_name
+ self.kubectl_command,
+ paths["kube_config"],
+ quote(namespace),
+ quote(service_name),
)
output, _rc = await self._local_async_exec(
return service
- async def _exec_inspect_comand(
+ async def _exec_get_command(
+ self, get_command: str, kdu_instance: str, namespace: str, kubeconfig: str
+ ):
+ """Obtains information about the kdu instance."""
+
+ full_command = self._get_get_command(
+ get_command, kdu_instance, namespace, kubeconfig
+ )
+
+ output, _rc = await self._local_async_exec(command=full_command)
+
+ return output
+
+ async def _exec_inspect_command(
self, inspect_command: str, kdu_model: str, repo_url: str = None
):
- """
- Obtains information about a kdu, no cluster (no env)
+ """Obtains information about an Helm Chart package (´helm show´ command)
+
+ Args:
+ inspect_command: the Helm sub command (`helm show <inspect_command> ...`)
+ kdu_model: The name or path of an Helm Chart
+ repo_url: Helm Chart repository url
+
+ Returns:
+ str: the requested info about the Helm Chart package
"""
repo_str = ""
if repo_url:
- repo_str = " --repo {}".format(repo_url)
+ repo_str = " --repo {}".format(quote(repo_url))
- idx = kdu_model.find("/")
- if idx >= 0:
- idx += 1
- kdu_model = kdu_model[idx:]
+ # Obtain the Chart's name and store it in the var kdu_model
+ kdu_model, _ = self._split_repo(kdu_model=kdu_model)
- version = ""
- if ":" in kdu_model:
- parts = kdu_model.split(sep=":")
- if len(parts) == 2:
- version = "--version {}".format(str(parts[1]))
- kdu_model = parts[0]
+ kdu_model, version = self._split_version(kdu_model)
+ if version:
+ version_str = "--version {}".format(quote(version))
+ else:
+ version_str = ""
full_command = self._get_inspect_command(
- inspect_command, kdu_model, repo_str, version
- )
- output, _rc = await self._local_async_exec(
- command=full_command, encode_utf8=True
+ show_command=inspect_command,
+ kdu_model=quote(kdu_model),
+ repo_str=repo_str,
+ version=version_str,
)
+ output, _ = await self._local_async_exec(command=full_command)
+
return output
+ async def _get_replica_count_url(
+ self,
+ kdu_model: str,
+ repo_url: str = None,
+ resource_name: str = None,
+ ) -> tuple[int, str]:
+ """Get the replica count value in the Helm Chart Values.
+
+ Args:
+ kdu_model: The name or path of an Helm Chart
+ repo_url: Helm Chart repository url
+ resource_name: Resource name
+
+ Returns:
+ A tuple with:
+ - The number of replicas of the specific instance; if not found, returns None; and
+ - The string corresponding to the replica count key in the Helm values
+ """
+
+ kdu_values = yaml.load(
+ await self.values_kdu(kdu_model=kdu_model, repo_url=repo_url),
+ Loader=yaml.SafeLoader,
+ )
+
+ self.log.debug(f"Obtained the Helm package values for the KDU: {kdu_values}")
+
+ if not kdu_values:
+ raise K8sException(
+ "kdu_values not found for kdu_model {}".format(kdu_model)
+ )
+
+ if resource_name:
+ kdu_values = kdu_values.get(resource_name, None)
+
+ if not kdu_values:
+ msg = "resource {} not found in the values in model {}".format(
+ resource_name, kdu_model
+ )
+ self.log.error(msg)
+ raise K8sException(msg)
+
+ duplicate_check = False
+
+ replica_str = ""
+ replicas = None
+
+ if kdu_values.get("replicaCount") is not None:
+ replicas = kdu_values["replicaCount"]
+ replica_str = "replicaCount"
+ elif kdu_values.get("replicas") is not None:
+ duplicate_check = True
+ replicas = kdu_values["replicas"]
+ replica_str = "replicas"
+ else:
+ if resource_name:
+ msg = (
+ "replicaCount or replicas not found in the resource"
+ "{} values in model {}. Cannot be scaled".format(
+ resource_name, kdu_model
+ )
+ )
+ else:
+ msg = (
+ "replicaCount or replicas not found in the values"
+ "in model {}. Cannot be scaled".format(kdu_model)
+ )
+ self.log.error(msg)
+ raise K8sException(msg)
+
+ # Control if replicas and replicaCount exists at the same time
+ msg = "replicaCount and replicas are exists at the same time"
+ if duplicate_check:
+ if "replicaCount" in kdu_values:
+ self.log.error(msg)
+ raise K8sException(msg)
+ else:
+ if "replicas" in kdu_values:
+ self.log.error(msg)
+ raise K8sException(msg)
+
+ return replicas, replica_str
+
+ async def _get_replica_count_instance(
+ self,
+ kdu_instance: str,
+ namespace: str,
+ kubeconfig: str,
+ resource_name: str = None,
+ ) -> int:
+ """Get the replica count value in the instance.
+
+ Args:
+ kdu_instance: The name of the KDU instance
+ namespace: KDU instance namespace
+ kubeconfig:
+ resource_name: Resource name
+
+ Returns:
+ The number of replicas of the specific instance; if not found, returns None
+ """
+
+ kdu_values = yaml.load(
+ await self.get_values_kdu(kdu_instance, namespace, kubeconfig),
+ Loader=yaml.SafeLoader,
+ )
+
+ self.log.debug(f"Obtained the Helm values for the KDU instance: {kdu_values}")
+
+ replicas = None
+
+ if kdu_values:
+ resource_values = (
+ kdu_values.get(resource_name, None) if resource_name else None
+ )
+
+ for replica_str in ("replicaCount", "replicas"):
+ if resource_values:
+ replicas = resource_values.get(replica_str)
+ else:
+ replicas = kdu_values.get(replica_str)
+
+ if replicas is not None:
+ break
+
+ return replicas
+
async def _store_status(
self,
cluster_id: str,
operation: str,
kdu_instance: str,
namespace: str = None,
- check_every: float = 10,
db_dict: dict = None,
- run_once: bool = False,
- ):
- while True:
- try:
- await asyncio.sleep(check_every)
- detailed_status = await self._status_kdu(
- cluster_id=cluster_id,
- kdu_instance=kdu_instance,
- namespace=namespace,
- return_text=False,
- )
- status = detailed_status.get("info").get("description")
- self.log.debug("KDU {} STATUS: {}.".format(kdu_instance, status))
- # write status to db
- result = await self.write_app_status_to_db(
- db_dict=db_dict,
- status=str(status),
- detailed_status=str(detailed_status),
- operation=operation,
- )
- if not result:
- self.log.info("Error writing in database. Task exiting...")
- return
- except asyncio.CancelledError:
- self.log.debug("Task cancelled")
- return
- except Exception as e:
- self.log.debug(
- "_store_status exception: {}".format(str(e)), exc_info=True
- )
- pass
- finally:
- if run_once:
- return
+ ) -> None:
+ """
+ Obtains the status of the KDU instance based on Helm Charts, and stores it in the database.
+
+ :param cluster_id (str): the cluster where the KDU instance is deployed
+ :param operation (str): The operation related to the status to be updated (for instance, "install" or "upgrade")
+ :param kdu_instance (str): The KDU instance in relation to which the status is obtained
+ :param namespace (str): The Kubernetes namespace where the KDU instance was deployed. Defaults to None
+ :param db_dict (dict): A dictionary with the database necessary information. It shall contain the
+ values for the keys:
+ - "collection": The Mongo DB collection to write to
+ - "filter": The query filter to use in the update process
+ - "path": The dot separated keys which targets the object to be updated
+ Defaults to None.
+ """
+
+ try:
+ detailed_status = await self._status_kdu(
+ cluster_id=cluster_id,
+ kdu_instance=kdu_instance,
+ yaml_format=False,
+ namespace=namespace,
+ )
+
+ status = detailed_status.get("info").get("description")
+ self.log.debug(f"Status for KDU {kdu_instance} obtained: {status}.")
+
+ # write status to db
+ result = await self.write_app_status_to_db(
+ db_dict=db_dict,
+ status=str(status),
+ detailed_status=str(detailed_status),
+ operation=operation,
+ )
+
+ if not result:
+ self.log.info("Error writing in database. Task exiting...")
+
+ except asyncio.CancelledError as e:
+ self.log.warning(
+ f"Exception in method {self._store_status.__name__} (task cancelled): {e}"
+ )
+ except Exception as e:
+ self.log.warning(f"Exception in method {self._store_status.__name__}: {e}")
# params for use in -f file
# returns values file option and filename (in order to delete it at the end)
- def _params_to_file_option(self, cluster_id: str, params: dict) -> (str, str):
-
+ def _params_to_file_option(self, cluster_id: str, params: dict) -> tuple[str, str]:
if params and len(params) > 0:
self._init_paths_env(cluster_name=cluster_id, create_if_not_exist=True)
def get_random_number():
- r = random.randrange(start=1, stop=99999999)
+ r = random.SystemRandom().randint(1, 99999999)
s = str(r)
while len(s) < 10:
s = "0" + s
for key in params:
value = params.get(key)
if "!!yaml" in str(value):
- value = yaml.load(value[7:])
+ value = yaml.safe_load(value[7:])
params2[key] = value
values_file = get_random_number() + ".yaml"
# params for use in --set option
@staticmethod
def _params_to_set_option(params: dict) -> str:
- params_str = ""
- if params and len(params) > 0:
- start = True
- for key in params:
- value = params.get(key, None)
- if value is not None:
- if start:
- params_str += "--set "
- start = False
- else:
- params_str += ","
- params_str += "{}={}".format(key, value)
- return params_str
+ pairs = [
+ f"{quote(str(key))}={quote(str(value))}"
+ for key, value in params.items()
+ if value is not None
+ ]
+ if not pairs:
+ return ""
+ return "--set " + ",".join(pairs)
@staticmethod
def generate_kdu_instance_name(**kwargs):
name += "-"
def get_random_number():
- r = random.randrange(start=1, stop=99999999)
+ r = random.SystemRandom().randint(1, 99999999)
s = str(r)
s = s.rjust(10, "0")
return s
name = name + get_random_number()
return name.lower()
+
+ def _split_version(self, kdu_model: str) -> tuple[str, str]:
+ version = None
+ if (
+ not (
+ self._is_helm_chart_a_file(kdu_model)
+ or self._is_helm_chart_a_url(kdu_model)
+ )
+ and ":" in kdu_model
+ ):
+ parts = kdu_model.split(sep=":")
+ if len(parts) == 2:
+ version = str(parts[1])
+ kdu_model = parts[0]
+ return kdu_model, version
+
+ def _split_repo(self, kdu_model: str) -> tuple[str, str]:
+ """Obtain the Helm Chart's repository and Chart's names from the KDU model
+
+ Args:
+ kdu_model (str): Associated KDU model
+
+ Returns:
+ (str, str): Tuple with the Chart name in index 0, and the repo name
+ in index 2; if there was a problem finding them, return None
+ for both
+ """
+
+ chart_name = None
+ repo_name = None
+
+ idx = kdu_model.find("/")
+ if not self._is_helm_chart_a_url(kdu_model) and idx >= 0:
+ chart_name = kdu_model[idx + 1 :]
+ repo_name = kdu_model[:idx]
+
+ return chart_name, repo_name
+
+ async def _find_repo(self, kdu_model: str, cluster_uuid: str) -> str:
+ """Obtain the Helm repository for an Helm Chart
+
+ Args:
+ kdu_model (str): the KDU model associated with the Helm Chart instantiation
+ cluster_uuid (str): The cluster UUID associated with the Helm Chart instantiation
+
+ Returns:
+ str: the repository URL; if Helm Chart is a local one, the function returns None
+ """
+
+ _, repo_name = self._split_repo(kdu_model=kdu_model)
+
+ repo_url = None
+ if repo_name:
+ # Find repository link
+ local_repo_list = await self.repo_list(cluster_uuid)
+ for repo in local_repo_list:
+ if repo["name"] == repo_name:
+ repo_url = repo["url"]
+ break # it is not necessary to continue the loop if the repo link was found...
+
+ return repo_url
+
+ def _repo_to_oci_url(self, repo):
+ db_repo = self.db.get_one("k8srepos", {"name": repo}, fail_on_empty=False)
+ if db_repo and "oci" in db_repo:
+ return db_repo.get("url")
+
+ async def _prepare_helm_chart(self, kdu_model, cluster_id):
+ # e.g.: "stable/openldap", "1.0"
+ kdu_model, version = self._split_version(kdu_model)
+ # e.g.: "openldap, stable"
+ chart_name, repo = self._split_repo(kdu_model)
+ if repo and chart_name: # repo/chart case
+ oci_url = self._repo_to_oci_url(repo)
+ if oci_url: # oci does not require helm repo update
+ kdu_model = f"{oci_url.rstrip('/')}/{chart_name.lstrip('/')}" # urljoin doesn't work for oci schema
+ else:
+ await self.repo_update(cluster_id, repo)
+ return kdu_model, version
+
+ async def create_certificate(
+ self, cluster_uuid, namespace, dns_prefix, name, secret_name, usage
+ ):
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ await kubectl.create_certificate(
+ namespace=namespace,
+ name=name,
+ dns_prefix=dns_prefix,
+ secret_name=secret_name,
+ usages=[usage],
+ issuer_name="ca-issuer",
+ )
+
+ async def delete_certificate(self, cluster_uuid, namespace, certificate_name):
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ await kubectl.delete_certificate(namespace, certificate_name)
+
+ async def create_namespace(
+ self,
+ namespace,
+ cluster_uuid,
+ labels,
+ ):
+ """
+ Create a namespace in a specific cluster
+
+ :param namespace: Namespace to be created
+ :param cluster_uuid: K8s cluster uuid used to retrieve kubeconfig
+ :param labels: Dictionary with labels for the new namespace
+ :returns: None
+ """
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ await kubectl.create_namespace(
+ name=namespace,
+ labels=labels,
+ )
+
+ async def delete_namespace(
+ self,
+ namespace,
+ cluster_uuid,
+ ):
+ """
+ Delete a namespace in a specific cluster
+
+ :param namespace: namespace to be deleted
+ :param cluster_uuid: K8s cluster uuid used to retrieve kubeconfig
+ :returns: None
+ """
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ await kubectl.delete_namespace(
+ name=namespace,
+ )
+
+ async def copy_secret_data(
+ self,
+ src_secret: str,
+ dst_secret: str,
+ cluster_uuid: str,
+ data_key: str,
+ src_namespace: str = "osm",
+ dst_namespace: str = "osm",
+ ):
+ """
+ Copy a single key and value from an existing secret to a new one
+
+ :param src_secret: name of the existing secret
+ :param dst_secret: name of the new secret
+ :param cluster_uuid: K8s cluster uuid used to retrieve kubeconfig
+ :param data_key: key of the existing secret to be copied
+ :param src_namespace: Namespace of the existing secret
+ :param dst_namespace: Namespace of the new secret
+ :returns: None
+ """
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ secret_data = await kubectl.get_secret_content(
+ name=src_secret,
+ namespace=src_namespace,
+ )
+ # Only the corresponding data_key value needs to be copy
+ data = {data_key: secret_data.get(data_key)}
+ await kubectl.create_secret(
+ name=dst_secret,
+ data=data,
+ namespace=dst_namespace,
+ secret_type="Opaque",
+ )
+
+ async def setup_default_rbac(
+ self,
+ name,
+ namespace,
+ cluster_uuid,
+ api_groups,
+ resources,
+ verbs,
+ service_account,
+ ):
+ """
+ Create a basic RBAC for a new namespace.
+
+ :param name: name of both Role and Role Binding
+ :param namespace: K8s namespace
+ :param cluster_uuid: K8s cluster uuid used to retrieve kubeconfig
+ :param api_groups: Api groups to be allowed in Policy Rule
+ :param resources: Resources to be allowed in Policy Rule
+ :param verbs: Verbs to be allowed in Policy Rule
+ :param service_account: Service Account name used to bind the Role
+ :returns: None
+ """
+ paths, env = self._init_paths_env(
+ cluster_name=cluster_uuid, create_if_not_exist=True
+ )
+ kubectl = Kubectl(config_file=paths["kube_config"])
+ await kubectl.create_role(
+ name=name,
+ labels={},
+ namespace=namespace,
+ api_groups=api_groups,
+ resources=resources,
+ verbs=verbs,
+ )
+ await kubectl.create_role_binding(
+ name=name,
+ labels={},
+ namespace=namespace,
+ role_name=name,
+ sa_name=service_account,
+ )
+++ /dev/null
-##
-# Copyright 2019 Telefonica Investigacion y Desarrollo, S.A.U.
-# This file is part of OSM
-# All Rights Reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-# http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-# implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-#
-# For those usages not covered by the Apache License, Version 2.0 please
-# contact with: nfvlabs@tid.es
-##
-import asyncio
-import os
-import yaml
-
-from n2vc.k8s_helm_base_conn import K8sHelmBaseConnector
-from n2vc.exceptions import K8sException
-
-
-class K8sHelmConnector(K8sHelmBaseConnector):
-
- """
- ####################################################################################
- ################################### P U B L I C ####################################
- ####################################################################################
- """
-
- def __init__(
- self,
- fs: object,
- db: object,
- kubectl_command: str = "/usr/bin/kubectl",
- helm_command: str = "/usr/bin/helm",
- log: object = None,
- on_update_db=None,
- ):
- """
- Initializes helm connector for helm v2
-
- :param fs: file system for kubernetes and helm configuration
- :param db: database object to write current operation status
- :param kubectl_command: path to kubectl executable
- :param helm_command: path to helm executable
- :param log: logger
- :param on_update_db: callback called when k8s connector updates database
- """
-
- # parent class
- K8sHelmBaseConnector.__init__(
- self,
- db=db,
- log=log,
- fs=fs,
- kubectl_command=kubectl_command,
- helm_command=helm_command,
- on_update_db=on_update_db,
- )
-
- self.log.info("Initializing K8S Helm2 connector")
-
- # initialize helm client-only
- self.log.debug("Initializing helm client-only...")
- command = "{} init --client-only {} ".format(
- self._helm_command,
- "--stable-repo-url {}".format(self._stable_repo_url)
- if self._stable_repo_url
- else "--skip-repos",
- )
- try:
- asyncio.ensure_future(
- self._local_async_exec(command=command, raise_exception_on_error=False)
- )
- # loop = asyncio.get_event_loop()
- # loop.run_until_complete(self._local_async_exec(command=command,
- # raise_exception_on_error=False))
- except Exception as e:
- self.warning(
- msg="helm init failed (it was already initialized): {}".format(e)
- )
-
- self.log.info("K8S Helm2 connector initialized")
-
- async def install(
- self,
- cluster_uuid: str,
- kdu_model: str,
- kdu_instance: str,
- atomic: bool = True,
- timeout: float = 300,
- params: dict = None,
- db_dict: dict = None,
- kdu_name: str = None,
- namespace: str = None,
- **kwargs,
- ):
- """
- Deploys of a new KDU instance. It would implicitly rely on the `install` call
- to deploy the Chart/Bundle properly parametrized (in practice, this call would
- happen before any _initial-config-primitive_of the VNF is called).
-
- :param cluster_uuid: UUID of a K8s cluster known by OSM
- :param kdu_model: chart/ reference (string), which can be either
- of these options:
- - a name of chart available via the repos known by OSM
- - a path to a packaged chart
- - a path to an unpacked chart directory or a URL
- :param kdu_instance: Kdu instance name
- :param atomic: If set, installation process purges chart/bundle on fail, also
- will wait until all the K8s objects are active
- :param timeout: Time in seconds to wait for the install of the chart/bundle
- (defaults to Helm default timeout: 300s)
- :param params: dictionary of key-value pairs for instantiation parameters
- (overriding default values)
- :param dict db_dict: where to write into database when the status changes.
- It contains a dict with {collection: <str>, filter: {},
- path: <str>},
- e.g. {collection: "nsrs", filter:
- {_id: <nsd-id>, path: "_admin.deployed.K8S.3"}
- :param kdu_name: Name of the KDU instance to be installed
- :param namespace: K8s namespace to use for the KDU instance
- :param kwargs: Additional parameters (None yet)
- :return: True if successful
- """
- _, cluster_id = self._get_namespace_cluster_id(cluster_uuid)
- self.log.debug("installing {} in cluster {}".format(kdu_model, cluster_id))
-
- # sync local dir
- self.fs.sync(from_path=cluster_id)
-
- # init env, paths
- paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
- )
-
- await self._install_impl(
- cluster_id,
- kdu_model,
- paths,
- env,
- kdu_instance,
- atomic=atomic,
- timeout=timeout,
- params=params,
- db_dict=db_dict,
- kdu_name=kdu_name,
- namespace=namespace,
- )
-
- # sync fs
- self.fs.reverse_sync(from_path=cluster_id)
-
- self.log.debug("Returning kdu_instance {}".format(kdu_instance))
- return True
-
- async def inspect_kdu(self, kdu_model: str, repo_url: str = None) -> str:
-
- self.log.debug(
- "inspect kdu_model {} from (optional) repo: {}".format(kdu_model, repo_url)
- )
-
- return await self._exec_inspect_comand(
- inspect_command="", kdu_model=kdu_model, repo_url=repo_url
- )
-
- """
- ####################################################################################
- ################################### P R I V A T E ##################################
- ####################################################################################
- """
-
- def _init_paths_env(self, cluster_name: str, create_if_not_exist: bool = True):
- """
- Creates and returns base cluster and kube dirs and returns them.
- Also created helm3 dirs according to new directory specification, paths are
- returned and also environment variables that must be provided to execute commands
-
- Helm 2 directory specification uses helm_home dir:
-
- The variables assigned for this paths are:
- - Helm hone: $HELM_HOME
- - helm kubeconfig: $KUBECONFIG
-
- :param cluster_name: cluster_name
- :return: Dictionary with config_paths and dictionary with helm environment variables
- """
- base = self.fs.path
- if base.endswith("/") or base.endswith("\\"):
- base = base[:-1]
-
- # base dir for cluster
- cluster_dir = base + "/" + cluster_name
-
- # kube dir
- kube_dir = cluster_dir + "/" + ".kube"
- if create_if_not_exist and not os.path.exists(kube_dir):
- self.log.debug("Creating dir {}".format(kube_dir))
- os.makedirs(kube_dir)
-
- # helm home dir
- helm_dir = cluster_dir + "/" + ".helm"
- if create_if_not_exist and not os.path.exists(helm_dir):
- self.log.debug("Creating dir {}".format(helm_dir))
- os.makedirs(helm_dir)
-
- config_filename = kube_dir + "/config"
-
- # 2 - Prepare dictionary with paths
- paths = {
- "kube_dir": kube_dir,
- "kube_config": config_filename,
- "cluster_dir": cluster_dir,
- "helm_dir": helm_dir,
- }
-
- for file_name, file in paths.items():
- if "dir" in file_name and not os.path.exists(file):
- err_msg = "{} dir does not exist".format(file)
- self.log.error(err_msg)
- raise K8sException(err_msg)
-
- # 3 - Prepare environment variables
- env = {"HELM_HOME": helm_dir, "KUBECONFIG": config_filename}
-
- return paths, env
-
- async def _get_services(self, cluster_id, kdu_instance, namespace):
-
- # init config, env
- paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
- )
-
- command1 = "{} get manifest {} ".format(self._helm_command, kdu_instance)
- command2 = "{} get --namespace={} -f -".format(self.kubectl_command, namespace)
- output, _rc = await self._local_async_exec_pipe(
- command1, command2, env=env, raise_exception_on_error=True
- )
- services = self._parse_services(output)
-
- return services
-
- async def _cluster_init(
- self, cluster_id: str, namespace: str, paths: dict, env: dict
- ):
- """
- Implements the helm version dependent cluster initialization:
- For helm2 it initialized tiller environment if needed
- """
-
- # check if tiller pod is up in cluster
- command = "{} --kubeconfig={} --namespace={} get deployments".format(
- self.kubectl_command, paths["kube_config"], namespace
- )
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
-
- output_table = self._output_to_table(output=output)
-
- # find 'tiller' pod in all pods
- already_initialized = False
- try:
- for row in output_table:
- if row[0].startswith("tiller-deploy"):
- already_initialized = True
- break
- except Exception:
- pass
-
- # helm init
- n2vc_installed_sw = False
- if not already_initialized:
- self.log.info(
- "Initializing helm in client and server: {}".format(cluster_id)
- )
- command = "{} --kubeconfig={} --namespace kube-system create serviceaccount {}".format(
- self.kubectl_command, paths["kube_config"], self.service_account
- )
- _, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=False, env=env
- )
-
- command = (
- "{} --kubeconfig={} create clusterrolebinding osm-tiller-cluster-rule "
- "--clusterrole=cluster-admin --serviceaccount=kube-system:{}"
- ).format(self.kubectl_command, paths["kube_config"], self.service_account)
- _, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=False, env=env
- )
-
- command = (
- "{} --kubeconfig={} --tiller-namespace={} --home={} --service-account {} "
- " {} init"
- ).format(
- self._helm_command,
- paths["kube_config"],
- namespace,
- paths["helm_dir"],
- self.service_account,
- "--stable-repo-url {}".format(self._stable_repo_url)
- if self._stable_repo_url
- else "--skip-repos",
- )
- _, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
- n2vc_installed_sw = True
- else:
- # check client helm installation
- check_file = paths["helm_dir"] + "/repository/repositories.yaml"
- if not self._check_file_exists(
- filename=check_file, exception_if_not_exists=False
- ):
- self.log.info("Initializing helm in client: {}".format(cluster_id))
- command = (
- "{} --kubeconfig={} --tiller-namespace={} "
- "--home={} init --client-only {} "
- ).format(
- self._helm_command,
- paths["kube_config"],
- namespace,
- paths["helm_dir"],
- "--stable-repo-url {}".format(self._stable_repo_url)
- if self._stable_repo_url
- else "--skip-repos",
- )
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
- else:
- self.log.info("Helm client already initialized")
-
- # remove old stable repo and add new one
- cluster_uuid = "{}:{}".format(namespace, cluster_id)
- repo_list = await self.repo_list(cluster_uuid)
- for repo in repo_list:
- if repo["name"] == "stable" and repo["url"] != self._stable_repo_url:
- self.log.debug("Add new stable repo url: {}")
- await self.repo_remove(cluster_uuid, "stable")
- if self._stable_repo_url:
- await self.repo_add(cluster_uuid, "stable", self._stable_repo_url)
- break
-
- return n2vc_installed_sw
-
- async def _uninstall_sw(self, cluster_id: str, namespace: str):
- # uninstall Tiller if necessary
-
- self.log.debug("Uninstalling tiller from cluster {}".format(cluster_id))
-
- # init paths, env
- paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
- )
-
- if not namespace:
- # find namespace for tiller pod
- command = "{} --kubeconfig={} get deployments --all-namespaces".format(
- self.kubectl_command, paths["kube_config"]
- )
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=False, env=env
- )
- output_table = self._output_to_table(output=output)
- namespace = None
- for r in output_table:
- try:
- if "tiller-deploy" in r[1]:
- namespace = r[0]
- break
- except Exception:
- pass
- else:
- msg = "Tiller deployment not found in cluster {}".format(cluster_id)
- self.log.error(msg)
-
- self.log.debug("namespace for tiller: {}".format(namespace))
-
- if namespace:
- # uninstall tiller from cluster
- self.log.debug("Uninstalling tiller from cluster {}".format(cluster_id))
- command = "{} --kubeconfig={} --home={} reset".format(
- self._helm_command, paths["kube_config"], paths["helm_dir"]
- )
- self.log.debug("resetting: {}".format(command))
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
- # Delete clusterrolebinding and serviceaccount.
- # Ignore if errors for backward compatibility
- command = (
- "{} --kubeconfig={} delete clusterrolebinding.rbac.authorization.k8s."
- "io/osm-tiller-cluster-rule"
- ).format(self.kubectl_command, paths["kube_config"])
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=False, env=env
- )
- command = "{} --kubeconfig={} --namespace kube-system delete serviceaccount/{}".format(
- self.kubectl_command, paths["kube_config"], self.service_account
- )
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=False, env=env
- )
-
- else:
- self.log.debug("namespace not found")
-
- async def _instances_list(self, cluster_id):
-
- # init paths, env
- paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
- )
-
- command = "{} list --output yaml".format(self._helm_command)
-
- output, _rc = await self._local_async_exec(
- command=command, raise_exception_on_error=True, env=env
- )
-
- if output and len(output) > 0:
- # parse yaml and update keys to lower case to unify with helm3
- instances = yaml.load(output, Loader=yaml.SafeLoader).get("Releases")
- new_instances = []
- for instance in instances:
- new_instance = dict((k.lower(), v) for k, v in instance.items())
- new_instances.append(new_instance)
- return new_instances
- else:
- return []
-
- def _get_inspect_command(
- self, show_command: str, kdu_model: str, repo_str: str, version: str
- ):
- inspect_command = "{} inspect {} {}{} {}".format(
- self._helm_command, show_command, kdu_model, repo_str, version
- )
- return inspect_command
-
- async def _status_kdu(
- self,
- cluster_id: str,
- kdu_instance: str,
- namespace: str = None,
- show_error_log: bool = False,
- return_text: bool = False,
- ):
-
- self.log.debug(
- "status of kdu_instance: {}, namespace: {} ".format(kdu_instance, namespace)
- )
-
- # init config, env
- paths, env = self._init_paths_env(
- cluster_name=cluster_id, create_if_not_exist=True
- )
- command = "{} status {} --output yaml".format(self._helm_command, kdu_instance)
- output, rc = await self._local_async_exec(
- command=command,
- raise_exception_on_error=True,
- show_error_log=show_error_log,
- env=env,
- )
-
- if return_text:
- return str(output)
-
- if rc != 0:
- return None
-
- data = yaml.load(output, Loader=yaml.SafeLoader)
-
- # remove field 'notes'
- try:
- del data.get("info").get("status")["notes"]
- except KeyError:
- pass
-
- # parse field 'resources'
- try:
- resources = str(data.get("info").get("status").get("resources"))
- resource_table = self._output_to_table(resources)
- data.get("info").get("status")["resources"] = resource_table
- except Exception:
- pass
-
- # set description to lowercase (unify with helm3)
- try:
- data.get("info")["description"] = data.get("info").pop("Description")
- except KeyError:
- pass
-
- return data
-
- def _get_helm_chart_repos_ids(self, cluster_uuid) -> list:
- repo_ids = []
- cluster_filter = {"_admin.helm-chart.id": cluster_uuid}
- cluster = self.db.get_one("k8sclusters", cluster_filter)
- if cluster:
- repo_ids = cluster.get("_admin").get("helm_chart_repos") or []
- return repo_ids
- else:
- raise K8sException(
- "k8cluster with helm-id : {} not found".format(cluster_uuid)
- )
-
- async def _is_install_completed(self, cluster_id: str, kdu_instance: str) -> bool:
-
- status = await self._status_kdu(
- cluster_id=cluster_id, kdu_instance=kdu_instance, return_text=False
- )
-
- # extract info.status.resources-> str
- # format:
- # ==> v1/Deployment
- # NAME READY UP-TO-DATE AVAILABLE AGE
- # halting-horse-mongodb 0/1 1 0 0s
- # halting-petit-mongodb 1/1 1 0 0s
- # blank line
- resources = K8sHelmBaseConnector._get_deep(
- status, ("info", "status", "resources")
- )
-
- # convert to table
- resources = K8sHelmBaseConnector._output_to_table(resources)
-
- num_lines = len(resources)
- index = 0
- ready = True
- while index < num_lines:
- try:
- line1 = resources[index]
- index += 1
- # find '==>' in column 0
- if line1[0] == "==>":
- line2 = resources[index]
- index += 1
- # find READY in column 1
- if line2[1] == "READY":
- # read next lines
- line3 = resources[index]
- index += 1
- while len(line3) > 1 and index < num_lines:
- ready_value = line3[1]
- parts = ready_value.split(sep="/")
- current = int(parts[0])
- total = int(parts[1])
- if current < total:
- self.log.debug("NOT READY:\n {}".format(line3))
- ready = False
- line3 = resources[index]
- index += 1
-
- except Exception:
- pass
-
- return ready
-
- def _get_install_command(
- self, kdu_model, kdu_instance, namespace, params_str, version, atomic, timeout
- ) -> str:
-
- timeout_str = ""
- if timeout:
- timeout_str = "--timeout {}".format(timeout)
-
- # atomic
- atomic_str = ""
- if atomic:
- atomic_str = "--atomic"
- # namespace
- namespace_str = ""
- if namespace:
- namespace_str = "--namespace {}".format(namespace)
-
- # version
- version_str = ""
- if version:
- version_str = version_str = "--version {}".format(version)
-
- command = (
- "{helm} install {atomic} --output yaml "
- "{params} {timeout} --name={name} {ns} {model} {ver}".format(
- helm=self._helm_command,
- atomic=atomic_str,
- params=params_str,
- timeout=timeout_str,
- name=kdu_instance,
- ns=namespace_str,
- model=kdu_model,
- ver=version_str,
- )
- )
- return command
-
- def _get_upgrade_command(
- self, kdu_model, kdu_instance, namespace, params_str, version, atomic, timeout
- ) -> str:
-
- timeout_str = ""
- if timeout:
- timeout_str = "--timeout {}".format(timeout)
-
- # atomic
- atomic_str = ""
- if atomic:
- atomic_str = "--atomic"
-
- # version
- version_str = ""
- if version:
- version_str = "--version {}".format(version)
-
- command = "{helm} upgrade {atomic} --output yaml {params} {timeout} {name} {model} {ver}".format(
- helm=self._helm_command,
- atomic=atomic_str,
- params=params_str,
- timeout=timeout_str,
- name=kdu_instance,
- model=kdu_model,
- ver=version_str,
- )
- return command
-
- def _get_rollback_command(self, kdu_instance, namespace, revision) -> str:
- return "{} rollback {} {} --wait".format(
- self._helm_command, kdu_instance, revision
- )
-
- def _get_uninstall_command(self, kdu_instance: str, namespace: str) -> str:
- return "{} delete --purge {}".format(self._helm_command, kdu_instance)
# limitations under the License.
import asyncio
+from typing import Union
import os
import uuid
import yaml
import binascii
from n2vc.config import EnvironConfig
+from n2vc.definitions import RelationEndpoint
from n2vc.exceptions import K8sException
from n2vc.k8s_conn import K8sConnector
from n2vc.kubectl import Kubectl
kubectl_command: str = "/usr/bin/kubectl",
juju_command: str = "/usr/bin/juju",
log: object = None,
- loop: object = None,
on_update_db=None,
):
"""
:param kubectl_command: path to kubectl executable
:param helm_command: path to helm executable
:param log: logger
- :param: loop: Asyncio loop
"""
# parent class
- K8sConnector.__init__(
- self,
- db,
- log=log,
- on_update_db=on_update_db,
- )
+ K8sConnector.__init__(self, db, log=log, on_update_db=on_update_db)
self.fs = fs
- self.loop = loop or asyncio.get_event_loop()
self.log.debug("Initializing K8S Juju connector")
db_uri = EnvironConfig(prefixes=["OSMLCM_", "OSMMON_"]).get("database_uri")
self._store = MotorStore(db_uri)
- self.loading_libjuju = asyncio.Lock(loop=self.loop)
+ self.loading_libjuju = asyncio.Lock()
+ self.uninstall_locks = {}
self.log.debug("K8S Juju connector initialized")
# TODO: Remove these commented lines:
# if it fails in the middle of the process
cleanup_data = []
try:
- kubectl.create_cluster_role(
- name=metadata_name,
- labels=labels,
- )
+ self.log.debug("Initializing K8s cluster for juju")
+ kubectl.create_cluster_role(name=metadata_name, labels=labels)
+ self.log.debug("Cluster role created")
cleanup_data.append(
- {
- "delete": kubectl.delete_cluster_role,
- "args": (metadata_name),
- }
+ {"delete": kubectl.delete_cluster_role, "args": (metadata_name,)}
)
- kubectl.create_service_account(
- name=metadata_name,
- labels=labels,
- )
+ kubectl.create_service_account(name=metadata_name, labels=labels)
+ self.log.debug("Service account created")
cleanup_data.append(
- {
- "delete": kubectl.delete_service_account,
- "args": (metadata_name),
- }
+ {"delete": kubectl.delete_service_account, "args": (metadata_name,)}
)
- kubectl.create_cluster_role_binding(
- name=metadata_name,
- labels=labels,
- )
+ kubectl.create_cluster_role_binding(name=metadata_name, labels=labels)
+ self.log.debug("Role binding created")
cleanup_data.append(
{
- "delete": kubectl.delete_service_account,
- "args": (metadata_name),
+ "delete": kubectl.delete_cluster_role_binding,
+ "args": (metadata_name,),
}
)
- token, client_cert_data = await kubectl.get_secret_data(
- metadata_name,
- )
+ token, client_cert_data = await kubectl.get_secret_data(metadata_name)
default_storage_class = kubectl.get_default_storage_class()
+ self.log.debug("Default storage class: {}".format(default_storage_class))
await libjuju.add_k8s(
name=cluster_uuid,
rbac_id=rbac_id,
storage_class=default_storage_class,
credential_name=self._get_credential_name(cluster_uuid),
)
+ self.log.debug("K8s cluster added to juju controller")
return cluster_uuid, True
except Exception as e:
- self.log.error("Error initializing k8scluster: {}".format(e))
+ self.log.error("Error initializing k8scluster: {}".format(e), exc_info=True)
if len(cleanup_data) > 0:
self.log.debug("Cleaning up created resources in k8s cluster...")
for item in cleanup_data:
name: str,
url: str,
_type: str = "charm",
+ cert: str = None,
+ user: str = None,
+ password: str = None,
):
raise MethodNotImplemented()
async def repo_list(self):
raise MethodNotImplemented()
- async def repo_remove(
- self,
- name: str,
- ):
+ async def repo_remove(self, name: str):
raise MethodNotImplemented()
async def synchronize_repos(self, cluster_uuid: str, name: str):
raise K8sException("bundle must be set")
if bundle.startswith("cs:"):
+ # For Juju Bundles provided by the Charm Store
+ pass
+ elif bundle.startswith("ch:"):
+ # For Juju Bundles provided by the Charm Hub (this only works for juju version >= 2.9)
pass
elif bundle.startswith("http"):
# Download the file
os.chdir(new_workdir)
bundle = "local:{}".format(kdu_model)
- self.log.debug("Checking for model named {}".format(kdu_instance))
+ # default namespace to kdu_instance
+ if not namespace:
+ namespace = kdu_instance
+
+ self.log.debug("Checking for model named {}".format(namespace))
# Create the new model
- self.log.debug("Adding model: {}".format(kdu_instance))
+ self.log.debug("Adding model: {}".format(namespace))
cloud = Cloud(cluster_uuid, self._get_credential_name(cluster_uuid))
- await libjuju.add_model(kdu_instance, cloud)
+ await libjuju.add_model(namespace, cloud)
# if model:
# TODO: Instantiation parameters
previous_workdir = "/app/storage"
self.log.debug("[install] deploying {}".format(bundle))
+ instantiation_params = params.get("overlay") if params else None
await libjuju.deploy(
- bundle, model_name=kdu_instance, wait=atomic, timeout=timeout
+ bundle,
+ model_name=namespace,
+ wait=atomic,
+ timeout=timeout,
+ instantiation_params=instantiation_params,
)
os.chdir(previous_workdir)
+
+ # update information in the database (first, the VCA status, and then, the namespace)
if self.on_update_db:
await self.on_update_db(
cluster_uuid,
filter=db_dict["filter"],
vca_id=kwargs.get("vca_id"),
)
+
+ self.db.set_one(
+ table="nsrs",
+ q_filter={"_admin.deployed.K8s.kdu-instance": kdu_instance},
+ update_dict={"_admin.deployed.K8s.$.namespace": namespace},
+ )
+
return True
async def scale(
scale: int,
resource_name: str,
total_timeout: float = 1800,
+ namespace: str = None,
**kwargs,
) -> bool:
"""Scale an application in a model
:param: kdu_instance str: KDU instance name
- :param: scale int: Scale to which to set this application
- :param: resource_name str: Resource name (Application name)
+ :param: scale int: Scale to which to set the application
+ :param: resource_name str: The application name in the Juju Bundle
:param: timeout float: The time, in seconds, to wait for the install
to finish
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param kwargs: Additional parameters
vca_id (str): VCA ID
:return: If successful, returns True
"""
+ model_name = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
try:
libjuju = await self._get_libjuju(kwargs.get("vca_id"))
await libjuju.scale_application(
- model_name=kdu_instance,
+ model_name=model_name,
application_name=resource_name,
scale=scale,
total_timeout=total_timeout,
)
except Exception as e:
- error_msg = "Error scaling application {} in kdu instance {}: {}".format(
- resource_name, kdu_instance, e
+ error_msg = "Error scaling application {} of the model {} of the kdu instance {}: {}".format(
+ resource_name, model_name, kdu_instance, e
)
self.log.error(error_msg)
raise K8sException(message=error_msg)
return True
async def get_scale_count(
- self,
- resource_name: str,
- kdu_instance: str,
- **kwargs,
+ self, resource_name: str, kdu_instance: str, namespace: str = None, **kwargs
) -> int:
"""Get an application scale count
- :param: resource_name str: Resource name (Application name)
+ :param: resource_name str: The application name in the Juju Bundle
:param: kdu_instance str: KDU instance name
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param kwargs: Additional parameters
vca_id (str): VCA ID
:return: Return application instance count
"""
+
+ model_name = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
try:
libjuju = await self._get_libjuju(kwargs.get("vca_id"))
- status = await libjuju.get_model_status(kdu_instance)
+ status = await libjuju.get_model_status(model_name=model_name)
return len(status.applications[resource_name].units)
except Exception as e:
- error_msg = "Error getting scale count from application {} in kdu instance {}: {}".format(
- resource_name, kdu_instance, e
+ error_msg = (
+ f"Error getting scale count from application {resource_name} of the model {model_name} of "
+ f"the kdu instance {kdu_instance}: {e}"
)
self.log.error(error_msg)
raise K8sException(message=error_msg)
"""Rollback"""
async def rollback(
- self,
- cluster_uuid: str,
- kdu_instance: str,
- revision: int = 0,
+ self, cluster_uuid: str, kdu_instance: str, revision: int = 0
) -> str:
"""Rollback a model
"""Deletion"""
async def uninstall(
- self,
- cluster_uuid: str,
- kdu_instance: str,
- **kwargs,
+ self, cluster_uuid: str, kdu_instance: str, namespace: str = None, **kwargs
) -> bool:
"""Uninstall a KDU instance
:param cluster_uuid str: The UUID of the cluster
:param kdu_instance str: The unique name of the KDU instance
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param kwargs: Additional parameters
vca_id (str): VCA ID
:return: Returns True if successful, or raises an exception
"""
+ model_name = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
- self.log.debug("[uninstall] Destroying model")
- libjuju = await self._get_libjuju(kwargs.get("vca_id"))
+ self.log.debug(f"[uninstall] Destroying model: {model_name}")
+
+ will_not_delete = False
+ if model_name not in self.uninstall_locks:
+ self.uninstall_locks[model_name] = asyncio.Lock()
+ delete_lock = self.uninstall_locks[model_name]
- await libjuju.destroy_model(kdu_instance, total_timeout=3600)
+ while delete_lock.locked():
+ will_not_delete = True
+ await asyncio.sleep(0.1)
+
+ if will_not_delete:
+ self.log.info("Model {} deleted by another worker.".format(model_name))
+ return True
+
+ try:
+ async with delete_lock:
+ libjuju = await self._get_libjuju(kwargs.get("vca_id"))
- # self.log.debug("[uninstall] Model destroyed and disconnecting")
- # await controller.disconnect()
+ await libjuju.destroy_model(model_name, total_timeout=3600)
+ finally:
+ self.uninstall_locks.pop(model_name)
+ self.log.debug(f"[uninstall] Model {model_name} destroyed")
return True
- # TODO: Remove these commented lines
- # if not self.authenticated:
- # self.log.debug("[uninstall] Connecting to controller")
- # await self.login(cluster_uuid)
+
+ async def upgrade_charm(
+ self,
+ ee_id: str = None,
+ path: str = None,
+ charm_id: str = None,
+ charm_type: str = None,
+ timeout: float = None,
+ ) -> str:
+ """This method upgrade charms in VNFs
+
+ Args:
+ ee_id: Execution environment id
+ path: Local path to the charm
+ charm_id: charm-id
+ charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm
+ timeout: (Float) Timeout for the ns update operation
+
+ Returns:
+ The output of the update operation if status equals to "completed"
+ """
+ raise K8sException(
+ "KDUs deployed with Juju Bundle do not support charm upgrade"
+ )
async def exec_primitive(
self,
timeout: float = 300,
params: dict = None,
db_dict: dict = None,
+ namespace: str = None,
**kwargs,
) -> str:
"""Exec primitive (Juju action)
:param timeout: Timeout for action execution
:param params: Dictionary of all the parameters needed for the action
:param db_dict: Dictionary for any additional data
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param kwargs: Additional parameters
vca_id (str): VCA ID
"""
libjuju = await self._get_libjuju(kwargs.get("vca_id"))
+ namespace = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
+
if not params or "application-name" not in params:
raise K8sException(
"Missing application-name argument, \
try:
self.log.debug(
"[exec_primitive] Getting model "
- "kdu_instance: {}".format(kdu_instance)
+ "{} for the kdu_instance: {}".format(namespace, kdu_instance)
)
application_name = params["application-name"]
- actions = await libjuju.get_actions(application_name, kdu_instance)
+ actions = await libjuju.get_actions(
+ application_name=application_name, model_name=namespace
+ )
if primitive_name not in actions:
raise K8sException("Primitive {} not found".format(primitive_name))
output, status = await libjuju.execute_action(
- application_name, kdu_instance, primitive_name, **params
+ application_name=application_name,
+ model_name=namespace,
+ action_name=primitive_name,
+ **params,
)
if status != "completed":
)
if self.on_update_db:
await self.on_update_db(
- cluster_uuid, kdu_instance, filter=db_dict["filter"]
+ cluster_uuid=cluster_uuid,
+ kdu_instance=kdu_instance,
+ filter=db_dict["filter"],
)
return output
"""Introspection"""
- async def inspect_kdu(
- self,
- kdu_model: str,
- ) -> dict:
+ async def inspect_kdu(self, kdu_model: str) -> dict:
"""Inspect a KDU
Inspects a bundle and returns a dictionary of config parameters and
return kdu
- async def help_kdu(
- self,
- kdu_model: str,
- ) -> str:
+ async def help_kdu(self, kdu_model: str) -> str:
"""View the README
- If available, returns the README of the bundle.
+ If available, returns the README of the bundle.
- :param kdu_model str: The name or path of a bundle
-
- :return: If found, returns the contents of the README.
+ :param kdu_model str: The name or path of a bundle
+ f
+ :return: If found, returns the contents of the README.
"""
readme = None
kdu_instance: str,
complete_status: bool = False,
yaml_format: bool = False,
+ namespace: str = None,
**kwargs,
- ) -> dict:
+ ) -> Union[str, dict]:
"""Get the status of the KDU
Get the current status of the KDU instance.
:param kdu_instance str: The unique id of the KDU instance
:param complete_status: To get the complete_status of the KDU
:param yaml_format: To get the status in proper format for NSR record
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param: kwargs: Additional parameters
vca_id (str): VCA ID
libjuju = await self._get_libjuju(kwargs.get("vca_id"))
status = {}
- model_status = await libjuju.get_model_status(kdu_instance)
+ model_name = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
+ model_status = await libjuju.get_model_status(model_name=model_name)
if not complete_status:
for name in model_status.applications:
return status
- async def update_vca_status(self, vcastatus: dict, kdu_instance: str, **kwargs):
+ async def add_relation(
+ self, provider: RelationEndpoint, requirer: RelationEndpoint
+ ):
+ """
+ Add relation between two charmed endpoints
+
+ :param: provider: Provider relation endpoint
+ :param: requirer: Requirer relation endpoint
+ """
+ self.log.debug(f"adding new relation between {provider} and {requirer}")
+ cross_model_relation = (
+ provider.model_name != requirer.model_name
+ or provider.vca_id != requirer.vca_id
+ )
+ try:
+ if cross_model_relation:
+ # Cross-model relation
+ provider_libjuju = await self._get_libjuju(provider.vca_id)
+ requirer_libjuju = await self._get_libjuju(requirer.vca_id)
+ offer = await provider_libjuju.offer(provider)
+ if offer:
+ saas_name = await requirer_libjuju.consume(
+ requirer.model_name, offer, provider_libjuju
+ )
+ await requirer_libjuju.add_relation(
+ requirer.model_name, requirer.endpoint, saas_name
+ )
+ else:
+ # Standard relation
+ vca_id = provider.vca_id
+ model = provider.model_name
+ libjuju = await self._get_libjuju(vca_id)
+ # add juju relations between two applications
+ await libjuju.add_relation(
+ model_name=model,
+ endpoint_1=provider.endpoint,
+ endpoint_2=requirer.endpoint,
+ )
+ except Exception as e:
+ message = f"Error adding relation between {provider} and {requirer}: {e}"
+ self.log.error(message)
+ raise Exception(message=message)
+
+ async def update_vca_status(
+ self, vcastatus: dict, kdu_instance: str, namespace: str = None, **kwargs
+ ):
"""
Add all configs, actions, executed actions of all applications in a model to vcastatus dict
:param vcastatus dict: dict containing vcastatus
:param kdu_instance str: The unique id of the KDU instance
+ :param namespace str: The namespace (model) where the Bundle was deployed
:param: kwargs: Additional parameters
vca_id (str): VCA ID
:return: None
"""
+
+ model_name = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
+
libjuju = await self._get_libjuju(kwargs.get("vca_id"))
try:
- for model_name in vcastatus:
+ for vca_model_name in vcastatus:
# Adding executed actions
- vcastatus[model_name][
+ vcastatus[vca_model_name][
"executedActions"
- ] = await libjuju.get_executed_actions(kdu_instance)
+ ] = await libjuju.get_executed_actions(model_name=model_name)
- for application in vcastatus[model_name]["applications"]:
+ for application in vcastatus[vca_model_name]["applications"]:
# Adding application actions
- vcastatus[model_name]["applications"][application][
+ vcastatus[vca_model_name]["applications"][application][
"actions"
- ] = await libjuju.get_actions(application, kdu_instance)
+ ] = {}
# Adding application configs
- vcastatus[model_name]["applications"][application][
+ vcastatus[vca_model_name]["applications"][application][
"configs"
- ] = await libjuju.get_application_configs(kdu_instance, application)
+ ] = await libjuju.get_application_configs(
+ model_name=model_name, application_name=application
+ )
except Exception as e:
self.log.debug("Error in updating vca status: {}".format(str(e)))
) -> list:
"""Return a list of services of a kdu_instance"""
+ namespace = self._obtain_namespace(
+ kdu_instance=kdu_instance, namespace=namespace
+ )
+
credentials = self.get_credentials(cluster_uuid=cluster_uuid)
kubectl = self._get_kubectl(credentials)
return kubectl.get_services(
- field_selector="metadata.namespace={}".format(kdu_instance)
+ field_selector="metadata.namespace={}".format(namespace)
)
async def get_service(
"""
return "cred-{}".format(cluster_uuid)
- def get_namespace(
- self,
- cluster_uuid: str,
- ) -> str:
+ def get_namespace(self, cluster_uuid: str) -> str:
"""Get the namespace UUID
Gets the namespace's unique name
if not self.libjuju:
async with self.loading_libjuju:
vca_connection = await get_connection(self._store)
- self.libjuju = Libjuju(vca_connection, loop=self.loop, log=self.log)
+ self.libjuju = Libjuju(vca_connection, log=self.log)
return self.libjuju
else:
vca_connection = await get_connection(self._store, vca_id)
- return Libjuju(
- vca_connection,
- loop=self.loop,
- log=self.log,
- n2vc=self,
- )
+ return Libjuju(vca_connection, log=self.log, n2vc=self)
def _get_kubectl(self, credentials: str) -> Kubectl:
"""
with open(kubecfg.name, "w") as kubecfg_file:
kubecfg_file.write(credentials)
return Kubectl(config_file=kubecfg.name)
+
+ def _obtain_namespace(self, kdu_instance: str, namespace: str = None) -> str:
+ """
+ Obtain the namespace/model name to use in the instantiation of a Juju Bundle in K8s. The default namespace is
+ the kdu_instance name. However, if the user passes the namespace where he wants to deploy the bundle,
+ that namespace will be used.
+
+ :param kdu_instance: the default KDU instance name
+ :param namespace: the namespace passed by the User
+ """
+
+ # deault the namespace/model name to the kdu_instance name TODO -> this should be the real return... But
+ # once the namespace is not passed in most methods, I had to do this in another way. But I think this should
+ # be the procedure in the future return namespace if namespace else kdu_instance
+
+ # TODO -> has referred above, this should be avoided in the future, this is temporary, in order to avoid
+ # compatibility issues
+ return (
+ namespace
+ if namespace
+ else self._obtain_namespace_from_db(kdu_instance=kdu_instance)
+ )
+
+ def _obtain_namespace_from_db(self, kdu_instance: str) -> str:
+ db_nsrs = self.db.get_one(
+ table="nsrs", q_filter={"_admin.deployed.K8s.kdu-instance": kdu_instance}
+ )
+ for k8s in db_nsrs["_admin"]["deployed"]["K8s"]:
+ if k8s.get("kdu-instance") == kdu_instance:
+ return k8s.get("namespace")
+ return ""
import logging
from typing import Dict
import typing
+import uuid
+import json
+from distutils.version import LooseVersion
from kubernetes import client, config
+from kubernetes.client.api import VersionApi
from kubernetes.client.models import (
V1ClusterRole,
+ V1Role,
V1ObjectMeta,
V1PolicyRule,
V1ServiceAccount,
V1ClusterRoleBinding,
+ V1RoleBinding,
V1RoleRef,
V1Subject,
+ V1Secret,
+ V1SecretReference,
+ V1Namespace,
)
from kubernetes.client.rest import ApiException
+from n2vc.libjuju import retry_callback
from retrying_async import retry
CORE_CLIENT = "core_v1"
RBAC_CLIENT = "rbac_v1"
STORAGE_CLIENT = "storage_v1"
+CUSTOM_OBJECT_CLIENT = "custom_object"
class Kubectl:
CORE_CLIENT: client.CoreV1Api(),
RBAC_CLIENT: client.RbacAuthorizationV1Api(),
STORAGE_CLIENT: client.StorageV1Api(),
+ CUSTOM_OBJECT_CLIENT: client.CustomObjectsApi(),
}
self._configuration = config.kube_config.Configuration.get_default_copy()
self.logger = logging.getLogger("Kubectl")
)
if len(cluster_roles.items) > 0:
- raise Exception(
- "Cluster role with metadata.name={} already exists".format(name)
- )
+ raise Exception("Role with metadata.name={} already exists".format(name))
metadata = V1ObjectMeta(name=name, labels=labels, namespace=namespace)
# Cluster role
self.clients[RBAC_CLIENT].create_cluster_role(cluster_role)
+ async def create_role(
+ self,
+ name: str,
+ labels: Dict[str, str],
+ api_groups: list,
+ resources: list,
+ verbs: list,
+ namespace: str,
+ ):
+ """
+ Create a role with one PolicyRule
+
+ :param: name: Name of the namespaced Role
+ :param: labels: Labels for namespaced Role metadata
+ :param: api_groups: List with api-groups allowed in the policy rule
+ :param: resources: List with resources allowed in the policy rule
+ :param: verbs: List with verbs allowed in the policy rule
+ :param: namespace: Kubernetes namespace for Role metadata
+
+ :return: None
+ """
+
+ roles = self.clients[RBAC_CLIENT].list_namespaced_role(
+ namespace, field_selector="metadata.name={}".format(name)
+ )
+
+ if len(roles.items) > 0:
+ raise Exception("Role with metadata.name={} already exists".format(name))
+
+ metadata = V1ObjectMeta(name=name, labels=labels, namespace=namespace)
+
+ role = V1Role(
+ metadata=metadata,
+ rules=[
+ V1PolicyRule(api_groups=api_groups, resources=resources, verbs=verbs),
+ ],
+ )
+
+ self.clients[RBAC_CLIENT].create_namespaced_role(namespace, role)
+
def delete_cluster_role(self, name: str):
"""
Delete a cluster role
"""
self.clients[RBAC_CLIENT].delete_cluster_role(name)
+ def _get_kubectl_version(self):
+ version = VersionApi().get_code()
+ return "{}.{}".format(version.major, version.minor)
+
+ def _need_to_create_new_secret(self):
+ min_k8s_version = "1.24"
+ current_k8s_version = self._get_kubectl_version()
+ return LooseVersion(min_k8s_version) <= LooseVersion(current_k8s_version)
+
+ def _get_secret_name(self, service_account_name: str):
+ random_alphanum = str(uuid.uuid4())[:5]
+ return "{}-token-{}".format(service_account_name, random_alphanum)
+
+ def _create_service_account_secret(
+ self, service_account_name: str, namespace: str, secret_name: str
+ ):
+ """
+ Create a secret for the service account. K8s version >= 1.24
+
+ :param: service_account_name: Name of the service account
+ :param: namespace: Kubernetes namespace for service account metadata
+ :param: secret_name: Name of the secret
+ """
+ v1_core = self.clients[CORE_CLIENT]
+ secrets = v1_core.list_namespaced_secret(
+ namespace, field_selector="metadata.name={}".format(secret_name)
+ ).items
+
+ if len(secrets) > 0:
+ raise Exception(
+ "Secret with metadata.name={} already exists".format(secret_name)
+ )
+
+ annotations = {"kubernetes.io/service-account.name": service_account_name}
+ metadata = V1ObjectMeta(
+ name=secret_name, namespace=namespace, annotations=annotations
+ )
+ type = "kubernetes.io/service-account-token"
+ secret = V1Secret(metadata=metadata, type=type)
+ v1_core.create_namespaced_secret(namespace, secret)
+
+ def _get_secret_reference_list(self, namespace: str, secret_name: str):
+ """
+ Return a secret reference list with one secret.
+ K8s version >= 1.24
+
+ :param: namespace: Kubernetes namespace for service account metadata
+ :param: secret_name: Name of the secret
+ :rtype: list[V1SecretReference]
+ """
+ return [V1SecretReference(name=secret_name, namespace=namespace)]
+
def create_service_account(
self,
name: str,
:param: namespace: Kubernetes namespace for service account metadata
Default: kube-system
"""
- service_accounts = self.clients[CORE_CLIENT].list_namespaced_service_account(
+ v1_core = self.clients[CORE_CLIENT]
+ service_accounts = v1_core.list_namespaced_service_account(
namespace, field_selector="metadata.name={}".format(name)
)
if len(service_accounts.items) > 0:
)
metadata = V1ObjectMeta(name=name, labels=labels, namespace=namespace)
- service_account = V1ServiceAccount(metadata=metadata)
- self.clients[CORE_CLIENT].create_namespaced_service_account(
- namespace, service_account
- )
+ if self._need_to_create_new_secret():
+ secret_name = self._get_secret_name(name)
+ secrets = self._get_secret_reference_list(namespace, secret_name)
+ service_account = V1ServiceAccount(metadata=metadata, secrets=secrets)
+ v1_core.create_namespaced_service_account(namespace, service_account)
+ self._create_service_account_secret(name, namespace, secret_name)
+ else:
+ service_account = V1ServiceAccount(metadata=metadata)
+ v1_core.create_namespaced_service_account(namespace, service_account)
def delete_service_account(self, name: str, namespace: str = "kube-system"):
"""
)
self.clients[RBAC_CLIENT].create_cluster_role_binding(role_binding)
+ async def create_role_binding(
+ self,
+ name: str,
+ role_name: str,
+ sa_name: str,
+ labels: Dict[str, str],
+ namespace: str,
+ ):
+ """
+ Create a cluster role binding
+
+ :param: name: Name of the namespaced Role Binding
+ :param: role_name: Name of the namespaced Role to be bound
+ :param: sa_name: Name of the Service Account to be bound
+ :param: labels: Labels for Role Binding metadata
+ :param: namespace: Kubernetes namespace for Role Binding metadata
+
+ :return: None
+ """
+ role_bindings = self.clients[RBAC_CLIENT].list_namespaced_role_binding(
+ namespace, field_selector="metadata.name={}".format(name)
+ )
+ if len(role_bindings.items) > 0:
+ raise Exception(
+ "Role Binding with metadata.name={} already exists".format(name)
+ )
+
+ role_binding = V1RoleBinding(
+ metadata=V1ObjectMeta(name=name, labels=labels),
+ role_ref=V1RoleRef(kind="Role", name=role_name, api_group=""),
+ subjects=[
+ V1Subject(kind="ServiceAccount", name=sa_name, namespace=namespace)
+ ],
+ )
+ self.clients[RBAC_CLIENT].create_namespaced_role_binding(
+ namespace, role_binding
+ )
+
def delete_cluster_role_binding(self, name: str):
"""
Delete a cluster role binding
attempts=10,
delay=1,
fallback=Exception("Failed getting the secret from service account"),
+ callback=retry_callback,
)
async def get_secret_data(
self, name: str, namespace: str = "kube-system"
raise Exception(
"Failed getting the secret from service account {}".format(name)
)
+ # TODO: refactor to use get_secret_content
secret = v1_core.list_namespaced_secret(
namespace, field_selector="metadata.name={}".format(secret_name)
).items[0]
base64.b64decode(token).decode("utf-8"),
base64.b64decode(client_certificate_data).decode("utf-8"),
)
+
+ @retry(
+ attempts=10,
+ delay=1,
+ fallback=Exception("Failed getting data from the secret"),
+ )
+ async def get_secret_content(
+ self,
+ name: str,
+ namespace: str,
+ ) -> dict:
+ """
+ Get secret data
+
+ :param: name: Name of the secret
+ :param: namespace: Name of the namespace where the secret is stored
+
+ :return: Dictionary with secret's data
+ """
+ v1_core = self.clients[CORE_CLIENT]
+
+ secret = v1_core.read_namespaced_secret(name, namespace)
+
+ return secret.data
+
+ @retry(
+ attempts=10,
+ delay=1,
+ fallback=Exception("Failed creating the secret"),
+ )
+ async def create_secret(
+ self, name: str, data: dict, namespace: str, secret_type: str
+ ):
+ """
+ Get secret data
+
+ :param: name: Name of the secret
+ :param: data: Dict with data content. Values must be already base64 encoded
+ :param: namespace: Name of the namespace where the secret will be stored
+ :param: secret_type: Type of the secret, e.g., Opaque, kubernetes.io/service-account-token, kubernetes.io/tls
+
+ :return: None
+ """
+ v1_core = self.clients[CORE_CLIENT]
+ metadata = V1ObjectMeta(name=name, namespace=namespace)
+ secret = V1Secret(metadata=metadata, data=data, type=secret_type)
+ v1_core.create_namespaced_secret(namespace, secret)
+
+ async def create_certificate(
+ self,
+ namespace: str,
+ name: str,
+ dns_prefix: str,
+ secret_name: str,
+ usages: list,
+ issuer_name: str,
+ ):
+ """
+ Creates cert-manager certificate object
+
+ :param: namespace: Name of the namespace where the certificate and secret is stored
+ :param: name: Name of the certificate object
+ :param: dns_prefix: Prefix for the dnsNames. They will be prefixed to the common k8s svc suffixes
+ :param: secret_name: Name of the secret created by cert-manager
+ :param: usages: List of X.509 key usages
+ :param: issuer_name: Name of the cert-manager's Issuer or ClusterIssuer object
+
+ """
+ certificate_body = {
+ "apiVersion": "cert-manager.io/v1",
+ "kind": "Certificate",
+ "metadata": {"name": name, "namespace": namespace},
+ "spec": {
+ "secretName": secret_name,
+ "privateKey": {
+ "rotationPolicy": "Always",
+ "algorithm": "ECDSA",
+ "size": 256,
+ },
+ "duration": "8760h", # 1 Year
+ "renewBefore": "2208h", # 9 months
+ "subject": {"organizations": ["osm"]},
+ "commonName": "osm",
+ "isCA": False,
+ "usages": usages,
+ "dnsNames": [
+ "{}.{}".format(dns_prefix, namespace),
+ "{}.{}.svc".format(dns_prefix, namespace),
+ "{}.{}.svc.cluster".format(dns_prefix, namespace),
+ "{}.{}.svc.cluster.local".format(dns_prefix, namespace),
+ ],
+ "issuerRef": {"name": issuer_name, "kind": "ClusterIssuer"},
+ },
+ }
+ client = self.clients[CUSTOM_OBJECT_CLIENT]
+ try:
+ client.create_namespaced_custom_object(
+ group="cert-manager.io",
+ plural="certificates",
+ version="v1",
+ body=certificate_body,
+ namespace=namespace,
+ )
+ except ApiException as e:
+ info = json.loads(e.body)
+ if info.get("reason").lower() == "alreadyexists":
+ self.logger.warning("Certificate already exists: {}".format(e))
+ else:
+ raise e
+
+ async def delete_certificate(self, namespace, object_name):
+ client = self.clients[CUSTOM_OBJECT_CLIENT]
+ try:
+ client.delete_namespaced_custom_object(
+ group="cert-manager.io",
+ plural="certificates",
+ version="v1",
+ name=object_name,
+ namespace=namespace,
+ )
+ except ApiException as e:
+ info = json.loads(e.body)
+ if info.get("reason").lower() == "notfound":
+ self.logger.warning("Certificate already deleted: {}".format(e))
+ else:
+ raise e
+
+ @retry(
+ attempts=10,
+ delay=1,
+ fallback=Exception("Failed creating the namespace"),
+ )
+ async def create_namespace(self, name: str, labels: dict = None):
+ """
+ Create a namespace
+
+ :param: name: Name of the namespace to be created
+ :param: labels: Dictionary with labels for the new namespace
+
+ """
+ v1_core = self.clients[CORE_CLIENT]
+ metadata = V1ObjectMeta(name=name, labels=labels)
+ namespace = V1Namespace(
+ metadata=metadata,
+ )
+
+ try:
+ v1_core.create_namespace(namespace)
+ self.logger.debug("Namespace created: {}".format(name))
+ except ApiException as e:
+ info = json.loads(e.body)
+ if info.get("reason").lower() == "alreadyexists":
+ self.logger.warning("Namespace already exists: {}".format(e))
+ else:
+ raise e
+
+ @retry(
+ attempts=10,
+ delay=1,
+ fallback=Exception("Failed deleting the namespace"),
+ )
+ async def delete_namespace(self, name: str):
+ """
+ Delete a namespace
+
+ :param: name: Name of the namespace to be deleted
+
+ """
+ try:
+ self.clients[CORE_CLIENT].delete_namespace(name)
+ except ApiException as e:
+ if e.reason == "Not Found":
+ self.logger.warning("Namespace already deleted: {}".format(e))
import asyncio
import logging
+import os
import typing
+import yaml
import time
import juju.errors
+from juju.bundle import BundleHandler
from juju.model import Model
from juju.machine import Machine
from juju.application import Application
from juju.unit import Unit
+from juju.url import URL
+from juju.version import DEFAULT_ARCHITECTURE
from juju.client._definitions import (
FullStatus,
QueryApplicationOffersResults,
from juju.client import client
from juju import tag
+from n2vc.definitions import Offer, RelationEndpoint
from n2vc.juju_watcher import JujuModelWatcher
from n2vc.provisioner import AsyncSSHProvisioner
from n2vc.n2vc_conn import N2VCConnector
RBAC_LABEL_KEY_NAME = "rbac-id"
+@asyncio.coroutine
+def retry_callback(attempt, exc, args, kwargs, delay=0.5, *, loop):
+ # Specifically overridden from upstream implementation so it can
+ # continue to work with Python 3.10
+ yield from asyncio.sleep(attempt * delay)
+ return retry
+
+
class Libjuju:
def __init__(
self,
vca_connection: Connection,
- loop: asyncio.AbstractEventLoop = None,
log: logging.Logger = None,
n2vc: N2VCConnector = None,
):
Constructor
:param: vca_connection: n2vc.vca.connection object
- :param: loop: Asyncio loop
:param: log: Logger
:param: n2vc: N2VC object
"""
self.n2vc = n2vc
self.vca_connection = vca_connection
- self.loop = loop or asyncio.get_event_loop()
- self.loop.set_exception_handler(self.handle_exception)
- self.creating_model = asyncio.Lock(loop=self.loop)
+ self.creating_model = asyncio.Lock()
if self.vca_connection.is_default:
self.health_check_task = self._create_health_check_task()
def _create_health_check_task(self):
- return self.loop.create_task(self.health_check())
+ return asyncio.get_event_loop().create_task(self.health_check())
async def get_controller(self, timeout: float = 60.0) -> Controller:
"""
"""
controller = None
try:
- controller = Controller(loop=self.loop)
+ controller = Controller()
await asyncio.wait_for(
controller.connect(
endpoint=self.vca_connection.data.endpoints,
)
if controller:
await self.disconnect_controller(controller)
- raise JujuControllerFailedConnecting(e)
+
+ raise JujuControllerFailedConnecting(
+ f"Error connecting to Juju controller: {e}"
+ )
async def disconnect(self):
"""Disconnect"""
if controller:
await controller.disconnect()
- @retry(attempts=3, delay=5, timeout=None)
+ @retry(attempts=3, delay=5, timeout=None, callback=retry_callback)
async def add_model(self, model_name: str, cloud: VcaCloud):
"""
Create model
await self.disconnect_controller(controller)
return application_configs
- @retry(attempts=3, delay=5)
+ @retry(attempts=3, delay=5, callback=retry_callback)
async def get_model(self, controller: Controller, model_name: str) -> Model:
"""
Get model from controller
return machine_id
async def deploy(
- self, uri: str, model_name: str, wait: bool = True, timeout: float = 3600
+ self,
+ uri: str,
+ model_name: str,
+ wait: bool = True,
+ timeout: float = 3600,
+ instantiation_params: dict = None,
):
"""
Deploy bundle or charm: Similar to the juju CLI command `juju deploy`
- :param: uri: Path or Charm Store uri in which the charm or bundle can be found
- :param: model_name: Model name
- :param: wait: Indicates whether to wait or not until all applications are active
- :param: timeout: Time in seconds to wait until all applications are active
+ :param uri: Path or Charm Store uri in which the charm or bundle can be found
+ :param model_name: Model name
+ :param wait: Indicates whether to wait or not until all applications are active
+ :param timeout: Time in seconds to wait until all applications are active
+ :param instantiation_params: To be applied as overlay bundle over primary bundle.
"""
controller = await self.get_controller()
model = await self.get_model(controller, model_name)
+ overlays = []
try:
- await model.deploy(uri, trust=True)
+ await self._validate_instantiation_params(uri, model, instantiation_params)
+ overlays = self._get_overlays(model_name, instantiation_params)
+ await model.deploy(uri, trust=True, overlays=overlays)
if wait:
await JujuModelWatcher.wait_for_model(model, timeout=timeout)
self.log.debug("All units active in model {}".format(model_name))
finally:
+ self._remove_overlay_file(overlays)
await self.disconnect_model(model)
await self.disconnect_controller(controller)
+ async def _validate_instantiation_params(
+ self, uri: str, model, instantiation_params: dict
+ ) -> None:
+ """Checks if all the applications in instantiation_params
+ exist ins the original bundle.
+
+ Raises:
+ JujuApplicationNotFound if there is an invalid app in
+ the instantiation params.
+ """
+ overlay_apps = self._get_apps_in_instantiation_params(instantiation_params)
+ if not overlay_apps:
+ return
+ original_apps = await self._get_apps_in_original_bundle(uri, model)
+ if not all(app in original_apps for app in overlay_apps):
+ raise JujuApplicationNotFound(
+ "Cannot find application {} in original bundle {}".format(
+ overlay_apps, original_apps
+ )
+ )
+
+ async def _get_apps_in_original_bundle(self, uri: str, model) -> set:
+ """Bundle is downloaded in BundleHandler.fetch_plan.
+ That method takes care of opening and exception handling.
+
+ Resolve method gets all the information regarding the channel,
+ track, revision, type, source.
+
+ Returns:
+ Set with the names of the applications in original bundle.
+ """
+ url = URL.parse(uri)
+ architecture = DEFAULT_ARCHITECTURE # only AMD64 is allowed
+ res = await model.deploy_types[str(url.schema)].resolve(
+ url, architecture, entity_url=uri
+ )
+ handler = BundleHandler(model, trusted=True, forced=False)
+ await handler.fetch_plan(url, res.origin)
+ return handler.applications
+
+ def _get_apps_in_instantiation_params(self, instantiation_params: dict) -> list:
+ """Extract applications key in instantiation params.
+
+ Returns:
+ List with the names of the applications in instantiation params.
+
+ Raises:
+ JujuError if applications key is not found.
+ """
+ if not instantiation_params:
+ return []
+ try:
+ return [key for key in instantiation_params.get("applications")]
+ except Exception as e:
+ raise JujuError("Invalid overlay format. {}".format(str(e)))
+
+ def _get_overlays(self, model_name: str, instantiation_params: dict) -> list:
+ """Creates a temporary overlay file which includes the instantiation params.
+ Only one overlay file is created.
+
+ Returns:
+ List with one overlay filename. Empty list if there are no instantiation params.
+ """
+ if not instantiation_params:
+ return []
+ file_name = model_name + "-overlay.yaml"
+ self._write_overlay_file(file_name, instantiation_params)
+ return [file_name]
+
+ def _write_overlay_file(self, file_name: str, instantiation_params: dict) -> None:
+ with open(file_name, "w") as file:
+ yaml.dump(instantiation_params, file)
+
+ def _remove_overlay_file(self, overlay: list) -> None:
+ """Overlay contains either one or zero file names."""
+ if not overlay:
+ return
+ try:
+ filename = overlay[0]
+ os.remove(filename)
+ except OSError as e:
+ self.log.warning(
+ "Overlay file {} could not be removed: {}".format(filename, e)
+ )
+
async def add_unit(
self,
application_name: str,
application = self._get_application(model, application_name)
if application is not None:
-
# Checks if the given machine id in the model,
# otherwise function raises an error
_machine, _series = self._get_machine_info(model, machine_id)
try:
if application_name not in model.applications:
-
if machine_id is not None:
machine, series = self._get_machine_info(model, machine_id)
raise JujuApplicationExists(
"Application {} exists".format(application_name)
)
+ except juju.errors.JujuError as e:
+ if "already exists" in e.message:
+ raise JujuApplicationExists(
+ "Application {} exists".format(application_name)
+ )
+ else:
+ raise e
+ finally:
+ await self.disconnect_model(model)
+ await self.disconnect_controller(controller)
+
+ return application
+
+ async def upgrade_charm(
+ self,
+ application_name: str,
+ path: str,
+ model_name: str,
+ total_timeout: float = None,
+ **kwargs,
+ ):
+ """Upgrade Charm
+
+ :param: application_name: Application name
+ :param: model_name: Model name
+ :param: path: Local path to the charm
+ :param: total_timeout: Timeout for the entity to be active
+
+ :return: (str, str): (output and status)
+ """
+
+ self.log.debug(
+ "Upgrading charm {} in model {} from path {}".format(
+ application_name, model_name, path
+ )
+ )
+
+ await self.resolve_application(
+ model_name=model_name, application_name=application_name
+ )
+
+ # Get controller
+ controller = await self.get_controller()
+
+ # Get model
+ model = await self.get_model(controller, model_name)
+
+ try:
+ # Get application
+ application = self._get_application(
+ model,
+ application_name=application_name,
+ )
+ if application is None:
+ raise JujuApplicationNotFound(
+ "Cannot find application {} to upgrade".format(application_name)
+ )
+
+ await application.refresh(path=path)
+
+ self.log.debug(
+ "Wait until charm upgrade is completed for application {} (model={})".format(
+ application_name, model_name
+ )
+ )
+
+ await JujuModelWatcher.ensure_units_idle(
+ model=model, application=application
+ )
+
+ if application.status == "error":
+ error_message = "Unknown"
+ for unit in application.units:
+ if (
+ unit.workload_status == "error"
+ and unit.workload_status_message != ""
+ ):
+ error_message = unit.workload_status_message
+
+ message = "Application {} failed update in {}: {}".format(
+ application_name, model_name, error_message
+ )
+ self.log.error(message)
+ raise JujuError(message=message)
+
+ self.log.debug(
+ "Application {} is ready in model {}".format(
+ application_name, model_name
+ )
+ )
+
finally:
await self.disconnect_model(model)
await self.disconnect_controller(controller)
return application
+ async def resolve_application(self, model_name: str, application_name: str):
+ controller = await self.get_controller()
+ model = await self.get_model(controller, model_name)
+
+ try:
+ application = self._get_application(
+ model,
+ application_name=application_name,
+ )
+ if application is None:
+ raise JujuApplicationNotFound(
+ "Cannot find application {} to resolve".format(application_name)
+ )
+
+ while application.status == "error":
+ for unit in application.units:
+ if unit.workload_status == "error":
+ self.log.debug(
+ "Model {}, Application {}, Unit {} in error state, resolving".format(
+ model_name, application_name, unit.entity_id
+ )
+ )
+ try:
+ await unit.resolved(retry=False)
+ except Exception:
+ pass
+
+ await asyncio.sleep(1)
+
+ finally:
+ await self.disconnect_model(model)
+ await self.disconnect_controller(controller)
+
+ async def resolve(self, model_name: str):
+ controller = await self.get_controller()
+ model = await self.get_model(controller, model_name)
+ all_units_active = False
+ try:
+ while not all_units_active:
+ all_units_active = True
+ for application_name, application in model.applications.items():
+ if application.status == "error":
+ for unit in application.units:
+ if unit.workload_status == "error":
+ self.log.debug(
+ "Model {}, Application {}, Unit {} in error state, resolving".format(
+ model_name, application_name, unit.entity_id
+ )
+ )
+ try:
+ await unit.resolved(retry=False)
+ all_units_active = False
+ except Exception:
+ pass
+
+ if not all_units_active:
+ await asyncio.sleep(5)
+ finally:
+ await self.disconnect_model(model)
+ await self.disconnect_controller(controller)
+
async def scale_application(
self,
model_name: str,
try:
await model.add_relation(endpoint_1, endpoint_2)
except juju.errors.JujuAPIError as e:
- if "not found" in e.message:
+ if self._relation_is_not_found(e):
self.log.warning("Relation not found: {}".format(e.message))
return
- if "already exists" in e.message:
+ if self._relation_already_exist(e):
self.log.warning("Relation already exists: {}".format(e.message))
return
# another exception, raise it
await self.disconnect_model(model)
await self.disconnect_controller(controller)
+ def _relation_is_not_found(self, juju_error):
+ text = "not found"
+ return (text in juju_error.message) or (
+ juju_error.error_code and text in juju_error.error_code
+ )
+
+ def _relation_already_exist(self, juju_error):
+ text = "already exists"
+ return (text in juju_error.message) or (
+ juju_error.error_code and text in juju_error.error_code
+ )
+
+ async def offer(self, endpoint: RelationEndpoint) -> Offer:
+ """
+ Create an offer from a RelationEndpoint
+
+ :param: endpoint: Relation endpoint
+
+ :return: Offer object
+ """
+ model_name = endpoint.model_name
+ offer_name = f"{endpoint.application_name}-{endpoint.endpoint_name}"
+ controller = await self.get_controller()
+ model = None
+ try:
+ model = await self.get_model(controller, model_name)
+ await model.create_offer(endpoint.endpoint, offer_name=offer_name)
+ offer_list = await self._list_offers(model_name, offer_name=offer_name)
+ if offer_list:
+ return Offer(offer_list[0].offer_url)
+ else:
+ raise Exception("offer was not created")
+ except juju.errors.JujuError as e:
+ if "application offer already exists" not in e.message:
+ raise e
+ finally:
+ if model:
+ self.disconnect_model(model)
+ self.disconnect_controller(controller)
+
async def consume(
self,
- offer_url: str,
model_name: str,
- ):
+ offer: Offer,
+ provider_libjuju: "Libjuju",
+ ) -> str:
"""
- Adds a remote offer to the model. Relations can be created later using "juju relate".
+ Consumes a remote offer in the model. Relations can be created later using "juju relate".
- :param: offer_url: Offer Url
- :param: model_name: Model name
+ :param: model_name: Model name
+ :param: offer: Offer object to consume
+ :param: provider_libjuju: Libjuju object of the provider endpoint
:raises ParseError if there's a problem parsing the offer_url
:raises JujuError if remote offer includes and endpoint
:raises JujuAPIError if the operation is not successful
+
+ :returns: Saas name. It is the application name in the model that reference the remote application.
"""
+ saas_name = f'{offer.name}-{offer.model_name.replace("-", "")}'
+ if offer.vca_id:
+ saas_name = f"{saas_name}-{offer.vca_id}"
controller = await self.get_controller()
- model = await controller.get_model(model_name)
-
+ model = None
+ provider_controller = None
try:
- await model.consume(offer_url)
+ model = await controller.get_model(model_name)
+ provider_controller = await provider_libjuju.get_controller()
+ await model.consume(
+ offer.url, application_alias=saas_name, controller=provider_controller
+ )
+ return saas_name
finally:
- await self.disconnect_model(model)
+ if model:
+ await self.disconnect_model(model)
+ if provider_controller:
+ await provider_libjuju.disconnect_controller(provider_controller)
await self.disconnect_controller(controller)
async def destroy_model(self, model_name: str, total_timeout: float = 1800):
model = None
try:
if not await self.model_exists(model_name, controller=controller):
+ self.log.warn(f"Model {model_name} doesn't exist")
return
- self.log.debug("Destroying model {}".format(model_name))
-
+ self.log.debug(f"Getting model {model_name} to be destroyed")
model = await self.get_model(controller, model_name)
+ self.log.debug(f"Destroying manual machines in model {model_name}")
# Destroy machines that are manually provisioned
# and still are in pending state
await self._destroy_pending_machines(model, only_manual=True)
await self.disconnect_model(model)
- await self._destroy_model(
- model_name,
- controller,
+ await asyncio.wait_for(
+ self._destroy_model(model_name, controller),
timeout=total_timeout,
)
+ except Exception as e:
+ if not await self.model_exists(model_name, controller=controller):
+ self.log.warn(
+ f"Failed deleting model {model_name}: model doesn't exist"
+ )
+ return
+ self.log.warn(f"Failed deleting model {model_name}: {e}")
+ raise e
finally:
if model:
await self.disconnect_model(model)
await self.disconnect_controller(controller)
async def _destroy_model(
- self, model_name: str, controller: Controller, timeout: float = 1800
+ self,
+ model_name: str,
+ controller: Controller,
):
"""
Destroy model from controller
:param: controller: Controller object
:param: timeout: Timeout in seconds
"""
+ self.log.debug(f"Destroying model {model_name}")
- async def _destroy_model_loop(model_name: str, controller: Controller):
- while await self.model_exists(model_name, controller=controller):
+ async def _destroy_model_gracefully(model_name: str, controller: Controller):
+ self.log.info(f"Gracefully deleting model {model_name}")
+ resolved = False
+ while model_name in await controller.list_models():
+ if not resolved:
+ await self.resolve(model_name)
+ resolved = True
+ await controller.destroy_model(model_name, destroy_storage=True)
+
+ await asyncio.sleep(5)
+ self.log.info(f"Model {model_name} deleted gracefully")
+
+ async def _destroy_model_forcefully(model_name: str, controller: Controller):
+ self.log.info(f"Forcefully deleting model {model_name}")
+ while model_name in await controller.list_models():
await controller.destroy_model(
- model_name, destroy_storage=True, force=True, max_wait=0
+ model_name, destroy_storage=True, force=True, max_wait=60
)
await asyncio.sleep(5)
+ self.log.info(f"Model {model_name} deleted forcefully")
try:
- await asyncio.wait_for(
- _destroy_model_loop(model_name, controller), timeout=timeout
- )
- except asyncio.TimeoutError:
- raise Exception(
- "Timeout waiting for model {} to be destroyed".format(model_name)
- )
+ try:
+ await asyncio.wait_for(
+ _destroy_model_gracefully(model_name, controller), timeout=120
+ )
+ except asyncio.TimeoutError:
+ await _destroy_model_forcefully(model_name, controller)
+ except juju.errors.JujuError as e:
+ if any("has been removed" in error for error in e.errors):
+ return
+ if any("model not found" in error for error in e.errors):
+ return
+ raise e
async def destroy_application(
self, model_name: str, application_name: str, total_timeout: float
await self.disconnect_model(model)
await self.disconnect_controller(controller)
- def handle_exception(self, loop, context):
- # All unhandled exceptions by libjuju are handled here.
- pass
-
async def health_check(self, interval: float = 300.0):
"""
Health check to make sure controller and controller_model connections are OK
finally:
await self.disconnect_controller(controller)
- async def list_offers(self, model_name: str) -> QueryApplicationOffersResults:
- """List models with certain names
+ async def _list_offers(
+ self, model_name: str, offer_name: str = None
+ ) -> QueryApplicationOffersResults:
+ """
+ List offers within a model
:param: model_name: Model name
+ :param: offer_name: Offer name to filter.
- :return: Returns list of offers
+ :return: Returns application offers results in the model
"""
controller = await self.get_controller()
try:
- return await controller.list_offers(model_name)
+ offers = (await controller.list_offers(model_name)).results
+ if offer_name:
+ matching_offer = []
+ for offer in offers:
+ if offer.offer_name == offer_name:
+ matching_offer.append(offer)
+ break
+ offers = matching_offer
+ return offers
finally:
await self.disconnect_controller(controller)
finally:
await self.disconnect_controller(controller)
- @retry(attempts=20, delay=5, fallback=JujuLeaderUnitNotFound())
+ @retry(
+ attempts=20, delay=5, fallback=JujuLeaderUnitNotFound(), callback=retry_callback
+ )
async def _get_leader_unit(self, application: Application) -> Unit:
unit = None
for u in application.units:
class Loggable:
def __init__(self, log, log_to_console: bool = False, prefix: str = ""):
-
self._last_log_time = None # used for time increment in logging
self._log_to_console = log_to_console
self._prefix = prefix
include_thread: bool = False,
include_coroutine: bool = True,
) -> str:
-
# time increment from last log
now = time.perf_counter()
if self._last_log_time is None:
coroutine_id = ""
if include_coroutine:
try:
- if asyncio.Task.current_task() is not None:
+ if asyncio.current_task() is not None:
def print_cor_name(c):
import inspect
except Exception:
pass
- coro = asyncio.Task.current_task()._coro
+ coro = asyncio.current_task()._coro
coroutine_id = "coro-{} {}()".format(
hex(id(coro))[2:], print_cor_name(coro)
)
import abc
import asyncio
from http import HTTPStatus
+from shlex import quote
import os
import shlex
import subprocess
db: object,
fs: object,
log: object,
- loop: object,
on_update_db=None,
**kwargs,
):
:param object fs: FileSystem object managing the package artifacts (repo common
FsBase)
:param object log: the logging object to log to
- :param object loop: the loop to use for asyncio (default current thread loop)
:param on_update_db: callback called when n2vc connector updates database.
Received arguments:
table: e.g. "nsrs"
# store arguments into self
self.db = db
self.fs = fs
- self.loop = loop or asyncio.get_event_loop()
self.on_update_db = on_update_db
# generate private/public key-pair
self.log.warning("No HOME environment variable, using /tmp")
homedir = "/tmp"
sshdir = "{}/.ssh".format(homedir)
+ sshdir = os.path.realpath(os.path.normpath(os.path.abspath(sshdir)))
if not os.path.exists(sshdir):
os.mkdir(sshdir)
self.private_key_path = "{}/id_n2vc_rsa".format(sshdir)
+ self.private_key_path = os.path.realpath(
+ os.path.normpath(os.path.abspath(self.private_key_path))
+ )
self.public_key_path = "{}.pub".format(self.private_key_path)
+ self.public_key_path = os.path.realpath(
+ os.path.normpath(os.path.abspath(self.public_key_path))
+ )
# If we don't have a key generated, then we have to generate it using ssh-keygen
if not os.path.exists(self.private_key_path):
- cmd = "ssh-keygen -t {} -b {} -N '' -f {}".format(
- "rsa", "4096", self.private_key_path
+ command = "ssh-keygen -t {} -b {} -N '' -f {}".format(
+ "rsa", "4096", quote(self.private_key_path)
)
# run command with arguments
- subprocess.check_output(shlex.split(cmd))
+ args = shlex.split(command)
+ subprocess.run(args, stdout=subprocess.PIPE, stderr=subprocess.PIPE)
# Read the public key. Only one public key (one line) in the file
with open(self.public_key_path, "r") as file:
reuse_ee_id: str = None,
progress_timeout: float = None,
total_timeout: float = None,
- ) -> (str, dict):
+ ) -> tuple[str, dict]:
"""Create an Execution Environment. Returns when it is created or raises an
exception on failing
:param float total_timeout:
"""
+ @abc.abstractmethod
+ async def upgrade_charm(
+ self,
+ ee_id: str = None,
+ path: str = None,
+ charm_id: str = None,
+ charm_type: str = None,
+ timeout: float = None,
+ ) -> str:
+ """This method upgrade charms in VNFs
+
+ Args:
+ ee_id: Execution environment id
+ path: Local path to the charm
+ charm_id: charm-id
+ charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm
+ timeout: (Float) Timeout for the ns update operation
+
+ Returns:
+ The output of the update operation if status equals to "completed"
+ """
+
@abc.abstractmethod
async def exec_primitive(
self,
####################################################################################
"""
- def _get_namespace_components(self, namespace: str) -> (str, str, str, str, str):
+ def _get_namespace_components(
+ self, namespace: str
+ ) -> tuple[str, str, str, str, str]:
"""
Split namespace components
# .format(str(status.value), detailed_status, vca_status, entity_type))
try:
-
the_table = db_dict["collection"]
the_filter = db_dict["filter"]
the_path = db_dict["path"]
# convert obj to yaml
yaml_text = obj_to_yaml(obj)
# parse to dict
- return yaml.load(yaml_text, Loader=yaml.Loader)
+ return yaml.load(yaml_text, Loader=yaml.SafeLoader)
import logging
from n2vc.config import EnvironConfig
+from n2vc.definitions import RelationEndpoint
from n2vc.exceptions import (
N2VCBadArgumentsException,
N2VCException,
)
from n2vc.n2vc_conn import N2VCConnector
from n2vc.n2vc_conn import obj_to_dict, obj_to_yaml
-from n2vc.libjuju import Libjuju
+from n2vc.libjuju import Libjuju, retry_callback
from n2vc.store import MotorStore
+from n2vc.utils import get_ee_id_components, generate_random_alfanum_string
from n2vc.vca.connection import get_connection
from retrying_async import retry
+from typing import Tuple
class N2VCJujuConnector(N2VCConnector):
db: object,
fs: object,
log: object = None,
- loop: object = None,
on_update_db=None,
):
"""
:param: db: Database object from osm_common
:param: fs: Filesystem object from osm_common
:param: log: Logger
- :param: loop: Asyncio loop
:param: on_update_db: Callback function to be called for updating the database.
"""
# parent class constructor
- N2VCConnector.__init__(
- self,
- db=db,
- fs=fs,
- log=log,
- loop=loop,
- on_update_db=on_update_db,
- )
+ N2VCConnector.__init__(self, db=db, fs=fs, log=log, on_update_db=on_update_db)
# silence websocket traffic log
logging.getLogger("websockets.protocol").setLevel(logging.INFO)
db_uri = EnvironConfig(prefixes=["OSMLCM_", "OSMMON_"]).get("database_uri")
self._store = MotorStore(db_uri)
- self.loading_libjuju = asyncio.Lock(loop=self.loop)
-
+ self.loading_libjuju = asyncio.Lock()
+ self.delete_namespace_locks = {}
self.log.info("N2VC juju connector initialized")
async def get_status(
# create or reuse a new juju machine
try:
if not await libjuju.model_exists(model_name):
- await libjuju.add_model(
- model_name,
- libjuju.vca_connection.lxd_cloud,
- )
+ await libjuju.add_model(model_name, libjuju.vca_connection.lxd_cloud)
machine, new = await libjuju.create_machine(
model_name=model_name,
machine_id=machine_id,
raise N2VCException(message=message)
# new machine credentials
- credentials = {
- "hostname": machine.dns_name,
- }
+ credentials = {"hostname": machine.dns_name}
self.log.info(
"Execution environment created. ee_id: {}, credentials: {}".format(
# register machine on juju
try:
if not await libjuju.model_exists(model_name):
- await libjuju.add_model(
- model_name,
- libjuju.vca_connection.lxd_cloud,
- )
+ await libjuju.add_model(model_name, libjuju.vca_connection.lxd_cloud)
machine_id = await libjuju.provision_machine(
model_name=model_name,
hostname=hostname,
# In case of native_charm is being deployed, if JujuApplicationExists error happens
# it will try to add_unit
- @retry(attempts=3, delay=5, retry_exceptions=(N2VCApplicationExists,), timeout=None)
+ @retry(
+ attempts=3,
+ delay=5,
+ retry_exceptions=(N2VCApplicationExists,),
+ timeout=None,
+ callback=retry_callback,
+ )
async def install_configuration_sw(
self,
ee_id: str,
artifact_path = artifact_path.replace("//", "/")
# check charm path
- if not self.fs.file_exists(artifact_path, mode="dir"):
+ if not self.fs.file_exists(artifact_path):
msg = "artifact path does not exist: {}".format(artifact_path)
raise N2VCBadArgumentsException(message=msg, bad_args=["artifact_path"])
artifact_path = artifact_path.replace("//", "/")
# check charm path
- if not self.fs.file_exists(artifact_path, mode="dir"):
+ if not self.fs.file_exists(artifact_path):
msg = "artifact path does not exist: {}".format(artifact_path)
raise N2VCBadArgumentsException(message=msg, bad_args=["artifact_path"])
_, ns_id, _, _, _ = self._get_namespace_components(namespace=namespace)
model_name = "{}-k8s".format(ns_id)
if not await libjuju.model_exists(model_name):
- await libjuju.add_model(
- model_name,
- libjuju.vca_connection.k8s_cloud,
- )
+ await libjuju.add_model(model_name, libjuju.vca_connection.k8s_cloud)
application_name = self._get_application_name(namespace)
try:
self.log.info("K8s proxy charm installed")
ee_id = N2VCJujuConnector._build_ee_id(
- model_name=model_name,
- application_name=application_name,
- machine_id="k8s",
+ model_name=model_name, application_name=application_name, machine_id="k8s"
)
self._write_ee_id_db(db_dict=db_dict, ee_id=ee_id)
return await libjuju.get_metrics(model_name, application_name)
async def add_relation(
- self,
- ee_id_1: str,
- ee_id_2: str,
- endpoint_1: str,
- endpoint_2: str,
- vca_id: str = None,
+ self, provider: RelationEndpoint, requirer: RelationEndpoint
):
"""
Add relation between two charmed endpoints
- :param: ee_id_1: The id of the first execution environment
- :param: ee_id_2: The id of the second execution environment
- :param: endpoint_1: The endpoint in the first execution environment
- :param: endpoint_2: The endpoint in the second execution environment
- :param: vca_id: VCA ID
+ :param: provider: Provider relation endpoint
+ :param: requirer: Requirer relation endpoint
"""
- self.log.debug(
- "adding new relation between {} and {}, endpoints: {}, {}".format(
- ee_id_1, ee_id_2, endpoint_1, endpoint_2
- )
+ self.log.debug(f"adding new relation between {provider} and {requirer}")
+ cross_model_relation = (
+ provider.model_name != requirer.model_name
+ or provider.vca_id != requirer.vca_id
)
- libjuju = await self._get_libjuju(vca_id)
-
- # check arguments
- if not ee_id_1:
- message = "EE 1 is mandatory"
- self.log.error(message)
- raise N2VCBadArgumentsException(message=message, bad_args=["ee_id_1"])
- if not ee_id_2:
- message = "EE 2 is mandatory"
- self.log.error(message)
- raise N2VCBadArgumentsException(message=message, bad_args=["ee_id_2"])
- if not endpoint_1:
- message = "endpoint 1 is mandatory"
- self.log.error(message)
- raise N2VCBadArgumentsException(message=message, bad_args=["endpoint_1"])
- if not endpoint_2:
- message = "endpoint 2 is mandatory"
- self.log.error(message)
- raise N2VCBadArgumentsException(message=message, bad_args=["endpoint_2"])
-
- # get the model, the applications and the machines from the ee_id's
- model_1, app_1, _machine_1 = self._get_ee_id_components(ee_id_1)
- model_2, app_2, _machine_2 = self._get_ee_id_components(ee_id_2)
-
- # model must be the same
- if model_1 != model_2:
- message = "EE models are not the same: {} vs {}".format(ee_id_1, ee_id_2)
- self.log.error(message)
- raise N2VCBadArgumentsException(
- message=message, bad_args=["ee_id_1", "ee_id_2"]
- )
-
- # add juju relations between two applications
try:
- await libjuju.add_relation(
- model_name=model_1,
- endpoint_1="{}:{}".format(app_1, endpoint_1),
- endpoint_2="{}:{}".format(app_2, endpoint_2),
- )
+ if cross_model_relation:
+ # Cross-model relation
+ provider_libjuju = await self._get_libjuju(provider.vca_id)
+ requirer_libjuju = await self._get_libjuju(requirer.vca_id)
+ offer = await provider_libjuju.offer(provider)
+ if offer:
+ saas_name = await requirer_libjuju.consume(
+ requirer.model_name, offer, provider_libjuju
+ )
+ await requirer_libjuju.add_relation(
+ requirer.model_name, requirer.endpoint, saas_name
+ )
+ else:
+ # Standard relation
+ vca_id = provider.vca_id
+ model = provider.model_name
+ libjuju = await self._get_libjuju(vca_id)
+ # add juju relations between two applications
+ await libjuju.add_relation(
+ model_name=model,
+ endpoint_1=provider.endpoint,
+ endpoint_2=requirer.endpoint,
+ )
except Exception as e:
- message = "Error adding relation between {} and {}: {}".format(
- ee_id_1, ee_id_2, e
- )
+ message = f"Error adding relation between {provider} and {requirer}: {e}"
self.log.error(message)
raise N2VCException(message=message)
:param: vca_id: VCA ID
"""
self.log.info("Deleting namespace={}".format(namespace))
- libjuju = await self._get_libjuju(vca_id)
+ will_not_delete = False
+ if namespace not in self.delete_namespace_locks:
+ self.delete_namespace_locks[namespace] = asyncio.Lock()
+ delete_lock = self.delete_namespace_locks[namespace]
- # check arguments
- if namespace is None:
- raise N2VCBadArgumentsException(
- message="namespace is mandatory", bad_args=["namespace"]
- )
+ while delete_lock.locked():
+ will_not_delete = True
+ await asyncio.sleep(0.1)
- _nsi_id, ns_id, _vnf_id, _vdu_id, _vdu_count = self._get_namespace_components(
- namespace=namespace
- )
- if ns_id is not None:
- try:
- models = await libjuju.list_models(contains=ns_id)
- for model in models:
- await libjuju.destroy_model(
- model_name=model, total_timeout=total_timeout
+ if will_not_delete:
+ self.log.info("Namespace {} deleted by another worker.".format(namespace))
+ return
+
+ try:
+ async with delete_lock:
+ libjuju = await self._get_libjuju(vca_id)
+
+ # check arguments
+ if namespace is None:
+ raise N2VCBadArgumentsException(
+ message="namespace is mandatory", bad_args=["namespace"]
)
- except Exception as e:
- raise N2VCException(
- message="Error deleting namespace {} : {}".format(namespace, e)
- )
- else:
- raise N2VCBadArgumentsException(
- message="only ns_id is permitted to delete yet", bad_args=["namespace"]
- )
+ (
+ _nsi_id,
+ ns_id,
+ _vnf_id,
+ _vdu_id,
+ _vdu_count,
+ ) = self._get_namespace_components(namespace=namespace)
+ if ns_id is not None:
+ try:
+ models = await libjuju.list_models(contains=ns_id)
+ for model in models:
+ await libjuju.destroy_model(
+ model_name=model, total_timeout=total_timeout
+ )
+ except Exception as e:
+ self.log.error(f"Error deleting namespace {namespace} : {e}")
+ raise N2VCException(
+ message="Error deleting namespace {} : {}".format(
+ namespace, e
+ )
+ )
+ else:
+ raise N2VCBadArgumentsException(
+ message="only ns_id is permitted to delete yet",
+ bad_args=["namespace"],
+ )
+ except Exception as e:
+ self.log.error(f"Error deleting namespace {namespace} : {e}")
+ raise e
+ finally:
+ self.delete_namespace_locks.pop(namespace)
self.log.info("Namespace {} deleted".format(namespace))
async def delete_execution_environment(
scaling_in: bool = False,
vca_type: str = None,
vca_id: str = None,
+ application_to_delete: str = None,
):
"""
Delete an execution environment
{collection: <str>, filter: {}, path: <str>},
e.g. {collection: "nsrs", filter:
{_id: <nsd-id>, path: "_admin.deployed.VCA.3"}
- :param: total_timeout: Total timeout
- :param: scaling_in: Boolean to indicate if it is a scaling in operation
- :param: vca_type: VCA type
- :param: vca_id: VCA ID
+ :param total_timeout: Total timeout
+ :param scaling_in: Boolean to indicate if it is a scaling in operation
+ :param vca_type: VCA type
+ :param vca_id: VCA ID
+ :param application_to_delete: name of the single application to be deleted
"""
self.log.info("Deleting execution environment ee_id={}".format(ee_id))
libjuju = await self._get_libjuju(vca_id)
ee_id=ee_id
)
try:
- if not scaling_in:
- # destroy the model
- await libjuju.destroy_model(
+ if application_to_delete == application_name:
+ # destroy the application
+ await libjuju.destroy_application(
model_name=model_name,
+ application_name=application_name,
total_timeout=total_timeout,
)
+ # if model is empty delete it
+ controller = await libjuju.get_controller()
+ model = await libjuju.get_model(
+ controller=controller,
+ model_name=model_name,
+ )
+ if not model.applications:
+ self.log.info("Model {} is empty, deleting it".format(model_name))
+ await libjuju.destroy_model(
+ model_name=model_name,
+ total_timeout=total_timeout,
+ )
+ elif not scaling_in:
+ # destroy the model
+ await libjuju.destroy_model(
+ model_name=model_name, total_timeout=total_timeout
+ )
elif vca_type == "native_charm" and scaling_in:
# destroy the unit in the application
await libjuju.destroy_unit(
config=params_dict,
)
actions = await libjuju.get_actions(
- application_name=application_name,
- model_name=model_name,
+ application_name=application_name, model_name=model_name
)
self.log.debug(
"Application {} has these actions: {}".format(
machine_id=machine_id,
progress_timeout=progress_timeout,
total_timeout=total_timeout,
- **params_dict
+ **params_dict,
)
if status == "completed":
return output
else:
- raise Exception("status is not completed: {}".format(status))
+ if "output" in output:
+ raise Exception(f'{status}: {output["output"]}')
+ else:
+ raise Exception(
+ f"{status}: No further information received from action"
+ )
+
except Exception as e:
- self.log.error(
- "Error executing primitive {}: {}".format(primitive_name, e)
- )
+ self.log.error(f"Error executing primitive {primitive_name}: {e}")
raise N2VCExecutionException(
- message="Error executing primitive {} into ee={} : {}".format(
- primitive_name, ee_id, e
- ),
+ message=f"Error executing primitive {primitive_name} in ee={ee_id}: {e}",
primitive_name=primitive_name,
)
+ async def upgrade_charm(
+ self,
+ ee_id: str = None,
+ path: str = None,
+ charm_id: str = None,
+ charm_type: str = None,
+ timeout: float = None,
+ ) -> str:
+ """This method upgrade charms in VNFs
+
+ Args:
+ ee_id: Execution environment id
+ path: Local path to the charm
+ charm_id: charm-id
+ charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm
+ timeout: (Float) Timeout for the ns update operation
+
+ Returns:
+ The output of the update operation if status equals to "completed"
+
+ """
+ self.log.info("Upgrading charm: {} on ee: {}".format(path, ee_id))
+ libjuju = await self._get_libjuju(charm_id)
+
+ # check arguments
+ if ee_id is None or len(ee_id) == 0:
+ raise N2VCBadArgumentsException(
+ message="ee_id is mandatory", bad_args=["ee_id"]
+ )
+ try:
+ (
+ model_name,
+ application_name,
+ machine_id,
+ ) = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id)
+
+ except Exception:
+ raise N2VCBadArgumentsException(
+ message="ee_id={} is not a valid execution environment id".format(
+ ee_id
+ ),
+ bad_args=["ee_id"],
+ )
+
+ try:
+ await libjuju.upgrade_charm(
+ application_name=application_name,
+ path=path,
+ model_name=model_name,
+ total_timeout=timeout,
+ )
+
+ return f"Charm upgraded with application name {application_name}"
+
+ except Exception as e:
+ self.log.error("Error upgrading charm {}: {}".format(path, e))
+
+ raise N2VCException(
+ message="Error upgrading charm {} in ee={} : {}".format(path, ee_id, e)
+ )
+
async def disconnect(self, vca_id: str = None):
"""
Disconnect from VCA
if not self.libjuju:
async with self.loading_libjuju:
vca_connection = await get_connection(self._store)
- self.libjuju = Libjuju(vca_connection, loop=self.loop, log=self.log)
+ self.libjuju = Libjuju(vca_connection, log=self.log)
return self.libjuju
else:
vca_connection = await get_connection(self._store, vca_id)
- return Libjuju(
- vca_connection,
- loop=self.loop,
- log=self.log,
- n2vc=self,
- )
+ return Libjuju(vca_connection, log=self.log, n2vc=self)
def _write_ee_id_db(self, db_dict: dict, ee_id: str):
-
# write ee_id to database: _admin.deployed.VCA.x
try:
the_table = db_dict["collection"]
:return: model_name, application_name, machine_id
"""
- if ee_id is None:
- return None, None, None
-
- # split components of id
- parts = ee_id.split(".")
- model_name = parts[0]
- application_name = parts[1]
- machine_id = parts[2]
- return model_name, application_name, machine_id
+ return get_ee_id_components(ee_id)
- def _get_application_name(self, namespace: str) -> str:
- """
- Build application name from namespace
- :param namespace:
- :return: app-vnf-<vnf id>-vdu-<vdu-id>-cnt-<vdu-count>
+ @staticmethod
+ def _find_charm_level(vnf_id: str, vdu_id: str) -> str:
+ """Decides the charm level.
+ Args:
+ vnf_id (str): VNF id
+ vdu_id (str): VDU id
+
+ Returns:
+ charm_level (str): ns-level or vnf-level or vdu-level
"""
+ if vdu_id and not vnf_id:
+ raise N2VCException(message="If vdu-id exists, vnf-id should be provided.")
+ if vnf_id and vdu_id:
+ return "vdu-level"
+ if vnf_id and not vdu_id:
+ return "vnf-level"
+ if not vnf_id and not vdu_id:
+ return "ns-level"
- # TODO: Enforce the Juju 50-character application limit
+ @staticmethod
+ def _generate_backward_compatible_application_name(
+ vnf_id: str, vdu_id: str, vdu_count: str
+ ) -> str:
+ """Generate backward compatible application name
+ by limiting the app name to 50 characters.
- # split namespace components
- _, _, vnf_id, vdu_id, vdu_count = self._get_namespace_components(
- namespace=namespace
- )
+ Args:
+ vnf_id (str): VNF ID
+ vdu_id (str): VDU ID
+ vdu_count (str): vdu-count-index
+
+ Returns:
+ application_name (str): generated application name
+ """
if vnf_id is None or len(vnf_id) == 0:
vnf_id = ""
else:
else:
vdu_count = "-cnt-" + vdu_count
- application_name = "app-{}{}{}".format(vnf_id, vdu_id, vdu_count)
+ # Generate a random suffix with 5 characters (the default size used by K8s)
+ random_suffix = generate_random_alfanum_string(size=5)
+
+ application_name = "app-{}{}{}-{}".format(
+ vnf_id, vdu_id, vdu_count, random_suffix
+ )
+ return application_name
+
+ @staticmethod
+ def _get_vca_record(search_key: str, vca_records: list, vdu_id: str) -> dict:
+ """Get the correct VCA record dict depending on the search key
+
+ Args:
+ search_key (str): keyword to find the correct VCA record
+ vca_records (list): All VCA records as list
+ vdu_id (str): VDU ID
+
+ Returns:
+ vca_record (dict): Dictionary which includes the correct VCA record
+
+ """
+ return next(
+ filter(lambda record: record[search_key] == vdu_id, vca_records), {}
+ )
+
+ @staticmethod
+ def _generate_application_name(
+ charm_level: str,
+ vnfrs: dict,
+ vca_records: list,
+ vnf_count: str = None,
+ vdu_id: str = None,
+ vdu_count: str = None,
+ ) -> str:
+ """Generate application name to make the relevant charm of VDU/KDU
+ in the VNFD descriptor become clearly visible.
+ Limiting the app name to 50 characters.
+
+ Args:
+ charm_level (str): level of charm
+ vnfrs (dict): vnf record dict
+ vca_records (list): db_nsr["_admin"]["deployed"]["VCA"] as list
+ vnf_count (str): vnf count index
+ vdu_id (str): VDU ID
+ vdu_count (str): vdu count index
+
+ Returns:
+ application_name (str): generated application name
+
+ """
+ application_name = ""
+ if charm_level == "ns-level":
+ if len(vca_records) != 1:
+ raise N2VCException(message="One VCA record is expected.")
+ # Only one VCA record is expected if it's ns-level charm.
+ # Shorten the charm name to its first 40 characters.
+ charm_name = vca_records[0]["charm_name"][:40]
+ if not charm_name:
+ raise N2VCException(message="Charm name should be provided.")
+ application_name = charm_name + "-ns"
+
+ elif charm_level == "vnf-level":
+ if len(vca_records) < 1:
+ raise N2VCException(message="One or more VCA record is expected.")
+ # If VNF is scaled, more than one VCA record may be included in vca_records
+ # but ee_descriptor_id is same.
+ # Shorten the ee_descriptor_id and member-vnf-index-ref
+ # to first 12 characters.
+ application_name = (
+ vca_records[0]["ee_descriptor_id"][:12]
+ + "-"
+ + vnf_count
+ + "-"
+ + vnfrs["member-vnf-index-ref"][:12]
+ + "-vnf"
+ )
+ elif charm_level == "vdu-level":
+ if len(vca_records) < 1:
+ raise N2VCException(message="One or more VCA record is expected.")
+
+ # Charms are also used for deployments with Helm charts.
+ # If deployment unit is a Helm chart/KDU,
+ # vdu_profile_id and vdu_count will be empty string.
+ if vdu_count is None:
+ vdu_count = ""
+
+ # If vnf/vdu is scaled, more than one VCA record may be included in vca_records
+ # but ee_descriptor_id is same.
+ # Shorten the ee_descriptor_id, member-vnf-index-ref and vdu_profile_id
+ # to first 12 characters.
+ if not vdu_id:
+ raise N2VCException(message="vdu-id should be provided.")
+
+ vca_record = N2VCJujuConnector._get_vca_record(
+ "vdu_id", vca_records, vdu_id
+ )
+
+ if not vca_record:
+ vca_record = N2VCJujuConnector._get_vca_record(
+ "kdu_name", vca_records, vdu_id
+ )
+
+ application_name = (
+ vca_record["ee_descriptor_id"][:12]
+ + "-"
+ + vnf_count
+ + "-"
+ + vnfrs["member-vnf-index-ref"][:12]
+ + "-"
+ + vdu_id[:12]
+ + "-"
+ + vdu_count
+ + "-vdu"
+ )
+
+ return application_name
+
+ def _get_vnf_count_and_record(
+ self, charm_level: str, vnf_id_and_count: str
+ ) -> Tuple[str, dict]:
+ """Get the vnf count and VNF record depend on charm level
+
+ Args:
+ charm_level (str)
+ vnf_id_and_count (str)
+
+ Returns:
+ (vnf_count (str), db_vnfr(dict)) as Tuple
+
+ """
+ vnf_count = ""
+ db_vnfr = {}
+
+ if charm_level in ("vnf-level", "vdu-level"):
+ vnf_id = "-".join(vnf_id_and_count.split("-")[:-1])
+ vnf_count = vnf_id_and_count.split("-")[-1]
+ db_vnfr = self.db.get_one("vnfrs", {"_id": vnf_id})
+
+ # If the charm is ns level, it returns empty vnf_count and db_vnfr
+ return vnf_count, db_vnfr
+
+ @staticmethod
+ def _get_vca_records(charm_level: str, db_nsr: dict, db_vnfr: dict) -> list:
+ """Get the VCA records from db_nsr dict
+
+ Args:
+ charm_level (str): level of charm
+ db_nsr (dict): NS record from database
+ db_vnfr (dict): VNF record from database
+
+ Returns:
+ vca_records (list): List of VCA record dictionaries
+
+ """
+ vca_records = {}
+ if charm_level == "ns-level":
+ vca_records = list(
+ filter(
+ lambda vca_record: vca_record["target_element"] == "ns",
+ db_nsr["_admin"]["deployed"]["VCA"],
+ )
+ )
+ elif charm_level in ["vnf-level", "vdu-level"]:
+ vca_records = list(
+ filter(
+ lambda vca_record: vca_record["member-vnf-index"]
+ == db_vnfr["member-vnf-index-ref"],
+ db_nsr["_admin"]["deployed"]["VCA"],
+ )
+ )
+
+ return vca_records
+
+ def _get_application_name(self, namespace: str) -> str:
+ """Build application name from namespace
+
+ Application name structure:
+ NS level: <charm-name>-ns
+ VNF level: <ee-name>-z<vnf-ordinal-scale-number>-<vnf-profile-id>-vnf
+ VDU level: <ee-name>-z<vnf-ordinal-scale-number>-<vnf-profile-id>-
+ <vdu-profile-id>-z<vdu-ordinal-scale-number>-vdu
+
+ Application naming for backward compatibility (old structure):
+ NS level: app-<random_value>
+ VNF level: app-vnf-<vnf-id>-z<ordinal-scale-number>-<random_value>
+ VDU level: app-vnf-<vnf-id>-z<vnf-ordinal-scale-number>-vdu-
+ <vdu-id>-cnt-<vdu-count>-z<vdu-ordinal-scale-number>-<random_value>
+
+ Args:
+ namespace (str)
+
+ Returns:
+ application_name (str)
+
+ """
+ # split namespace components
+ (
+ nsi_id,
+ ns_id,
+ vnf_id_and_count,
+ vdu_id,
+ vdu_count,
+ ) = self._get_namespace_components(namespace=namespace)
+
+ if not ns_id:
+ raise N2VCException(message="ns-id should be provided.")
+
+ charm_level = self._find_charm_level(vnf_id_and_count, vdu_id)
+ db_nsr = self.db.get_one("nsrs", {"_id": ns_id})
+ vnf_count, db_vnfr = self._get_vnf_count_and_record(
+ charm_level, vnf_id_and_count
+ )
+ vca_records = self._get_vca_records(charm_level, db_nsr, db_vnfr)
+
+ if all("charm_name" in vca_record.keys() for vca_record in vca_records):
+ application_name = self._generate_application_name(
+ charm_level,
+ db_vnfr,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ else:
+ application_name = self._generate_backward_compatible_application_name(
+ vnf_id_and_count, vdu_id, vdu_count
+ )
return N2VCJujuConnector._format_app_name(application_name)
:param: vca_id: VCA ID
"""
vca_connection = await get_connection(self._store, vca_id=vca_id)
- libjuju = Libjuju(vca_connection, loop=self.loop, log=self.log, n2vc=self)
+ libjuju = Libjuju(vca_connection, log=self.log, n2vc=self)
controller = await libjuju.get_controller()
await libjuju.disconnect_controller(controller)
# limitations under the License.
import abc
-import asyncio
-from base64 import b64decode
-import re
import typing
-from Crypto.Cipher import AES
from motor.motor_asyncio import AsyncIOMotorClient
from n2vc.config import EnvironConfig
from n2vc.vca.connection_data import ConnectionData
from osm_common.dbmongo import DbMongo, DbException
+from osm_common.dbbase import Encryption
+
DB_NAME = "osm"
class MotorStore(Store):
- def __init__(self, uri: str, loop=None):
+ def __init__(self, uri: str):
"""
Constructor
:param: uri: Connection string to connect to the database.
- :param: loop: Asyncio Loop
"""
self._client = AsyncIOMotorClient(uri)
- self.loop = loop or asyncio.get_event_loop()
self._secret_key = None
self._config = EnvironConfig(prefixes=["OSMLCM_", "OSMMON_"])
+ self.encryption = Encryption(
+ uri=uri,
+ config=self._config,
+ encoding_type="utf-8",
+ logger_name="db",
+ )
@property
def _database(self):
data = await self._vca_collection.find_one({"_id": vca_id})
if not data:
raise Exception("vca with id {} not found".format(vca_id))
- await self.decrypt_fields(
+ await self.encryption.decrypt_fields(
data,
["secret", "cacert"],
schema_version=data["schema_version"],
async def _get_juju_info(self):
"""Get Juju information (the default VCA) from the admin collection"""
return await self._admin_collection.find_one({"_id": "juju"})
-
- # DECRYPT METHODS
- async def decrypt_fields(
- self,
- item: dict,
- fields: typing.List[str],
- schema_version: str = None,
- salt: str = None,
- ):
- """
- Decrypt fields
-
- Decrypt fields from a dictionary. Follows the same logic as in osm_common.
-
- :param: item: Dictionary with the keys to be decrypted
- :param: fields: List of keys to decrypt
- :param: schema version: Schema version. (i.e. 1.11)
- :param: salt: Salt for the decryption
- """
- flags = re.I
-
- async def process(_item):
- if isinstance(_item, list):
- for elem in _item:
- await process(elem)
- elif isinstance(_item, dict):
- for key, val in _item.items():
- if isinstance(val, str):
- if any(re.search(f, key, flags) for f in fields):
- _item[key] = await self.decrypt(val, schema_version, salt)
- else:
- await process(val)
-
- await process(item)
-
- async def decrypt(self, value, schema_version=None, salt=None):
- """
- Decrypt an encrypted value
- :param value: value to be decrypted. It is a base64 string
- :param schema_version: used for known encryption method used. If None or '1.0' no encryption has been done.
- If '1.1' symmetric AES encryption has been done
- :param salt: optional salt to be used
- :return: Plain content of value
- """
- await self.get_secret_key()
- if not self.secret_key or not schema_version or schema_version == "1.0":
- return value
- else:
- secret_key = self._join_secret_key(salt)
- encrypted_msg = b64decode(value)
- cipher = AES.new(secret_key)
- decrypted_msg = cipher.decrypt(encrypted_msg)
- try:
- unpadded_private_msg = decrypted_msg.decode().rstrip("\0")
- except UnicodeDecodeError:
- raise DbException(
- "Cannot decrypt information. Are you using same COMMONKEY in all OSM components?",
- http_code=500,
- )
- return unpadded_private_msg
-
- def _join_secret_key(self, update_key: typing.Any) -> bytes:
- """
- Join key with secret key
-
- :param: update_key: str or bytes with the to update
-
- :return: Joined key
- """
- return self._join_keys(update_key, self.secret_key)
-
- def _join_keys(self, key: typing.Any, secret_key: bytes) -> bytes:
- """
- Join key with secret_key
-
- :param: key: str or bytesof the key to update
- :param: secret_key: bytes of the secret key
-
- :return: Joined key
- """
- if isinstance(key, str):
- update_key_bytes = key.encode()
- else:
- update_key_bytes = key
- new_secret_key = bytearray(secret_key) if secret_key else bytearray(32)
- for i, b in enumerate(update_key_bytes):
- new_secret_key[i % 32] ^= b
- return bytes(new_secret_key)
-
- @property
- def secret_key(self):
- return self._secret_key
-
- async def get_secret_key(self):
- """
- Get secret key using the database key and the serial key in the DB
- The key is populated in the property self.secret_key
- """
- if self.secret_key:
- return
- secret_key = None
- if self.database_key:
- secret_key = self._join_keys(self.database_key, None)
- version_data = await self._admin_collection.find_one({"_id": "version"})
- if version_data and version_data.get("serial"):
- secret_key = self._join_keys(b64decode(version_data["serial"]), secret_key)
- self._secret_key = secret_key
-
- @property
- def database_key(self):
- return self._config["database_commonkey"]
--- /dev/null
+# Copyright 2021 Canonical Ltd.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+from typing import NoReturn
+from unittest import TestCase
+from unittest.mock import patch
+
+from n2vc.definitions import Offer, RelationEndpoint
+
+
+@patch("n2vc.definitions.get_ee_id_components")
+class RelationEndpointTest(TestCase):
+ def test_success(self, mock_get_ee_id_components) -> NoReturn:
+ mock_get_ee_id_components.return_value = ("model", "application", "machine_id")
+ relation_endpoint = RelationEndpoint(
+ "model.application.machine_id",
+ "vca",
+ "endpoint",
+ )
+ self.assertEqual(relation_endpoint.model_name, "model")
+ self.assertEqual(relation_endpoint.application_name, "application")
+ self.assertEqual(relation_endpoint.vca_id, "vca")
+ self.assertEqual(relation_endpoint.endpoint, "application:endpoint")
+ self.assertEqual(relation_endpoint.endpoint_name, "endpoint")
+ self.assertEqual(
+ str(relation_endpoint), "application:endpoint (model: model, vca: vca)"
+ )
+
+
+class OfferTest(TestCase):
+ def test_success(self) -> NoReturn:
+ url = "admin/test-model.my-offer"
+ offer = Offer(url)
+ self.assertEqual(offer.model_name, "test-model")
+ self.assertEqual(offer.name, "my-offer")
+ self.assertEqual(offer.username, "admin")
+ self.assertEqual(offer.url, url)
# See the License for the specific language governing permissions and
# limitations under the License.
+import json
+import os
+from time import sleep
import asynctest
import asyncio
-from unittest import mock, TestCase
-from unittest.mock import Mock
from n2vc.juju_watcher import JujuModelWatcher, entity_ready, status
from n2vc.exceptions import EntityInvalidException
from .utils import FakeN2VC, AsyncMock, Deltas, FakeWatcher
from juju.application import Application
-from juju.model import Model
+from juju.action import Action
from juju.annotation import Annotation
+from juju.client._definitions import AllWatcherNextResults
from juju.machine import Machine
-from juju.action import Action
+from juju.model import Model
+from juju.unit import Unit
+from unittest import mock, TestCase
+from unittest.mock import Mock
class JujuWatcherTest(asynctest.TestCase):
self.assertTrue(isinstance(entity_ready(entity), bool))
+@mock.patch("n2vc.juju_watcher.client.AllWatcherFacade.from_connection")
+class EntityStateTest(TestCase):
+ def setUp(self):
+ self.model = Model()
+ self.model._connector = mock.MagicMock()
+ self.loop = asyncio.new_event_loop()
+ self.application = Mock(Application)
+ self.upgrade_file = None
+ self.line_number = 1
+
+ def _fetch_next_delta(self):
+ delta = None
+ while delta is None:
+ raw_data = self.upgrade_file.readline()
+ if not raw_data:
+ raise EOFError("Log file is out of events")
+ try:
+ delta = json.loads(raw_data)
+ except ValueError:
+ continue
+
+ if delta[0] == "unit":
+ if delta[2]["life"] == "dead":
+ # Remove the unit from the application
+ for unit in self.application.units:
+ if unit.entity_id == delta[2]["name"]:
+ self.application.units.remove(unit)
+ else:
+ unit_present = False
+ for unit in self.application.units:
+ if unit.entity_id == delta[2]["name"]:
+ unit_present = True
+
+ if not unit_present:
+ print("Application gets a new unit: {}".format(delta[2]["name"]))
+ unit = Mock(Unit)
+ unit.entity_id = delta[2]["name"]
+ unit.entity_type = "unit"
+ self.application.units.append(unit)
+
+ print("{} {}".format(self.line_number, delta))
+ self.line_number = self.line_number + 1
+
+ return AllWatcherNextResults(
+ deltas=[
+ delta,
+ ]
+ )
+
+ def _ensure_state(self, filename, mock_all_watcher):
+ with open(
+ os.path.join(os.path.dirname(__file__), "testdata", filename),
+ "r",
+ ) as self.upgrade_file:
+ all_changes = AsyncMock()
+ all_changes.Next.side_effect = self._fetch_next_delta
+ mock_all_watcher.return_value = all_changes
+
+ self.loop.run_until_complete(
+ JujuModelWatcher.ensure_units_idle(
+ model=self.model, application=self.application
+ )
+ )
+
+ with self.assertRaises(EOFError, msg="Not all events consumed"):
+ change = self._fetch_next_delta()
+ print(change.deltas[0].deltas)
+
+ def _slow_changes(self):
+ sleep(0.1)
+ return AllWatcherNextResults(
+ deltas=[
+ json.loads(
+ """["unit","change",
+ {
+ "name": "app-vnf-7a49ace2b6-z0/2",
+ "application": "app-vnf-7a49ace2b6-z0",
+ "workload-status": {
+ "current": "active",
+ "message": "",
+ "since": "2022-04-26T18:50:27.579802723Z"},
+ "agent-status": {
+ "current": "idle",
+ "message": "",
+ "since": "2022-04-26T18:50:28.592142816Z"}
+ }]"""
+ ),
+ ]
+ )
+
+ def test_timeout(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "app-vnf-7a49ace2b6-z0/0"
+ unit1.entity_type = "unit"
+ self.application.units = [
+ unit1,
+ ]
+
+ all_changes = AsyncMock()
+ all_changes.Next.side_effect = self._slow_changes
+ mock_all_watcher.return_value = all_changes
+
+ with self.assertRaises(TimeoutError):
+ self.loop.run_until_complete(
+ JujuModelWatcher.wait_for_units_idle(
+ model=self.model, application=self.application, timeout=0.01
+ )
+ )
+
+ def test_machine_unit_upgrade(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "app-vnf-7a49ace2b6-z0/0"
+ unit1.entity_type = "unit"
+ unit2 = Mock(Unit)
+ unit2.entity_id = "app-vnf-7a49ace2b6-z0/1"
+ unit2.entity_type = "unit"
+ unit3 = Mock(Unit)
+ unit3.entity_id = "app-vnf-7a49ace2b6-z0/2"
+ unit3.entity_type = "unit"
+
+ self.application.units = [unit1, unit2, unit3]
+
+ self._ensure_state("upgrade-machine.log", mock_all_watcher)
+
+ def test_operator_upgrade(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "sshproxy/0"
+ unit1.entity_type = "unit"
+ self.application.units = [
+ unit1,
+ ]
+ self._ensure_state("upgrade-operator.log", mock_all_watcher)
+
+ def test_podspec_stateful_upgrade(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "mongodb/0"
+ unit1.entity_type = "unit"
+ self.application.units = [
+ unit1,
+ ]
+ self._ensure_state("upgrade-podspec-stateful.log", mock_all_watcher)
+
+ def test_podspec_stateless_upgrade(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "lcm/9"
+ unit1.entity_type = "unit"
+ self.application.units = [
+ unit1,
+ ]
+ self._ensure_state("upgrade-podspec-stateless.log", mock_all_watcher)
+
+ def test_sidecar_upgrade(self, mock_all_watcher):
+ unit1 = Mock(Unit)
+ unit1.entity_id = "kafka/0"
+ unit1.entity_type = "unit"
+ self.application.units = [
+ unit1,
+ ]
+ self._ensure_state("upgrade-sidecar.log", mock_all_watcher)
+
+
class StatusTest(TestCase):
def setUp(self):
self.model = Model()
self.fs.path = "./tmp/"
self.namespace = "testk8s"
self.cluster_id = "helm3_cluster_id"
- self.cluster_uuid = "{}:{}".format(self.namespace, self.cluster_id)
+ self.cluster_uuid = self.cluster_id
# pass fake kubectl and helm commands to make sure it does not call actual commands
K8sHelm3Connector._check_file_exists = asynctest.Mock(return_value=True)
cluster_dir = self.fs.path + self.cluster_id
self.assertEqual(
k8scluster_uuid,
- "{}:{}".format(self.namespace, self.cluster_id),
- "Check cluster_uuid format: <namespace>.<cluster_id>",
+ self.cluster_id,
+ "Check cluster_uuid",
)
self.helm_conn._get_namespaces.assert_called_once_with(self.cluster_id)
self.helm_conn._create_namespace.assert_called_once_with(
async def test_repo_add(self):
repo_name = "bitnami"
repo_url = "https://charts.bitnami.com/bitnami"
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
+ self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=(0, ""))
await self.helm_conn.repo_add(self.cluster_uuid, repo_name, repo_url)
),
)
- repo_update_command = "/usr/bin/helm3 repo update"
- repo_add_command = "/usr/bin/helm3 repo add {} {}".format(repo_name, repo_url)
+ repo_update_command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 repo update {}"
+ ).format(repo_name)
+ repo_add_command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 repo add {} {}"
+ ).format(repo_name, repo_url)
calls = self.helm_conn._local_async_exec.call_args_list
call0_kargs = calls[0][1]
self.assertEqual(
call0_kargs.get("command"),
- repo_update_command,
- "Invalid repo update command: {}".format(call0_kargs.get("command")),
+ repo_add_command,
+ "Invalid repo add command: {}".format(call0_kargs.get("command")),
)
self.assertEqual(
call0_kargs.get("env"),
self.env,
- "Invalid env for update command: {}".format(call0_kargs.get("env")),
+ "Invalid env for add command: {}".format(call0_kargs.get("env")),
)
call1_kargs = calls[1][1]
self.assertEqual(
call1_kargs.get("command"),
- repo_add_command,
- "Invalid repo add command: {}".format(call1_kargs.get("command")),
+ repo_update_command,
+ "Invalid repo update command: {}".format(call1_kargs.get("command")),
)
self.assertEqual(
call1_kargs.get("env"),
self.env,
- "Invalid env for add command: {}".format(call1_kargs.get("env")),
+ "Invalid env for update command: {}".format(call1_kargs.get("env")),
)
@asynctest.fail_on(active_handles=True)
async def test_repo_list(self):
-
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
await self.helm_conn.repo_list(self.cluster_uuid)
self.helm_conn.fs.reverse_sync.assert_called_once_with(
from_path=self.cluster_id
)
- command = "/usr/bin/helm3 repo list --output yaml"
+ command = "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 repo list --output yaml"
self.helm_conn._local_async_exec.assert_called_with(
command=command, env=self.env, raise_exception_on_error=False
)
@asynctest.fail_on(active_handles=True)
async def test_repo_remove(self):
-
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
repo_name = "bitnami"
await self.helm_conn.repo_remove(self.cluster_uuid, repo_name)
self.helm_conn.fs.reverse_sync.assert_called_once_with(
from_path=self.cluster_id
)
- command = "/usr/bin/helm3 repo remove {}".format(repo_name)
+ command = "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 repo remove {}".format(
+ repo_name
+ )
self.helm_conn._local_async_exec.assert_called_with(
command=command, env=self.env, raise_exception_on_error=True
)
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
self.helm_conn._status_kdu = asynctest.CoroutineMock(return_value=None)
self.helm_conn._store_status = asynctest.CoroutineMock()
+ self.helm_conn._repo_to_oci_url = Mock(return_value=None)
self.kdu_instance = "stable-openldap-0005399828"
self.helm_conn.generate_kdu_instance_name = Mock(return_value=self.kdu_instance)
self.helm_conn._get_namespaces = asynctest.CoroutineMock(return_value=[])
self.helm_conn._create_namespace.assert_called_once_with(
self.cluster_id, self.namespace
)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
+ self.helm_conn.fs.sync.assert_has_calls(
+ [
+ asynctest.call(from_path=self.cluster_id),
+ asynctest.call(from_path=self.cluster_id),
+ ]
+ )
+ self.helm_conn.fs.reverse_sync.assert_has_calls(
+ [
+ asynctest.call(from_path=self.cluster_id),
+ asynctest.call(from_path=self.cluster_id),
+ ]
)
self.helm_conn._store_status.assert_called_with(
cluster_id=self.cluster_id,
namespace=self.namespace,
db_dict=db_dict,
operation="install",
- run_once=True,
- check_every=0,
)
command = (
- "/usr/bin/helm3 install stable-openldap-0005399828 --atomic --output yaml "
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 "
+ "install stable-openldap-0005399828 --atomic --output yaml "
"--timeout 300s --namespace testk8s stable/openldap --version 1.2.2"
)
- self.helm_conn._local_async_exec.assert_called_once_with(
+ self.helm_conn._local_async_exec.assert_called_with(
command=command, env=self.env, raise_exception_on_error=False
)
}
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
self.helm_conn._store_status = asynctest.CoroutineMock()
+ self.helm_conn._repo_to_oci_url = Mock(return_value=None)
self.helm_conn.get_instance_info = asynctest.CoroutineMock(
return_value=instance_info
)
+ # TEST-1 (--force true)
+ await self.helm_conn.upgrade(
+ self.cluster_uuid,
+ kdu_instance,
+ kdu_model,
+ atomic=True,
+ db_dict=db_dict,
+ force=True,
+ )
+ self.helm_conn.fs.sync.assert_called_with(from_path=self.cluster_id)
+ self.helm_conn.fs.reverse_sync.assert_has_calls(
+ [
+ asynctest.call(from_path=self.cluster_id),
+ asynctest.call(from_path=self.cluster_id),
+ ]
+ )
+ self.helm_conn._store_status.assert_called_with(
+ cluster_id=self.cluster_id,
+ kdu_instance=kdu_instance,
+ namespace=self.namespace,
+ db_dict=db_dict,
+ operation="upgrade",
+ )
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config "
+ "/usr/bin/helm3 upgrade stable-openldap-0005399828 stable/openldap "
+ "--namespace testk8s --atomic --force --output yaml --timeout 300s "
+ "--reuse-values --version 1.2.3"
+ )
+ self.helm_conn._local_async_exec.assert_called_with(
+ command=command, env=self.env, raise_exception_on_error=False
+ )
+ # TEST-2 (--force false)
await self.helm_conn.upgrade(
- self.cluster_uuid, kdu_instance, kdu_model, atomic=True, db_dict=db_dict
+ self.cluster_uuid,
+ kdu_instance,
+ kdu_model,
+ atomic=True,
+ db_dict=db_dict,
)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
+ self.helm_conn.fs.sync.assert_called_with(from_path=self.cluster_id)
+ self.helm_conn.fs.reverse_sync.assert_has_calls(
+ [
+ asynctest.call(from_path=self.cluster_id),
+ asynctest.call(from_path=self.cluster_id),
+ ]
)
self.helm_conn._store_status.assert_called_with(
cluster_id=self.cluster_id,
namespace=self.namespace,
db_dict=db_dict,
operation="upgrade",
- run_once=True,
- check_every=0,
)
command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config "
"/usr/bin/helm3 upgrade stable-openldap-0005399828 stable/openldap "
- "--namespace testk8s --atomic --output yaml --timeout 300s "
- "--version 1.2.3"
+ "--namespace testk8s --atomic --output yaml --timeout 300s "
+ "--reuse-values --version 1.2.3"
)
- self.helm_conn._local_async_exec.assert_called_once_with(
+ self.helm_conn._local_async_exec.assert_called_with(
+ command=command, env=self.env, raise_exception_on_error=False
+ )
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_upgrade_namespace(self):
+ kdu_model = "stable/openldap:1.2.3"
+ kdu_instance = "stable-openldap-0005399828"
+ db_dict = {}
+ instance_info = {
+ "chart": "openldap-1.2.2",
+ "name": kdu_instance,
+ "namespace": self.namespace,
+ "revision": 1,
+ "status": "DEPLOYED",
+ }
+ self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
+ self.helm_conn._store_status = asynctest.CoroutineMock()
+ self.helm_conn._repo_to_oci_url = Mock(return_value=None)
+ self.helm_conn.get_instance_info = asynctest.CoroutineMock(
+ return_value=instance_info
+ )
+
+ await self.helm_conn.upgrade(
+ self.cluster_uuid,
+ kdu_instance,
+ kdu_model,
+ atomic=True,
+ db_dict=db_dict,
+ namespace="default",
+ )
+ self.helm_conn.fs.sync.assert_called_with(from_path=self.cluster_id)
+ self.helm_conn.fs.reverse_sync.assert_has_calls(
+ [
+ asynctest.call(from_path=self.cluster_id),
+ asynctest.call(from_path=self.cluster_id),
+ ]
+ )
+ self.helm_conn._store_status.assert_called_with(
+ cluster_id=self.cluster_id,
+ kdu_instance=kdu_instance,
+ namespace="default",
+ db_dict=db_dict,
+ operation="upgrade",
+ )
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config "
+ "/usr/bin/helm3 upgrade stable-openldap-0005399828 stable/openldap "
+ "--namespace default --atomic --output yaml --timeout 300s "
+ "--reuse-values --version 1.2.3"
+ )
+ self.helm_conn._local_async_exec.assert_called_with(
command=command, env=self.env, raise_exception_on_error=False
)
+ @asynctest.fail_on(active_handles=True)
+ async def test_scale(self):
+ kdu_model = "stable/openldap:1.2.3"
+ kdu_instance = "stable-openldap-0005399828"
+ db_dict = {}
+ instance_info = {
+ "chart": "openldap-1.2.3",
+ "name": kdu_instance,
+ "namespace": self.namespace,
+ "revision": 1,
+ "status": "DEPLOYED",
+ }
+ repo_list = [
+ {
+ "name": "stable",
+ "url": "https://kubernetes-charts.storage.googleapis.com/",
+ }
+ ]
+ kdu_values = """
+ # Default values for openldap.
+ # This is a YAML-formatted file.
+ # Declare variables to be passed into your templates.
+
+ replicaCount: 1
+ dummy-app:
+ replicas: 2
+ """
+
+ self.helm_conn.repo_list = asynctest.CoroutineMock(return_value=repo_list)
+ self.helm_conn.values_kdu = asynctest.CoroutineMock(return_value=kdu_values)
+ self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
+ self.helm_conn._store_status = asynctest.CoroutineMock()
+ self.helm_conn._repo_to_oci_url = Mock(return_value=None)
+ self.helm_conn.get_instance_info = asynctest.CoroutineMock(
+ return_value=instance_info
+ )
+
+ # TEST-1
+ await self.helm_conn.scale(
+ kdu_instance,
+ 2,
+ "",
+ kdu_model=kdu_model,
+ cluster_uuid=self.cluster_uuid,
+ atomic=True,
+ db_dict=db_dict,
+ )
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config "
+ "/usr/bin/helm3 upgrade stable-openldap-0005399828 stable/openldap "
+ "--namespace testk8s --atomic --output yaml --set replicaCount=2 --timeout 1800s "
+ "--reuse-values --version 1.2.3"
+ )
+ self.helm_conn._local_async_exec.assert_called_with(
+ command=command, env=self.env, raise_exception_on_error=False
+ )
+ # TEST-2
+ await self.helm_conn.scale(
+ kdu_instance,
+ 3,
+ "dummy-app",
+ kdu_model=kdu_model,
+ cluster_uuid=self.cluster_uuid,
+ atomic=True,
+ db_dict=db_dict,
+ )
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config "
+ "/usr/bin/helm3 upgrade stable-openldap-0005399828 stable/openldap "
+ "--namespace testk8s --atomic --output yaml --set dummy-app.replicas=3 --timeout 1800s "
+ "--reuse-values --version 1.2.3"
+ )
+ self.helm_conn._local_async_exec.assert_called_with(
+ command=command, env=self.env, raise_exception_on_error=False
+ )
+ self.helm_conn.fs.reverse_sync.assert_called_with(from_path=self.cluster_id)
+ self.helm_conn._store_status.assert_called_with(
+ cluster_id=self.cluster_id,
+ kdu_instance=kdu_instance,
+ namespace=self.namespace,
+ db_dict=db_dict,
+ operation="scale",
+ )
+
@asynctest.fail_on(active_handles=True)
async def test_rollback(self):
kdu_instance = "stable-openldap-0005399828"
await self.helm_conn.rollback(
self.cluster_uuid, kdu_instance=kdu_instance, revision=1, db_dict=db_dict
)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
+ self.helm_conn.fs.sync.assert_called_with(from_path=self.cluster_id)
self.helm_conn.fs.reverse_sync.assert_called_once_with(
from_path=self.cluster_id
)
namespace=self.namespace,
db_dict=db_dict,
operation="rollback",
- run_once=True,
- check_every=0,
)
- command = "/usr/bin/helm3 rollback stable-openldap-0005399828 1 --namespace=testk8s --wait"
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 "
+ "rollback stable-openldap-0005399828 1 --namespace=testk8s --wait"
+ )
self.helm_conn._local_async_exec.assert_called_once_with(
command=command, env=self.env, raise_exception_on_error=False
)
)
await self.helm_conn.uninstall(self.cluster_uuid, kdu_instance)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
+ self.helm_conn.fs.sync.assert_called_with(from_path=self.cluster_id)
self.helm_conn.fs.reverse_sync.assert_called_once_with(
from_path=self.cluster_id
)
- command = "/usr/bin/helm3 uninstall {} --namespace={}".format(
- kdu_instance, self.namespace
- )
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 uninstall {} --namespace={}"
+ ).format(kdu_instance, self.namespace)
self.helm_conn._local_async_exec.assert_called_once_with(
command=command, env=self.env, raise_exception_on_error=True
)
from_path=self.cluster_id
)
self.helm_conn._parse_services.assert_called_once()
- command1 = "/usr/bin/helm3 get manifest {} --namespace=testk8s".format(
- kdu_instance
- )
+ command1 = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 get manifest {} --namespace=testk8s"
+ ).format(kdu_instance)
command2 = "/usr/bin/kubectl get --namespace={} -f -".format(self.namespace)
self.helm_conn._local_async_exec_pipe.assert_called_once_with(
command1, command2, env=self.env, raise_exception_on_error=True
"https://kubernetes-charts.storage.googleapis.com/ "
"--version 1.2.4"
)
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
- )
+ self.helm_conn._local_async_exec.assert_called_with(command=command)
@asynctest.fail_on(active_handles=True)
async def test_help_kdu(self):
"https://kubernetes-charts.storage.googleapis.com/ "
"--version 1.2.4"
)
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
- )
+ self.helm_conn._local_async_exec.assert_called_with(command=command)
@asynctest.fail_on(active_handles=True)
async def test_values_kdu(self):
"https://kubernetes-charts.storage.googleapis.com/ "
"--version 1.2.4"
)
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
+ self.helm_conn._local_async_exec.assert_called_with(command=command)
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_get_values_kdu(self):
+ self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
+
+ kdu_instance = "stable-openldap-0005399828"
+ await self.helm_conn.get_values_kdu(
+ kdu_instance, self.namespace, self.env["KUBECONFIG"]
)
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 get values "
+ "stable-openldap-0005399828 --namespace=testk8s --output yaml"
+ )
+ self.helm_conn._local_async_exec.assert_called_with(command=command)
+
@asynctest.fail_on(active_handles=True)
async def test_instances_list(self):
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
await self.helm_conn._status_kdu(
- self.cluster_id, kdu_instance, self.namespace, return_text=True
- )
- command = "/usr/bin/helm3 status {} --namespace={} --output yaml".format(
- kdu_instance, self.namespace
+ self.cluster_id, kdu_instance, self.namespace, yaml_format=True
)
+ command = (
+ "env KUBECONFIG=./tmp/helm3_cluster_id/.kube/config /usr/bin/helm3 status {} --namespace={} --output yaml"
+ ).format(kdu_instance, self.namespace)
self.helm_conn._local_async_exec.assert_called_once_with(
command=command,
env=self.env,
namespace=self.namespace,
db_dict=db_dict,
operation="install",
- run_once=True,
- check_every=0,
)
self.helm_conn._status_kdu.assert_called_once_with(
cluster_id=self.cluster_id,
kdu_instance=kdu_instance,
namespace=self.namespace,
- return_text=False,
+ yaml_format=False,
)
self.helm_conn.write_app_status_to_db.assert_called_once_with(
db_dict=db_dict,
"updated": "2020-10-30 11:11:20.376744191 +0000 UTC",
}
]
+ self.helm_conn._get_namespace = Mock(return_value=self.namespace)
self.helm_conn._uninstall_sw = asynctest.CoroutineMock()
self.helm_conn.instances_list = asynctest.CoroutineMock(return_value=instances)
self.helm_conn.uninstall = asynctest.CoroutineMock()
self.helm_conn.fs.file_delete.assert_called_once_with(
self.cluster_id, ignore_non_exist=True
)
+ self.helm_conn._get_namespace.assert_called_once_with(
+ cluster_uuid=self.cluster_uuid
+ )
self.helm_conn.instances_list.assert_called_once_with(
cluster_uuid=self.cluster_uuid
)
cluster_uuid=self.cluster_uuid, kdu_instance=kdu_instance
)
self.helm_conn._uninstall_sw.assert_called_once_with(
- self.cluster_id, self.namespace
+ cluster_id=self.cluster_id, namespace=self.namespace
)
@asynctest.fail_on(active_handles=True)
)
self.helm_conn.repo_remove.assert_not_called()
self.helm_conn.repo_add.assert_called_once_with(
- self.cluster_uuid, "bitnami", "https://charts.bitnami.com/bitnami"
+ self.cluster_uuid,
+ "bitnami",
+ "https://charts.bitnami.com/bitnami",
+ cert=None,
+ user=None,
+ password=None,
+ oci=False,
)
self.assertEqual(deleted_repo_list, [], "Deleted repo list should be empty")
self.assertEqual(
+++ /dev/null
-##
-# Licensed under the Apache License, Version 2.0 (the "License"); you may
-# not use this file except in compliance with the License. You may obtain
-# a copy of the License at
-#
-# http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
-# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
-# License for the specific language governing permissions and limitations
-# under the License.
-#
-# For those usages not covered by the Apache License, Version 2.0 please
-# contact: alfonso.tiernosepulveda@telefonica.com
-##
-
-import asynctest
-import logging
-
-from asynctest.mock import Mock
-from osm_common.dbmemory import DbMemory
-from osm_common.fslocal import FsLocal
-from n2vc.k8s_helm_conn import K8sHelmConnector
-
-__author__ = "Isabel Lloret <illoret@indra.es>"
-
-
-class TestK8sHelmConn(asynctest.TestCase):
- logging.basicConfig(level=logging.DEBUG)
- logger = logging.getLogger(__name__)
- logger.setLevel(logging.DEBUG)
-
- async def setUp(self):
- self.db = Mock(DbMemory())
- self.fs = asynctest.Mock(FsLocal())
- self.fs.path = "./tmp/"
- self.namespace = "testk8s"
- self.service_account = "osm"
- self.cluster_id = "helm_cluster_id"
- self.cluster_uuid = "{}:{}".format(self.namespace, self.cluster_id)
- # pass fake kubectl and helm commands to make sure it does not call actual commands
- K8sHelmConnector._check_file_exists = asynctest.Mock(return_value=True)
- K8sHelmConnector._local_async_exec = asynctest.CoroutineMock(
- return_value=("", 0)
- )
- cluster_dir = self.fs.path + self.cluster_id
- self.kube_config = self.fs.path + self.cluster_id + "/.kube/config"
- self.helm_home = self.fs.path + self.cluster_id + "/.helm"
- self.env = {
- "HELM_HOME": "{}/.helm".format(cluster_dir),
- "KUBECONFIG": "{}/.kube/config".format(cluster_dir),
- }
- self.helm_conn = K8sHelmConnector(self.fs, self.db, log=self.logger)
- self.logger.debug("Set up executed")
-
- @asynctest.fail_on(active_handles=True)
- async def test_init_env(self):
- # TODO
- pass
-
- @asynctest.fail_on(active_handles=True)
- async def test_repo_add(self):
- repo_name = "bitnami"
- repo_url = "https://charts.bitnami.com/bitnami"
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- await self.helm_conn.repo_add(self.cluster_uuid, repo_name, repo_url)
-
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- self.assertEqual(
- self.helm_conn._local_async_exec.call_count,
- 2,
- "local_async_exec expected 2 calls, called {}".format(
- self.helm_conn._local_async_exec.call_count
- ),
- )
-
- repo_update_command = "/usr/bin/helm repo update"
- repo_add_command = "/usr/bin/helm repo add {} {}".format(repo_name, repo_url)
- calls = self.helm_conn._local_async_exec.call_args_list
- call0_kargs = calls[0][1]
- self.assertEqual(
- call0_kargs.get("command"),
- repo_update_command,
- "Invalid repo update command: {}".format(call0_kargs.get("command")),
- )
- self.assertEqual(
- call0_kargs.get("env"),
- self.env,
- "Invalid env for update command: {}".format(call0_kargs.get("env")),
- )
- call1_kargs = calls[1][1]
- self.assertEqual(
- call1_kargs.get("command"),
- repo_add_command,
- "Invalid repo add command: {}".format(call1_kargs.get("command")),
- )
- self.assertEqual(
- call1_kargs.get("env"),
- self.env,
- "Invalid env for add command: {}".format(call1_kargs.get("env")),
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_repo_list(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- await self.helm_conn.repo_list(self.cluster_uuid)
-
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- command = "/usr/bin/helm repo list --output yaml"
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, env=self.env, raise_exception_on_error=False
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_repo_remove(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- repo_name = "bitnami"
- await self.helm_conn.repo_remove(self.cluster_uuid, repo_name)
-
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- command = "/usr/bin/helm repo remove {}".format(repo_name)
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_install(self):
- kdu_model = "stable/openldap:1.2.2"
- kdu_instance = "stable-openldap-0005399828"
- db_dict = {}
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- self.helm_conn._status_kdu = asynctest.CoroutineMock(return_value=None)
- self.helm_conn._store_status = asynctest.CoroutineMock()
- self.helm_conn.generate_kdu_instance_name = Mock(return_value=kdu_instance)
-
- await self.helm_conn.install(
- self.cluster_uuid,
- kdu_model,
- kdu_instance,
- atomic=True,
- namespace=self.namespace,
- db_dict=db_dict,
- )
-
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- self.helm_conn._store_status.assert_called_with(
- cluster_id=self.cluster_id,
- kdu_instance=kdu_instance,
- namespace=self.namespace,
- db_dict=db_dict,
- operation="install",
- run_once=True,
- check_every=0,
- )
- command = (
- "/usr/bin/helm install --atomic --output yaml --timeout 300 "
- "--name=stable-openldap-0005399828 --namespace testk8s stable/openldap "
- "--version 1.2.2"
- )
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=False
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_upgrade(self):
- kdu_model = "stable/openldap:1.2.3"
- kdu_instance = "stable-openldap-0005399828"
- db_dict = {}
- instance_info = {
- "chart": "openldap-1.2.2",
- "name": kdu_instance,
- "namespace": self.namespace,
- "revision": 1,
- "status": "DEPLOYED",
- }
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- self.helm_conn._store_status = asynctest.CoroutineMock()
- self.helm_conn.get_instance_info = asynctest.CoroutineMock(
- return_value=instance_info
- )
-
- await self.helm_conn.upgrade(
- self.cluster_uuid, kdu_instance, kdu_model, atomic=True, db_dict=db_dict
- )
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- self.helm_conn._store_status.assert_called_with(
- cluster_id=self.cluster_id,
- kdu_instance=kdu_instance,
- namespace=self.namespace,
- db_dict=db_dict,
- operation="upgrade",
- run_once=True,
- check_every=0,
- )
- command = (
- "/usr/bin/helm upgrade --atomic --output yaml --timeout 300 "
- "stable-openldap-0005399828 stable/openldap --version 1.2.3"
- )
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=False
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_rollback(self):
- kdu_instance = "stable-openldap-0005399828"
- db_dict = {}
- instance_info = {
- "chart": "openldap-1.2.3",
- "name": kdu_instance,
- "namespace": self.namespace,
- "revision": 2,
- "status": "DEPLOYED",
- }
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- self.helm_conn._store_status = asynctest.CoroutineMock()
- self.helm_conn.get_instance_info = asynctest.CoroutineMock(
- return_value=instance_info
- )
-
- await self.helm_conn.rollback(
- self.cluster_uuid, kdu_instance=kdu_instance, revision=1, db_dict=db_dict
- )
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- self.helm_conn._store_status.assert_called_with(
- cluster_id=self.cluster_id,
- kdu_instance=kdu_instance,
- namespace=self.namespace,
- db_dict=db_dict,
- operation="rollback",
- run_once=True,
- check_every=0,
- )
- command = "/usr/bin/helm rollback stable-openldap-0005399828 1 --wait"
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=False
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_uninstall(self):
- kdu_instance = "stable-openldap-0005399828"
- instance_info = {
- "chart": "openldap-1.2.2",
- "name": kdu_instance,
- "namespace": self.namespace,
- "revision": 3,
- "status": "DEPLOYED",
- }
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- self.helm_conn._store_status = asynctest.CoroutineMock()
- self.helm_conn.get_instance_info = asynctest.CoroutineMock(
- return_value=instance_info
- )
-
- await self.helm_conn.uninstall(self.cluster_uuid, kdu_instance)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- command = "/usr/bin/helm delete --purge {}".format(kdu_instance)
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_get_services(self):
- kdu_instance = "test_services_1"
- service = {"name": "testservice", "type": "LoadBalancer"}
- self.helm_conn._local_async_exec_pipe = asynctest.CoroutineMock(
- return_value=("", 0)
- )
- self.helm_conn._parse_services = Mock(return_value=["testservice"])
- self.helm_conn._get_service = asynctest.CoroutineMock(return_value=service)
-
- services = await self.helm_conn.get_services(
- self.cluster_uuid, kdu_instance, self.namespace
- )
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- self.helm_conn._parse_services.assert_called_once()
- command1 = "/usr/bin/helm get manifest {} ".format(kdu_instance)
- command2 = "/usr/bin/kubectl get --namespace={} -f -".format(self.namespace)
- self.helm_conn._local_async_exec_pipe.assert_called_once_with(
- command1, command2, env=self.env, raise_exception_on_error=True
- )
- self.assertEqual(
- services, [service], "Invalid service returned from get_service"
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_get_service(self):
- service_name = "service1"
-
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
- await self.helm_conn.get_service(
- self.cluster_uuid, service_name, self.namespace
- )
-
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- command = (
- "/usr/bin/kubectl --kubeconfig=./tmp/helm_cluster_id/.kube/config "
- "--namespace=testk8s get service service1 -o=yaml"
- )
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_inspect_kdu(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- kdu_model = "stable/openldap:1.2.4"
- repo_url = "https://kubernetes-charts.storage.googleapis.com/"
- await self.helm_conn.inspect_kdu(kdu_model, repo_url)
-
- command = (
- "/usr/bin/helm inspect openldap --repo "
- "https://kubernetes-charts.storage.googleapis.com/ "
- "--version 1.2.4"
- )
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_help_kdu(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- kdu_model = "stable/openldap:1.2.4"
- repo_url = "https://kubernetes-charts.storage.googleapis.com/"
- await self.helm_conn.help_kdu(kdu_model, repo_url)
-
- command = (
- "/usr/bin/helm inspect readme openldap --repo "
- "https://kubernetes-charts.storage.googleapis.com/ "
- "--version 1.2.4"
- )
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_values_kdu(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- kdu_model = "stable/openldap:1.2.4"
- repo_url = "https://kubernetes-charts.storage.googleapis.com/"
- await self.helm_conn.values_kdu(kdu_model, repo_url)
-
- command = (
- "/usr/bin/helm inspect values openldap --repo "
- "https://kubernetes-charts.storage.googleapis.com/ "
- "--version 1.2.4"
- )
- self.helm_conn._local_async_exec.assert_called_with(
- command=command, encode_utf8=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_instances_list(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- await self.helm_conn.instances_list(self.cluster_uuid)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.reverse_sync.assert_called_once_with(
- from_path=self.cluster_id
- )
- command = "/usr/bin/helm list --output yaml"
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command, env=self.env, raise_exception_on_error=True
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_status_kdu(self):
- kdu_instance = "stable-openldap-0005399828"
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- await self.helm_conn._status_kdu(
- self.cluster_id, kdu_instance, self.namespace, return_text=True
- )
- command = "/usr/bin/helm status {} --output yaml".format(kdu_instance)
- self.helm_conn._local_async_exec.assert_called_once_with(
- command=command,
- env=self.env,
- raise_exception_on_error=True,
- show_error_log=False,
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_store_status(self):
- kdu_instance = "stable-openldap-0005399828"
- db_dict = {}
- status = {
- "info": {
- "description": "Install complete",
- "status": {
- "code": "1",
- "notes": "The openldap helm chart has been installed",
- },
- }
- }
- self.helm_conn._status_kdu = asynctest.CoroutineMock(return_value=status)
- self.helm_conn.write_app_status_to_db = asynctest.CoroutineMock(
- return_value=status
- )
-
- await self.helm_conn._store_status(
- cluster_id=self.cluster_id,
- kdu_instance=kdu_instance,
- namespace=self.namespace,
- db_dict=db_dict,
- operation="install",
- run_once=True,
- check_every=0,
- )
- self.helm_conn._status_kdu.assert_called_once_with(
- cluster_id=self.cluster_id,
- kdu_instance=kdu_instance,
- namespace=self.namespace,
- return_text=False,
- )
- self.helm_conn.write_app_status_to_db.assert_called_once_with(
- db_dict=db_dict,
- status="Install complete",
- detailed_status=str(status),
- operation="install",
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_reset_uninstall_false(self):
- self.helm_conn._uninstall_sw = asynctest.CoroutineMock()
-
- await self.helm_conn.reset(self.cluster_uuid, force=False, uninstall_sw=False)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.file_delete.assert_called_once_with(
- self.cluster_id, ignore_non_exist=True
- )
- self.helm_conn._uninstall_sw.assert_not_called()
-
- @asynctest.fail_on(active_handles=True)
- async def test_reset_uninstall(self):
- kdu_instance = "stable-openldap-0021099429"
- instances = [
- {
- "app_version": "2.4.48",
- "chart": "openldap-1.2.3",
- "name": kdu_instance,
- "namespace": self.namespace,
- "revision": "1",
- "status": "deployed",
- "updated": "2020-10-30 11:11:20.376744191 +0000 UTC",
- }
- ]
- self.helm_conn._uninstall_sw = asynctest.CoroutineMock()
- self.helm_conn.instances_list = asynctest.CoroutineMock(return_value=instances)
- self.helm_conn.uninstall = asynctest.CoroutineMock()
-
- await self.helm_conn.reset(self.cluster_uuid, force=True, uninstall_sw=True)
- self.helm_conn.fs.sync.assert_called_once_with(from_path=self.cluster_id)
- self.helm_conn.fs.file_delete.assert_called_once_with(
- self.cluster_id, ignore_non_exist=True
- )
- self.helm_conn.instances_list.assert_called_once_with(
- cluster_uuid=self.cluster_uuid
- )
- self.helm_conn.uninstall.assert_called_once_with(
- cluster_uuid=self.cluster_uuid, kdu_instance=kdu_instance
- )
- self.helm_conn._uninstall_sw.assert_called_once_with(
- self.cluster_id, self.namespace
- )
-
- @asynctest.fail_on(active_handles=True)
- async def test_uninstall_sw_namespace(self):
- self.helm_conn._local_async_exec = asynctest.CoroutineMock(return_value=("", 0))
-
- await self.helm_conn._uninstall_sw(self.cluster_id, self.namespace)
- calls = self.helm_conn._local_async_exec.call_args_list
- self.assertEqual(
- len(calls), 3, "To uninstall should have executed three commands"
- )
- call0_kargs = calls[0][1]
- command_0 = "/usr/bin/helm --kubeconfig={} --home={} reset".format(
- self.kube_config, self.helm_home
- )
- self.assertEqual(
- call0_kargs,
- {"command": command_0, "raise_exception_on_error": True, "env": self.env},
- "Invalid args for first call to local_exec",
- )
- call1_kargs = calls[1][1]
- command_1 = (
- "/usr/bin/kubectl --kubeconfig={} delete "
- "clusterrolebinding.rbac.authorization.k8s.io/osm-tiller-cluster-rule".format(
- self.kube_config
- )
- )
- self.assertEqual(
- call1_kargs,
- {"command": command_1, "raise_exception_on_error": False, "env": self.env},
- "Invalid args for second call to local_exec",
- )
- call2_kargs = calls[2][1]
- command_2 = (
- "/usr/bin/kubectl --kubeconfig={} --namespace kube-system delete "
- "serviceaccount/{}".format(self.kube_config, self.service_account)
- )
- self.assertEqual(
- call2_kargs,
- {"command": command_2, "raise_exception_on_error": False, "env": self.env},
- "Invalid args for third call to local_exec",
- )
import logging
import asynctest
from unittest.mock import Mock
+from n2vc.definitions import Offer, RelationEndpoint
from n2vc.k8s_juju_conn import K8sJujuConnector, RBAC_LABEL_KEY_NAME
from osm_common import fslocal
from .utils import kubeconfig, FakeModel, FakeFileWrapper, AsyncMock, FakeApplication
-from n2vc.exceptions import (
- MethodNotImplemented,
- K8sException,
-)
+from n2vc.exceptions import MethodNotImplemented, K8sException
from n2vc.vca.connection_data import ConnectionData
)
logging.disable(logging.CRITICAL)
+ self.kdu_name = "kdu_name"
+ self.kdu_instance = "{}-{}".format(self.kdu_name, "id")
+ self.default_namespace = self.kdu_instance
+
self.k8s_juju_conn = K8sJujuConnector(
fs=fslocal.FsLocal(),
db=self.db,
log=None,
- loop=self.loop,
on_update_db=None,
)
self.k8s_juju_conn._store.get_vca_id.return_value = None
self.kubectl.get_services.return_value = [{}]
self.k8s_juju_conn._get_kubectl = Mock()
self.k8s_juju_conn._get_kubectl.return_value = self.kubectl
+ self.k8s_juju_conn._obtain_namespace_from_db = Mock(
+ return_value=self.default_namespace
+ )
class InitEnvTest(K8sJujuConnTestCase):
uuid, created = self.loop.run_until_complete(
self.k8s_juju_conn.init_env(k8s_creds=kubeconfig)
)
-
self.assertIsNone(created)
self.assertIsNone(uuid)
+ self.kubectl.create_cluster_role.assert_called_once()
+ self.kubectl.create_service_account.assert_called_once()
+ self.kubectl.create_cluster_role_binding.assert_called_once()
+ self.kubectl.get_default_storage_class.assert_called_once()
+ self.kubectl.delete_cluster_role.assert_called_once()
+ self.kubectl.delete_service_account.assert_called_once()
+ self.kubectl.delete_cluster_role_binding.assert_called_once()
self.k8s_juju_conn.libjuju.add_k8s.assert_called_once()
self.local_bundle = "bundle"
self.cs_bundle = "cs:bundle"
self.http_bundle = "https://example.com/bundle.yaml"
- self.kdu_name = "kdu_name"
self.cluster_uuid = "cluster"
- self.kdu_instance = "{}-{}".format(self.kdu_name, "id")
self.k8s_juju_conn.libjuju.add_model = AsyncMock()
self.k8s_juju_conn.libjuju.deploy = AsyncMock()
kdu_name=self.kdu_name,
db_dict=self.db_dict,
timeout=1800,
+ params=None,
)
)
self.assertEqual(mock_chdir.call_count, 2)
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
"local:{}".format(self.local_bundle),
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=None,
)
def test_success_cs(self, mock_chdir):
kdu_name=self.kdu_name,
db_dict=self.db_dict,
timeout=1800,
+ params={},
)
)
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
self.cs_bundle,
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=None,
)
def test_success_http(self, mock_chdir):
+ params = {"overlay": {"applications": {"squid": {"scale": 2}}}}
self.loop.run_until_complete(
self.k8s_juju_conn.install(
self.cluster_uuid,
kdu_name=self.kdu_name,
db_dict=self.db_dict,
timeout=1800,
+ params=params,
)
)
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
self.http_bundle,
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=params.get("overlay"),
)
def test_success_not_kdu_name(self, mock_chdir):
+ params = {"some_key": {"applications": {"squid": {"scale": 2}}}}
self.loop.run_until_complete(
self.k8s_juju_conn.install(
self.cluster_uuid,
atomic=True,
db_dict=self.db_dict,
timeout=1800,
+ params=params,
)
)
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
self.cs_bundle,
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=None,
)
def test_missing_db_dict(self, mock_chdir):
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
self.cs_bundle,
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=None,
)
def test_missing_bundle(self, mock_chdir):
self.k8s_juju_conn.libjuju.add_model.assert_called_once()
self.k8s_juju_conn.libjuju.deploy.assert_called_once_with(
"local:{}".format(self.local_bundle),
- model_name=self.kdu_instance,
+ model_name=self.default_namespace,
wait=True,
timeout=1800,
+ instantiation_params=None,
)
super(ExecPrimitivesTest, self).setUp()
self.action_name = "touch"
self.application_name = "myapp"
- self.model_name = "model"
self.k8s_juju_conn.libjuju.get_actions = AsyncMock()
self.k8s_juju_conn.libjuju.execute_action = AsyncMock()
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, self.action_name, params=params
+ "cluster", self.kdu_instance, self.action_name, params=params
)
)
self.assertEqual(output, "success")
+ self.k8s_juju_conn._obtain_namespace_from_db.assert_called_once_with(
+ kdu_instance=self.kdu_instance
+ )
self.k8s_juju_conn.libjuju.get_actions.assert_called_once_with(
- self.application_name, self.model_name
+ application_name=self.application_name, model_name=self.default_namespace
)
self.k8s_juju_conn.libjuju.execute_action.assert_called_once_with(
- self.application_name, self.model_name, self.action_name, **params
+ application_name=self.application_name,
+ model_name=self.default_namespace,
+ action_name=self.action_name,
+ **params
)
def test_exception(self):
with self.assertRaises(Exception):
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, self.action_name, params=params
+ "cluster", self.kdu_instance, self.action_name, params=params
)
)
self.assertIsNone(output)
+ self.k8s_juju_conn._obtain_namespace_from_db.assert_called_once_with(
+ kdu_instance=self.kdu_instance
+ )
self.k8s_juju_conn.libjuju.get_actions.assert_called_once_with(
- self.application_name, self.model_name
+ application_name=self.application_name, model_name=self.default_namespace
)
self.k8s_juju_conn.libjuju.execute_action.assert_called_once_with(
- self.application_name, self.model_name, self.action_name, **params
+ application_name=self.application_name,
+ model_name=self.default_namespace,
+ action_name=self.action_name,
+ **params
)
def test_missing_application_name_in_params(self):
with self.assertRaises(K8sException):
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, self.action_name, params=params
+ "cluster", self.kdu_instance, self.action_name, params=params
)
)
with self.assertRaises(K8sException):
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, self.action_name
+ "cluster", self.kdu_instance, self.action_name
)
)
with self.assertRaises(K8sException):
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, "non-existing-action", params=params
+ "cluster", self.kdu_instance, "non-existing-action", params=params
)
)
self.assertIsNone(output)
+ self.k8s_juju_conn._obtain_namespace_from_db.assert_called_once_with(
+ kdu_instance=self.kdu_instance
+ )
self.k8s_juju_conn.libjuju.get_actions.assert_called_once_with(
- self.application_name, self.model_name
+ application_name=self.application_name, model_name=self.default_namespace
)
self.k8s_juju_conn.libjuju.execute_action.assert_not_called()
with self.assertRaises(K8sException):
output = self.loop.run_until_complete(
self.k8s_juju_conn.exec_primitive(
- "cluster", self.model_name, self.action_name, params=params
+ "cluster", self.kdu_instance, self.action_name, params=params
)
)
self.assertIsNone(output)
+ self.k8s_juju_conn._obtain_namespace_from_db.assert_called_once_with(
+ kdu_instance=self.kdu_instance
+ )
self.k8s_juju_conn.libjuju.get_actions.assert_called_once_with(
- self.application_name, self.model_name
+ application_name=self.application_name, model_name=self.default_namespace
)
self.k8s_juju_conn.libjuju.execute_action.assert_called_once_with(
- self.application_name, self.model_name, self.action_name, **params
+ application_name=self.application_name,
+ model_name=self.default_namespace,
+ action_name=self.action_name,
+ **params
)
def setUp(self):
super(UpdateVcaStatusTest, self).setUp()
self.vcaStatus = {"model": {"applications": {"app": {"actions": {}}}}}
- self.kdu_name = "kdu_name"
- self.kdu_instance = "{}-{}".format(self.kdu_name, "id")
self.k8s_juju_conn.libjuju.get_executed_actions = AsyncMock()
self.k8s_juju_conn.libjuju.get_actions = AsyncMock()
self.k8s_juju_conn.libjuju.get_application_configs = AsyncMock()
self.k8s_juju_conn.update_vca_status(self.vcaStatus, self.kdu_instance)
)
self.k8s_juju_conn.libjuju.get_executed_actions.assert_called_once()
- self.k8s_juju_conn.libjuju.get_actions.assert_called_once()
self.k8s_juju_conn.libjuju.get_application_configs.assert_called_once()
def test_exception(self):
self.k8s_juju_conn.update_vca_status(self.vcaStatus, self.kdu_instance)
)
self.k8s_juju_conn.libjuju.get_executed_actions.assert_not_called()
- self.k8s_juju_conn.libjuju.get_actions.assert_not_called_once()
self.k8s_juju_conn.libjuju.get_application_configs.assert_not_called_once()
)
self.assertIsNone(status)
self.k8s_juju_conn.libjuju.get_model_status.assert_called_once()
+
+
+class AddRelationTest(K8sJujuConnTestCase):
+ def setUp(self):
+ super(AddRelationTest, self).setUp()
+ self.k8s_juju_conn.libjuju.add_relation = AsyncMock()
+ self.k8s_juju_conn.libjuju.offer = AsyncMock()
+ self.k8s_juju_conn.libjuju.get_controller = AsyncMock()
+ self.k8s_juju_conn.libjuju.consume = AsyncMock()
+
+ def test_standard_relation_same_model_and_controller(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint1")
+ relation_endpoint_2 = RelationEndpoint("model-1.app2.1", None, "endpoint2")
+ self.loop.run_until_complete(
+ self.k8s_juju_conn.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.k8s_juju_conn.libjuju.add_relation.assert_called_once_with(
+ model_name="model-1",
+ endpoint_1="app1:endpoint1",
+ endpoint_2="app2:endpoint2",
+ )
+ self.k8s_juju_conn.libjuju.offer.assert_not_called()
+ self.k8s_juju_conn.libjuju.consume.assert_not_called()
+
+ def test_cmr_relation_same_controller(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint")
+ relation_endpoint_2 = RelationEndpoint("model-2.app2.1", None, "endpoint")
+ offer = Offer("admin/model-1.app1")
+ self.k8s_juju_conn.libjuju.offer.return_value = offer
+ self.k8s_juju_conn.libjuju.consume.return_value = "saas"
+ self.loop.run_until_complete(
+ self.k8s_juju_conn.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.k8s_juju_conn.libjuju.offer.assert_called_once_with(relation_endpoint_1)
+ self.k8s_juju_conn.libjuju.consume.assert_called_once()
+ self.k8s_juju_conn.libjuju.add_relation.assert_called_once_with(
+ "model-2", "app2:endpoint", "saas"
+ )
+
+ def test_cmr_relation_different_controller(self):
+ self.k8s_juju_conn._get_libjuju = AsyncMock(
+ return_value=self.k8s_juju_conn.libjuju
+ )
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", "vca-id-1", "endpoint")
+ relation_endpoint_2 = RelationEndpoint("model-1.app2.1", "vca-id-2", "endpoint")
+ offer = Offer("admin/model-1.app1")
+ self.k8s_juju_conn.libjuju.offer.return_value = offer
+ self.k8s_juju_conn.libjuju.consume.return_value = "saas"
+ self.loop.run_until_complete(
+ self.k8s_juju_conn.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.k8s_juju_conn.libjuju.offer.assert_called_once_with(relation_endpoint_1)
+ self.k8s_juju_conn.libjuju.consume.assert_called_once()
+ self.k8s_juju_conn.libjuju.add_relation.assert_called_once_with(
+ "model-1", "app2:endpoint", "saas"
+ )
+
+ def test_relation_exception(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint")
+ relation_endpoint_2 = RelationEndpoint("model-2.app2.1", None, "endpoint")
+ self.k8s_juju_conn.libjuju.offer.side_effect = Exception()
+ with self.assertRaises(Exception):
+ self.loop.run_until_complete(
+ self.k8s_juju_conn.add_relation(
+ relation_endpoint_1, relation_endpoint_2
+ )
+ )
# See the License for the specific language governing permissions and
# limitations under the License.
+import asynctest
+import yaml
+import os
from unittest import TestCase, mock
-from n2vc.kubectl import Kubectl, CORE_CLIENT
+from n2vc.kubectl import Kubectl, CORE_CLIENT, CUSTOM_OBJECT_CLIENT
from n2vc.utils import Dict
from kubernetes.client.rest import ApiException
+from kubernetes.client import (
+ V1ObjectMeta,
+ V1Secret,
+ V1ServiceAccount,
+ V1SecretReference,
+ V1Role,
+ V1RoleBinding,
+ V1RoleRef,
+ V1Subject,
+ V1PolicyRule,
+ V1Namespace,
+)
class FakeK8sResourceMetadata:
return self._items
+class FakeK8sServiceAccountsList:
+ def __init__(self, items=[]):
+ self._items = items
+
+ @property
+ def items(self):
+ return self._items
+
+
+class FakeK8sSecretList:
+ def __init__(self, items=[]):
+ self._items = items
+
+ @property
+ def items(self):
+ return self._items
+
+
+class FakeK8sRoleList:
+ def __init__(self, items=[]):
+ self._items = items
+
+ @property
+ def items(self):
+ return self._items
+
+
+class FakeK8sRoleBindingList:
+ def __init__(self, items=[]):
+ self._items = items
+
+ @property
+ def items(self):
+ return self._items
+
+
+class FakeK8sVersionApiCode:
+ def __init__(self, major: str, minor: str):
+ self._major = major
+ self._minor = minor
+
+ @property
+ def major(self):
+ return self._major
+
+ @property
+ def minor(self):
+ return self._minor
+
+
fake_list_services = Dict(
{
"items": [
sc_name = kubectl.get_default_storage_class()
self.assertEqual(sc_name, self.default_sc_name)
mock_list_storage_class.assert_called_once()
+
+
+@mock.patch("kubernetes.client.VersionApi.get_code")
+@mock.patch("kubernetes.client.CoreV1Api.list_namespaced_secret")
+@mock.patch("kubernetes.client.CoreV1Api.create_namespaced_secret")
+@mock.patch("kubernetes.client.CoreV1Api.create_namespaced_service_account")
+@mock.patch("kubernetes.client.CoreV1Api.list_namespaced_service_account")
+class CreateServiceAccountClass(KubectlTestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateServiceAccountClass, self).setUp()
+ self.service_account_name = "Service_account"
+ self.labels = {"Key1": "Value1", "Key2": "Value2"}
+ self.namespace = "kubernetes"
+ self.token_id = "abc12345"
+ self.kubectl = Kubectl()
+
+ def assert_create_secret(self, mock_create_secret, secret_name):
+ annotations = {"kubernetes.io/service-account.name": self.service_account_name}
+ secret_metadata = V1ObjectMeta(
+ name=secret_name, namespace=self.namespace, annotations=annotations
+ )
+ secret_type = "kubernetes.io/service-account-token"
+ secret = V1Secret(metadata=secret_metadata, type=secret_type)
+ mock_create_secret.assert_called_once_with(self.namespace, secret)
+
+ def assert_create_service_account_v_1_24(
+ self, mock_create_service_account, secret_name
+ ):
+ sevice_account_metadata = V1ObjectMeta(
+ name=self.service_account_name, labels=self.labels, namespace=self.namespace
+ )
+ secrets = [V1SecretReference(name=secret_name, namespace=self.namespace)]
+ service_account = V1ServiceAccount(
+ metadata=sevice_account_metadata, secrets=secrets
+ )
+ mock_create_service_account.assert_called_once_with(
+ self.namespace, service_account
+ )
+
+ def assert_create_service_account_v_1_23(self, mock_create_service_account):
+ metadata = V1ObjectMeta(
+ name=self.service_account_name, labels=self.labels, namespace=self.namespace
+ )
+ service_account = V1ServiceAccount(metadata=metadata)
+ mock_create_service_account.assert_called_once_with(
+ self.namespace, service_account
+ )
+
+ @mock.patch("n2vc.kubectl.uuid.uuid4")
+ def test_secret_is_created_when_k8s_1_24(
+ self,
+ mock_uuid4,
+ mock_list_service_account,
+ mock_create_service_account,
+ mock_create_secret,
+ mock_list_secret,
+ mock_version,
+ ):
+ mock_list_service_account.return_value = FakeK8sServiceAccountsList(items=[])
+ mock_list_secret.return_value = FakeK8sSecretList(items=[])
+ mock_version.return_value = FakeK8sVersionApiCode("1", "24")
+ mock_uuid4.return_value = self.token_id
+ self.kubectl.create_service_account(
+ self.service_account_name, self.labels, self.namespace
+ )
+ secret_name = "{}-token-{}".format(self.service_account_name, self.token_id[:5])
+ self.assert_create_service_account_v_1_24(
+ mock_create_service_account, secret_name
+ )
+ self.assert_create_secret(mock_create_secret, secret_name)
+
+ def test_secret_is_not_created_when_k8s_1_23(
+ self,
+ mock_list_service_account,
+ mock_create_service_account,
+ mock_create_secret,
+ mock_list_secret,
+ mock_version,
+ ):
+ mock_list_service_account.return_value = FakeK8sServiceAccountsList(items=[])
+ mock_version.return_value = FakeK8sVersionApiCode("1", "23+")
+ self.kubectl.create_service_account(
+ self.service_account_name, self.labels, self.namespace
+ )
+ self.assert_create_service_account_v_1_23(mock_create_service_account)
+ mock_create_secret.assert_not_called()
+ mock_list_secret.assert_not_called()
+
+ def test_raise_exception_if_service_account_already_exists(
+ self,
+ mock_list_service_account,
+ mock_create_service_account,
+ mock_create_secret,
+ mock_list_secret,
+ mock_version,
+ ):
+ mock_list_service_account.return_value = FakeK8sServiceAccountsList(items=[1])
+ with self.assertRaises(Exception) as context:
+ self.kubectl.create_service_account(
+ self.service_account_name, self.labels, self.namespace
+ )
+ self.assertTrue(
+ "Service account with metadata.name={} already exists".format(
+ self.service_account_name
+ )
+ in str(context.exception)
+ )
+ mock_create_service_account.assert_not_called()
+ mock_create_secret.assert_not_called()
+
+ @mock.patch("n2vc.kubectl.uuid.uuid4")
+ def test_raise_exception_if_secret_already_exists(
+ self,
+ mock_uuid4,
+ mock_list_service_account,
+ mock_create_service_account,
+ mock_create_secret,
+ mock_list_secret,
+ mock_version,
+ ):
+ mock_list_service_account.return_value = FakeK8sServiceAccountsList(items=[])
+ mock_list_secret.return_value = FakeK8sSecretList(items=[1])
+ mock_version.return_value = FakeK8sVersionApiCode("1", "24+")
+ mock_uuid4.return_value = self.token_id
+ with self.assertRaises(Exception) as context:
+ self.kubectl.create_service_account(
+ self.service_account_name, self.labels, self.namespace
+ )
+ self.assertTrue(
+ "Secret with metadata.name={}-token-{} already exists".format(
+ self.service_account_name, self.token_id[:5]
+ )
+ in str(context.exception)
+ )
+ mock_create_service_account.assert_called()
+ mock_create_secret.assert_not_called()
+
+
+@mock.patch("kubernetes.client.CustomObjectsApi.create_namespaced_custom_object")
+class CreateCertificateClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateCertificateClass, self).setUp()
+ self.namespace = "osm"
+ self.name = "test-cert"
+ self.dns_prefix = "*"
+ self.secret_name = "test-cert-secret"
+ self.usages = ["server auth"]
+ self.issuer_name = "ca-issuer"
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_certificate_is_created(
+ self,
+ mock_create_certificate,
+ ):
+ with open(
+ os.path.join(
+ os.path.dirname(__file__), "testdata", "test_certificate.yaml"
+ ),
+ "r",
+ ) as test_certificate:
+ certificate_body = yaml.safe_load(test_certificate.read())
+ print(certificate_body)
+ await self.kubectl.create_certificate(
+ namespace=self.namespace,
+ name=self.name,
+ dns_prefix=self.dns_prefix,
+ secret_name=self.secret_name,
+ usages=self.usages,
+ issuer_name=self.issuer_name,
+ )
+ mock_create_certificate.assert_called_once_with(
+ group="cert-manager.io",
+ plural="certificates",
+ version="v1",
+ body=certificate_body,
+ namespace=self.namespace,
+ )
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_no_exception_if_alreadyexists(
+ self,
+ mock_create_certificate,
+ ):
+ api_exception = ApiException()
+ api_exception.body = '{"reason": "AlreadyExists"}'
+ self.kubectl.clients[
+ CUSTOM_OBJECT_CLIENT
+ ].create_namespaced_custom_object.side_effect = api_exception
+ raised = False
+ try:
+ await self.kubectl.create_certificate(
+ namespace=self.namespace,
+ name=self.name,
+ dns_prefix=self.dns_prefix,
+ secret_name=self.secret_name,
+ usages=self.usages,
+ issuer_name=self.issuer_name,
+ )
+ except Exception:
+ raised = True
+ self.assertFalse(raised, "An exception was raised")
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_other_exceptions(
+ self,
+ mock_create_certificate,
+ ):
+ self.kubectl.clients[
+ CUSTOM_OBJECT_CLIENT
+ ].create_namespaced_custom_object.side_effect = Exception()
+ with self.assertRaises(Exception):
+ await self.kubectl.create_certificate(
+ namespace=self.namespace,
+ name=self.name,
+ dns_prefix=self.dns_prefix,
+ secret_name=self.secret_name,
+ usages=self.usages,
+ issuer_name=self.issuer_name,
+ )
+
+
+@mock.patch("kubernetes.client.CustomObjectsApi.delete_namespaced_custom_object")
+class DeleteCertificateClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(DeleteCertificateClass, self).setUp()
+ self.namespace = "osm"
+ self.object_name = "test-cert"
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_no_exception_if_notfound(
+ self,
+ mock_create_certificate,
+ ):
+ api_exception = ApiException()
+ api_exception.body = '{"reason": "NotFound"}'
+ self.kubectl.clients[
+ CUSTOM_OBJECT_CLIENT
+ ].delete_namespaced_custom_object.side_effect = api_exception
+ raised = False
+ try:
+ await self.kubectl.delete_certificate(
+ namespace=self.namespace,
+ object_name=self.object_name,
+ )
+ except Exception:
+ raised = True
+ self.assertFalse(raised, "An exception was raised")
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_other_exceptions(
+ self,
+ mock_create_certificate,
+ ):
+ self.kubectl.clients[
+ CUSTOM_OBJECT_CLIENT
+ ].delete_namespaced_custom_object.side_effect = Exception()
+ with self.assertRaises(Exception):
+ await self.kubectl.delete_certificate(
+ namespace=self.namespace,
+ object_name=self.object_name,
+ )
+
+
+@mock.patch("kubernetes.client.RbacAuthorizationV1Api.create_namespaced_role")
+@mock.patch("kubernetes.client.RbacAuthorizationV1Api.list_namespaced_role")
+class CreateRoleClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateRoleClass, self).setUp()
+ self.name = "role"
+ self.namespace = "osm"
+ self.resources = ["*"]
+ self.api_groups = ["*"]
+ self.verbs = ["*"]
+ self.labels = {}
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def assert_create_role(self, mock_create_role):
+ metadata = V1ObjectMeta(
+ name=self.name, labels=self.labels, namespace=self.namespace
+ )
+ role = V1Role(
+ metadata=metadata,
+ rules=[
+ V1PolicyRule(
+ api_groups=self.api_groups,
+ resources=self.resources,
+ verbs=self.verbs,
+ ),
+ ],
+ )
+ await self.kubectl.create_role(
+ namespace=self.namespace,
+ api_groups=self.api_groups,
+ name=self.name,
+ resources=self.resources,
+ verbs=self.verbs,
+ labels=self.labels,
+ )
+ mock_create_role.assert_called_once_with(self.namespace, role)
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_raise_exception_if_role_already_exists(
+ self,
+ mock_list_role,
+ mock_create_role,
+ ):
+ mock_list_role.return_value = FakeK8sRoleList(items=[1])
+ with self.assertRaises(Exception) as context:
+ await self.kubectl.create_role(
+ self.name,
+ self.labels,
+ self.api_groups,
+ self.resources,
+ self.verbs,
+ self.namespace,
+ )
+ self.assertTrue(
+ "Role with metadata.name={} already exists".format(self.name)
+ in str(context.exception)
+ )
+ mock_create_role.assert_not_called()
+
+
+@mock.patch("kubernetes.client.RbacAuthorizationV1Api.create_namespaced_role_binding")
+@mock.patch("kubernetes.client.RbacAuthorizationV1Api.list_namespaced_role_binding")
+class CreateRoleBindingClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateRoleBindingClass, self).setUp()
+ self.name = "rolebinding"
+ self.namespace = "osm"
+ self.role_name = "role"
+ self.sa_name = "Default"
+ self.labels = {}
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def assert_create_role_binding(self, mock_create_role_binding):
+ role_binding = V1RoleBinding(
+ metadata=V1ObjectMeta(name=self.name, labels=self.labels),
+ role_ref=V1RoleRef(kind="Role", name=self.role_name, api_group=""),
+ subjects=[
+ V1Subject(
+ kind="ServiceAccount",
+ name=self.sa_name,
+ namespace=self.namespace,
+ )
+ ],
+ )
+ await self.kubectl.create_role_binding(
+ namespace=self.namespace,
+ role_name=self.role_name,
+ name=self.name,
+ sa_name=self.sa_name,
+ labels=self.labels,
+ )
+ mock_create_role_binding.assert_called_once_with(self.namespace, role_binding)
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_raise_exception_if_role_binding_already_exists(
+ self,
+ mock_list_role_binding,
+ mock_create_role_binding,
+ ):
+ mock_list_role_binding.return_value = FakeK8sRoleBindingList(items=[1])
+ with self.assertRaises(Exception) as context:
+ await self.kubectl.create_role_binding(
+ self.name,
+ self.role_name,
+ self.sa_name,
+ self.labels,
+ self.namespace,
+ )
+ self.assertTrue(
+ "Role Binding with metadata.name={} already exists".format(self.name)
+ in str(context.exception)
+ )
+ mock_create_role_binding.assert_not_called()
+
+
+@mock.patch("kubernetes.client.CoreV1Api.create_namespaced_secret")
+class CreateSecretClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateSecretClass, self).setUp()
+ self.name = "secret"
+ self.namespace = "osm"
+ self.data = {"test": "1234"}
+ self.secret_type = "Opaque"
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def assert_create_secret(self, mock_create_secret):
+ secret_metadata = V1ObjectMeta(name=self.name, namespace=self.namespace)
+ secret = V1Secret(
+ metadata=secret_metadata,
+ data=self.data,
+ type=self.secret_type,
+ )
+ await self.kubectl.create_secret(
+ namespace=self.namespace,
+ data=self.data,
+ name=self.name,
+ secret_type=self.secret_type,
+ )
+ mock_create_secret.assert_called_once_with(self.namespace, secret)
+
+
+@mock.patch("kubernetes.client.CoreV1Api.create_namespace")
+class CreateNamespaceClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(CreateNamespaceClass, self).setUp()
+ self.namespace = "osm"
+ self.labels = {"key": "value"}
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_namespace_is_created(
+ self,
+ mock_create_namespace,
+ ):
+ metadata = V1ObjectMeta(name=self.namespace, labels=self.labels)
+ namespace = V1Namespace(
+ metadata=metadata,
+ )
+ await self.kubectl.create_namespace(
+ name=self.namespace,
+ labels=self.labels,
+ )
+ mock_create_namespace.assert_called_once_with(namespace)
+
+ async def test_namespace_is_created_default_labels(
+ self,
+ mock_create_namespace,
+ ):
+ metadata = V1ObjectMeta(name=self.namespace, labels=None)
+ namespace = V1Namespace(
+ metadata=metadata,
+ )
+ await self.kubectl.create_namespace(
+ name=self.namespace,
+ )
+ mock_create_namespace.assert_called_once_with(namespace)
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_no_exception_if_alreadyexists(
+ self,
+ mock_create_namespace,
+ ):
+ api_exception = ApiException()
+ api_exception.body = '{"reason": "AlreadyExists"}'
+ self.kubectl.clients[CORE_CLIENT].create_namespace.side_effect = api_exception
+ raised = False
+ try:
+ await self.kubectl.create_namespace(
+ name=self.namespace,
+ )
+ except Exception:
+ raised = True
+ self.assertFalse(raised, "An exception was raised")
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_other_exceptions(
+ self,
+ mock_create_namespace,
+ ):
+ self.kubectl.clients[CORE_CLIENT].create_namespace.side_effect = Exception()
+ with self.assertRaises(Exception):
+ await self.kubectl.create_namespace(
+ name=self.namespace,
+ )
+
+
+@mock.patch("kubernetes.client.CoreV1Api.delete_namespace")
+class DeleteNamespaceClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(DeleteNamespaceClass, self).setUp()
+ self.namespace = "osm"
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_no_exception_if_notfound(
+ self,
+ mock_delete_namespace,
+ ):
+ api_exception = ApiException()
+ api_exception.body = '{"reason": "NotFound"}'
+ self.kubectl.clients[CORE_CLIENT].delete_namespace.side_effect = api_exception
+ raised = False
+ try:
+ await self.kubectl.delete_namespace(
+ name=self.namespace,
+ )
+ except Exception:
+ raised = True
+ self.assertFalse(raised, "An exception was raised")
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_other_exceptions(
+ self,
+ mock_delete_namespace,
+ ):
+ self.kubectl.clients[CORE_CLIENT].delete_namespace.side_effect = Exception()
+ with self.assertRaises(Exception):
+ await self.kubectl.delete_namespace(
+ name=self.namespace,
+ )
+
+
+@mock.patch("kubernetes.client.CoreV1Api.read_namespaced_secret")
+class GetSecretContentClass(asynctest.TestCase):
+ @mock.patch("kubernetes.config.load_kube_config")
+ def setUp(self, mock_load_kube_config):
+ super(GetSecretContentClass, self).setUp()
+ self.name = "my_secret"
+ self.namespace = "osm"
+ self.data = {"my_key": "my_value"}
+ self.type = "Opaque"
+ self.kubectl = Kubectl()
+
+ @asynctest.fail_on(active_handles=True)
+ async def test_return_type_is_dict(
+ self,
+ mock_read_namespaced_secret,
+ ):
+ metadata = V1ObjectMeta(name=self.name, namespace=self.namespace)
+ secret = V1Secret(metadata=metadata, data=self.data, type=self.type)
+ mock_read_namespaced_secret.return_value = secret
+ content = await self.kubectl.get_secret_content(self.name, self.namespace)
+ assert type(content) is dict
import kubernetes
from juju.errors import JujuAPIError
import logging
+
+from n2vc.definitions import Offer, RelationEndpoint
from .utils import (
FakeApplication,
FakeMachine,
self.loop = asyncio.get_event_loop()
self.db = Mock()
mock_base64_to_cacert.return_value = cacert
- Connection._load_vca_connection_data = Mock()
+ # Connection._load_vca_connection_data = Mock()
vca_connection = Connection(AsyncMock())
vca_connection._data = ConnectionData(
**{
}
)
logging.disable(logging.CRITICAL)
- self.libjuju = Libjuju(vca_connection, self.loop)
+ self.libjuju = Libjuju(vca_connection)
self.loop.run_until_complete(self.libjuju.disconnect())
# TODO test provision machine
+@asynctest.mock.patch("os.remove")
+@asynctest.mock.patch("n2vc.libjuju.yaml.dump")
+@asynctest.mock.patch("builtins.open", create=True)
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_controller")
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_model")
@asynctest.mock.patch("n2vc.libjuju.Libjuju.disconnect_model")
@asynctest.mock.patch("n2vc.libjuju.Libjuju.disconnect_controller")
@asynctest.mock.patch("n2vc.juju_watcher.JujuModelWatcher.wait_for_model")
@asynctest.mock.patch("juju.model.Model.deploy")
+@asynctest.mock.patch("juju.model.CharmhubDeployType.resolve")
+@asynctest.mock.patch("n2vc.libjuju.BundleHandler")
+@asynctest.mock.patch("juju.url.URL.parse")
class DeployTest(LibjujuTestCase):
def setUp(self):
super(DeployTest, self).setUp()
+ self.instantiation_params = {"applications": {"squid": {"scale": 2}}}
+ self.architecture = "amd64"
+ self.uri = "cs:osm"
+ self.url = AsyncMock()
+ self.url.schema = juju.url.Schema.CHARM_HUB
+ self.bundle_instance = None
+
+ def setup_bundle_download_mocks(
+ self, mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ ):
+ mock_url_parse.return_value = self.url
+ mock_bundle.return_value = AsyncMock()
+ mock_resolve.return_value = AsyncMock()
+ mock_resolve.origin = AsyncMock()
+ mock_get_model.return_value = juju.model.Model()
+ self.bundle_instance = mock_bundle.return_value
+ self.bundle_instance.applications = {"squid"}
+
+ def assert_overlay_file_is_written(self, filename, mocked_file, mock_yaml, mock_os):
+ mocked_file.assert_called_once_with(filename, "w")
+ mock_yaml.assert_called_once_with(
+ self.instantiation_params, mocked_file.return_value.__enter__.return_value
+ )
+ mock_os.assert_called_once_with(filename)
+
+ def assert_overlay_file_is_not_written(self, mocked_file, mock_yaml, mock_os):
+ mocked_file.assert_not_called()
+ mock_yaml.assert_not_called()
+ mock_os.assert_not_called()
+
+ def assert_bundle_is_downloaded(self, mock_resolve, mock_url_parse):
+ mock_resolve.assert_called_once_with(
+ self.url, self.architecture, entity_url=self.uri
+ )
+ mock_url_parse.assert_called_once_with(self.uri)
+ self.bundle_instance.fetch_plan.assert_called_once_with(
+ self.url, mock_resolve.origin
+ )
+
+ def assert_bundle_is_not_downloaded(self, mock_resolve, mock_url_parse):
+ mock_resolve.assert_not_called()
+ mock_url_parse.assert_not_called()
+ self.bundle_instance.fetch_plan.assert_not_called()
def test_deploy(
self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
mock_deploy,
mock_wait_for_model,
mock_disconnect_controller,
mock_disconnect_model,
mock_get_model,
mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
):
- mock_get_model.return_value = juju.model.Model()
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+ model_name = "model1"
+
self.loop.run_until_complete(
- self.libjuju.deploy("cs:osm", "model", wait=True, timeout=0)
+ self.libjuju.deploy(
+ "cs:osm",
+ model_name,
+ wait=True,
+ timeout=0,
+ instantiation_params=None,
+ )
)
- mock_deploy.assert_called_once()
+ self.assert_overlay_file_is_not_written(mocked_file, mock_yaml, mock_os)
+ self.assert_bundle_is_not_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with("cs:osm", trust=True, overlays=[])
mock_wait_for_model.assert_called_once()
mock_disconnect_controller.assert_called_once()
mock_disconnect_model.assert_called_once()
def test_deploy_no_wait(
self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
mock_deploy,
mock_wait_for_model,
mock_disconnect_controller,
mock_disconnect_model,
mock_get_model,
mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
):
- mock_get_model.return_value = juju.model.Model()
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
self.loop.run_until_complete(
- self.libjuju.deploy("cs:osm", "model", wait=False, timeout=0)
+ self.libjuju.deploy(
+ "cs:osm", "model", wait=False, timeout=0, instantiation_params={}
+ )
)
- mock_deploy.assert_called_once()
+ self.assert_overlay_file_is_not_written(mocked_file, mock_yaml, mock_os)
+ self.assert_bundle_is_not_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with("cs:osm", trust=True, overlays=[])
mock_wait_for_model.assert_not_called()
mock_disconnect_controller.assert_called_once()
mock_disconnect_model.assert_called_once()
def test_deploy_exception(
self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
mock_deploy,
mock_wait_for_model,
mock_disconnect_controller,
mock_disconnect_model,
mock_get_model,
mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
):
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
mock_deploy.side_effect = Exception()
- mock_get_model.return_value = juju.model.Model()
with self.assertRaises(Exception):
self.loop.run_until_complete(self.libjuju.deploy("cs:osm", "model"))
+ self.assert_overlay_file_is_not_written(mocked_file, mock_yaml, mock_os)
+ self.assert_bundle_is_not_downloaded(mock_resolve, mock_url_parse)
mock_deploy.assert_called_once()
mock_wait_for_model.assert_not_called()
mock_disconnect_controller.assert_called_once()
mock_disconnect_model.assert_called_once()
+ def test_deploy_with_instantiation_params(
+ self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+ model_name = "model1"
+ expected_filename = "{}-overlay.yaml".format(model_name)
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ model_name,
+ wait=True,
+ timeout=0,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+ self.assert_overlay_file_is_written(
+ expected_filename, mocked_file, mock_yaml, mock_os
+ )
+ self.assert_bundle_is_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with(
+ self.uri, trust=True, overlays=[expected_filename]
+ )
+ mock_wait_for_model.assert_called_once()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
+ def test_deploy_with_instantiation_params_no_applications(
+ self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.instantiation_params = {"applications": {}}
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+
+ model_name = "model3"
+ expected_filename = "{}-overlay.yaml".format(model_name)
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ model_name,
+ wait=False,
+ timeout=0,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+
+ self.assert_overlay_file_is_written(
+ expected_filename, mocked_file, mock_yaml, mock_os
+ )
+ self.assert_bundle_is_not_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with(
+ self.uri, trust=True, overlays=[expected_filename]
+ )
+ mock_wait_for_model.assert_not_called()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
+ def test_deploy_with_instantiation_params_applications_not_found(
+ self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.instantiation_params = {"some_key": {"squid": {"scale": 2}}}
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+
+ with self.assertRaises(JujuError):
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ "model1",
+ wait=True,
+ timeout=0,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+
+ self.assert_overlay_file_is_not_written(mocked_file, mock_yaml, mock_os)
+ self.assert_bundle_is_not_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_not_called()
+ mock_wait_for_model.assert_not_called()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
+ def test_deploy_overlay_contains_invalid_app(
+ self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+ self.bundle_instance.applications = {"new_app"}
+
+ with self.assertRaises(JujuApplicationNotFound) as error:
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ "model2",
+ wait=True,
+ timeout=0,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+ error_msg = "Cannot find application ['squid'] in original bundle {'new_app'}"
+ self.assertEqual(str(error.exception), error_msg)
+
+ self.assert_overlay_file_is_not_written(mocked_file, mock_yaml, mock_os)
+ self.assert_bundle_is_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_not_called()
+ mock_wait_for_model.assert_not_called()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
+ def test_deploy_exception_with_instantiation_params(
+ self,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+
+ mock_deploy.side_effect = Exception()
+ model_name = "model2"
+ expected_filename = "{}-overlay.yaml".format(model_name)
+ with self.assertRaises(Exception):
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ model_name,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+
+ self.assert_overlay_file_is_written(
+ expected_filename, mocked_file, mock_yaml, mock_os
+ )
+ self.assert_bundle_is_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with(
+ self.uri, trust=True, overlays=[expected_filename]
+ )
+ mock_wait_for_model.assert_not_called()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
+ @asynctest.mock.patch("logging.Logger.warning")
+ def test_deploy_exception_when_deleting_file_is_not_propagated(
+ self,
+ mock_warning,
+ mock_url_parse,
+ mock_bundle,
+ mock_resolve,
+ mock_deploy,
+ mock_wait_for_model,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ mocked_file,
+ mock_yaml,
+ mock_os,
+ ):
+ self.setup_bundle_download_mocks(
+ mock_url_parse, mock_bundle, mock_resolve, mock_get_model
+ )
+
+ mock_os.side_effect = OSError("Error")
+ model_name = "model2"
+ expected_filename = "{}-overlay.yaml".format(model_name)
+ self.loop.run_until_complete(
+ self.libjuju.deploy(
+ self.uri,
+ model_name,
+ instantiation_params=self.instantiation_params,
+ )
+ )
+
+ self.assert_overlay_file_is_written(
+ expected_filename, mocked_file, mock_yaml, mock_os
+ )
+ self.assert_bundle_is_downloaded(mock_resolve, mock_url_parse)
+ mock_deploy.assert_called_once_with(
+ self.uri, trust=True, overlays=[expected_filename]
+ )
+ mock_wait_for_model.assert_called_once()
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+ mock_warning.assert_called_with(
+ "Overlay file {} could not be removed: Error".format(expected_filename)
+ )
+
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_controller")
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_model")
mock_get_model,
mock_get_controller,
):
-
mock_get_model.return_value = juju.model.Model()
mock__get_application.return_value = FakeApplication()
output = None
mock_disconnect_controller.assert_called_once()
mock_disconnect_model.assert_called_once()
+ @asynctest.mock.patch("logging.Logger.warning")
+ def test_not_found_in_error_code(
+ self,
+ mock_warning,
+ mock_add_relation,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ ):
+ result = {
+ "error": "relation cannot be added",
+ "error-code": "not found",
+ "response": "response",
+ "request-id": 1,
+ }
+
+ mock_get_model.return_value = juju.model.Model()
+ mock_add_relation.side_effect = JujuAPIError(result)
+
+ self.loop.run_until_complete(
+ self.libjuju.add_relation(
+ "model",
+ "app1:relation1",
+ "app2:relation2",
+ )
+ )
+
+ mock_warning.assert_called_with("Relation not found: relation cannot be added")
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
@asynctest.mock.patch("logging.Logger.warning")
def test_already_exists(
self,
mock_disconnect_controller.assert_called_once()
mock_disconnect_model.assert_called_once()
+ @asynctest.mock.patch("logging.Logger.warning")
+ def test_already_exists_error_code(
+ self,
+ mock_warning,
+ mock_add_relation,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ ):
+ result = {
+ "error": "relation cannot be added",
+ "error-code": "already exists",
+ "response": "response",
+ "request-id": 1,
+ }
+
+ mock_get_model.return_value = juju.model.Model()
+ mock_add_relation.side_effect = JujuAPIError(result)
+
+ self.loop.run_until_complete(
+ self.libjuju.add_relation(
+ "model",
+ "app1:relation1",
+ "app2:relation2",
+ )
+ )
+
+ mock_warning.assert_called_with(
+ "Relation already exists: relation cannot be added"
+ )
+ mock_disconnect_controller.assert_called_once()
+ mock_disconnect_model.assert_called_once()
+
def test_exception(
self,
mock_add_relation,
mock_get_model,
mock_get_controller,
):
-
mock_get_application.return_value = FakeApplication()
self.loop.run_until_complete(
mock_get_model,
mock_get_controller,
):
-
mock_get_application.side_effect = Exception()
with self.assertRaises(Exception):
mock_get_model,
mock_get_controller,
):
-
result = {"error": "not found", "response": "response", "request-id": 1}
mock_get_controller.side_effect = JujuAPIError(result)
mock_get_model,
mock_get_controller,
):
-
result = {"error": "not found", "response": "response", "request-id": 1}
mock_get_model.side_effect = JujuAPIError(result)
mock_get_controller.return_value = juju.controller.Controller()
mock_list_offers.side_effect = Exception()
with self.assertRaises(Exception):
- self.loop.run_until_complete(self.libjuju.list_offers("model"))
+ self.loop.run_until_complete(self.libjuju._list_offers("model"))
mock_disconnect_controller.assert_called_once()
def test_empty_list(
mock_get_controller,
):
mock_get_controller.return_value = juju.controller.Controller()
- mock_list_offers.return_value = []
- offers = self.loop.run_until_complete(self.libjuju.list_offers("model"))
+ offer_results = Mock()
+ offer_results.results = []
+ mock_list_offers.return_value = offer_results
+ offers = self.loop.run_until_complete(self.libjuju._list_offers("model"))
self.assertEqual(offers, [])
mock_disconnect_controller.assert_called_once()
mock_get_controller,
):
mock_get_controller.return_value = juju.controller.Controller()
- mock_list_offers.return_value = ["offer"]
- offers = self.loop.run_until_complete(self.libjuju.list_offers("model"))
- self.assertEqual(offers, ["offer"])
+ offer = Mock()
+ offer_results = Mock()
+ offer_results.results = [offer]
+ mock_list_offers.return_value = offer_results
+ offers = self.loop.run_until_complete(self.libjuju._list_offers("model"))
+ self.assertEqual(offers, [offer])
+ mock_disconnect_controller.assert_called_once()
+
+ def test_matching_offer_name(
+ self,
+ mock_list_offers,
+ mock_disconnect_controller,
+ mock_get_controller,
+ ):
+ mock_get_controller.return_value = juju.controller.Controller()
+ offer_1 = Mock()
+ offer_1.offer_name = "offer1"
+ offer_2 = Mock()
+ offer_2.offer_name = "offer2"
+ offer_results = Mock()
+ offer_results.results = [offer_1, offer_2]
+ mock_list_offers.return_value = offer_results
+ offers = self.loop.run_until_complete(
+ self.libjuju._list_offers("model", offer_name="offer2")
+ )
+ self.assertEqual(offers, [offer_2])
+ mock_disconnect_controller.assert_called_once()
+
+ def test_not_matching_offer_name(
+ self,
+ mock_list_offers,
+ mock_disconnect_controller,
+ mock_get_controller,
+ ):
+ mock_get_controller.return_value = juju.controller.Controller()
+ offer_1 = Mock()
+ offer_1.offer_name = "offer1"
+ offer_2 = Mock()
+ offer_2.offer_name = "offer2"
+ offer_results = Mock()
+ offer_results.results = [offer_1, offer_2]
+ mock_list_offers.return_value = offer_results
+ offers = self.loop.run_until_complete(
+ self.libjuju._list_offers("model", offer_name="offer3")
+ )
+ self.assertEqual(offers, [])
mock_disconnect_controller.assert_called_once()
+@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_controller")
+@asynctest.mock.patch("juju.controller.Controller.get_model")
+@asynctest.mock.patch("n2vc.libjuju.Libjuju.disconnect_model")
+@asynctest.mock.patch("n2vc.libjuju.Libjuju.disconnect_controller")
+@asynctest.mock.patch("n2vc.libjuju.Libjuju._list_offers")
+@asynctest.mock.patch("juju.model.Model.create_offer")
+class OfferTest(LibjujuTestCase):
+ def setUp(self):
+ super(OfferTest, self).setUp()
+
+ def test_offer(
+ self,
+ mock_create_offer,
+ mock__list_offers,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ ):
+ controller = juju.controller.Controller()
+ model = juju.model.Model()
+ mock_get_controller.return_value = controller
+ mock_get_model.return_value = model
+ endpoint = RelationEndpoint("model.app-name.0", "vca", "endpoint")
+ self.loop.run_until_complete(self.libjuju.offer(endpoint))
+ mock_create_offer.assert_called_with(
+ "app-name:endpoint", offer_name="app-name-endpoint"
+ )
+ mock_disconnect_model.assert_called_once_with(model)
+ mock_disconnect_controller.assert_called_once_with(controller)
+
+ def test_offer_exception(
+ self,
+ mock_create_offer,
+ mock__list_offers,
+ mock_disconnect_controller,
+ mock_disconnect_model,
+ mock_get_model,
+ mock_get_controller,
+ ):
+ controller = juju.controller.Controller()
+ model = juju.model.Model()
+ mock_get_controller.return_value = controller
+ mock_get_model.return_value = model
+ mock__list_offers.return_value = []
+ endpoint = RelationEndpoint("model.app-name.0", "vca", "endpoint")
+ with self.assertRaises(Exception):
+ self.loop.run_until_complete(self.libjuju.offer(endpoint))
+ mock_create_offer.assert_called_with(
+ "app-name:endpoint", offer_name="app-name-endpoint"
+ )
+ mock_disconnect_model.assert_called_once_with(model)
+ mock_disconnect_controller.assert_called_once_with(controller)
+
+
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_controller")
@asynctest.mock.patch("juju.controller.Controller.get_model")
@asynctest.mock.patch("n2vc.libjuju.Libjuju.disconnect_model")
@asynctest.mock.patch("juju.model.Model.consume")
class ConsumeTest(LibjujuTestCase):
def setUp(self):
+ self.offer_url = "admin/model.offer_name"
super(ConsumeTest, self).setUp()
+ self.provider_libjuju = self.libjuju
def test_consume(
self,
mock_get_model,
mock_get_controller,
):
- mock_get_controller.return_value = juju.controller.Controller()
+ self_controller = juju.controller.Controller()
+ provider_controller = juju.controller.Controller()
+ mock_get_controller.side_effect = [self_controller, provider_controller]
mock_get_model.return_value = juju.model.Model()
- self.loop.run_until_complete(self.libjuju.consume("offer_url", "model_name"))
- mock_consume.assert_called_once()
+ self.loop.run_until_complete(
+ self.libjuju.consume(
+ "model_name",
+ Offer(self.offer_url, vca_id="vca-id"),
+ self.provider_libjuju,
+ )
+ )
+ mock_consume.assert_called_once_with(
+ "admin/model.offer_name",
+ application_alias="offer_name-model-vca-id",
+ controller=provider_controller,
+ )
mock_disconnect_model.assert_called_once()
- mock_disconnect_controller.assert_called_once()
+ self.assertEqual(mock_disconnect_controller.call_count, 2)
def test_parsing_error_exception(
self,
with self.assertRaises(juju.offerendpoints.ParseError):
self.loop.run_until_complete(
- self.libjuju.consume("offer_url", "model_name")
+ self.libjuju.consume(
+ "model_name", Offer(self.offer_url), self.provider_libjuju
+ )
)
mock_consume.assert_called_once()
mock_disconnect_model.assert_called_once()
- mock_disconnect_controller.assert_called_once()
+ self.assertEqual(mock_disconnect_controller.call_count, 2)
def test_juju_error_exception(
self,
with self.assertRaises(juju.errors.JujuError):
self.loop.run_until_complete(
- self.libjuju.consume("offer_url", "model_name")
+ self.libjuju.consume(
+ "model_name", Offer(self.offer_url), self.provider_libjuju
+ )
)
mock_consume.assert_called_once()
mock_disconnect_model.assert_called_once()
- mock_disconnect_controller.assert_called_once()
+ self.assertEqual(mock_disconnect_controller.call_count, 2)
def test_juju_api_error_exception(
self,
with self.assertRaises(juju.errors.JujuAPIError):
self.loop.run_until_complete(
- self.libjuju.consume("offer_url", "model_name")
+ self.libjuju.consume(
+ "model_name", Offer(self.offer_url), self.provider_libjuju
+ )
)
mock_consume.assert_called_once()
mock_disconnect_model.assert_called_once()
- mock_disconnect_controller.assert_called_once()
+ self.assertEqual(mock_disconnect_controller.call_count, 2)
@asynctest.mock.patch("n2vc.libjuju.Libjuju.get_k8s_cloud_credential")
import asyncio
import logging
-from unittest.mock import Mock
+from unittest.mock import Mock, MagicMock
+from unittest.mock import patch
import asynctest
+from n2vc.definitions import Offer, RelationEndpoint
from n2vc.n2vc_juju_conn import N2VCJujuConnector
from osm_common import fslocal
+from osm_common.dbmemory import DbMemory
from n2vc.exceptions import (
N2VCBadArgumentsException,
N2VCException,
+ JujuApplicationNotFound,
)
from n2vc.tests.unit.utils import AsyncMock
from n2vc.vca.connection_data import ConnectionData
+from n2vc.tests.unit.testdata import test_db_descriptors as descriptors
+import yaml
class N2VCJujuConnTestCase(asynctest.TestCase):
@asynctest.mock.patch("n2vc.n2vc_juju_conn.get_connection")
@asynctest.mock.patch("n2vc.vca.connection_data.base64_to_cacert")
def setUp(
- self,
- mock_base64_to_cacert=None,
- mock_get_connection=None,
- mock_store=None,
+ self, mock_base64_to_cacert=None, mock_get_connection=None, mock_store=None
):
self.loop = asyncio.get_event_loop()
self.db = Mock()
db=self.db,
fs=fslocal.FsLocal(),
log=None,
- loop=self.loop,
on_update_db=None,
)
N2VCJujuConnector.get_public_key.assert_not_called()
self.n2vc.libjuju.get_application_configs.assert_not_called_once()
-@asynctest.mock.patch("osm_common.fslocal.FsLocal.file_exists")
-@asynctest.mock.patch(
- "osm_common.fslocal.FsLocal.path", new_callable=asynctest.PropertyMock, create=True
-)
class K8sProxyCharmsTest(N2VCJujuConnTestCase):
def setUp(self):
super(K8sProxyCharmsTest, self).setUp()
self.n2vc.libjuju.add_model = AsyncMock()
self.n2vc.libjuju.deploy_charm = AsyncMock()
self.n2vc.libjuju.model_exists.return_value = False
+ self.db = DbMemory()
+ self.fs = fslocal.FsLocal()
+ self.fs.path = "/"
+ self.n2vc.fs = self.fs
+ self.n2vc.db = self.db
+ self.db.create_list("nsrs", yaml.safe_load(descriptors.db_nsrs_text))
+ self.db.create_list("vnfrs", yaml.safe_load(descriptors.db_vnfrs_text))
- def test_success(
- self,
- mock_path,
- mock_file_exists,
- ):
- mock_file_exists.return_value = True
- mock_path.return_value = "/path"
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_success(self, mock_generate_random_alfanum_string):
+ self.n2vc.fs.file_exists = MagicMock(create_autospec=True)
+ self.n2vc.fs.file_exists.return_value = True
ee_id = self.loop.run_until_complete(
self.n2vc.install_k8s_proxy_charm(
- "charm",
- "nsi-id.ns-id.vnf-id.vdu",
- "////path/",
+ "simple",
+ ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0",
+ "path",
{},
)
)
self.n2vc.libjuju.add_model.assert_called_once()
self.n2vc.libjuju.deploy_charm.assert_called_once_with(
- model_name="ns-id-k8s",
- application_name="app-vnf-vnf-id-vdu-vdu",
- path="/path/path/",
+ model_name="dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s",
+ application_name="simple-ee-z0-vnf1-vnf",
+ path="//path",
machine_id=None,
db_dict={},
progress_timeout=None,
total_timeout=None,
config=None,
)
- self.assertEqual(ee_id, "ns-id-k8s.app-vnf-vnf-id-vdu-vdu.k8s")
+ self.assertEqual(
+ ee_id, "dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s.simple-ee-z0-vnf1-vnf.k8s"
+ )
def test_no_artifact_path(
self,
- mock_path,
- mock_file_exists,
):
with self.assertRaises(N2VCBadArgumentsException):
ee_id = self.loop.run_until_complete(
self.n2vc.install_k8s_proxy_charm(
- "charm",
- "nsi-id.ns-id.vnf-id.vdu",
+ "simple",
+ ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0",
"",
{},
)
def test_no_db(
self,
- mock_path,
- mock_file_exists,
):
with self.assertRaises(N2VCBadArgumentsException):
ee_id = self.loop.run_until_complete(
self.n2vc.install_k8s_proxy_charm(
- "charm",
- "nsi-id.ns-id.vnf-id.vdu",
- "/path/",
+ "simple",
+ ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0",
+ "path",
None,
)
)
def test_file_not_exists(
self,
- mock_path,
- mock_file_exists,
):
- mock_file_exists.return_value = False
+ self.n2vc.fs.file_exists = MagicMock(create_autospec=True)
+ self.n2vc.fs.file_exists.return_value = False
with self.assertRaises(N2VCBadArgumentsException):
ee_id = self.loop.run_until_complete(
self.n2vc.install_k8s_proxy_charm(
- "charm",
- "nsi-id.ns-id.vnf-id.vdu",
- "/path/",
+ "simple",
+ ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0",
+ "path",
{},
)
)
def test_exception(
self,
- mock_path,
- mock_file_exists,
):
- mock_file_exists.return_value = True
- mock_path.return_value = "/path"
+ self.n2vc.fs.file_exists = MagicMock(create_autospec=True)
+ self.n2vc.fs.file_exists.return_value = True
+ self.n2vc.fs.path = MagicMock(create_autospec=True)
+ self.n2vc.fs.path.return_value = "path"
self.n2vc.libjuju.deploy_charm.side_effect = Exception()
with self.assertRaises(N2VCException):
ee_id = self.loop.run_until_complete(
self.n2vc.install_k8s_proxy_charm(
- "charm",
- "nsi-id.ns-id.vnf-id.vdu",
- "path/",
+ "simple",
+ ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0",
+ "path",
{},
)
)
self.assertIsNone(ee_id)
+
+
+class AddRelationTest(N2VCJujuConnTestCase):
+ def setUp(self):
+ super(AddRelationTest, self).setUp()
+ self.n2vc.libjuju.add_relation = AsyncMock()
+ self.n2vc.libjuju.offer = AsyncMock()
+ self.n2vc.libjuju.get_controller = AsyncMock()
+ self.n2vc.libjuju.consume = AsyncMock()
+
+ def test_standard_relation_same_model_and_controller(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint1")
+ relation_endpoint_2 = RelationEndpoint("model-1.app2.1", None, "endpoint2")
+ self.loop.run_until_complete(
+ self.n2vc.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.n2vc.libjuju.add_relation.assert_called_once_with(
+ model_name="model-1",
+ endpoint_1="app1:endpoint1",
+ endpoint_2="app2:endpoint2",
+ )
+ self.n2vc.libjuju.offer.assert_not_called()
+ self.n2vc.libjuju.consume.assert_not_called()
+
+ def test_cmr_relation_same_controller(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint")
+ relation_endpoint_2 = RelationEndpoint("model-2.app2.1", None, "endpoint")
+ offer = Offer("admin/model-1.app1")
+ self.n2vc.libjuju.offer.return_value = offer
+ self.n2vc.libjuju.consume.return_value = "saas"
+ self.loop.run_until_complete(
+ self.n2vc.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.n2vc.libjuju.offer.assert_called_once_with(relation_endpoint_1)
+ self.n2vc.libjuju.consume.assert_called_once()
+ self.n2vc.libjuju.add_relation.assert_called_once_with(
+ "model-2", "app2:endpoint", "saas"
+ )
+
+ def test_cmr_relation_different_controller(self):
+ self.n2vc._get_libjuju = AsyncMock(return_value=self.n2vc.libjuju)
+ relation_endpoint_1 = RelationEndpoint(
+ "model-1.app1.0", "vca-id-1", "endpoint1"
+ )
+ relation_endpoint_2 = RelationEndpoint(
+ "model-1.app2.1", "vca-id-2", "endpoint2"
+ )
+ offer = Offer("admin/model-1.app1")
+ self.n2vc.libjuju.offer.return_value = offer
+ self.n2vc.libjuju.consume.return_value = "saas"
+ self.loop.run_until_complete(
+ self.n2vc.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+ self.n2vc.libjuju.offer.assert_called_once_with(relation_endpoint_1)
+ self.n2vc.libjuju.consume.assert_called_once()
+ self.n2vc.libjuju.add_relation.assert_called_once_with(
+ "model-1", "app2:endpoint2", "saas"
+ )
+
+ def test_relation_exception(self):
+ relation_endpoint_1 = RelationEndpoint("model-1.app1.0", None, "endpoint")
+ relation_endpoint_2 = RelationEndpoint("model-2.app2.1", None, "endpoint")
+ self.n2vc.libjuju.offer.side_effect = Exception()
+ with self.assertRaises(N2VCException):
+ self.loop.run_until_complete(
+ self.n2vc.add_relation(relation_endpoint_1, relation_endpoint_2)
+ )
+
+
+class UpgradeCharmTest(N2VCJujuConnTestCase):
+ def setUp(self):
+ super(UpgradeCharmTest, self).setUp()
+ self.n2vc._get_libjuju = AsyncMock(return_value=self.n2vc.libjuju)
+ N2VCJujuConnector._get_ee_id_components = Mock()
+ self.n2vc.libjuju.upgrade_charm = AsyncMock()
+
+ def test_empty_ee_id(self):
+ with self.assertRaises(N2VCBadArgumentsException):
+ self.loop.run_until_complete(
+ self.n2vc.upgrade_charm(
+ "", "/sample_charm_path", "sample_charm_id", "native-charm", None
+ )
+ )
+ self.n2vc._get_libjuju.assert_called()
+ self.n2vc._get_ee_id_components.assert_not_called()
+ self.n2vc.libjuju.upgrade_charm.assert_not_called()
+
+ def test_wrong_ee_id(self):
+ N2VCJujuConnector._get_ee_id_components.side_effect = Exception
+ with self.assertRaises(N2VCBadArgumentsException):
+ self.loop.run_until_complete(
+ self.n2vc.upgrade_charm(
+ "ns-id-k8s.app-vnf-vnf-id-vdu-vdu-random.k8s",
+ "/sample_charm_path",
+ "sample_charm_id",
+ "native-charm",
+ 500,
+ )
+ )
+ self.n2vc._get_libjuju.assert_called()
+ self.n2vc._get_ee_id_components.assert_called()
+ self.n2vc.libjuju.upgrade_charm.assert_not_called()
+
+ def test_charm_upgrade_succeded(self):
+ N2VCJujuConnector._get_ee_id_components.return_value = (
+ "sample_model",
+ "sample_app",
+ "sample_machine_id",
+ )
+ self.loop.run_until_complete(
+ self.n2vc.upgrade_charm(
+ "ns-id-k8s.app-vnf-vnf-id-vdu-vdu-random.k8s",
+ "/sample_charm_path",
+ "sample_charm_id",
+ "native-charm",
+ 500,
+ )
+ )
+ self.n2vc._get_libjuju.assert_called()
+ self.n2vc._get_ee_id_components.assert_called()
+ self.n2vc.libjuju.upgrade_charm.assert_called_with(
+ application_name="sample_app",
+ path="/sample_charm_path",
+ model_name="sample_model",
+ total_timeout=500,
+ )
+
+ def test_charm_upgrade_failed(self):
+ N2VCJujuConnector._get_ee_id_components.return_value = (
+ "sample_model",
+ "sample_app",
+ "sample_machine_id",
+ )
+ self.n2vc.libjuju.upgrade_charm.side_effect = JujuApplicationNotFound
+ with self.assertRaises(N2VCException):
+ self.loop.run_until_complete(
+ self.n2vc.upgrade_charm(
+ "ns-id-k8s.app-vnf-vnf-id-vdu-vdu-random.k8s",
+ "/sample_charm_path",
+ "sample_charm_id",
+ "native-charm",
+ None,
+ )
+ )
+ self.n2vc._get_libjuju.assert_called()
+ self.n2vc._get_ee_id_components.assert_called()
+ self.n2vc.libjuju.upgrade_charm.assert_called_with(
+ application_name="sample_app",
+ path="/sample_charm_path",
+ model_name="sample_model",
+ total_timeout=None,
+ )
+
+
+class GenerateApplicationNameTest(N2VCJujuConnTestCase):
+ vnf_id = "dbfbd751-3de4-4e68-bd40-ec5ae0a53898"
+
+ def setUp(self):
+ super(GenerateApplicationNameTest, self).setUp()
+ self.db = MagicMock(DbMemory)
+
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_generate_backward_compatible_application_name(
+ self, mock_generate_random_alfanum
+ ):
+ vdu_id = "mgmtVM"
+ vdu_count = "0"
+ expected_result = "app-vnf-ec5ae0a53898-vdu-mgmtVM-cnt-0-random"
+
+ application_name = self.n2vc._generate_backward_compatible_application_name(
+ GenerateApplicationNameTest.vnf_id, vdu_id, vdu_count
+ )
+ self.assertEqual(application_name, expected_result)
+
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_generate_backward_compatible_application_name_without_vnf_id_vdu_id(
+ self, mock_generate_random_alfanum
+ ):
+ vnf_id = None
+ vdu_id = ""
+ vdu_count = None
+ expected_result = "app--random"
+ application_name = self.n2vc._generate_backward_compatible_application_name(
+ vnf_id, vdu_id, vdu_count
+ )
+
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_find_charm_level_with_vnf_id(self):
+ vdu_id = ""
+ expected_result = "vnf-level"
+ charm_level = self.n2vc._find_charm_level(
+ GenerateApplicationNameTest.vnf_id, vdu_id
+ )
+ self.assertEqual(charm_level, expected_result)
+
+ def test_find_charm_level_with_vdu_id(self):
+ vnf_id = ""
+ vdu_id = "mgmtVM"
+ with self.assertRaises(N2VCException):
+ self.n2vc._find_charm_level(vnf_id, vdu_id)
+
+ def test_find_charm_level_with_vnf_id_and_vdu_id(self):
+ vdu_id = "mgmtVM"
+ expected_result = "vdu-level"
+ charm_level = self.n2vc._find_charm_level(
+ GenerateApplicationNameTest.vnf_id, vdu_id
+ )
+ self.assertEqual(charm_level, expected_result)
+
+ def test_find_charm_level_without_vnf_id_and_vdu_id(self):
+ vnf_id = ""
+ vdu_id = ""
+ expected_result = "ns-level"
+ charm_level = self.n2vc._find_charm_level(vnf_id, vdu_id)
+ self.assertEqual(charm_level, expected_result)
+
+ def test_generate_application_name_ns_charm(self):
+ charm_level = "ns-level"
+ vnfrs = {}
+ vca_records = [
+ {
+ "target_element": "ns",
+ "member-vnf-index": "",
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": None,
+ "vdu_name": None,
+ "type": "proxy_charm",
+ "ee_descriptor_id": None,
+ "charm_name": "simple-ns-charm-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh",
+ "ee_id": None,
+ "application": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = ""
+ vdu_count = ""
+ vdu_id = None
+ expected_result = "simple-ns-charm-abc-000-rrrr-nnnn-4444-h-ns"
+ application_name = self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_generate_application_name_ns_charm_empty_vca_records(self):
+ charm_level = "ns-level"
+ vnfrs = {}
+ vca_records = []
+ vnf_count = ""
+ vdu_count = ""
+ vdu_id = None
+ with self.assertRaises(N2VCException):
+ self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+
+ def test_generate_application_name_vnf_charm(self):
+ charm_level = "vnf-level"
+ vnfrs = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = "1"
+ vdu_count = ""
+ vdu_id = None
+ expected_result = "simple-ee-ab-1-vnf111-xxx-y-vnf"
+ application_name = self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_generate_application_name_vdu_charm_kdu_name_in_vca_record_is_none(self):
+ charm_level = "vdu-level"
+ vnfrs = {
+ "member-vnf-index-ref": "vnf111-xxx-yyy-zzz",
+ "vdur": [
+ {"_id": "38912ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "mgmtVM"},
+ {"_id": "45512ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "dataVM"},
+ ],
+ }
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "mgmtVM",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "vnf/vnf1/dataVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "dataVM",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "datavm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-8888-hhh-3333-yyyy-888-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = "mgmtVM"
+ expected_result = "simple-ee-ab-2-vnf111-xxx-y-mgmtVM-0-vdu"
+ application_name = self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_generate_application_name_vdu_charm_vdu_id_kdu_name_in_vca_record_are_both_set(
+ self,
+ ):
+ charm_level = "vdu-level"
+ vnfrs = {
+ "member-vnf-index-ref": "vnf111-xxx-yyy-zzz",
+ "vdur": [
+ {"_id": "38912ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "mgmtVM"},
+ {"_id": "45512ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "dataVM"},
+ ],
+ }
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "mgmtVM",
+ "kdu_name": "mgmtVM",
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "vnf/vnf1/dataVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "dataVM",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "datavm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-8888-hhh-3333-yyyy-888-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = "mgmtVM"
+ expected_result = "simple-ee-ab-2-vnf111-xxx-y-mgmtVM-0-vdu"
+ application_name = self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_generate_application_name_vdu_charm_both_vdu_id_kdu_name_in_vca_record_are_none(
+ self,
+ ):
+ charm_level = "vdu-level"
+ vnfrs = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = "mgmtVM"
+ with self.assertRaises(KeyError):
+ self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+
+ def test_generate_application_name_vdu_charm_given_vdu_id_is_none(self):
+ charm_level = "vdu-level"
+ vnfrs = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtvVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": None,
+ "kdu_name": "mgmtVM",
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = None
+ with self.assertRaises(N2VCException):
+ self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+
+ def test_generate_application_name_vdu_charm_vdu_id_does_not_match_with_the_key_in_vca_record(
+ self,
+ ):
+ charm_level = "vdu-level"
+ vnfrs = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": None,
+ "kdu_name": "mgmtVM",
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = "mgmtvm"
+ with self.assertRaises(KeyError):
+ self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+
+ def test_generate_application_name_vdu_charm_vdu_id_in_vca_record_is_none(self):
+ charm_level = "vdu-level"
+ vnfrs = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vca_records = [
+ {
+ "target_element": "vnf/vnf1/mgmtVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": None,
+ "kdu_name": "mgmtVM",
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vnf_count = "2"
+ vdu_count = "0"
+ vdu_id = "mgmtVM"
+ expected_result = "simple-ee-ab-2-vnf111-xxx-y-mgmtVM-0-vdu"
+ application_name = self.n2vc._generate_application_name(
+ charm_level,
+ vnfrs,
+ vca_records,
+ vnf_count=vnf_count,
+ vdu_id=vdu_id,
+ vdu_count=vdu_count,
+ )
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+
+ def test_get_vnf_count_db_vnfr_ns_charm(self):
+ self.db.get_one.return_value = {"member-vnf-index-ref": "sample-ref"}
+ charm_level = "ns-level"
+ vnf_id_and_count = "m7fbd751-3de4-4e68-bd40-ec5ae0a53898-4"
+ with patch.object(self.n2vc, "db", self.db):
+ vnf_count, db_vnfr = self.n2vc._get_vnf_count_and_record(
+ charm_level, vnf_id_and_count
+ )
+ self.assertEqual(vnf_count, "")
+ self.assertEqual(db_vnfr, {})
+
+ def test_get_vnf_count_db_vnfr_vnf_charm(self):
+ self.db.get_one.return_value = {"member-vnf-index-ref": "sample-ref"}
+ charm_level = "vnf-level"
+ vnf_id_and_count = "m7fbd751-3de4-4e68-bd40-ec5ae0a53898-4"
+ with patch.object(self.n2vc, "db", self.db):
+ vnf_count, db_vnfr = self.n2vc._get_vnf_count_and_record(
+ charm_level, vnf_id_and_count
+ )
+ self.assertEqual(vnf_count, "4")
+ self.assertEqual(db_vnfr, {"member-vnf-index-ref": "sample-ref"})
+
+ def test_get_vnf_count_db_vnfr_vdu_charm(self):
+ self.db.get_one.return_value = {"member-vnf-index-ref": "sample-ref"}
+ charm_level = "vdu-level"
+ vnf_id_and_count = "m7fbd751-3de4-4e68-bd40-ec5ae0a53898-2"
+ with patch.object(self.n2vc, "db", self.db):
+ vnf_count, db_vnfr = self.n2vc._get_vnf_count_and_record(
+ charm_level, vnf_id_and_count
+ )
+ self.assertEqual(vnf_count, "2")
+ self.assertEqual(db_vnfr, {"member-vnf-index-ref": "sample-ref"})
+
+ def test_get_vca_records_vdu_charm(self):
+ charm_level = "vdu-level"
+ db_vnfr = {
+ "member-vnf-index-ref": "vnf111-xxx-yyy-zzz",
+ "vdur": [
+ {"_id": "38912ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "mgmtVM"},
+ {"_id": "45512ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "dataVM"},
+ ],
+ }
+ db_nsr = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "vnf/vnf2/datavm",
+ "member-vnf-index": "vnf222-xxx-yyy-zzz",
+ "vdu_id": "45512ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "datavm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-8888-hhh-3333-yyyy-888-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ expected_result = [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vca_records = self.n2vc._get_vca_records(charm_level, db_nsr, db_vnfr)
+ self.assertEqual(vca_records, expected_result)
+
+ def test_get_vca_records_vnf_charm_member_vnf_index_mismatch(self):
+ charm_level = "vnf-level"
+ db_vnfr = {"member-vnf-index-ref": "vnf222-xxx-yyy-zzz"}
+ db_nsr = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "45512ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "datavm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-8888-hhh-3333-yyyy-888-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ expected_result = []
+ vca_records = self.n2vc._get_vca_records(charm_level, db_nsr, db_vnfr)
+ self.assertEqual(vca_records, expected_result)
+
+ def test_get_vca_records_ns_charm(self):
+ charm_level = "ns-level"
+ db_vnfr = {"member-vnf-index-ref": "vnf222-xxx-yyy-zzz"}
+ db_nsr = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "simple-ns-charm-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ expected_result = [
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "simple-ns-charm-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vca_records = self.n2vc._get_vca_records(charm_level, db_nsr, db_vnfr)
+ self.assertEqual(vca_records, expected_result)
+
+ def test_get_vca_records_ns_charm_empty_charm_name(self):
+ charm_level = "ns-level"
+ db_vnfr = {"member-vnf-index-ref": "vnf222-xxx-yyy-zzz"}
+ db_nsr = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ expected_result = [
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ vca_records = self.n2vc._get_vca_records(charm_level, db_nsr, db_vnfr)
+ self.assertEqual(vca_records, expected_result)
+
+ def test_get_application_name_vnf_charm(self):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "simple-ee-ab-z0-vnf111-xxx-y-vnf"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vnf-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_get_application_name_vnf_charm_old_naming(
+ self, mock_generate_random_alfanum
+ ):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {"member-vnf-index-ref": "vnf111-xxx-yyy-zzz"}
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "app-vnf-eb3161eec0-z0-random"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vnf-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ def test_get_application_name_vnf_charm_vnf_index_ref_mismatch(self):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "38912ff7-5bdd-4228-911f-c2bee259c44a",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {"member-vnf-index-ref": "vnf222-xxx-yyy-zzz"}
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ with self.assertRaises(N2VCException):
+ self.n2vc._get_application_name(namespace)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vnf-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ def test_get_application_name_vdu_charm(self):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0.mgmtVM-0"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtvm",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "mgmtVM",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {
+ "member-vnf-index-ref": "vnf111-xxx-yyy-zzz",
+ "vdur": [
+ {"_id": "38912ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "mgmtVM"},
+ {"_id": "45512ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "dataVM"},
+ ],
+ }
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "simple-ee-ab-z0-vnf111-xxx-y-mgmtvm-z0-vdu"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vdu-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ def test_get_application_name_kdu_charm(self):
+ namespace = ".82b11965-e580-47c0-9ee0-329f318a305b.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0.ldap"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/openldap/kdu/ldap",
+ "member-vnf-index": "openldap",
+ "vdu_id": None,
+ "kdu_name": "ldap",
+ "vdu_count_index": 0,
+ "operational-status": "init",
+ "detailed-status": "",
+ "step": "initial-deploy",
+ "vnfd_id": "openldap_knf",
+ "vdu_name": None,
+ "type": "lxc_proxy_charm",
+ "ee_descriptor_id": "openldap-ee",
+ "charm_name": "",
+ "ee_id": "",
+ "application": "openldap-ee-z0-openldap-vdu",
+ "model": "82b11965-e580-47c0-9ee0-329f318a305b",
+ "config_sw_installed": True,
+ }
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {"member-vnf-index-ref": "openldap", "vdur": {}}
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "openldap-ee-z0-openldap-ldap-vdu"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vdu-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_get_application_name_vdu_charm_old_naming(
+ self, mock_generate_random_alfanum
+ ):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898.1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0.mgmtVM-0"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "vnf/vnf1/mgmtVM",
+ "member-vnf-index": "vnf111-xxx-yyy-zzz",
+ "vdu_id": "mgmtVM",
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "r7fbd751-3de4-4e68-bd40-ec5ae0a53898",
+ "vdu_name": "mgmtvm",
+ "ee_descriptor_id": "simple-ee-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ },
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {
+ "member-vnf-index-ref": "vnf111-xxx-yyy-zzz",
+ "vdur": [
+ {"_id": "38912ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "mgmtVM"},
+ {"_id": "45512ff7-5bdd-4228-911f-c2bee259c44a", "vdu-id-ref": "dataVM"},
+ ],
+ }
+ vnf_count = "0"
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "app-vnf-eb3161eec0-z0-vdu-mgmtvm-cnt-z0-random"
+
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with(
+ "vdu-level", "1b6a4eb3-4fbf-415e-985c-4aeb3161eec0-0"
+ )
+ self.db.get_one.assert_called_once()
+
+ def test_get_application_name_ns_charm(self):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "simple-ns-charm-abc-000-rrrr-nnnn-4444-hhh-3333-yyyy-333-hhh-ttt-444",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {}
+ vnf_count = ""
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "simple-ns-charm-abc-z000-rrrr-nnnn-z4444-h-ns"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with("ns-level", None)
+ self.db.get_one.assert_called_once()
+
+ def test_get_application_name_ns_charm_empty_charm_name(self):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "charm_name": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {}
+ vnf_count = ""
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ with self.assertRaises(N2VCException):
+ self.n2vc._get_application_name(namespace)
+ mock_vnf_count_and_record.assert_called_once_with("ns-level", None)
+ self.db.get_one.assert_called_once()
+
+ @patch(
+ "n2vc.n2vc_juju_conn.generate_random_alfanum_string",
+ **{"return_value": "random"}
+ )
+ def test_get_application_name_ns_charm_old_naming(
+ self, mock_generate_random_alfanum
+ ):
+ namespace = ".dbfbd751-3de4-4e68-bd40-ec5ae0a53898"
+ self.db.get_one.return_value = {
+ "_admin": {
+ "deployed": {
+ "VCA": [
+ {
+ "target_element": "ns",
+ "member-vnf-index": None,
+ "vdu_id": None,
+ "kdu_name": None,
+ "vdu_count_index": None,
+ "vnfd_id": "",
+ "vdu_name": "",
+ "ee_descriptor_id": "",
+ "model": "dbfbd751-3de4-4e68-bd40-ec5ae0a53898",
+ }
+ ]
+ }
+ }
+ }
+ mock_vnf_count_and_record = MagicMock()
+ db_vnfr = {}
+ vnf_count = ""
+ mock_vnf_count_and_record.return_value = (vnf_count, db_vnfr)
+ expected_result = "app-random"
+ with patch.object(self.n2vc, "db", self.db), patch.object(
+ self.n2vc, "_get_vnf_count_and_record", mock_vnf_count_and_record
+ ):
+ application_name = self.n2vc._get_application_name(namespace)
+ self.assertEqual(application_name, expected_result)
+ self.assertLess(len(application_name), 50)
+ mock_vnf_count_and_record.assert_called_once_with("ns-level", None)
+ self.db.get_one.assert_called_once()
+
+
+class DeleteExecutionEnvironmentTest(N2VCJujuConnTestCase):
+ def setUp(self):
+ super(DeleteExecutionEnvironmentTest, self).setUp()
+ self.n2vc.libjuju.get_controller = AsyncMock()
+ self.n2vc.libjuju.destroy_model = AsyncMock()
+ self.n2vc.libjuju.destroy_application = AsyncMock()
+
+ def test_remove_ee__target_application_exists__model_is_deleted(self):
+ get_ee_id_components = MagicMock()
+ get_ee_id_components.return_value = ("my_model", "my_app", None)
+ model = MagicMock(create_autospec=True)
+ model.applications = {}
+ self.n2vc.libjuju.get_model = AsyncMock()
+ self.n2vc.libjuju.get_model.return_value = model
+ with patch.object(self.n2vc, "_get_ee_id_components", get_ee_id_components):
+ self.loop.run_until_complete(
+ self.n2vc.delete_execution_environment(
+ "my_ee", application_to_delete="my_app"
+ )
+ )
+ self.n2vc.libjuju.destroy_application.assert_called_with(
+ model_name="my_model",
+ application_name="my_app",
+ total_timeout=None,
+ )
+ self.n2vc.libjuju.destroy_model.assert_called_with(
+ model_name="my_model",
+ total_timeout=None,
+ )
+
+ def test_remove_ee__multiple_applications_exist__model_is_not_deleted(self):
+ get_ee_id_components = MagicMock()
+ get_ee_id_components.return_value = ("my_model", "my_app", None)
+ model = MagicMock(create_autospec=True)
+ model.applications = {MagicMock(create_autospec=True)}
+ self.n2vc.libjuju.get_model = AsyncMock()
+ self.n2vc.libjuju.get_model.return_value = model
+ with patch.object(self.n2vc, "_get_ee_id_components", get_ee_id_components):
+ self.loop.run_until_complete(
+ self.n2vc.delete_execution_environment(
+ "my_ee", application_to_delete="my_app"
+ )
+ )
+ self.n2vc.libjuju.destroy_application.assert_called_with(
+ model_name="my_model",
+ application_name="my_app",
+ total_timeout=None,
+ )
+ self.n2vc.libjuju.destroy_model.assert_not_called()
+
+ def test_remove_ee__target_application_does_not_exist__model_is_deleted(self):
+ get_ee_id_components = MagicMock()
+ get_ee_id_components.return_value = ("my_model", "my_app", None)
+ with patch.object(self.n2vc, "_get_ee_id_components", get_ee_id_components):
+ self.loop.run_until_complete(
+ self.n2vc.delete_execution_environment("my_ee")
+ )
+ self.n2vc.libjuju.destroy_model.assert_called_with(
+ model_name="my_model",
+ total_timeout=None,
+ )
self.vca_collection.find_one = AsyncMock()
self.vca_collection.insert_one = AsyncMock()
self.vca_collection.replace_one = AsyncMock()
+ self.encryption = Mock()
+ self.encryption.admin_collection = Mock()
+ self.encryption.admin_collection.find_one = AsyncMock()
self.admin_collection = Mock()
self.admin_collection.find_one = AsyncMock()
self.admin_collection.insert_one = AsyncMock()
self.admin_collection.replace_one = AsyncMock()
self.vim_accounts_collection = Mock()
self.vim_accounts_collection.find_one = AsyncMock()
+ self.store.encryption._client = {
+ "osm": {
+ "admin": self.encryption.admin_collection,
+ }
+ }
self.store._client = {
"osm": {
"vca": self.vca_collection,
}
}
self.store._config = {"database_commonkey": "osm"}
- # self.store.decrypt_fields = Mock()
+ self.store.encryption._config = {"database_commonkey": "osm"}
self.loop = asyncio.get_event_loop()
@patch("n2vc.vca.connection_data.base64_to_cacert")
db_find_one = conn_data.copy()
db_find_one.update({"schema_version": "1.1", "_id": "id"})
self.vca_collection.find_one.return_value = db_find_one
- self.store.decrypt_fields = AsyncMock()
+ self.store.encryption.decrypt_fields = AsyncMock()
connection_data = self.loop.run_until_complete(
self.store.get_vca_connection_data("vca_id")
)
encrypted_secret = "kI46kRJh828ExSNpr16OG/q5a5/qTsE0bsHrv/W/2/g="
cacert = "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUQ4ekNDQWx1Z0F3SUJBZ0lVRWlzTTBoQWxiYzQ0Z1ZhZWh6bS80ZUsyNnRZd0RRWUpLb1pJaHZjTkFRRUwKQlFBd0lURU5NQXNHQTFVRUNoTUVTblZxZFRFUU1BNEdBMVVFQXhNSGFuVnFkUzFqWVRBZUZ3MHlNVEEwTWpNeApNRFV3TXpSYUZ3MHpNVEEwTWpNeE1EVTFNelJhTUNFeERUQUxCZ05WQkFvVEJFcDFhblV4RURBT0JnTlZCQU1UCkIycDFhblV0WTJFd2dnR2lNQTBHQ1NxR1NJYjNEUUVCQVFVQUE0SUJqd0F3Z2dHS0FvSUJnUUNhTmFvNGZab2gKTDJWYThtdy9LdCs3RG9tMHBYTlIvbEUxSHJyVmZvbmZqZFVQV01zSHpTSjJZZXlXcUNSd3BiaHlLaE82N1c1dgpUY2RsV3Y3WGFLTGtsdVkraDBZY3BQT3BFTmZZYmxrNGk0QkV1L0wzYVY5MFFkUFFrMG94S01CS2R5QlBNZVNNCkJmS2pPWXdyOGgzM0ZWUWhmVkJnMXVGZ2tGaDdTamNuNHczUFdvc1BCMjNiVHBCbGR3VE9zemN4Qm9TaDNSVTkKTzZjb3lQdDdEN0drOCtHRlA3RGRUQTdoV1RkaUM4cDBkeHp2RUNmY0psMXNFeFEyZVprS1QvVzZyelNtVDhUTApCM0ErM1FDRDhEOEVsQU1IVy9zS25SeHphYU8welpNVmVlQnRnNlFGZ1F3M0dJMGo2ZTY0K2w3VExoOW8wSkZVCjdpUitPY01xUzVDY0NROGpWV3JPSk9Xc2dEbDZ4T2FFREczYnR5SVJHY29jbVcvcEZFQjNZd1A2S1BRTUIrNXkKWDdnZExEWmFGRFBVakZmblhkMnhHdUZlMnpRTDNVbXZEUkZuUlBBaW02QlpQbWo1OFh2emFhZXROa3lyaUZLZwp4Z0Z1dVpTcDUwV2JWdjF0MkdzOTMrRE53NlhFZHRFYnlWWUNBa28xTTY0MkozczFnN3NoQnRFQ0F3RUFBYU1qCk1DRXdEZ1lEVlIwUEFRSC9CQVFEQWdLa01BOEdBMVVkRXdFQi93UUZNQU1CQWY4d0RRWUpLb1pJaHZjTkFRRUwKQlFBRGdnR0JBRXYxM2o2ZGFVbDBqeERPSnNTV1ZJZS9JdXNXVTRpN2ZXSWlqMHAwRU1GNS9LTE8yemRndTR5SQoreVd2T3N5aVFPanEzMlRYVlo2bTRDSnBkR1dGVE5HK2lLdXVOU3M0N3g3Q3dmVUNBWm5VVzhyamd3ZWJyS3BmCkJMNEVQcTZTcW0rSmltN0VPankyMWJkY2cyUXdZb3A3eUhvaHcveWEvL0l6RTMzVzZxNHlJeEFvNDBVYUhPTEMKTGtGbnNVYitjcFZBeFlPZGp6bjFzNWhnclpuWXlETEl3WmtIdFdEWm94alUzeC9jdnZzZ1FzLytzTWYrRFU4RgpZMkJKRHJjQ1VQM2xzclc0QVpFMFplZkEwOTlncFEvb3dSN0REYnMwSjZUeFM4NGt6Tldjc1FuWnRraXZheHJNClkyVHNnaWVndFExVFdGRWpxLy9sUFV4emJCdmpnd1FBZm5CQXZGeVNKejdTa0VuVm5rUXJGaUlUQVArTHljQVIKMlg4UFI2ZGI1bEt0SitBSENDM3kvZmNQS2k0ZzNTL3djeXRRdmdvOXJ6ODRFalp5YUNTaGJXNG9jNzNrMS9RcAowQWtHRDU0ZGVDWWVPYVJNbW96c0w3ZzdxWkpFekhtODdOcVBYSy9EZFoweWNxaVFhMXY2T3QxNjdXNUlzMUkzCjBWb0IzUzloSlE9PQotLS0tLUVORCBDRVJUSUZJQ0FURS0tLS0tCgo=" # noqa: E501
encrypted_cacert = "QeV4evTLXzcKwZZvmXQ/OvSHToXH3ISwfoLmU+Q9JlQWAFUHSJ9IhO0ewaQrJmx3NkfFb7NCxsQhh+wE57zDW4rWgn4w/SWkzvwSi1h2xYOO3ECEHzzVqgUm15Sk0xaj1Fv9Ed4hipf6PRijeOZ7A1G9zekr1w9WIvebMyJZrK+f6QJ8AP20NUZqG/3k+MeJr3kjrl+8uwU5aPOrHAexSQGAqSKTkWzW7glmlyMWTjwkuSgNVgFg0ctdWTZ5JnNwxXbpjwIKrC4E4sIHcxko2vsTeLF8pZFPk+3QUZIg8BrgtyM3lJC2kO1g3emPQhCIk3VDb5GBgssc/GyFyRXNS651d5BNgcABOKZ4Rv/gGnprB35zP7TKJKkST44XJTEBiugWMkSZg+T9H98/l3eE34O6thfTZXgIyG+ZM6uGlW2XOce0OoEIyJiEL039WJe3izjbD3b9sCCdgQc0MgS+hTaayJI6oCUWPsJLmRji19jLi/wjOsU5gPItCFWw3pBye/A4Zf8Hxm+hShvqBnk8R2yx1fPTiyw/Zx4Jn8m49XQJyjDSZnhIck0PVHR9xWzKCr++PKljLMLdkdFxVRVPFQk/FBbesqofjSXsq9DASY6ACTL3Jmignx2OXD6ac4SlBqCTjV2dIM0yEgZF7zwMNCtppRdXTV8S29JP4W2mfaiqXCUSRTggv8EYU+9diCE+8sPB6HjuLrsfiySbFlYR2m4ysDGXjsVx5CDAf0Nh4IRfcSceYnnBGIQ2sfgGcJFOZoJqr/QeE2NWz6jlWYbWT7MjS/0decpKxP7L88qrR+F48WXQvfsvjWgKjlMKw7lHmFF8FeY836VWWICTRZx+y6IlY1Ys2ML4kySF27Hal4OPhOOoBljMNMVwUEvBulOnKUWw4BGz8eGCl8Hw6tlyJdC7kcBj/aCyNCR/NnuDk4Wck6e//He8L6mS83OJi/hIFc8vYQxnCJMXj9Ou7wr5hxtBnvxXzZM3kFHxCDO24Cd5UyBV9GD8TiQJfBGAy7a2BCBMb5ESVX8NOkyyv2hXMHOjpnKhUM9yP3Ke4CBImO7mCKJNHdFVtAmuyVKJ+jT6ooAAArkX2xwEAvBEpvGNmW2jgs6wxSuKY0h5aUm0rA4v/s8fqSZhzdInB54sMldyAnt9G+9e+g933DfyA/tkc56Ed0vZ/XEvTkThVHyUbfYR/Gjsoab1RpnDBi4aZ2E7iceoBshy+L6NXdL0jlWEs4ZubiWlbVNWlN/MqJcjV/quLU7q4HtkG0MDEFm6To3o48x7xpv8otih6YBduNqBFnwQ6Qz9rM2chFgOR4IgNSZKPxHO0AGCi1gnK/CeCvrSfWYAMn+2rmw0hMZybqKMStG28+rXsKDdqmy6vAwL/+dJwkAW+ix68rWRXpeqHlWidu4SkIBELuwEkFIC/GJU/DRvcN2GG9uP1m+VFifCIS2UdiO4OVrP6PVoW1O+jBJvFH3K1YT7CRqevb9OzjS9fO1wjkOff0W8zZyJK9Mp25aynpf0k3oMpZDpjnlOsFXFUb3N6SvXD1Yi95szIlmsr5yRYaeGUJH7/SAmMr8R6RqsCR0ANptL2dtRoGPi/qcDQE15vnjJ+QMYCg9KbCdV+Qq5di93XAjmwPj6tKZv0aXQuaTZgYR7bdLmAnJaFLbHWcQG1k6F/vdKNEb7llLsoAD9KuKXPZT/LErIyKcI0RZySy9yvhTZb4jQWn17b83yfvqfd5/2NpcyaY4gNERhDRJHw7VhoS5Leai5ZnFaO3C1vU9tIJ85XgCUASTsBLoQWVCKPSQZGxzF7PVLnHui3YA5OsOQpVqAPtgGZ12tP9XkEKj+u2/Atj2bgYrqBF7zUL64X/AQpwr/UElWDhJLSD/KStVeDOUx3AwAVVi9eTUJr6NiNMutCE1sqUf9XVIddgZ/BaG5t3NV2L+T+11QzAl+Xrh8wH/XeUCTmnU3NGkvCz/9Y7PMS+qQL7T7WeGdYmEhb5s/5p/yjSYeqybr5sANOHs83OdeSXbop9cLWW+JksHmS//rHHcrrJhZgCb3P0EOpEoEMCarT6sJq0V1Hwf/YNFdJ9V7Ac654ALS+a9ffNthMUEJeY21QMtNOrEg3QH5RWBPn+yOYN/f38tzwlT1k6Ec94y/sBmeQVv8rRzkkiMSXeAL5ATdJntq8NQq5JbvLQDNnZnHQthZt+uhcUf08mWlRrxxBUaE6xLppgMqFdYSjLGvgn/d8FZ9y7UCg5ZBhgP1rrRQL1COpNKKlJLf5laqwiGAucIDmzSbhO+MidSauDLWuv+fsdd2QYk98PHxqNrPYLrlAlABFi3JEApBm4IlrGbHxKg6dRiy7L1c9xWnAD7E3XrZrSc6DXvGRsjMXWoQdlp4CX5H3cdH9sjIE6akWqiwwrOP6QTbJcxmJGv/MVhsDVrVKmrKSn2H0/Us1fyYCHCOyCSc2L96uId8i9wQO1NXj+1PJmUq3tJ8U0TUwTblOEQdYej99xEI8EzsXLjNJHCgbDygtHBYd/SHToXH3ISwfoLmU+Q9JlS1woaUpVa5sdvbsr4BXR6J" # noqa: E501
-
self.vca_collection.find_one.return_value = {
"_id": "2ade7f0e-9b58-4dbd-93a3-4ec076185d39",
"schema_version": "1.11",
"secret": encrypted_secret,
"cacert": encrypted_cacert,
}
- self.admin_collection.find_one.return_value = {
+ self.encryption.admin_collection.find_one.return_value = {
"serial": b"l+U3HDp9td+UjQ+AN+Ypj/Uh7n3C+rMJueQNNxkIpWI="
}
connection_data = self.loop.run_until_complete(
from unittest import TestCase
-from n2vc.utils import Dict, EntityType, JujuStatusToOSM, N2VCDeploymentStatus
+from n2vc.utils import (
+ Dict,
+ EntityType,
+ JujuStatusToOSM,
+ N2VCDeploymentStatus,
+ get_ee_id_components,
+)
from juju.machine import Machine
from juju.application import Application
from juju.action import Action
osm_status = status["osm"]
self.assertTrue(juju_status in JujuStatusToOSM[entity_type])
self.assertEqual(osm_status, JujuStatusToOSM[entity_type][juju_status])
+
+
+class GetEEComponentTest(TestCase):
+ def test_valid(self):
+ model, application, machine = get_ee_id_components("model.application.machine")
+ self.assertEqual(model, "model")
+ self.assertEqual(application, "application")
+ self.assertEqual(machine, "machine")
+
+ def test_invalid(self):
+ with self.assertRaises(Exception):
+ get_ee_id_components("model.application.machine.1")
+ with self.assertRaises(Exception):
+ get_ee_id_components("model.application")
--- /dev/null
+# Copyright 2022 Whitestack, LLC
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+apiVersion: cert-manager.io/v1
+kind: Certificate
+metadata:
+ name: test-cert
+ namespace: osm
+spec:
+ secretName: test-cert-secret
+ privateKey:
+ rotationPolicy: Always
+ algorithm: ECDSA
+ size: 256
+ duration: 8760h
+ renewBefore: 2208h
+ subject:
+ organizations:
+ - osm
+ commonName: osm
+ isCA: false
+ usages:
+ - server auth
+ dnsNames:
+ - "*.osm"
+ - "*.osm.svc"
+ - "*.osm.svc.cluster"
+ - "*.osm.svc.cluster.local"
+ issuerRef:
+ name: ca-issuer
+ kind: ClusterIssuer
--- /dev/null
+# Copyright 2022 Canonical Ltd.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+db_nsrs_text = """
+---
+- _id: dbfbd751-3de4-4e68-bd40-ec5ae0a53898
+ name: k8s-ns
+ name-ref: k8s-ns
+ short-name: k8s-ns
+ admin-status: ENABLED
+ nsState: READY
+ currentOperation: IDLE
+ currentOperationID: null
+ errorDescription: null
+ errorDetail: null
+ deploymentStatus: null
+ configurationStatus:
+ - elementType: VNF
+ elementUnderConfiguration: 1b6a4eb3-4fbf-415e-985c-4aeb3161eec0
+ status: READY
+ - elementType: VNF
+ elementUnderConfiguration: 17892d73-aa19-4b87-9a00-1d094f07a6b3
+ status: READY
+ vcaStatus: null
+ nsd:
+ _id: 12f320b5-2a57-40f4-82b5-020a6b1171d7
+ id: k8s_proxy_charm-ns
+ version: '1.0'
+ name: k8s_proxy_charm-ns
+ vnfd-id:
+ - k8s_proxy_charm-vnf
+ virtual-link-desc:
+ - id: mgmtnet
+ mgmt-network: true
+ - id: datanet
+ df:
+ - id: default-df
+ vnf-profile:
+ - id: vnf1
+ virtual-link-connectivity:
+ - constituent-cpd-id:
+ - constituent-base-element-id: vnf1
+ constituent-cpd-id: vnf-mgmt-ext
+ virtual-link-profile-id: mgmtnet
+ - constituent-cpd-id:
+ - constituent-base-element-id: vnf1
+ constituent-cpd-id: vnf-data-ext
+ virtual-link-profile-id: datanet
+ vnfd-id: k8s_proxy_charm-vnf
+ - id: vnf2
+ virtual-link-connectivity:
+ - constituent-cpd-id:
+ - constituent-base-element-id: vnf2
+ constituent-cpd-id: vnf-mgmt-ext
+ virtual-link-profile-id: mgmtnet
+ - constituent-cpd-id:
+ - constituent-base-element-id: vnf2
+ constituent-cpd-id: vnf-data-ext
+ virtual-link-profile-id: datanet
+ vnfd-id: k8s_proxy_charm-vnf
+ description: NS with 2 VNFs with cloudinit connected by datanet and mgmtnet VLs
+ _admin:
+ userDefinedData: {}
+ revision: 1
+ created: 1658990740.88281
+ modified: 1658990741.09266
+ projects_read:
+ - 51e0e80fe533469d98766caa16552a3e
+ projects_write:
+ - 51e0e80fe533469d98766caa16552a3e
+ onboardingState: ONBOARDED
+ operationalState: ENABLED
+ usageState: NOT_IN_USE
+ storage:
+ fs: mongo
+ path: /app/storage/
+ folder: '12f320b5-2a57-40f4-82b5-020a6b1171d7:1'
+ pkg-dir: k8s_proxy_charm_ns
+ descriptor: k8s_proxy_charm_ns/k8s_proxy_charm_nsd.yaml
+ zipfile: k8s_proxy_charm_ns.tar.gz
+ datacenter: bad7338b-ae46-43d4-a434-c3337a8054ac
+ resource-orchestrator: osmopenmano
+ description: default description
+ constituent-vnfr-ref:
+ - 1b6a4eb3-4fbf-415e-985c-4aeb3161eec0
+ - 17892d73-aa19-4b87-9a00-1d094f07a6b3
+ operational-status: running
+ config-status: configured
+ detailed-status: Done
+ orchestration-progress: {}
+ create-time: 1658998097.57611
+ nsd-name-ref: k8s_proxy_charm-ns
+ operational-events: []
+ nsd-ref: k8s_proxy_charm-ns
+ nsd-id: 12f320b5-2a57-40f4-82b5-020a6b1171d7
+ vnfd-id:
+ - 6d9e1ca1-f387-4d01-9876-066fc7311e0f
+ instantiate_params:
+ nsdId: 12f320b5-2a57-40f4-82b5-020a6b1171d7
+ nsName: k8s-ns
+ nsDescription: default description
+ vimAccountId: bad7338b-ae46-43d4-a434-c3337a8054ac
+ vld:
+ - name: mgmtnet
+ vim-network-name: osm-ext
+ additionalParamsForNs: null
+ ns-instance-config-ref: dbfbd751-3de4-4e68-bd40-ec5ae0a53898
+ id: dbfbd751-3de4-4e68-bd40-ec5ae0a53898
+ ssh-authorized-key: null
+ flavor:
+ - id: '0'
+ memory-mb: 1024
+ name: mgmtVM-flv
+ storage-gb: '10'
+ vcpu-count: 1
+ vim_info:
+ 'vim:bad7338b-ae46-43d4-a434-c3337a8054ac':
+ vim_details: null
+ vim_id: 17a9ba76-beb7-4ad4-a481-97de37174866
+ vim_status: DONE
+ - vcpu-count: 1
+ memory-mb: 1024
+ storage-gb: '10'
+ name: mgmtVM-flv
+ id: '1'
+ image:
+ - id: '0'
+ image: ubuntu18.04
+ vim_info:
+ 'vim:bad7338b-ae46-43d4-a434-c3337a8054ac':
+ vim_details: null
+ vim_id: 919fc71a-6acd-4ee3-8123-739a9abbc2e7
+ vim_status: DONE
+ - image: 'Canonical:UbuntuServer:18.04-LTS:latest'
+ vim-type: azure
+ id: '1'
+ - image: 'ubuntu-os-cloud:image-family:ubuntu-1804-lts'
+ vim-type: gcp
+ id: '2'
+ - image: ubuntu/images/hvm-ssd/ubuntu-artful-17.10-amd64-server-20180509
+ vim-type: aws
+ id: '3'
+ affinity-or-anti-affinity-group: []
+ revision: 1
+ vld:
+ - id: mgmtnet
+ mgmt-network: true
+ name: mgmtnet
+ type: null
+ vim_info:
+ 'vim:bad7338b-ae46-43d4-a434-c3337a8054ac':
+ vim_account_id: bad7338b-ae46-43d4-a434-c3337a8054ac
+ vim_network_name: osm-ext
+ vim_details: >
+ {admin_state_up: true, availability_zone_hints: [],
+ availability_zones: [nova], created_at: '2019-10-17T23:44:03Z',
+ description: '', encapsulation: vlan, encapsulation_id: 2148,
+ encapsulation_type: vlan, id: 21ea5d92-24f1-40ab-8d28-83230e277a49,
+ ipv4_address_scope: null,
+ ipv6_address_scope: null, is_default: false, mtu: 1500, name: osm-ext, port_security_enabled: true, project_id: 456b6471010b4737b47a0dd599c920c5, 'provider:network_type': vlan, 'provider:physical_network': physnet1, 'provider:segmentation_id': 2148, revision_number: 1009,
+ 'router:external': true, segmentation_id: 2148, shared: true, status: ACTIVE, subnets: [{subnet: {allocation_pools: [{end: 172.21.249.255, start: 172.21.248.1}], cidr: 172.21.248.0/22, created_at: '2019-10-17T23:44:07Z', description: '', dns_nameservers: [],
+ enable_dhcp: true, gateway_ip: 172.21.251.254, host_routes: [], id: d14f68b7-8287-41fe-b533-dafb2240680a, ip_version: 4, ipv6_address_mode: null, ipv6_ra_mode: null, name: osm-ext-subnet, network_id: 21ea5d92-24f1-40ab-8d28-83230e277a49, project_id: 456b6471010b4737b47a0dd599c920c5,
+ revision_number: 5, service_types: [], subnetpool_id: null, tags: [], tenant_id: 456b6471010b4737b47a0dd599c920c5, updated_at: '2020-09-14T15:15:06Z'}}], tags: [], tenant_id: 456b6471010b4737b47a0dd599c920c5, type: data, updated_at: '2022-07-05T18:39:02Z'}
+ vim_id: 21ea5d92-24f1-40ab-8d28-83230e277a49
+ vim_status: ACTIVE
+ - id: datanet
+ mgmt-network: false
+ name: datanet
+ type: null
+ vim_info:
+ 'vim:bad7338b-ae46-43d4-a434-c3337a8054ac':
+ vim_account_id: bad7338b-ae46-43d4-a434-c3337a8054ac
+ vim_network_name: null
+ vim_details: >
+ {admin_state_up: true, availability_zone_hints: [],
+ availability_zones: [nova], created_at: '2022-07-28T08:41:59Z',
+ description: '', encapsulation: vxlan, encapsulation_id: 27,
+ encapsulation_type: vxlan, id: 34056287-3cd5-42cb-92d3-413382b50813,
+ ipv4_address_scope: null,
+ ipv6_address_scope: null, mtu: 1450, name: k8s-ns-datanet, port_security_enabled: true, project_id: 71c7971a7cab4b72bd5c10dbe6617f1e, 'provider:network_type': vxlan, 'provider:physical_network': null, 'provider:segmentation_id': 27, revision_number: 2, 'router:external': false,
+ segmentation_id: 27, shared: false, status: ACTIVE, subnets: [{subnet: {allocation_pools: [{end: 192.168.181.254, start: 192.168.181.1}], cidr: 192.168.181.0/24, created_at: '2022-07-28T08:41:59Z', description: '', dns_nameservers: [], enable_dhcp: true, gateway_ip: null,
+ host_routes: [], id: ab2920f8-881b-4bef-82a5-9582a7930786, ip_version: 4, ipv6_address_mode: null, ipv6_ra_mode: null, name: k8s-ns-datanet-subnet, network_id: 34056287-3cd5-42cb-92d3-413382b50813, project_id: 71c7971a7cab4b72bd5c10dbe6617f1e, revision_number: 0,
+ service_types: [], subnetpool_id: null, tags: [], tenant_id: 71c7971a7cab4b72bd5c10dbe6617f1e, updated_at: '2022-07-28T08:41:59Z'}}], tags: [], tenant_id: 71c7971a7cab4b72bd5c10dbe6617f1e, type: bridge, updated_at: '2022-07-28T08:41:59Z'}
+ vim_id: 34056287-3cd5-42cb-92d3-413382b50813
+ vim_status: ACTIVE
+ _admin:
+ created: 1658998097.58182
+ modified: 1658998193.42562
+ projects_read:
+ - 51e0e80fe533469d98766caa16552a3e
+ projects_write:
+ - 51e0e80fe533469d98766caa16552a3e
+ nsState: INSTANTIATED
+ current-operation: null
+ nslcmop: null
+ operation-type: null
+ deployed:
+ RO:
+ vnfd: []
+ operational-status: running
+ VCA:
+ - target_element: vnf/vnf1
+ member-vnf-index: vnf1
+ vdu_id: null
+ kdu_name: null
+ vdu_count_index: 0
+ operational-status: init
+ detailed-status: ''
+ step: initial-deploy
+ vnfd_id: k8s_proxy_charm-vnf
+ vdu_name: null
+ type: k8s_proxy_charm
+ ee_descriptor_id: simple-ee
+ charm_name: ''
+ ee_id: dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s.simple-ee-z0-vnf1-vnf.k8s
+ application: simple-ee-z0-vnf1-vnf
+ model: dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s
+ config_sw_installed: true
+ - target_element: vnf/vnf2
+ member-vnf-index: vnf2
+ vdu_id: null
+ kdu_name: null
+ vdu_count_index: 0
+ operational-status: init
+ detailed-status: ''
+ step: initial-deploy
+ vnfd_id: k8s_proxy_charm-vnf
+ vdu_name: null
+ type: k8s_proxy_charm
+ ee_descriptor_id: simple-ee
+ charm_name: ''
+ ee_id: dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s.simple-ee-z0-vnf2-vnf.k8s
+ application: simple-ee-z0-vnf2-vnf
+ model: dbfbd751-3de4-4e68-bd40-ec5ae0a53898-k8s
+ config_sw_installed: true
+ K8s: []
+"""
+
+db_vnfrs_text = """
+- _id: 1b6a4eb3-4fbf-415e-985c-4aeb3161eec0
+ id: 1b6a4eb3-4fbf-415e-985c-4aeb3161eec0
+ nsr-id-ref: dbfbd751-3de4-4e68-bd40-ec5ae0a53898
+ member-vnf-index-ref: vnf1
+ additionalParamsForVnf: null
+ created-time: 1658998097.58036
+ vnfd-ref: k8s_proxy_charm-vnf
+ vnfd-id: 6d9e1ca1-f387-4d01-9876-066fc7311e0f
+ vim-account-id: bad7338b-ae46-43d4-a434-c3337a8054ac
+ vca-id: null
+ vdur:
+ - _id: 38912ff7-5bdd-4228-911f-c2bee259c44a
+ additionalParams:
+ OSM:
+ count_index: 0
+ member_vnf_index: vnf1
+ ns_id: dbfbd751-3de4-4e68-bd40-ec5ae0a53898
+ vdu:
+ mgmtVM-0:
+ count_index: 0
+ interfaces:
+ dataVM-xe0:
+ name: dataVM-xe0
+ mgmtVM-eth0:
+ name: mgmtVM-eth0
+ vdu_id: mgmtVM
+ vdu_id: mgmtVM
+ vim_account_id: bad7338b-ae46-43d4-a434-c3337a8054ac
+ vnf_id: 1b6a4eb3-4fbf-415e-985c-4aeb3161eec0
+ vnfd_id: 6d9e1ca1-f387-4d01-9876-066fc7311e0f
+ vnfd_ref: k8s_proxy_charm-vnf
+ affinity-or-anti-affinity-group-id: []
+ alt-image-ids:
+ - '1'
+ - '2'
+ - '3'
+ cloud-init: '6d9e1ca1-f387-4d01-9876-066fc7311e0f:file:cloud-config.txt'
+ count-index: 0
+ id: 38912ff7-5bdd-4228-911f-c2bee259c44a
+ interfaces:
+ - external-connection-point-ref: vnf-mgmt-ext
+ internal-connection-point-ref: mgmtVM-eth0-int
+ mgmt-interface: true
+ mgmt-vnf: true
+ name: mgmtVM-eth0
+ ns-vld-id: mgmtnet
+ position: 1
+ type: PARAVIRT
+ compute_node: nfvisrv11
+ ip-address: 172.21.248.199
+ mac-address: 'fa:16:3e:4d:65:e9'
+ pci: null
+ vlan: 2148
+ - external-connection-point-ref: vnf-data-ext
+ internal-connection-point-ref: dataVM-xe0-int
+ name: dataVM-xe0
+ ns-vld-id: datanet
+ position: 2
+ type: PARAVIRT
+ compute_node: nfvisrv11
+ ip-address: 192.168.181.179
+ mac-address: 'fa:16:3e:ca:b5:d3'
+ pci: null
+ vlan: null
+ internal-connection-point:
+ - connection-point-id: mgmtVM-eth0-int
+ id: mgmtVM-eth0-int
+ name: mgmtVM-eth0-int
+ - connection-point-id: dataVM-xe0-int
+ id: dataVM-xe0-int
+ name: dataVM-xe0-int
+ ip-address: 172.21.248.199
+ ns-flavor-id: '0'
+ ns-image-id: '0'
+ ssh-access-required: true
+ ssh-keys:
+ - >
+ ssh-rsa
+ AAAAB3NzaC1yc2EAAAADAQABAAACAQDW3dtEDKfwZL0WZp6LeJUZFlZzYAHP7M4AsJwl2YFO/wmblfrTpWZ8tRyGwyjQacB7Zb7J07wD5AZACE71A3Nc9zjI22/gWN7N8X+ZxH6ywcr1GdXBqZDBeOdzD4pRb11E9mydGZ9l++KtFRtlF4G7IFYuxkOiSCJrkgiKuVDGodtQ/6VUKwxuI8U6N7MxtIBN2L3IfvMwuNyTo1daiUabQMwQKt/Q8Zpp78zsZ6SoxU+eYAHzbeTjAfNwhA88nRzRZn7tQW+gWl9wbSINbr2+JetTN+BTot/CMPmKzzul9tZrzhSzck1QSM3UDrD36ctRdaLABnWCoxpm0wJthNt693xVrFP+bMgK2BR0fyu9WwVEcHkC9CZ8yoi37k5rGVtoDw6sW6lxQ5QKS+Plv/YjGKqK3Ro/UoIEhgxcW53uz4PveyMBss4geB9ad/1T8dtugd288qfCWJRBpJBrE497EalhHolF3L/2bEu3uCKN0TY4POzqP/5cuAUc/uTJ2mjZewJdlJtrn7IyFtSUypeuVmXRx5LwByQw9EwPhUZlKVjYEHYmu5YTKlFSWyorWgRLBBIK7LLPj+bCGgLeT+fXmip6eFquAyVtoQfDofQ/gc0OXEA1uKfK2VFKg1le+joz1WA/XieGSvKRQ4aZorYgi/FzbpxKj2a60cZubJMq5w==
+ root@lcm-7b6bcf7cdd-5h2ql
+ - >-
+ ssh-rsa
+ AAAAB3NzaC1yc2EAAAADAQABAAABAQDtg65/Jh3KDWC9+YzkTz8Md/uhalkjPo15DSxlUNWzYQNFUzaG5Pt0trDwQ29UOQIUy1CB9HpWSZMTA1ESet/+cyXWkZ9MznAmGLQBdnwqWU792UQf6rv74Zpned8MbnKQXfs8gog1ZFFKRMcwitNRqs8xs8XsPLE/l1Jo2QemhM0fIRofjJiLKYaKeGP59Fb8UlIeGDaxmIFgLs8bAZvrmjbae3o4b1fZDNboqlQbHb9rakxI9uCnsaBrCmelXpP9EFmENx85vdHEwCAfCRvSWKnbXuOojJJzFM5odoWFZo8AuIhEb5ZiLkGet3CvCfWZZPpQc4TuNDaY0t1XUegH
+ juju-client-key
+ vdu-id-ref: mgmtVM
+ vdu-name: mgmtVM
+ vim_info:
+ 'vim:bad7338b-ae46-43d4-a434-c3337a8054ac':
+ interfaces:
+ - vim_info: >
+ {admin_state_up: true, allowed_address_pairs: [],
+ 'binding:host_id': nfvisrv11, 'binding:profile': {},
+ 'binding:vif_details': {bridge_name: br-int, connectivity: l2,
+ datapath_type: system, ovs_hybrid_plug: true, port_filter: true},
+ 'binding:vif_type': ovs, 'binding:vnic_type': normal,
+ created_at: '2022-07-28T08:42:04Z', description: '', device_id: 1fabddca-0dcf-4702-a5f3-5cc028c2aba7, device_owner: 'compute:nova', extra_dhcp_opts: [], fixed_ips: [{ip_address: 172.21.248.199, subnet_id: d14f68b7-8287-41fe-b533-dafb2240680a}], id: e053d44f-1d67-4274-b85d-1cef243353d6,
+ mac_address: 'fa:16:3e:4d:65:e9', name: mgmtVM-eth0, network_id: 21ea5d92-24f1-40ab-8d28-83230e277a49, port_security_enabled: true, project_id: 71c7971a7cab4b72bd5c10dbe6617f1e, revision_number: 4, security_groups: [1de4b2c2-e4be-4e91-985c-d887e2715949], status: ACTIVE,
+ tags: [], tenant_id: 71c7971a7cab4b72bd5c10dbe6617f1e, updated_at: '2022-07-28T08:42:16Z'}
+ mac_address: 'fa:16:3e:4d:65:e9'
+ vim_net_id: 21ea5d92-24f1-40ab-8d28-83230e277a49
+ vim_interface_id: e053d44f-1d67-4274-b85d-1cef243353d6
+ compute_node: nfvisrv11
+ pci: null
+ vlan: 2148
+ ip_address: 172.21.248.199
+ mgmt_vnf_interface: true
+ mgmt_vdu_interface: true
+ - vim_info: >
+ {admin_state_up: true, allowed_address_pairs: [],
+ 'binding:host_id': nfvisrv11, 'binding:profile': {},
+ 'binding:vif_details': {bridge_name: br-int, connectivity: l2,
+ datapath_type: system, ovs_hybrid_plug: true, port_filter: true},
+ 'binding:vif_type': ovs, 'binding:vnic_type': normal,
+ created_at: '2022-07-28T08:42:04Z', description: '', device_id: 1fabddca-0dcf-4702-a5f3-5cc028c2aba7, device_owner: 'compute:nova', extra_dhcp_opts: [], fixed_ips: [{ip_address: 192.168.181.179, subnet_id: ab2920f8-881b-4bef-82a5-9582a7930786}], id: 8a34c944-0fc1-41ae-9dbc-9743e5988162,
+ mac_address: 'fa:16:3e:ca:b5:d3', name: dataVM-xe0, network_id: 34056287-3cd5-42cb-92d3-413382b50813, port_security_enabled: true, project_id: 71c7971a7cab4b72bd5c10dbe6617f1e, revision_number: 4, security_groups: [1de4b2c2-e4be-4e91-985c-d887e2715949], status: ACTIVE,
+ tags: [], tenant_id: 71c7971a7cab4b72bd5c10dbe6617f1e, updated_at: '2022-07-28T08:42:15Z'}
+ mac_address: 'fa:16:3e:ca:b5:d3'
+ vim_net_id: 34056287-3cd5-42cb-92d3-413382b50813
+ vim_interface_id: 8a34c944-0fc1-41ae-9dbc-9743e5988162
+ compute_node: nfvisrv11
+ pci: null
+ vlan: null
+ ip_address: 192.168.181.179
+ vim_details: >
+ {'OS-DCF:diskConfig': MANUAL, 'OS-EXT-AZ:availability_zone': nova,
+ 'OS-EXT-SRV-ATTR:host': nfvisrv11,
+ 'OS-EXT-SRV-ATTR:hypervisor_hostname': nfvisrv11,
+ 'OS-EXT-SRV-ATTR:instance_name': instance-0002967a,
+ 'OS-EXT-STS:power_state': 1, 'OS-EXT-STS:task_state': null,
+ 'OS-EXT-STS:vm_state': active, 'OS-SRV-USG:launched_at': '2022-07-28T08:42:17.000000', 'OS-SRV-USG:terminated_at': null, accessIPv4: '', accessIPv6: '', addresses: {k8s-ns-datanet: [{'OS-EXT-IPS-MAC:mac_addr': 'fa:16:3e:ca:b5:d3', 'OS-EXT-IPS:type': fixed,
+ addr: 192.168.181.179, version: 4}], osm-ext: [{'OS-EXT-IPS-MAC:mac_addr': 'fa:16:3e:4d:65:e9', 'OS-EXT-IPS:type': fixed, addr: 172.21.248.199, version: 4}]}, config_drive: '', created: '2022-07-28T08:42:06Z', flavor: {id: 17a9ba76-beb7-4ad4-a481-97de37174866,
+ links: [{href: 'http://172.21.247.1:8774/flavors/17a9ba76-beb7-4ad4-a481-97de37174866', rel: bookmark}]}, hostId: 2aa7155bd281bd308d8e3776af56d428210c21aab788a8cbdf5ef500, id: 1fabddca-0dcf-4702-a5f3-5cc028c2aba7, image: {id: 919fc71a-6acd-4ee3-8123-739a9abbc2e7,
+ links: [{href: 'http://172.21.247.1:8774/images/919fc71a-6acd-4ee3-8123-739a9abbc2e7', rel: bookmark}]}, key_name: null, links: [{href: 'http://172.21.247.1:8774/v2.1/servers/1fabddca-0dcf-4702-a5f3-5cc028c2aba7', rel: self}, {href: 'http://172.21.247.1:8774/servers/1fabddca-0dcf-4702-a5f3-5cc028c2aba7',
+ rel: bookmark}], metadata: {}, name: k8s-ns-vnf1-mgmtVM-0, 'os-extended-volumes:volumes_attached': [], progress: 0, security_groups: [{name: default}, {name: default}], status: ACTIVE, tenant_id: 71c7971a7cab4b72bd5c10dbe6617f1e, updated: '2022-07-28T08:42:17Z',
+ user_id: f043c84f940b4fc8a01a98714ea97c80}
+ vim_id: 1fabddca-0dcf-4702-a5f3-5cc028c2aba7
+ vim_status: ACTIVE
+ vim_name: k8s-ns-vnf1-mgmtVM-0
+ virtual-storages:
+ - id: mgmtVM-storage
+ size-of-storage: '10'
+ status: ACTIVE
+ vim-id: 1fabddca-0dcf-4702-a5f3-5cc028c2aba7
+ name: k8s-ns-vnf1-mgmtVM-0
+ connection-point:
+ - name: vnf-mgmt-ext
+ connection-point-id: mgmtVM-eth0-int
+ connection-point-vdu-id: mgmtVM
+ id: vnf-mgmt-ext
+ - name: vnf-data-ext
+ connection-point-id: dataVM-xe0-int
+ connection-point-vdu-id: mgmtVM
+ id: vnf-data-ext
+ ip-address: 172.21.248.199
+ revision: 1
+ _admin:
+ created: 1658998097.58048
+ modified: 1658998097.58048
+ projects_read:
+ - 51e0e80fe533469d98766caa16552a3e
+ projects_write:
+ - 51e0e80fe533469d98766caa16552a3e
+ nsState: INSTANTIATED
+"""
--- /dev/null
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+["charm", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "charm-url": "local:bionic/simple-ha-proxy-29", "charm-version": "", "life": "alive", "profile": null, "config": {"ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["application", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0", "exposed": false, "charm-url": "local:bionic/simple-ha-proxy-29", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"ssh-hostname": "172.21.249.28", "ssh-password": "osm4u", "ssh-username": "ubuntu"}, "subordinate": false, "status": {"current": "unset", "message": "", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.56175336Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:21:56.481875662Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.579802723Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:20:44.69125318Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.563068618Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:20:48.695716332Z", "version": "2.9.22"}}]
+["charm", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "charm-url": "local:bionic/simple-ha-proxy-28", "charm-version": "", "life": "dying", "profile": null, "config": {"ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["charm", "remove", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "charm-url": "local:bionic/simple-ha-proxy-28", "charm-version": "", "life": "dying", "profile": null, "config": {"ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.56175336Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T16:22:54.354997486Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.579802723Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T16:22:54.400387228Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.563068618Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T16:22:54.523797611Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.56175336Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.934760959Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.579802723Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.982259225Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Waiting for SSH credentials", "since": "2022-04-27T16:22:55.091278959Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.934760959Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-26T18:50:27.563068618Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:55.091697191Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Waiting for SSH credentials", "since": "2022-04-27T16:22:55.153254035Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.982259225Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Waiting for SSH credentials", "since": "2022-04-27T16:22:55.307204975Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:55.091697191Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:22:58.698041924Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:55.091697191Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:22:58.698041924Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-settings-changed hook", "since": "2022-04-27T16:22:59.098429743Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/1", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.4", "private-address": "10.37.209.4", "machine-id": "2", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:22:58.698041924Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:22:59.636191881Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:23:00.173022824Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.934760959Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:23:00.5376781Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T16:22:54.982259225Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/0", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.54", "private-address": "10.37.209.54", "machine-id": "1", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:23:00.173022824Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:23:00.529675913Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:23:00.5376781Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-settings-changed hook", "since": "2022-04-27T16:23:00.948967357Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "1ee18c0b-bd69-4e85-8ebc-01eec76c964d", "name": "app-vnf-7a49ace2b6-z0/2", "application": "app-vnf-7a49ace2b6-z0", "series": "bionic", "charm-url": "local:bionic/simple-ha-proxy-29", "life": "alive", "public-address": "10.37.209.93", "private-address": "10.37.209.93", "machine-id": "3", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T16:23:00.5376781Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T16:23:01.449283589Z", "version": "2.9.22"}}]
\ No newline at end of file
--- /dev/null
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/sshproxy-1", "charm-version": "", "life": "alive", "profile": null}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/sshproxy-1", "charm-version": "", "life": "alive", "profile": null, "config": {"apt-mirror": null, "security-apt-mirror": null, "ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy", "exposed": false, "charm-url": "local:kubernetes/sshproxy-1", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"ssh-hostname": "127.0.0.1", "ssh-password": "osm4u", "ssh-username": "ubuntu"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:06:37.951722352Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy", "exposed": false, "charm-url": "local:kubernetes/sshproxy-1", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"ssh-hostname": "127.0.0.1", "ssh-password": "osm4u", "ssh-username": "ubuntu"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:06:37.951722352Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy/0", "application": "sshproxy", "series": "kubernetes", "charm-url": "local:kubernetes/sshproxy-1", "life": "alive", "public-address": "", "private-address": "10.152.183.24", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:08:40.533982098Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:08:41.574108719Z", "version": ""}}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/sshproxy-0", "charm-version": "", "life": "dying", "profile": null, "config": {"apt-mirror": null, "security-apt-mirror": null, "ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["charm", "remove", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/sshproxy-0", "charm-version": "", "life": "dying", "profile": null, "config": {"apt-mirror": null, "security-apt-mirror": null, "ssh-hostname": "", "ssh-key-bits": 4096, "ssh-key-type": "rsa", "ssh-password": "", "ssh-public-key": "", "ssh-username": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy", "exposed": false, "charm-url": "local:kubernetes/sshproxy-1", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"ssh-hostname": "127.0.0.1", "ssh-password": "osm4u", "ssh-username": "ubuntu"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:06:37.951722352Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy/0", "application": "sshproxy", "series": "kubernetes", "charm-url": "local:kubernetes/sshproxy-1", "life": "alive", "public-address": "", "private-address": "10.152.183.24", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "Active", "since": "2022-04-27T18:09:49.713279872Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:09:48.529774773Z", "version": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy", "exposed": false, "charm-url": "local:kubernetes/sshproxy-1", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"ssh-hostname": "127.0.0.1", "ssh-password": "osm4u", "ssh-username": "ubuntu"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:06:37.951722352Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy/0", "application": "sshproxy", "series": "kubernetes", "charm-url": "local:kubernetes/sshproxy-1", "life": "alive", "public-address": "", "private-address": "10.152.183.24", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "Active", "since": "2022-04-27T18:09:49.713279872Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:09:50.760612389Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy/0", "application": "sshproxy", "series": "kubernetes", "charm-url": "local:kubernetes/sshproxy-1", "life": "alive", "public-address": "", "private-address": "10.152.183.24", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:09:51.90389784Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:09:50.760612389Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "sshproxy/0", "application": "sshproxy", "series": "kubernetes", "charm-url": "local:kubernetes/sshproxy-1", "life": "alive", "public-address": "", "private-address": "10.152.183.24", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:09:51.90389784Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:09:52.859465812Z", "version": ""}}]
\ No newline at end of file
--- /dev/null
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/mongodb-k8s-0", "charm-version": "", "life": "alive", "profile": null}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/mongodb-k8s-0", "charm-version": "", "life": "alive", "profile": null, "config": {"replica_set_name": "rs0"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:03:59.520286015Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:03:59.520286015Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T17:36:42.739482369Z", "version": ""}}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "charm-version": "", "life": "dying", "profile": null, "config": {"replica_set_name": "rs0"}}]
+["charm", "remove", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "charm-version": "", "life": "dying", "profile": null, "config": {"replica_set_name": "rs0"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:03:59.520286015Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:23:25.164370911Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Fetching image information", "since": "2022-04-27T18:23:26.17972471Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:23:25.164370911Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Assembling pod spec", "since": "2022-04-27T18:23:26.4876642Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:23:25.164370911Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:26.747039555Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:23:25.164370911Z", "version": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:03:59.520286015Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:26.747039555Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:23:27.665397171Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Fetching image information", "since": "2022-04-27T18:23:28.405317887Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:23:27.665397171Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "Assembling pod spec", "since": "2022-04-27T18:23:28.701544881Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:23:27.665397171Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:29.040857644Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:23:27.665397171Z", "version": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:03:59.520286015Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:29.040857644Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:23:29.956508325Z", "version": ""}}]
+##########################################################################################################################################################################################################################################################
+# These next events are visible on steful charm upgrade, but so far there is no method to link them to the overall upgrade change
+#["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:23:30.879168477Z", "version": ""}, "workload-version": ""}]
+#["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "waiting", "message": "", "since": "2022-04-27T18:23:33.296232835Z", "version": ""}, "workload-version": ""}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:29.040857644Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:23:29.956508325Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:29.040857644Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:23:29.956508325Z", "version": ""}}]
+#["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb", "exposed": false, "charm-url": "local:kubernetes/mongodb-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:23:53.480017079Z", "version": ""}, "workload-version": ""}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "local:kubernetes/mongodb-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:23:29.040857644Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:23:54.070335385Z", "version": ""}}]
\ No newline at end of file
--- /dev/null
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/osm-lcm-0", "charm-version": "", "life": "alive", "profile": null}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:kubernetes/osm-lcm-0", "charm-version": "", "life": "alive", "profile": null, "config": {"database_commonkey": "osm", "debug_common_local_path": null, "debug_lcm_local_path": null, "debug_mode": false, "debug_n2vc_local_path": null, "debug_pubkey": null, "image_pull_policy": "always", "log_level": "INFO", "mongodb_uri": null, "security_context": false, "vca_apiproxy": null, "vca_cacert": null, "vca_cloud": null, "vca_helm_ca_certs": "", "vca_host": null, "vca_k8s_cloud": null, "vca_model_config_agent_metadata_url": null, "vca_model_config_agent_stream": null, "vca_model_config_apt_ftp_proxy": null, "vca_model_config_apt_http_proxy": null, "vca_model_config_apt_https_proxy": null, "vca_model_config_apt_mirror": null, "vca_model_config_apt_no_proxy": null, "vca_model_config_automatically_retry_hooks": null, "vca_model_config_backup_dir": null, "vca_model_config_cloudinit_userdata": null, "vca_model_config_container_image_metadata_url": null, "vca_model_config_container_image_stream": null, "vca_model_config_container_inherit_properties": null, "vca_model_config_container_networking_method": null, "vca_model_config_default_series": null, "vca_model_config_default_space": null, "vca_model_config_development": null, "vca_model_config_disable_network_management": null, "vca_model_config_egress_subnets": null, "vca_model_config_enable_os_refresh_update": null, "vca_model_config_enable_os_upgrade": null, "vca_model_config_fan_config": null, "vca_model_config_firewall_mode": null, "vca_model_config_ftp_proxy": null, "vca_model_config_http_proxy": null, "vca_model_config_https_proxy": null, "vca_model_config_ignore_machine_addresses": null, "vca_model_config_image_metadata_url": null, "vca_model_config_image_stream": null, "vca_model_config_juju_ftp_proxy": null, "vca_model_config_juju_http_proxy": null, "vca_model_config_juju_https_proxy": null, "vca_model_config_juju_no_proxy": null, "vca_model_config_logforward_enabled": null, "vca_model_config_logging_config": null, "vca_model_config_lxd_snap_channel": null, "vca_model_config_max_action_results_age": null, "vca_model_config_max_action_results_size": null, "vca_model_config_max_status_history_age": null, "vca_model_config_max_status_history_size": null, "vca_model_config_net_bond_reconfigure_delay": null, "vca_model_config_no_proxy": null, "vca_model_config_provisioner_harvest_mode": null, "vca_model_config_proxy_ssh": null, "vca_model_config_snap_http_proxy": null, "vca_model_config_snap_https_proxy": null, "vca_model_config_snap_store_assertions": null, "vca_model_config_snap_store_proxy": null, "vca_model_config_snap_store_proxy_url": null, "vca_model_config_ssl_hostname_verification": null, "vca_model_config_test_mode": null, "vca_model_config_transmit_vendor_metrics": null, "vca_model_config_update_status_hook_interval": null, "vca_port": null, "vca_pubkey": null, "vca_secret": null, "vca_stablerepourl": "https://charts.helm.sh/stable", "vca_user": null}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:19:30.580696141Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:19:30.580696141Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:19:46.158217393Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-25T15:19:47.020240886Z", "version": ""}}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/kubernetes/osm-lcm-1", "charm-version": "", "life": "dying", "profile": null, "config": {"database_commonkey": "osm", "debug_common_local_path": null, "debug_lcm_local_path": null, "debug_mode": false, "debug_n2vc_local_path": null, "debug_pubkey": null, "image_pull_policy": "always", "log_level": "INFO", "mongodb_uri": null, "security_context": false, "vca_apiproxy": null, "vca_cacert": null, "vca_cloud": null, "vca_helm_ca_certs": "", "vca_host": null, "vca_k8s_cloud": null, "vca_model_config_agent_metadata_url": null, "vca_model_config_agent_stream": null, "vca_model_config_apt_ftp_proxy": null, "vca_model_config_apt_http_proxy": null, "vca_model_config_apt_https_proxy": null, "vca_model_config_apt_mirror": null, "vca_model_config_apt_no_proxy": null, "vca_model_config_automatically_retry_hooks": null, "vca_model_config_backup_dir": null, "vca_model_config_cloudinit_userdata": null, "vca_model_config_container_image_metadata_url": null, "vca_model_config_container_image_stream": null, "vca_model_config_container_inherit_properties": null, "vca_model_config_container_networking_method": null, "vca_model_config_default_series": null, "vca_model_config_default_space": null, "vca_model_config_development": null, "vca_model_config_disable_network_management": null, "vca_model_config_egress_subnets": null, "vca_model_config_enable_os_refresh_update": null, "vca_model_config_enable_os_upgrade": null, "vca_model_config_fan_config": null, "vca_model_config_firewall_mode": null, "vca_model_config_ftp_proxy": null, "vca_model_config_http_proxy": null, "vca_model_config_https_proxy": null, "vca_model_config_ignore_machine_addresses": null, "vca_model_config_image_metadata_url": null, "vca_model_config_image_stream": null, "vca_model_config_juju_ftp_proxy": null, "vca_model_config_juju_http_proxy": null, "vca_model_config_juju_https_proxy": null, "vca_model_config_juju_no_proxy": null, "vca_model_config_logforward_enabled": null, "vca_model_config_logging_config": null, "vca_model_config_lxd_snap_channel": null, "vca_model_config_max_action_results_age": null, "vca_model_config_max_action_results_size": null, "vca_model_config_max_status_history_age": null, "vca_model_config_max_status_history_size": null, "vca_model_config_net_bond_reconfigure_delay": null, "vca_model_config_no_proxy": null, "vca_model_config_provisioner_harvest_mode": null, "vca_model_config_proxy_ssh": null, "vca_model_config_snap_http_proxy": null, "vca_model_config_snap_https_proxy": null, "vca_model_config_snap_store_assertions": null, "vca_model_config_snap_store_proxy": null, "vca_model_config_snap_store_proxy_url": null, "vca_model_config_ssl_hostname_verification": null, "vca_model_config_test_mode": null, "vca_model_config_transmit_vendor_metrics": null, "vca_model_config_update_status_hook_interval": null, "vca_port": null, "vca_pubkey": null, "vca_secret": null, "vca_stablerepourl": "https://charts.helm.sh/stable", "vca_user": null}}]
+["charm", "remove", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/kubernetes/osm-lcm-1", "charm-version": "", "life": "dying", "profile": null, "config": {"database_commonkey": "osm", "debug_common_local_path": null, "debug_lcm_local_path": null, "debug_mode": false, "debug_n2vc_local_path": null, "debug_pubkey": null, "image_pull_policy": "always", "log_level": "INFO", "mongodb_uri": null, "security_context": false, "vca_apiproxy": null, "vca_cacert": null, "vca_cloud": null, "vca_helm_ca_certs": "", "vca_host": null, "vca_k8s_cloud": null, "vca_model_config_agent_metadata_url": null, "vca_model_config_agent_stream": null, "vca_model_config_apt_ftp_proxy": null, "vca_model_config_apt_http_proxy": null, "vca_model_config_apt_https_proxy": null, "vca_model_config_apt_mirror": null, "vca_model_config_apt_no_proxy": null, "vca_model_config_automatically_retry_hooks": null, "vca_model_config_backup_dir": null, "vca_model_config_cloudinit_userdata": null, "vca_model_config_container_image_metadata_url": null, "vca_model_config_container_image_stream": null, "vca_model_config_container_inherit_properties": null, "vca_model_config_container_networking_method": null, "vca_model_config_default_series": null, "vca_model_config_default_space": null, "vca_model_config_development": null, "vca_model_config_disable_network_management": null, "vca_model_config_egress_subnets": null, "vca_model_config_enable_os_refresh_update": null, "vca_model_config_enable_os_upgrade": null, "vca_model_config_fan_config": null, "vca_model_config_firewall_mode": null, "vca_model_config_ftp_proxy": null, "vca_model_config_http_proxy": null, "vca_model_config_https_proxy": null, "vca_model_config_ignore_machine_addresses": null, "vca_model_config_image_metadata_url": null, "vca_model_config_image_stream": null, "vca_model_config_juju_ftp_proxy": null, "vca_model_config_juju_http_proxy": null, "vca_model_config_juju_https_proxy": null, "vca_model_config_juju_no_proxy": null, "vca_model_config_logforward_enabled": null, "vca_model_config_logging_config": null, "vca_model_config_lxd_snap_channel": null, "vca_model_config_max_action_results_age": null, "vca_model_config_max_action_results_size": null, "vca_model_config_max_status_history_age": null, "vca_model_config_max_status_history_size": null, "vca_model_config_net_bond_reconfigure_delay": null, "vca_model_config_no_proxy": null, "vca_model_config_provisioner_harvest_mode": null, "vca_model_config_proxy_ssh": null, "vca_model_config_snap_http_proxy": null, "vca_model_config_snap_https_proxy": null, "vca_model_config_snap_store_assertions": null, "vca_model_config_snap_store_proxy": null, "vca_model_config_snap_store_proxy_url": null, "vca_model_config_ssl_hostname_verification": null, "vca_model_config_test_mode": null, "vca_model_config_transmit_vendor_metrics": null, "vca_model_config_update_status_hook_interval": null, "vca_port": null, "vca_pubkey": null, "vca_secret": null, "vca_stablerepourl": "https://charts.helm.sh/stable", "vca_user": null}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:19:30.580696141Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:19:46.158217393Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T13:52:43.299439405Z", "version": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-25T15:19:30.580696141Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:19:46.158217393Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T13:52:44.718162892Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "Assembling pod spec", "since": "2022-04-27T13:52:45.691682061Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T13:52:44.718162892Z", "version": ""}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "waiting", "message": "", "since": "2022-04-27T13:52:46.113865949Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T13:52:44.718162892Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "installing agent", "since": "2022-04-27T13:52:46.170916945Z", "version": ""}, "agent-status": {"current": "allocating", "message": "", "since": "2022-04-27T13:52:46.170916945Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:46.185629877Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "agent initializing", "since": "2022-04-27T13:52:46.396291377Z", "version": ""}, "agent-status": {"current": "allocating", "message": "", "since": "2022-04-27T13:52:46.170916945Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "waiting", "message": "agent initializing", "since": "2022-04-27T13:52:46.396291377Z", "version": ""}, "agent-status": {"current": "allocating", "message": "", "since": "2022-04-27T13:52:46.170916945Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:47.626524855Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:47.626524855Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:49.020057468Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:49.020057468Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "allocating", "message": "", "since": "2022-04-27T13:52:46.170916945Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running install hook", "since": "2022-04-27T13:52:50.406261397Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-created hook", "since": "2022-04-27T13:52:52.218957218Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "ro/0", "application": "ro", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/osm-ro-1", "life": "alive", "public-address": "", "private-address": "10.152.183.73", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:03:19.691982951Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-joined hook for lcm/10", "since": "2022-04-27T13:52:52.325816598Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "executing", "message": "running database-relation-joined hook for lcm/10", "since": "2022-04-27T13:52:52.333131271Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T17:38:51.675080168Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-joined hook for lcm/10", "since": "2022-04-27T13:52:52.343941917Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T17:38:51.675080168Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-changed hook for lcm/10", "since": "2022-04-27T13:52:53.180263675Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-created hook", "since": "2022-04-27T13:52:53.81029874Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T17:38:51.675080168Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:53.921515789Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "executing", "message": "running database-relation-changed hook for lcm/10", "since": "2022-04-27T13:52:54.095455492Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "ro/0", "application": "ro", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/osm-ro-1", "life": "alive", "public-address": "", "private-address": "10.152.183.73", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:03:19.691982951Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-changed hook for lcm/10", "since": "2022-04-27T13:52:54.485374136Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-created hook", "since": "2022-04-27T13:52:55.252323315Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "ro/0", "application": "ro", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/osm-ro-1", "life": "alive", "public-address": "", "private-address": "10.152.183.73", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:03:19.691982951Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:55.946718559Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:52:56.207634629Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-settings-changed hook", "since": "2022-04-27T13:52:56.781189067Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "installing charm software", "since": "2022-04-27T13:52:50.379089676Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T13:53:00.13054224Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T13:53:00.13054224Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running start hook", "since": "2022-04-27T13:53:02.069519075Z", "version": ""}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:03.159295668Z", "version": ""}}]
+##########################################################################################################################################################################################################################################################
+# These next events are visible on stateless charm upgrade, but so far there is no method to link them to the overall upgrade change
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:03.159295668Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:03.161083444Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-joined hook for mongodb/0", "since": "2022-04-27T13:53:03.638418924Z", "version": ""}}]
+#["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm", "exposed": false, "charm-url": "local:kubernetes/osm-lcm-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "config": {"database_commonkey": "osm", "debug_common_local_path": "/home/ubuntu/mark/git/osm/branches/master/common", "debug_lcm_local_path": "/home/ubuntu/mark/git/osm/branches/master/LCM", "debug_mode": true, "debug_n2vc_local_path": "/home/ubuntu/mark/git/osm/branches/master/N2VC", "debug_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUrOLpYylC9lRlIknpGeda2mzY+mqTYxLDj9Q5t2jerT/aHARSr7DBbkLroqb8bZLsHw3QSHOy9AjF7Y8z5HpkFHGL0do1A/a3MkY+TIX3+FVP8FuvSIb7fNofC2odH5Pj/5kY2TSQhGcsAeYejoYn6qQ0xElNJtWaoqPKkAe825TJkANc31YvokxYCbY9oHfzUPEXtS2nADJrn5drEgc/R8cAwPRNPs2EU/XT2u1m+UP5T9nHbFV9rjv7RhrezB1ynQ5IGsPteOCDIsLswLKpuSQ0JBpuYb6wKjzBlYYyMe1lQF+m9ZWEnywGzCEQncsOxF+GzSbxrrtTLOFgDAbT mark.beierl@canonical.com", "log_level": "DEBUG", "vca_cacert": "LS0tLS1CRUdJTiBDRVJUSUZJQ0FURS0tLS0tCk1JSUVFekNDQW51Z0F3SUJBZ0lWQU1iT21oMThUaFc3NDNlSGhIckZQL1JzcXd5U01BMEdDU3FHU0liM0RRRUIKQ3dVQU1DRXhEVEFMQmdOVkJBb1RCRXAxYW5VeEVEQU9CZ05WQkFNVEIycDFhblV0WTJFd0hoY05Nakl3TkRBNApNREl5TXpReldoY05Nekl3TkRBNE1ESXlPRFF6V2pBaE1RMHdDd1lEVlFRS0V3UktkV3AxTVJBd0RnWURWUVFECkV3ZHFkV3AxTFdOaE1JSUJvakFOQmdrcWhraUc5dzBCQVFFRkFBT0NBWThBTUlJQmlnS0NBWUVBMWJMYUMwemMKQzdKOGRSdkg0UEtSZzU5MEI0S0EzRXpTNXUxbW81QldLblBoQ3RPb1hIVU03ZnhvU2RlV1dKb0FKb0hWOFlaUApiVzF0MnBzZEtGbWlZYWxhdGNkUSs5VGU5dWMxbnRNRDRlTVFTSjVKQ0MrSW83SDdCSjY0bkV4dms4RWNmT0F3CnNxL1lvMnZJaHcwVTNDZk5LaWNPNHE4MW1jamlkc001Nmp3eHA2R05SaVY5bEszV2hXd0JKWjZMdkovUDZySDAKNU8yV2crK0pNOFMzdGlFV1N3SzhZTmxiYTVKUExkdnNPVkVWWVVsK0NUc0RpRGhzZ2hFSHU2RHBzSzd5dGw2aApWa3NFRjI4Y1krRmhhVXpXejk2d0JqM1M0UUdKQXV5K1dBWStnRVZZcXIrQ0dySkVNeEJLK0VPWjJ2MjJ1YW9iClJyNmo5dkZRQ2I5YVQ5RTV1SDRZWGhIelJ2YUZLQVB4b2J5OFFpR0cwRXJkZTA1ajFYU0NaS0EyMXEyODcvR2wKT0NWWUxMMVNBb1VIbUMzUEZGU25ycDYzdUxLSWVJVTAyb1o0L3JQODlnbUM4VXBJNXgxTEdKQXJ1OEd1NHltRApBR2FxSjNWdjQ0MjIyWEhJaThXZGdwUFNLZWpQeUlReW9HMHBuTTZRUk5KaUdYdXg5S3dIblV5bEFnTUJBQUdqClFqQkFNQTRHQTFVZER3RUIvd1FFQXdJQ3BEQVBCZ05WSFJNQkFmOEVCVEFEQVFIL01CMEdBMVVkRGdRV0JCU2cKM3VmTzhhajJCc2V2R0lMaEUxQUZpaTR3VWpBTkJna3Foa2lHOXcwQkFRc0ZBQU9DQVlFQWs1eXFQeDFFWEF3MApIM2VoeVJienhCa1VKQkgwU2RDT3drelY4MVp3dmxBbktLS3hOTTFBd2VSQUxrUTNIRlMrOW11L2szK2ZZRG1uCkxMR3ZLMjM2THYzWWZpMkVHd2ZpbC9icnQ3bU5pQkRtTDdvd0Vta09oVzVKYlRiM2RRcmxtelJsVXhIU1R4d0MKUUM2NWdQTkJJcTNUZUZmU2t6ZlA1N0FIK0ZHemZYNTVBa0pnbEZpQXRRcGFoQXgxVlRaWitPK3RjbWZSSW5mUQpDSzArZE5qc3VUd2NHbzhvYUpOamJmWHNPYlA1eWFneWV5d2ZxQ3lvRExnT2gwdUlGUVBiUlBRM1g0OUw3bzhmCnNGRm9CcmVNbjFJWjJBUlplc0dWYXRKSFhRb01WRzcrK3F1L0g2dVNEMFZtK3piNTBJbGVhZHZiQVR2aUlUTlgKYWNtQkRvSmdOQ1JsTEhBR3hWN2pabFIrSFBjUitOTGordklJOUloeHVaY09STW5kTHpyT2hGSjVqM2FuOG5kbApOdW9sR2c3WW1hRmJWdFo3aUdEWnBISTdSQVFSZitjNVlKbFVIbUwrMnpNR2xiZHlKL3B5cTRjUEJsVDZlWUhtCmxSVEhseXVRaTd2ZndneXJwVU53ajMvbkNUekxjWDVqaHp3L1h2aDlGeGZpL1FTTmxKREIKLS0tLS1FTkQgQ0VSVElGSUNBVEUtLS0tLQoK", "vca_cloud": "lxd-cloud", "vca_host": "10.0.2.68", "vca_k8s_cloud": "microk8s", "vca_port": 17070, "vca_pubkey": "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC+tPyU/gOogK/jQFbDgHtlaYhba8Y1SshxC5vL908ST2I6ku4+1XfIgVi8gfCUDRG8kzHL9S0i8iCvPYqCIasSEVD7+LCjYn19JZXWhnkwmlmHoW3a7ljw++d4aNWGKNWxiQOKKtM26ZH5yu1kKHtmZ1bcgrKGkQdiYBhzsKZ/8lRoWakGwZdDTdny6ZxmcvJ52GLyDs/K4jK730ogRVcsj7h3hb7KXKedNkX89ciAaus8m3HA9nMWsf8C0GRXR9ymGDml9pUORO8/6uOsccn5VQWHl5sitSG4K2W/5jBBNNmRQ8obV2ey7N+3nhb9luzhgk2Slj0XTjhnKOLP01Jn juju-client-key", "vca_secret": "86bbee23c74c078a3a67a95349788748", "vca_user": "admin"}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T13:53:04.151820427Z", "version": ""}, "workload-version": ""}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:04.183165399Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:04.374726337Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T17:38:51.675080168Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-departed hook for lcm/9", "since": "2022-04-27T13:53:04.530097985Z", "version": "2.9.22"}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "executing", "message": "running database-relation-departed hook for lcm/9", "since": "2022-04-27T13:53:04.546541075Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "ro/0", "application": "ro", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/osm-ro-1", "life": "alive", "public-address": "", "private-address": "10.152.183.73", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:03:19.691982951Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-departed hook for lcm/9", "since": "2022-04-27T13:53:04.579582114Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-settings-changed hook", "since": "2022-04-27T13:53:05.20239186Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T17:38:51.675080168Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:05.375082613Z", "version": "2.9.22"}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "ro/0", "application": "ro", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/osm-ro-1", "life": "alive", "public-address": "", "private-address": "10.152.183.73", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-25T15:03:19.691982951Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:06.287930066Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "mongodb/0", "application": "mongodb", "series": "kubernetes", "charm-url": "ch:amd64/kubernetes/mongodb-k8s-1", "life": "alive", "public-address": "", "private-address": "10.152.183.147", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-24T08:22:00.904010692Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:06.339773748Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-changed hook for mongodb/0", "since": "2022-04-27T13:53:06.794110477Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-departed hook for ro/0", "since": "2022-04-27T13:53:08.598222736Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-changed hook", "since": "2022-04-27T13:53:09.895852655Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-departed hook for kafka/0", "since": "2022-04-27T13:53:11.774748891Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-changed hook", "since": "2022-04-27T13:53:13.053185245Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-departed hook for mongodb/0", "since": "2022-04-27T13:53:14.670972589Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-joined hook for kafka/0", "since": "2022-04-27T13:53:16.050710673Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:52:46.270309812Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-broken hook", "since": "2022-04-27T13:53:17.564633836Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "Assembling pod spec", "since": "2022-04-27T13:53:18.455720015Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-broken hook", "since": "2022-04-27T13:53:17.564633836Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "blocked", "message": "Need kafka, mongodb, ro relations", "since": "2022-04-27T13:53:18.840406999Z", "version": ""}, "agent-status": {"current": "executing", "message": "running mongodb-relation-broken hook", "since": "2022-04-27T13:53:17.564633836Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-joined hook for ro/0", "since": "2022-04-27T13:53:19.686052274Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "blocked", "message": "Need kafka, mongodb, ro relations", "since": "2022-04-27T13:53:18.840406999Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-broken hook", "since": "2022-04-27T13:53:21.149271009Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "Assembling pod spec", "since": "2022-04-27T13:53:22.073656705Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-broken hook", "since": "2022-04-27T13:53:21.149271009Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "blocked", "message": "Need kafka, mongodb, ro relations", "since": "2022-04-27T13:53:22.515373602Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-broken hook", "since": "2022-04-27T13:53:21.149271009Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-changed hook for ro/0", "since": "2022-04-27T13:53:23.355070294Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "blocked", "message": "Need kafka, mongodb, ro relations", "since": "2022-04-27T13:53:22.515373602Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-broken hook", "since": "2022-04-27T13:53:25.062699158Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "Assembling pod spec", "since": "2022-04-27T13:53:25.93483528Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-broken hook", "since": "2022-04-27T13:53:25.062699158Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "blocked", "message": "Need kafka, mongodb, ro relations", "since": "2022-04-27T13:53:26.411373222Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-broken hook", "since": "2022-04-27T13:53:25.062699158Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-relation-changed hook for kafka/0", "since": "2022-04-27T13:53:27.418670221Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:29.278763461Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "stopping charm software", "since": "2022-04-27T13:53:29.342891381Z", "version": ""}, "agent-status": {"current": "executing", "message": "running ro-relation-broken hook", "since": "2022-04-27T13:53:25.062699158Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "stopping charm software", "since": "2022-04-27T13:53:29.342891381Z", "version": ""}, "agent-status": {"current": "executing", "message": "running stop hook", "since": "2022-04-27T13:53:29.36656005Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T13:53:30.616545619Z", "version": ""}, "agent-status": {"current": "executing", "message": "running stop hook", "since": "2022-04-27T13:53:29.36656005Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "cleaning up prior to charm deletion", "since": "2022-04-27T13:53:31.150790695Z", "version": ""}, "agent-status": {"current": "executing", "message": "running stop hook", "since": "2022-04-27T13:53:29.36656005Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "cleaning up prior to charm deletion", "since": "2022-04-27T13:53:31.150790695Z", "version": ""}, "agent-status": {"current": "executing", "message": "running remove hook", "since": "2022-04-27T13:53:31.185567398Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dying", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "terminated", "message": "", "since": "2022-04-27T13:53:32.316608499Z", "version": ""}, "agent-status": {"current": "executing", "message": "running remove hook", "since": "2022-04-27T13:53:31.185567398Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dead", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "terminated", "message": "", "since": "2022-04-27T13:53:32.316608499Z", "version": ""}, "agent-status": {"current": "executing", "message": "running remove hook", "since": "2022-04-27T13:53:31.185567398Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:01.044522359Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-elected hook", "since": "2022-04-27T13:53:32.725754517Z", "version": ""}}]
+#["unit", "remove", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/9", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "dead", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "terminated", "message": "", "since": "2022-04-27T13:53:32.316608499Z", "version": ""}, "agent-status": {"current": "executing", "message": "running remove hook", "since": "2022-04-27T13:53:31.185567398Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "Assembling pod spec", "since": "2022-04-27T13:53:33.678220029Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-elected hook", "since": "2022-04-27T13:53:32.725754517Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:34.328293936Z", "version": ""}, "agent-status": {"current": "executing", "message": "running leader-elected hook", "since": "2022-04-27T13:53:32.725754517Z", "version": ""}}]
+#["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "lcm/10", "application": "lcm", "series": "kubernetes", "charm-url": "local:kubernetes/osm-lcm-0", "life": "alive", "public-address": "", "private-address": "10.152.183.135", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "ready", "since": "2022-04-27T13:53:34.328293936Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T13:53:34.770344608Z", "version": ""}}]
\ No newline at end of file
--- /dev/null
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:focal/kafka-k8s-0", "charm-version": "", "life": "alive", "profile": null}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "local:focal/kafka-k8s-0", "charm-version": "", "life": "alive", "profile": null, "config": {"kafka-properties": "clientPort=2181\nbroker.id.generation.enable=true\nlisteners=PLAINTEXT://:9092\nadvertised.listeners=PLAINTEXT://:9092\nlog.dirs=/var/lib/kafka/data\nauto.create.topics.enable=true\nauto.leader.rebalance.enable=true\nbackground.threads=10\ncompression.type=producer\ndelete.topic.enable=false\nleader.imbalance.check.interval.seconds=300\nleader.imbalance.per.broker.percentage=10\nlog.flush.interval.messages=9223372036854775807\nlog.flush.offset.checkpoint.interval.ms=60000\nlog.flush.scheduler.interval.ms=9223372036854775807\nlog.retention.bytes=-1\nlog.retention.hours=168\nlog.roll.hours=168\nlog.roll.jitter.hours=0\nlog.segment.bytes=1073741824\nlog.segment.delete.delay.ms=60000\nmessage.max.bytes=1000012\nmin.insync.replicas=1\nnum.io.threads=8\nnum.network.threads=1\nnum.recovery.threads.per.data.dir=1\nnum.replica.fetchers=1\noffset.metadata.max.bytes=4096\noffsets.commit.required.acks=-1\noffsets.commit.timeout.ms=5000\noffsets.load.buffer.size=5242880\noffsets.retention.check.interval.ms=600000\noffsets.retention.minutes=1440\noffsets.topic.compression.codec=0\noffsets.topic.num.partitions=50\noffsets.topic.replication.factor=1\noffsets.topic.segment.bytes=104857600\nqueued.max.requests=500\nquota.consumer.default=9223372036854775807\nquota.producer.default=9223372036854775807\nreplica.fetch.min.bytes=1\nreplica.fetch.wait.max.ms=500\nreplica.high.watermark.checkpoint.interval.ms=5000\nreplica.lag.time.max.ms=10000\nreplica.socket.receive.buffer.bytes=65536\nreplica.socket.timeout.ms=30000\nrequest.timeout.ms=30000\nsocket.receive.buffer.bytes=102400\nsocket.request.max.bytes=104857600\nsocket.send.buffer.bytes=102400\nunclean.leader.election.enable=true\nzookeeper.session.timeout.ms=6000\nzookeeper.set.acl=false\nbroker.id.generation.enable=true\nconnections.max.idle.ms=600000\ncontrolled.shutdown.enable=true\ncontrolled.shutdown.max.retries=3\ncontrolled.shutdown.retry.backoff.ms=5000\ncontroller.socket.timeout.ms=30000\ndefault.replication.factor=1\nfetch.purgatory.purge.interval.requests=1000\ngroup.max.session.timeout.ms=300000\ngroup.min.session.timeout.ms=6000\nlog.cleaner.backoff.ms=15000\nlog.cleaner.dedupe.buffer.size=134217728\nlog.cleaner.delete.retention.ms=86400000\nlog.cleaner.enable=true\nlog.cleaner.io.buffer.load.factor=0.9\nlog.cleaner.io.buffer.size=524288\nlog.cleaner.io.max.bytes.per.second=1.7976931348623157E308\nlog.cleaner.min.cleanable.ratio=0.5\nlog.cleaner.min.compaction.lag.ms=0\nlog.cleaner.threads=1\nlog.cleanup.policy=delete\nlog.index.interval.bytes=4096\nlog.index.size.max.bytes=10485760\nlog.message.timestamp.difference.max.ms=9223372036854775807\nlog.message.timestamp.type=CreateTime\nlog.preallocate=false\nlog.retention.check.interval.ms=300000\nmax.connections.per.ip=2147483647\nnum.partitions=1\nproducer.purgatory.purge.interval.requests=1000\nreplica.fetch.backoff.ms=1000\nreplica.fetch.max.bytes=1048576\nreplica.fetch.response.max.bytes=10485760\nreserved.broker.max.id=1000\n", "metrics": true}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-24T18:39:35.346890724Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "stopping charm software", "since": "2022-04-27T18:32:59.063102743Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T17:36:41.956361285Z", "version": "2.9.22"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-24T18:39:35.346890724Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "stopping charm software", "since": "2022-04-27T18:32:59.063102743Z", "version": ""}, "agent-status": {"current": "executing", "message": "running stop hook", "since": "2022-04-27T18:32:59.129679756Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "executing", "message": "running stop hook", "since": "2022-04-27T18:32:59.129679756Z", "version": "2.9.22"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:00.285536226Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:01.685500631Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:03.885273135Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "ch:amd64/focal/kafka-k8s-5", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "allocating", "message": "Started container charm-init", "since": "2022-04-27T18:33:03.9134045Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "allocating", "message": "Started container charm-init", "since": "2022-04-27T18:33:03.9134045Z", "version": "2.9.22"}}]
+["charm", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/focal/kafka-k8s-5", "charm-version": "", "life": "dying", "profile": null, "config": {"kafka-properties": "clientPort=2181\nbroker.id.generation.enable=true\nlisteners=PLAINTEXT://:9092\nadvertised.listeners=PLAINTEXT://:9092\nlog.dirs=/var/lib/kafka/data\nauto.create.topics.enable=true\nauto.leader.rebalance.enable=true\nbackground.threads=10\ncompression.type=producer\ndelete.topic.enable=false\nleader.imbalance.check.interval.seconds=300\nleader.imbalance.per.broker.percentage=10\nlog.flush.interval.messages=9223372036854775807\nlog.flush.offset.checkpoint.interval.ms=60000\nlog.flush.scheduler.interval.ms=9223372036854775807\nlog.retention.bytes=-1\nlog.retention.hours=168\nlog.roll.hours=168\nlog.roll.jitter.hours=0\nlog.segment.bytes=1073741824\nlog.segment.delete.delay.ms=60000\nmessage.max.bytes=1000012\nmin.insync.replicas=1\nnum.io.threads=8\nnum.network.threads=1\nnum.recovery.threads.per.data.dir=1\nnum.replica.fetchers=1\noffset.metadata.max.bytes=4096\noffsets.commit.required.acks=-1\noffsets.commit.timeout.ms=5000\noffsets.load.buffer.size=5242880\noffsets.retention.check.interval.ms=600000\noffsets.retention.minutes=1440\noffsets.topic.compression.codec=0\noffsets.topic.num.partitions=50\noffsets.topic.replication.factor=1\noffsets.topic.segment.bytes=104857600\nqueued.max.requests=500\nquota.consumer.default=9223372036854775807\nquota.producer.default=9223372036854775807\nreplica.fetch.min.bytes=1\nreplica.fetch.wait.max.ms=500\nreplica.high.watermark.checkpoint.interval.ms=5000\nreplica.lag.time.max.ms=10000\nreplica.socket.receive.buffer.bytes=65536\nreplica.socket.timeout.ms=30000\nrequest.timeout.ms=30000\nsocket.receive.buffer.bytes=102400\nsocket.request.max.bytes=104857600\nsocket.send.buffer.bytes=102400\nunclean.leader.election.enable=true\nzookeeper.session.timeout.ms=6000\nzookeeper.set.acl=false\nbroker.id.generation.enable=true\nconnections.max.idle.ms=600000\ncontrolled.shutdown.enable=true\ncontrolled.shutdown.max.retries=3\ncontrolled.shutdown.retry.backoff.ms=5000\ncontroller.socket.timeout.ms=30000\ndefault.replication.factor=1\nfetch.purgatory.purge.interval.requests=1000\ngroup.max.session.timeout.ms=300000\ngroup.min.session.timeout.ms=6000\nlog.cleaner.backoff.ms=15000\nlog.cleaner.dedupe.buffer.size=134217728\nlog.cleaner.delete.retention.ms=86400000\nlog.cleaner.enable=true\nlog.cleaner.io.buffer.load.factor=0.9\nlog.cleaner.io.buffer.size=524288\nlog.cleaner.io.max.bytes.per.second=1.7976931348623157E308\nlog.cleaner.min.cleanable.ratio=0.5\nlog.cleaner.min.compaction.lag.ms=0\nlog.cleaner.threads=1\nlog.cleanup.policy=delete\nlog.index.interval.bytes=4096\nlog.index.size.max.bytes=10485760\nlog.message.timestamp.difference.max.ms=9223372036854775807\nlog.message.timestamp.type=CreateTime\nlog.preallocate=false\nlog.retention.check.interval.ms=300000\nmax.connections.per.ip=2147483647\nnum.partitions=1\nproducer.purgatory.purge.interval.requests=1000\nreplica.fetch.backoff.ms=1000\nreplica.fetch.max.bytes=1048576\nreplica.fetch.response.max.bytes=10485760\nreserved.broker.max.id=1000\n", "metrics": true}}]
+["charm", "remove", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "charm-url": "ch:amd64/focal/kafka-k8s-5", "charm-version": "", "life": "dying", "profile": null, "config": {"kafka-properties": "clientPort=2181\nbroker.id.generation.enable=true\nlisteners=PLAINTEXT://:9092\nadvertised.listeners=PLAINTEXT://:9092\nlog.dirs=/var/lib/kafka/data\nauto.create.topics.enable=true\nauto.leader.rebalance.enable=true\nbackground.threads=10\ncompression.type=producer\ndelete.topic.enable=false\nleader.imbalance.check.interval.seconds=300\nleader.imbalance.per.broker.percentage=10\nlog.flush.interval.messages=9223372036854775807\nlog.flush.offset.checkpoint.interval.ms=60000\nlog.flush.scheduler.interval.ms=9223372036854775807\nlog.retention.bytes=-1\nlog.retention.hours=168\nlog.roll.hours=168\nlog.roll.jitter.hours=0\nlog.segment.bytes=1073741824\nlog.segment.delete.delay.ms=60000\nmessage.max.bytes=1000012\nmin.insync.replicas=1\nnum.io.threads=8\nnum.network.threads=1\nnum.recovery.threads.per.data.dir=1\nnum.replica.fetchers=1\noffset.metadata.max.bytes=4096\noffsets.commit.required.acks=-1\noffsets.commit.timeout.ms=5000\noffsets.load.buffer.size=5242880\noffsets.retention.check.interval.ms=600000\noffsets.retention.minutes=1440\noffsets.topic.compression.codec=0\noffsets.topic.num.partitions=50\noffsets.topic.replication.factor=1\noffsets.topic.segment.bytes=104857600\nqueued.max.requests=500\nquota.consumer.default=9223372036854775807\nquota.producer.default=9223372036854775807\nreplica.fetch.min.bytes=1\nreplica.fetch.wait.max.ms=500\nreplica.high.watermark.checkpoint.interval.ms=5000\nreplica.lag.time.max.ms=10000\nreplica.socket.receive.buffer.bytes=65536\nreplica.socket.timeout.ms=30000\nrequest.timeout.ms=30000\nsocket.receive.buffer.bytes=102400\nsocket.request.max.bytes=104857600\nsocket.send.buffer.bytes=102400\nunclean.leader.election.enable=true\nzookeeper.session.timeout.ms=6000\nzookeeper.set.acl=false\nbroker.id.generation.enable=true\nconnections.max.idle.ms=600000\ncontrolled.shutdown.enable=true\ncontrolled.shutdown.max.retries=3\ncontrolled.shutdown.retry.backoff.ms=5000\ncontroller.socket.timeout.ms=30000\ndefault.replication.factor=1\nfetch.purgatory.purge.interval.requests=1000\ngroup.max.session.timeout.ms=300000\ngroup.min.session.timeout.ms=6000\nlog.cleaner.backoff.ms=15000\nlog.cleaner.dedupe.buffer.size=134217728\nlog.cleaner.delete.retention.ms=86400000\nlog.cleaner.enable=true\nlog.cleaner.io.buffer.load.factor=0.9\nlog.cleaner.io.buffer.size=524288\nlog.cleaner.io.max.bytes.per.second=1.7976931348623157E308\nlog.cleaner.min.cleanable.ratio=0.5\nlog.cleaner.min.compaction.lag.ms=0\nlog.cleaner.threads=1\nlog.cleanup.policy=delete\nlog.index.interval.bytes=4096\nlog.index.size.max.bytes=10485760\nlog.message.timestamp.difference.max.ms=9223372036854775807\nlog.message.timestamp.type=CreateTime\nlog.preallocate=false\nlog.retention.check.interval.ms=300000\nmax.connections.per.ip=2147483647\nnum.partitions=1\nproducer.purgatory.purge.interval.requests=1000\nreplica.fetch.backoff.ms=1000\nreplica.fetch.max.bytes=1048576\nreplica.fetch.response.max.bytes=10485760\nreserved.broker.max.id=1000\n", "metrics": true}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:05.885991239Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:33:05.939780569Z", "version": "2.9.22"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:07.685099274Z", "version": ""}, "workload-version": ""}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:09.485853048Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "executing", "message": "running upgrade-charm hook", "since": "2022-04-27T18:33:11.686940017Z", "version": "2.9.22"}}]
+["application", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka", "exposed": false, "charm-url": "local:focal/kafka-k8s-0", "owner-tag": "", "life": "alive", "min-units": 0, "constraints": {}, "subordinate": false, "status": {"current": "active", "message": "", "since": "2022-04-27T18:33:09.485853048Z", "version": ""}, "workload-version": ""}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "maintenance", "message": "", "since": "2022-04-27T18:32:59.701881796Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:33:13.166304447Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:33:14.910656736Z", "version": ""}, "agent-status": {"current": "executing", "message": "running config-changed hook", "since": "2022-04-27T18:33:13.166304447Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:33:14.910656736Z", "version": ""}, "agent-status": {"current": "executing", "message": "running start hook", "since": "2022-04-27T18:33:15.313510973Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:33:14.910656736Z", "version": ""}, "agent-status": {"current": "executing", "message": "running kafka-pebble-ready hook", "since": "2022-04-27T18:33:16.205042856Z", "version": "2.9.22"}}]
+["unit", "change", {"model-uuid": "835bd5cf-237b-44dd-8fac-1f5db45e5a06", "name": "kafka/0", "application": "kafka", "series": "focal", "charm-url": "local:focal/kafka-k8s-0", "life": "alive", "public-address": "", "private-address": "10.152.183.188", "machine-id": "", "ports": null, "port-ranges": null, "principal": "", "subordinate": false, "workload-status": {"current": "active", "message": "", "since": "2022-04-27T18:33:14.910656736Z", "version": ""}, "agent-status": {"current": "idle", "message": "", "since": "2022-04-27T18:33:17.168708577Z", "version": "2.9.22"}}]
\ No newline at end of file
class FakeWatcher(AsyncMock):
-
delta_to_return = None
async def Next(self):
import re
import binascii
import yaml
+import string
+import secrets
from enum import Enum
from juju.machine import Machine
from juju.application import Application
from juju.action import Action
from juju.unit import Unit
from n2vc.exceptions import N2VCInvalidCertificate
+from typing import Tuple
def base64_to_cacert(b64string):
# convert obj to yaml
yaml_text = obj_to_yaml(obj)
# parse to dict
- return yaml.load(yaml_text, Loader=yaml.Loader)
+ return yaml.load(yaml_text, Loader=yaml.SafeLoader)
+
+
+def get_ee_id_components(ee_id: str) -> Tuple[str, str, str]:
+ """
+ Get model, application and machine components from an execution environment id
+ :param ee_id:
+ :return: model_name, application_name, machine_id
+ """
+ parts = ee_id.split(".")
+ if len(parts) != 3:
+ raise Exception("invalid ee id.")
+ model_name = parts[0]
+ application_name = parts[1]
+ machine_id = parts[2]
+ return model_name, application_name, machine_id
+
+
+def generate_random_alfanum_string(size: int) -> str:
+ """
+ Generate random alfa-numeric string with a size given by argument
+ :param size:
+ :return: random generated string
+ """
+
+ return "".join(
+ secrets.choice(string.ascii_letters + string.digits) for i in range(size)
+ )
-aiokafka==0.7.0
- # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
-dataclasses==0.6
- # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
-kafka-python==2.0.2
- # via
- # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
- # aiokafka
-git+https://osm.etsi.org/gerrit/osm/common.git@master#egg=osm-common
- # via -r requirements-dev.in
-pycrypto==2.6.1
- # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
-pymongo==3.11.3
- # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
-pyyaml==5.4.1
- # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
#######################################################################################
# Copyright ETSI Contributors and Others.
#
# See the License for the specific language governing permissions and
# limitations under the License.
#######################################################################################
+aiokafka==0.8.1
+ # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+async-timeout==4.0.3
+ # via
+ # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+ # aiokafka
+dataclasses==0.6
+ # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+dnspython==2.4.2
+ # via
+ # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+ # pymongo
+kafka-python==2.0.2
+ # via
+ # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+ # aiokafka
+motor==3.3.1
+ # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+osm-common @ git+https://osm.etsi.org/gerrit/osm/common.git@master
+ # via -r requirements-dev.in
+packaging==23.1
+ # via
+ # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+ # aiokafka
+pycryptodome==3.19.0
+ # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+pymongo==4.5.0
+ # via
+ # -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
+ # motor
+pyyaml==6.0.1
+ # via -r https://osm.etsi.org/gitweb/?p=osm/common.git;a=blob_plain;f=requirements.txt;hb=master
-# Copyright 2021 Canonical Ltd.
+# Copyright ETSI Contributors and Others.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
-# http://www.apache.org/licenses/LICENSE-2.0
+# http://www.apache.org/licenses/LICENSE-2.0
#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+# implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
stdeb
setuptools-version-command
+setuptools<60
\ No newline at end of file
-setuptools-version-command==2.2
- # via -r requirements-dist.in
-stdeb==0.10.0
- # via -r requirements-dist.in
-
-# The following packages are considered to be unsafe in a requirements file:
-# setuptools
#######################################################################################
# Copyright ETSI Contributors and Others.
#
# See the License for the specific language governing permissions and
# limitations under the License.
#######################################################################################
+setuptools-version-command==99.9
+ # via -r requirements-dist.in
+stdeb==0.10.0
+ # via -r requirements-dist.in
+
+# The following packages are considered to be unsafe in a requirements file:
+setuptools==59.8.0
+ # via
+ # -r requirements-dist.in
+ # setuptools-version-command
# limitations under the License.
asynctest
+charset-normalizer
coverage
-flake8
+flake8<5.0.0
mock
nose2
requests-mock
-asynctest==0.13.0
- # via -r requirements-test.in
-certifi==2020.12.5
- # via requests
-chardet==4.0.0
- # via requests
-coverage==5.5
- # via
- # -r requirements-test.in
- # nose2
-flake8==3.9.0
- # via -r requirements-test.in
-idna==2.10
- # via requests
-mccabe==0.6.1
- # via flake8
-mock==4.0.3
- # via -r requirements-test.in
-nose2==0.10.0
- # via -r requirements-test.in
-pycodestyle==2.7.0
- # via flake8
-pyflakes==2.3.1
- # via flake8
-requests-mock==1.8.0
- # via -r requirements-test.in
-requests==2.25.1
- # via requests-mock
-six==1.15.0
- # via
- # nose2
- # requests-mock
-urllib3==1.26.4
- # via requests
#######################################################################################
# Copyright ETSI Contributors and Others.
#
# See the License for the specific language governing permissions and
# limitations under the License.
#######################################################################################
+asynctest==0.13.0
+ # via -r requirements-test.in
+certifi==2023.7.22
+ # via requests
+charset-normalizer==3.2.0
+ # via
+ # -r requirements-test.in
+ # requests
+coverage==7.3.1
+ # via -r requirements-test.in
+flake8==4.0.1
+ # via -r requirements-test.in
+idna==3.4
+ # via requests
+mccabe==0.6.1
+ # via flake8
+mock==5.1.0
+ # via -r requirements-test.in
+nose2==0.13.0
+ # via -r requirements-test.in
+pycodestyle==2.8.0
+ # via flake8
+pyflakes==2.4.0
+ # via flake8
+requests==2.31.0
+ # via requests-mock
+requests-mock==1.11.0
+ # via -r requirements-test.in
+six==1.16.0
+ # via requests-mock
+urllib3==2.0.5
+ # via requests
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
-
-juju
-kubernetes
+charset-normalizer
+google-auth<2.18.0
+juju==2.9.44.0
+kubernetes==26.1.0
+motor
pyasn1
-motor==1.3.1
+pyyaml>6
retrying-async
-async-timeout==3.0.1
+#######################################################################################
+# Copyright ETSI Contributors and Others.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+# implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#######################################################################################
+async-timeout==4.0.3
# via retrying-async
-bcrypt==3.2.0
+bcrypt==4.0.1
# via paramiko
-cachetools==4.2.1
+cachetools==5.3.1
# via google-auth
-certifi==2020.12.5
+certifi==2023.7.22
# via
# kubernetes
# requests
-cffi==1.14.5
+cffi==1.16.0
# via
- # bcrypt
# cryptography
# pynacl
-chardet==4.0.0
- # via requests
-cryptography==3.4.7
+charset-normalizer==3.2.0
+ # via
+ # -r requirements.in
+ # requests
+cryptography==41.0.4
# via paramiko
-google-auth==1.28.0
- # via kubernetes
-idna==2.10
+dnspython==2.4.2
+ # via pymongo
+google-auth==2.17.3
+ # via
+ # -r requirements.in
+ # kubernetes
+idna==3.4
# via requests
-juju==2.9.4
+juju==2.9.44.0
# via -r requirements.in
-jujubundlelib==0.5.6
+jujubundlelib==0.5.7
# via theblues
-kubernetes==17.17.0
- # via -r requirements.in
+kubernetes==26.1.0
+ # via
+ # -r requirements.in
+ # juju
macaroonbakery==1.3.1
# via
# juju
# theblues
-motor==1.3.1
+motor==3.3.1
# via -r requirements.in
-mypy-extensions==0.4.3
+mypy-extensions==1.0.0
# via typing-inspect
-oauthlib==3.1.0
+oauthlib==3.2.2
# via requests-oauthlib
-paramiko==2.7.2
+paramiko==2.12.0
# via juju
-protobuf==3.15.6
+protobuf==3.20.3
# via macaroonbakery
-pyasn1-modules==0.2.8
- # via google-auth
-pyasn1==0.4.8
+pyasn1==0.5.0
# via
# -r requirements.in
# juju
# pyasn1-modules
# rsa
-pycparser==2.20
+pyasn1-modules==0.3.0
+ # via google-auth
+pycparser==2.21
# via cffi
pymacaroons==0.13.0
# via macaroonbakery
-pymongo==3.11.3
+pymongo==4.5.0
# via motor
-pynacl==1.4.0
+pynacl==1.5.0
# via
# macaroonbakery
# paramiko
# via
# juju
# macaroonbakery
-python-dateutil==2.8.1
+python-dateutil==2.8.2
# via kubernetes
-pytz==2021.1
+pytz==2023.3.post1
# via pyrfc3339
-pyyaml==5.4.1
+pyyaml==6.0.1
# via
+ # -r requirements.in
# juju
# jujubundlelib
# kubernetes
-requests-oauthlib==1.3.0
- # via kubernetes
-requests==2.25.1
+requests==2.31.0
# via
# kubernetes
# macaroonbakery
# requests-oauthlib
# theblues
-retrying-async==1.2.0
+requests-oauthlib==1.3.1
+ # via kubernetes
+retrying-async==2.0.0
# via -r requirements.in
-rsa==4.7.2
+rsa==4.9
# via google-auth
-six==1.15.0
+six==1.16.0
# via
- # bcrypt
# google-auth
# kubernetes
# macaroonbakery
- # protobuf
+ # paramiko
# pymacaroons
- # pynacl
# python-dateutil
- # websocket-client
theblues==0.5.2
# via juju
-toposort==1.6
+toposort==1.10
# via juju
-typing-extensions==3.7.4.3
+typing-extensions==4.8.0
# via typing-inspect
-typing-inspect==0.6.0
+typing-inspect==0.9.0
# via juju
-urllib3==1.26.4
+urllib3==2.0.5
# via
# kubernetes
# requests
-websocket-client==0.58.0
+websocket-client==1.6.3
# via kubernetes
-websockets==7.0
+websockets==11.0.3
# via juju
# The following packages are considered to be unsafe in a requirements file:
# setuptools
-#######################################################################################
-# Copyright ETSI Contributors and Others.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-# http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-# implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-#######################################################################################
[testenv]
usedevelop = True
-basepython = python3
+basepython = python3.10
setenv = VIRTUAL_ENV={envdir}
PYTHONDONTWRITEBYTECODE = 1
deps = -r{toxinidir}/requirements.txt
#######################################################################################
[testenv:black]
-deps = black
+deps = black==23.12.1
skip_install = true
commands =
black --check --diff n2vc/
coverage report --omit='*tests*'
coverage html -d ./cover --omit='*tests*'
coverage xml -o coverage.xml --omit=*tests*
-whitelist_externals = sh
+allowlist_externals = sh
#######################################################################################
#######################################################################################
[testenv:pip-compile]
-deps = pip-tools==5.5.0
+deps = pip-tools==6.13.0
+skip_install = true
+allowlist_externals = bash
+ [
commands =
- - sh -c 'for file in requirements*.in ; do pip-compile -rU --no-header $file ;\
- out=`echo $file | sed "s/.in/.txt/"` ; \
- head -16 tox.ini >> $out ;\
- done'
-whitelist_externals = sh
+ - bash -c "for file in requirements*.in ; do \
+ UNSAFE="" ; \
+ if [[ $file =~ 'dist' ]] ; then UNSAFE='--allow-unsafe' ; fi ; \
+ pip-compile --resolver=backtracking -rU --no-header $UNSAFE $file ;\
+ out=`echo $file | sed 's/.in/.txt/'` ; \
+ sed -i -e '1 e head -16 tox.ini' $out ;\
+ done"
#######################################################################################
python3 setup.py --command-packages=stdeb.command sdist_dsc
sh -c 'cd deb_dist/n2vc*/ && dpkg-buildpackage -rfakeroot -uc -us'
sh -c 'rm n2vc/requirements.txt'
-whitelist_externals = sh
+allowlist_externals = sh
#######################################################################################
[flake8]
E125,
E203,
E226,
- E241
+ E241,
+ E501
exclude =
.git,
__pycache__,