skyquake/plugins/launchpad/api/launchpad.js

   1 /*
   2  *
   3  *   Copyright 2016 RIFT.IO Inc
   4  *
   5  *   Licensed under the Apache License, Version 2.0 (the "License");
   6  *   you may not use this file except in compliance with the License.
   7  *   You may obtain a copy of the License at
   8  *
   9  *       http://www.apache.org/licenses/LICENSE-2.0
  10  *
  11  *   Unless required by applicable law or agreed to in writing, software
  12  *   distributed under the License is distributed on an "AS IS" BASIS,
  13  *   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
  14  *   See the License for the specific language governing permissions and
  15  *   limitations under the License.
  16  *
  17  */
  18
  19 var request = require('request');
  20 var Promise = require('bluebird');
  21 var rp = require('request-promise');
  22 var utils = require('../../../framework/core/api_utils/utils.js');
  23 var constants = require('../../../framework/core/api_utils/constants.js');
  24 var APIVersion = '/v1';
  25 var _ = require('underscore');
  26 var epa_aggregator = require('./epa_aggregator.js');
  27 var transforms = require('./transforms.js');
  28 var uuid = require('node-uuid');
  29
  30 // Revealing module pattern objects
  31 var Catalog = {};
  32 var Config = {};
  33 var NSR = {};
  34 var VNFR = {};
  35 var VLR = {};
  36 var RIFT = {};
  37 var ComputeTopology = {};
  38 var NetworkTopology = {};
  39 var VDUR = {};
  40 var CloudAccount = {};
  41 var ConfigAgentAccount = {};
  42 var RPC = {};
  43 var SSHkey = {};
  44 // API Configuration Info
  45 var APIConfig = {}
  46 APIConfig.NfviMetrics = ['vcpu', 'memory'];
  47
  48 RPC.executeNSServicePrimitive = function(req) {
  49     var api_server = req.query['api_server'];
  50     return new Promise(function(resolve, reject) {
  51         var jsonData = {
  52             "input": req.body
  53         };
  54
  55         var headers = _.extend({},
  56             constants.HTTP_HEADERS.accept.data,
  57             constants.HTTP_HEADERS.content_type.data, {
  58                 'Authorization': req.get('Authorization')
  59             }
  60         );
  61         request({
  62             url: utils.confdPort(api_server) + APIVersion + '/api/operations/exec-ns-service-primitive',
  63             method: 'POST',
  64             headers: headers,
  65             forever: constants.FOREVER_ON,
  66             rejectUnauthorized: false,
  67             json: jsonData
  68         }, function(error, response, body) {
  69             if (utils.validateResponse('RPC.executeNSServicePrimitive', error, response, body, resolve, reject)) {
  70                 return resolve({
  71                     statusCode: response.statusCode,
  72                     data: JSON.stringify(response.body)
  73                 });
  74             }
  75         })
  76     });
  77 };
  78
  79 RPC.getNSServicePrimitiveValues = function(req) {
  80     var api_server = req.query['api_server'];
  81     // var nsr_id = req.body['nsr_id_ref'];
  82     // var nsConfigPrimitiveName = req.body['name'];
  83     return new Promise(function(resolve, reject) {
  84         var jsonData = {
  85             "input": req.body
  86         };
  87
  88         var headers = _.extend({},
  89             constants.HTTP_HEADERS.accept.data,
  90             constants.HTTP_HEADERS.content_type.data, {
  91                 'Authorization': req.get('Authorization')
  92             }
  93         );
  94         request({
  95             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/get-ns-service-primitive-values',
  96             method: 'POST',
  97             headers: headers,
  98             forever: constants.FOREVER_ON,
  99             rejectUnauthorized: false,
 100             json: jsonData
 101         }, function(error, response, body) {
 102             if (utils.validateResponse('RPC.getNSServicePrimitiveValues', error, response, body, resolve, reject)) {
 103
 104                 resolve({
 105                     statusCode: response.statusCode,
 106                     data: JSON.parse(body)
 107                 });
 108             }
 109         });
 110     }).catch(function(error) {
 111         console.log('error getting primitive values');
 112     });
 113 };
 114 RPC.refreshAccountConnectionStatus = function(req) {
 115     var api_server = req.query['api_server'];
 116     var Name = req.params.name;
 117     var Type = req.params.type;
 118     var jsonData = {
 119         input: {}
 120     };
 121     var rpcInfo = {
 122         sdn: {
 123             label: 'sdn-account',
 124             rpc: 'update-sdn-status'
 125         },
 126         config: {
 127             label: 'cfg-agent-account',
 128             rpc: 'update-cfg-agent-status'
 129         },
 130         cloud: {
 131             label: 'cloud-account',
 132             rpc: 'update-cloud-status'
 133         }
 134     }
 135     jsonData.input[rpcInfo[Type].label] = Name;
 136     var headers = _.extend({},
 137         constants.HTTP_HEADERS.accept.data,
 138         constants.HTTP_HEADERS.content_type.data, {
 139             'Authorization': req.get('Authorization')
 140         }
 141     );
 142     return new Promise(function(resolve, reject) {
 143
 144         request({
 145             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/' + rpcInfo[Type].rpc,
 146             method: 'POST',
 147             headers: headers,
 148             forever: constants.FOREVER_ON,
 149             rejectUnauthorized: false,
 150             json: jsonData
 151         }, function(error, response, body) {
 152             if (utils.validateResponse('RPC.refreshAccountConnectionStatus', error, response, body, resolve, reject)) {
 153
 154                 resolve({
 155                     statusCode: response.statusCode,
 156                     data: body
 157                 });
 158             }
 159         });
 160     }).catch(function(error) {
 161         console.log('Error refreshing account info');
 162     });
 163 };
 164
 165
 166 var DataCenters = {};
 167 // Catalog module methods
 168 Catalog.get = function(req) {
 169     var api_server = req.query['api_server'];
 170     var results = {}
 171     return new Promise(function(resolve, reject) {
 172         Promise.all([
 173             rp({
 174                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 175                 method: 'GET',
 176                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 177                     'Authorization': req.get('Authorization')
 178                 }),
 179                 forever: constants.FOREVER_ON,
 180                 rejectUnauthorized: false,
 181                 resolveWithFullResponse: true
 182             }),
 183             rp({
 184                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd?deep',
 185                 method: 'GET',
 186                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 187                     'Authorization': req.get('Authorization')
 188                 }),
 189                 forever: constants.FOREVER_ON,
 190                 rejectUnauthorized: false,
 191                 resolveWithFullResponse: true
 192             }),
 193             rp({
 194                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata?deep',
 195                 method: 'GET',
 196                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 197                     'Authorization': req.get('Authorization')
 198                 }),
 199                 forever: constants.FOREVER_ON,
 200                 rejectUnauthorized: false,
 201                 resolveWithFullResponse: true
 202             })
 203             // Not enabled for now
 204             // rp({
 205             //   uri: utils.confdPort(api_server) + APIVersion + '/api/config/pnfd-catalog/pnfd?deep',
 206             //   method: 'GET',
 207             //   headers: _.extend({},
 208             //     constants.HTTP_HEADERS.accept.collection,
 209             //     {
 210             //       'Authorization': req.get('Authorization')
 211             //     }),
 212             //   forever: constants.FOREVER_ON,
 213             // rejectUnauthorized: false,
 214             //   resolveWithFullResponse: true
 215             // })
 216         ]).then(function(result) {
 217             console.log('Resolved all request promises (NSD, VNFD) successfully');
 218             var response = [{
 219                 "id": "GUID-1",
 220                 "name": "RIFT.ware™ NS Descriptors Catalog",
 221                 "short-name": "rift.ware-nsd-cat",
 222                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 223                 "vendor": "RIFT.io",
 224                 "version": "",
 225                 "created-on": "",
 226                 "type": "nsd",
 227                 "meta": {
 228                     "icon-svg": "data:image/svg+xml,%3C%3Fxml%20version%3D%221.0%22%20encoding%3D%22iso-8859-1%22%3F%3E%0A%3C!--%20Generator%3A%20Adobe%20Illustrator%2018.0.0%2C%20SVG%20Export%20Plug-In%20.%20SVG%20Version%3A%206.00%20Build%200)%20%20--%3E%0A%3C!DOCTYPE%20svg%20PUBLIC%20%22-%2F%2FW3C%2F%2FDTD%20SVG%201.1%2F%2FEN%22%20%22http%3A%2F%2Fwww.w3.org%2FGraphics%2FSVG%2F1.1%2FDTD%2Fsvg11.dtd%22%3E%0A%3Csvg%20version%3D%221.1%22%20id%3D%22connection-icon-1%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20xmlns%3Axlink%3D%22http%3A%2F%2Fwww.w3.org%2F1999%2Fxlink%22%20x%3D%220px%22%20y%3D%220px%22%0A%09%20viewBox%3D%220%200%2050%2050%22%20style%3D%22enable-background%3Anew%200%200%2050%2050%3B%22%20xml%3Aspace%3D%22preserve%22%3E%0A%09%3Cpath%20d%3D%22M15%2030c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2020c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2040c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M19.007%2025.885l12.88%206.44-.895%201.788-12.88-6.44z%22%2F%3E%3Cpath%20d%3D%22M30.993%2015.885l.894%201.79-12.88%206.438-.894-1.79z%22%2F%3E%3C%2Fsvg%3E"
 229                 },
 230                 "descriptors": []
 231             }, {
 232                 "id": "GUID-2",
 233                 "name": "RIFT.ware™ VNF Descriptors Catalog",
 234                 "short-name": "rift.ware-vnfd-cat",
 235                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 236                 "vendor": "RIFT.io",
 237                 "version": "",
 238                 "created-on": "",
 239                 "type": "vnfd",
 240                 "meta": {
 241                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_3\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <g> <path d=\"M58.852,62.447l-4.662-1.033c-0.047-3.138-0.719-6.168-1.996-9.007l3.606-2.92c0.858-0.695,0.99-1.954,0.296-2.813 l-4.521-5.584c-0.334-0.413-0.818-0.675-1.346-0.731c-0.525-0.057-1.056,0.102-1.468,0.435L45.25,43.64v0 c-2.486-1.907-5.277-3.259-8.297-4.019v-4.458c0-1.104-0.896-2-2-2H27.77c-1.104,0-2,0.896-2,2v4.461 c-3.08,0.777-5.922,2.171-8.447,4.144l-3.545-2.82c-0.415-0.33-0.94-0.479-1.472-0.422c-0.527,0.06-1.009,0.327-1.339,0.743 l-4.472,5.623c-0.688,0.864-0.544,2.123,0.32,2.81l3.642,2.896v0c-1.25,2.848-1.895,5.88-1.916,9.011l-4.666,1.078 c-1.076,0.249-1.747,1.322-1.499,2.398l1.616,7.001c0.249,1.077,1.325,1.747,2.399,1.499l4.813-1.111v0 c1.429,2.681,3.344,5.017,5.691,6.943l-2.17,4.55c-0.476,0.997-0.054,2.19,0.943,2.666l6.484,3.094 c0.271,0.129,0.566,0.195,0.861,0.195c0.226,0,0.451-0.038,0.668-0.115c0.5-0.177,0.909-0.545,1.138-1.024l2.198-4.611 c2.923,0.563,5.966,0.554,8.879-0.033l2.236,4.585c0.484,0.994,1.685,1.403,2.675,0.921l6.456-3.148 c0.992-0.484,1.405-1.682,0.921-2.674l-2.206-4.524c2.335-1.946,4.231-4.301,5.639-6.999l4.812,1.067 c1.076,0.237,2.146-0.441,2.385-1.52l1.556-7.014c0.115-0.518,0.02-1.06-0.266-1.508C59.82,62.878,59.369,62.562,58.852,62.447z M40.18,61.761c0,4.859-3.953,8.812-8.813,8.812c-4.858,0-8.811-3.953-8.811-8.812s3.952-8.812,8.811-8.812 C36.227,52.949,40.18,56.902,40.18,61.761z\"/> <path d=\"M64.268,45.324c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.826,0.353,3.736,0.345,5.551-0.021l1.07,2.195 c0.484,0.992,1.682,1.405,2.675,0.921l2.691-1.313c0.477-0.233,0.842-0.646,1.015-1.147c0.172-0.501,0.139-1.051-0.095-1.528 l-1.052-2.155c1.458-1.214,2.645-2.686,3.527-4.377l2.278,0.504c1.075,0.238,2.146-0.442,2.386-1.52l0.647-2.923 c0.238-1.078-0.442-2.146-1.521-2.385l-2.184-0.484c-0.028-1.962-0.449-3.857-1.248-5.632l1.673-1.355 c0.412-0.334,0.675-0.818,0.73-1.345s-0.102-1.056-0.436-1.468l-1.884-2.327c-0.697-0.859-1.957-0.99-2.813-0.295l-1.614,1.307 c-1.554-1.193-3.299-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.04 c-1.927,0.486-3.703,1.358-5.28,2.592l-1.634-1.298c-0.862-0.687-2.12-0.543-2.81,0.32l-1.864,2.344 c-0.33,0.416-0.481,0.945-0.422,1.472c0.061,0.527,0.327,1.009,0.743,1.339l1.69,1.345c-0.78,1.779-1.184,3.676-1.197,5.636 l-2.189,0.505c-0.517,0.119-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51l0.675,2.918 c0.249,1.076,1.323,1.747,2.398,1.498l2.28-0.527c0.892,1.676,2.089,3.137,3.559,4.343l-1.035,2.17 c-0.228,0.479-0.257,1.028-0.08,1.528c0.178,0.5,0.546,0.91,1.024,1.138l2.703,1.289C63.686,45.261,63.979,45.324,64.268,45.324z M64.334,27.961c0-3.039,2.473-5.51,5.512-5.51c3.038,0,5.51,2.472,5.51,5.51c0,3.039-2.472,5.511-5.51,5.511 C66.807,33.472,64.334,31,64.334,27.961z\"/> <path d=\"M96.107,66.441l-2.182-0.484c-0.028-1.961-0.449-3.856-1.25-5.632l1.675-1.355c0.412-0.334,0.675-0.818,0.73-1.346 c0.056-0.527-0.102-1.056-0.436-1.468l-1.885-2.327c-0.695-0.859-1.956-0.99-2.813-0.295l-1.614,1.307 c-1.555-1.193-3.3-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.041 c-1.929,0.486-3.706,1.358-5.282,2.592l-0.001,0l-1.631-1.298c-0.415-0.331-0.938-0.482-1.472-0.422 c-0.527,0.06-1.009,0.327-1.339,0.742l-1.863,2.343c-0.688,0.865-0.544,2.123,0.32,2.811l1.691,1.345 c-0.782,1.784-1.186,3.68-1.199,5.636l-2.188,0.505c-0.517,0.12-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51 l0.675,2.918c0.249,1.076,1.327,1.744,2.397,1.498l2.281-0.526c0.893,1.677,2.09,3.138,3.558,4.343h0.001l-1.035,2.168 c-0.229,0.479-0.258,1.029-0.081,1.529c0.178,0.5,0.546,0.909,1.024,1.138l2.702,1.289c0.278,0.132,0.571,0.195,0.86,0.195 c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.828,0.353,3.739,0.347,5.552-0.021l1.071,2.194 c0.484,0.992,1.682,1.405,2.675,0.921l2.69-1.312c0.477-0.233,0.842-0.645,1.014-1.147c0.173-0.501,0.14-1.051-0.093-1.528 l-1.052-2.155c1.459-1.215,2.645-2.688,3.525-4.377l2.278,0.505c0.52,0.116,1.061,0.02,1.508-0.266 c0.447-0.285,0.763-0.736,0.878-1.254l0.647-2.923C97.866,67.748,97.186,66.681,96.107,66.441z M85.162,66.174 c0,3.039-2.471,5.511-5.508,5.511c-3.039,0-5.512-2.472-5.512-5.511c0-3.039,2.473-5.511,5.512-5.511 C82.691,60.664,85.162,63.136,85.162,66.174z\"/> </g> </svg> "
 242                 },
 243                 "descriptors": []
 244             }, {
 245                 "id": "GUID-3",
 246                 "name": "RIFT.ware™ PNF Descriptors Catalog",
 247                 "short-name": "rift.ware-pnfd-cat",
 248                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 249                 "vendor": "RIFT.io",
 250                 "version": "",
 251                 "created-on": "",
 252                 "type": "pnfd",
 253                 "meta": {
 254                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_4\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <path d=\"M86.334,47.444V35.759H13.666v11.686h3.561v5.111h-3.561v11.686h72.668V52.556h-4.108v-5.111H86.334z M26.628,59.454h-5.051 v-4.941h5.051V59.454z M26.628,52.404h-5.051v-4.941h5.051V52.404z M26.628,45.486h-5.051v-4.941h5.051V45.486z M34.094,59.454 h-5.051v-4.941h5.051V59.454z M34.094,52.404h-5.051v-4.941h5.051V52.404z M34.094,45.486h-5.051v-4.941h5.051V45.486z M41.452,59.454h-5.051v-4.941h5.051V59.454z M41.452,52.404h-5.051v-4.941h5.051V52.404z M41.452,45.486h-5.051v-4.941h5.051 V45.486z M48.733,59.454h-5.051v-4.941h5.051V59.454z M48.733,52.404h-5.051v-4.941h5.051V52.404z M48.733,45.486h-5.051v-4.941 h5.051V45.486z M56.2,59.454h-5.051v-4.941H56.2V59.454z M56.2,52.404h-5.051v-4.941H56.2V52.404z M56.2,45.486h-5.051v-4.941H56.2 V45.486z M63.558,59.454h-5.05v-4.941h5.05V59.454z M63.558,52.404h-5.05v-4.941h5.05V52.404z M63.558,45.486h-5.05v-4.941h5.05 V45.486z M74.858,59.312h-6.521v-3.013h6.521V59.312z M71.572,50.854c-2.875,0-5.204-2.33-5.204-5.203s2.329-5.203,5.204-5.203 s5.204,2.33,5.204,5.203S74.446,50.854,71.572,50.854z M74.858,45.618c0,1.801-1.46,3.261-3.261,3.261 c-1.8,0-3.261-1.46-3.261-3.261s1.46-3.26,3.261-3.26C73.398,42.358,74.858,43.817,74.858,45.618z\"/> </svg>"
 255                 },
 256                 "descriptors": []
 257             }];
 258             var vnfdCatalog = null;
 259             var vnfdDict = {};
 260             if (result[1].body) {
 261                 vnfdCatalog = JSON.parse(result[1].body).collection['vnfd:vnfd'].map(function(v, i) {
 262                     vnfdDict[v.id] = v['short-name'] || v.name;
 263                 })
 264             }
 265             if (result[0].body) {
 266                 response[0].descriptors = JSON.parse(result[0].body).collection['nsd:nsd'];
 267                 if (result[2].body) {
 268                     var data = JSON.parse(result[2].body);
 269                     if (data && data["nsr:ns-instance-opdata"] && data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]) {
 270                         var nsdRefCountCollection = data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"];
 271                         response[0].descriptors.map(function(nsd) {
 272                             if (!nsd["meta"]) {
 273                                 nsd["meta"] = {};
 274                             }
 275                             if (typeof nsd['meta'] == 'string') {
 276                                 nsd['meta'] = JSON.parse(nsd['meta']);
 277                             }
 278                             nsd["meta"]["instance-ref-count"] = _.findWhere(nsdRefCountCollection, {
 279                                 "nsd-id-ref": nsd.id
 280                             })["instance-ref-count"];
 281                             nsd["constituent-vnfd"] && nsd["constituent-vnfd"].map(function(v) {
 282                                 v.name = vnfdDict[v["vnfd-id-ref"]];
 283                             })
 284                         });
 285                     }
 286                 }
 287             };
 288             if (result[1].body) {
 289                 response[1].descriptors = JSON.parse(result[1].body).collection['vnfd:vnfd'];
 290             };
 291             // if (result[2].body) {
 292             //   response[2].descriptors = JSON.parse(result[2].body).collection['pnfd:pnfd'];
 293             // };
 294             resolve({
 295                 statusCode: response.statusCode || 200,
 296                 data: JSON.stringify(response)
 297             });
 298         }).catch(function(error) {
 299             // Todo: Need better logic than all or nothing.
 300             // Right now even if one of the southbound APIs fails - all fail
 301             var res = {};
 302             console.log('Problem with Catalog.get', error);
 303             res.statusCode = error.statusCode || 500;
 304             res.errorMessage = {
 305                 error: 'Failed to get catalogs' + error
 306             };
 307             reject(res);
 308         });
 309     });
 310 };
 311 Catalog.delete = function(req) {
 312     var api_server = req.query['api_server'];
 313     var catalogType = req.params.catalogType;
 314     var id = req.params.id;
 315     console.log('Deleting', catalogType, id, 'from', api_server);
 316     return new Promise(function(resolve, reject) {
 317         request({
 318             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog/' + catalogType + '/' + id,
 319             method: 'DELETE',
 320             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 321                 'Authorization': req.get('Authorization')
 322             }),
 323             forever: constants.FOREVER_ON,
 324             rejectUnauthorized: false,
 325         }, function(error, response, body) {
 326             if (utils.validateResponse('Catalog.delete', error, response, body, resolve, reject)) {
 327                 resolve({
 328                     statusCode: response.statusCode
 329                 });
 330             }
 331         });
 332     });
 333 };
 334 Catalog.getVNFD = function(req) {
 335     var api_server = req.query['api_server'];
 336     var vnfdID = req.body.data;
 337     var authorization = req.get('Authorization');
 338     var VNFDs = [];
 339     if (typeof(vnfdID) == "object" && vnfdID.constructor.name == "Array") {
 340         vnfdID.map(function(id) {
 341             VNFDs.push(requestVNFD(id));
 342         });
 343     } else {
 344         VNFDs.push(requestVNFD(vnfdID));
 345     }
 346     return new Promise(function(resolve, reject) {
 347         Promise.all(VNFDs).then(function(data) {
 348             resolve(data)
 349         }).catch(function(error) {
 350             // Todo: Need better logic than all or nothing.
 351             // Right now even if one of the southbound APIs fails - all fail
 352             var res = {};
 353             console.log('Problem with Catalog.getVNFD', error);
 354             res.statusCode = 404;
 355             res.errorMessage = {
 356                 error: 'Failed to get VNFDs' + error
 357             };
 358             reject(res);
 359         });
 360     });
 361
 362     function requestVNFD(id) {
 363         return new Promise(function(resolve, reject) {
 364             var url = utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd' + (id ? '/' + id : '') + '?deep';
 365             request({
 366                 uri: url,
 367                 method: 'GET',
 368                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 369                     'Authorization': authorization
 370                 }),
 371                 forever: constants.FOREVER_ON,
 372                 rejectUnauthorized: false,
 373             }, function(error, response, body) {
 374                 if (utils.validateResponse('Catalog.getVNFD', error, response, body, resolve, reject)) {
 375                     var data;
 376                     //Is this still needed?
 377                     try {
 378                         data = JSON.parse(response.body)
 379                     } catch (e) {
 380                         reject({
 381                             statusCode: response ? response.statusCode : 400,
 382                             errorMessage: 'Issue parsing VNFD ' + id + 'from ' + utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd/' + id + '?deep'
 383                         });
 384                     }
 385                     resolve(data);
 386                 }
 387             });
 388         });
 389     }
 390 };
 391 Catalog.create = function(req) {
 392     var api_server = req.query['api_server'];
 393     var catalogType = req.params.catalogType;
 394     var data = req.body;
 395     console.log('Creating', catalogType, 'on', api_server);
 396     var jsonData = {};
 397     jsonData[catalogType] = [];
 398     jsonData[catalogType].push(data);
 399     return new Promise(function(resolve, reject) {
 400         var requestHeaders = {};
 401         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 402             'Authorization': req.get('Authorization')
 403         });
 404         request({
 405             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog',
 406             method: 'POST',
 407             headers: requestHeaders,
 408             forever: constants.FOREVER_ON,
 409             rejectUnauthorized: false,
 410             json: jsonData
 411         }, function(error, response, body) {
 412             if (utils.validateResponse('Catalog.create', error, response, body, resolve, reject)) {
 413                 resolve({
 414                     statusCode: response.statusCode
 415                 });
 416             }
 417         });
 418     });
 419 };
 420 Catalog.update = function(req) {
 421     var api_server = req.query['api_server'];
 422     var catalogType = req.params.catalogType;
 423     var id = req.params.id;
 424     var data = req.body;
 425     console.log('Updating', catalogType, 'id', id, 'on', api_server);
 426     var jsonData = {};
 427     jsonData[catalogType] = {};
 428     jsonData[catalogType] = data;
 429     return new Promise(function(resolve, reject) {
 430         var requestHeaders = {};
 431         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 432             'Authorization': req.get('Authorization')
 433         });
 434         request({
 435             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog' + '/' + catalogType + '/' + id,
 436             method: 'PUT',
 437             headers: requestHeaders,
 438             forever: constants.FOREVER_ON,
 439             rejectUnauthorized: false,
 440             json: jsonData
 441         }, function(error, response, body) {
 442             if (utils.validateResponse('Catalog.update', error, response, body, resolve, reject)) {
 443                 resolve({
 444                     statusCode: response.statusCode
 445                 });
 446             }
 447         });
 448     });
 449 };
 450
 451 Catalog.decorateNsdCatalogWithPlacementGroups = function decorateNsdCatalogWithPlacementGroups(catalog) {
 452     var newData = catalog;
 453     var parsedCatalog = JSON.parse(catalog.data);
 454     var nsds = parsedCatalog[0].descriptors;
 455     var vnfds = parsedCatalog[1].descriptors;
 456     var vnfdDict = (function(){
 457         var dict = {};
 458         vnfds.map(function(v, i) {
 459             dict[v.id] = v;
 460         })
 461         return dict;
 462     })(vnfds);
 463
 464     nsds.map(function(c, i) {
 465         //Rename and decorate NSD placement groups
 466         c['ns-placement-groups'] = c['placement-groups'] && c['placement-groups'].map(function(p, i) {
 467             //Adds vnfd name to member-vnfd entry
 468             p['member-vnfd'] = p['member-vnfd'].map(function(v) {
 469                 v.name = vnfdDict[v['vnfd-id-ref']].name;
 470                 return v;
 471             });
 472             p['host-aggregate'] = [];
 473             return p;
 474         });
 475
 476         //Adds vnf placement groups to nsd object for UI
 477         c['vnf-placement-groups'] = [];
 478         c['constituent-vnfd'] && c['constituent-vnfd'].map(function(v) {
 479             var vnf = vnfdDict[v['vnfd-id-ref']];
 480             // var vnfPg = {
 481             //     name: vnf.name,
 482             //     'placement-groups': vnf['placement-groups'].map(function(vp){
 483             //         vp['host-aggregate'] = [{}];
 484             //         return vp;
 485             //     })
 486             // };
 487             v['vnf-name'] = vnf.name;
 488             vnf['placement-groups'] && vnf['placement-groups'].map(function(vp) {
 489                 vp['host-aggregate'] = [];
 490                 vp['vnf-name'] = vnf.name;
 491                 vp['vnfd-id-ref'] = v['vnfd-id-ref'];
 492                 vp['member-vnf-index'] = v['member-vnf-index'];
 493                 c['vnf-placement-groups'].push(vp);
 494             })
 495         })
 496         return c;
 497     })
 498     // parsedCatalog[0].descriptors = nsds;
 499     newData.data = JSON.stringify(parsedCatalog);
 500     return newData;
 501 }
 502
 503 // NSR module methods
 504 // Spend some time refactoring this
 505 // refactor to accept only request object
 506 NSR.get = function(req) {
 507     var self = this;
 508     var nsrPromises = [];
 509     var api_server = req.query["api_server"];
 510     var id = req.params.id;
 511     var nsdInfo = new Promise(function(resolve, reject) {
 512         request({
 513             uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 514             method: 'GET',
 515             headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 516                 'Authorization': req.get('Authorization')
 517             }),
 518             forever: constants.FOREVER_ON,
 519             rejectUnauthorized: false,
 520         }, function(error, response, body) {
 521             if (utils.validateResponse('NSR.get nsd-catalog', error, response, body, resolve, reject)) {
 522                 var data;
 523                 var isString = typeof(response.body) == "string";
 524                 if (isString && response.body == '') return resolve('empty');
 525                 data = isString ? JSON.parse(response.body) : response.body;
 526                 var nsdData = data.collection["nsd:nsd"];
 527                 if (nsdData.constructor.name == "Object") {
 528                     nsdData = [nsdData];
 529                 }
 530                 resolve(nsdData);
 531             };
 532         })
 533     })
 534     var config = new Promise(function(resolve, reject) {
 535         request({
 536             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-config/nsr' + (id ? '/' + id : '') + '?deep',
 537             method: 'GET',
 538             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 539                 'Authorization': req.get('Authorization')
 540             }),
 541             forever: constants.FOREVER_ON,
 542             rejectUnauthorized: false,
 543         }, function(error, response, body) {
 544             if (utils.validateResponse('NSR.get ns-instance-config', error, response, body, resolve, reject)) {
 545                 var data;
 546                 var isString = typeof(response.body) == "string";
 547                 if (isString && response.body == '') return resolve();
 548                 data = isString ? JSON.parse(response.body) : response.body;
 549                 data = id ? data : data.collection;
 550                 var nsrData = data["nsr:nsr"];
 551                 if (nsrData.constructor.name == "Object") {
 552                     nsrData = [nsrData];
 553                 }
 554                 resolve(nsrData);
 555             };
 556         });
 557     });
 558     var opData = new Promise(function(resolve, reject) {
 559         request({
 560             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr' + (id ? '/' + id : '') + '?deep',
 561             method: 'GET',
 562             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 563                 'Authorization': req.get('Authorization')
 564             }),
 565             forever: constants.FOREVER_ON,
 566             rejectUnauthorized: false,
 567         }, function(error, response, body) {
 568             if (utils.validateResponse('NSR.get ns-instance-opdata', error, response, body, resolve, reject)) {
 569                 var data;
 570                 var isString = typeof(response.body) == "string";
 571                 if (isString && response.body == '') return resolve();
 572                 data = isString ? JSON.parse(response.body) : response.body;
 573                 data = id ? data : data.collection;
 574                 var nsrData = data["nsr:nsr"];
 575                 if (nsrData.constructor.name == "Object") {
 576                     nsrData = [nsrData];
 577                 }
 578                 nsrData.forEach(self.decorateWithScalingGroupDict);
 579                 nsrData.forEach(self.decorateAndTransformNFVI);
 580                 nsrData.forEach(self.decorateAndTransformWithControls);
 581                 Promise.all(self.addVnfrDataPromise(req, nsrData)).then(function() {
 582                     Promise.all(self.addVlrDataPromise(req, nsrData)).then(function() {
 583                         resolve(nsrData);
 584                     });
 585                 });
 586             };
 587         });
 588     }).catch(function(error) {
 589         console.log('error getting aggregated NS opdata', error)
 590         //note this will actually trigger the success callback
 591     });
 592     return new Promise(function(resolve, reject) {
 593         //Need smarter error handling here
 594         Promise.all([config, opData]).then(function(resolves) {
 595             var aggregate = {};
 596             // resolves[0] ==> ns-instance-config
 597             // resolves[1] ==> ns-instance-opdata
 598
 599             var nsInstanceConfig = resolves[0] && resolves[0];
 600             var nsInstanceOpdata = resolves[1] && resolves[1];
 601
 602             if (!nsInstanceConfig && !nsInstanceOpdata) {
 603                 return resolve({
 604                     nsrs: []
 605                 });
 606             }
 607
 608             nsInstanceConfig.forEach(function(v, k) {
 609                 v.nsd_name = v['nsd'] && v['nsd']['name'];
 610                 var scaling_group_descriptor = null;
 611
 612                 scaling_group_descriptor = v['nsd'] && v['nsd']['scaling-group-descriptor'];
 613
 614                 if (scaling_group_descriptor) {
 615                     scaling_group_descriptor.map(function(sgd, sgdi) {
 616                         sgd['vnfd-member'] && sgd['vnfd-member'].map(function(vnfd, vnfdi) {
 617                             var vnfrObj = _.findWhere(_.findWhere(nsInstanceOpdata, {
 618                                     'ns-instance-config-ref': v.id
 619                                 }).vnfrs, {
 620                                 'member-vnf-index-ref': vnfd['member-vnf-index-ref']
 621                             });
 622                             if (vnfrObj) {
 623                                 vnfd['short-name'] = vnfrObj['short-name'];
 624                             }
 625                         })
 626                     })
 627                     v['scaling-group-descriptor'] = scaling_group_descriptor;
 628                 }
 629
 630                 if (nsInstanceOpdata && nsInstanceOpdata.constructor.name == "Array") {
 631                     nsInstanceOpdata.forEach(function(w, l) {
 632                         if (v.id == w["ns-instance-config-ref"]) {
 633                             for (prop in w) {
 634                                 if (prop != "ns-instance-config-ref" && !v.hasOwnProperty(prop)) {
 635                                     v[prop] = w[prop];
 636                                 }
 637                             }
 638                         }
 639                     });
 640                 }
 641
 642                 v['scaling-group-record'] && v['scaling-group-record'].map(function(sgr) {
 643                     var scalingGroupName = sgr['scaling-group-name-ref'];
 644                     sgr['instance'] && sgr['instance'].map(function(instance) {
 645                         var scalingGroupInstanceId = instance['instance-id'];
 646                         instance['vnfrs'] && instance['vnfrs'].map(function(vnfr) {
 647                             var vnfrObj = _.findWhere(v['vnfrs'], {id: vnfr});
 648                             if (vnfrObj) {
 649                                 vnfrObj['scaling-group-name'] = scalingGroupName;
 650                                 vnfrObj['scaling-group-instance-id'] = scalingGroupInstanceId;
 651                             }
 652                         });
 653                     });
 654                 })
 655             });
 656             var nsrsData = nsInstanceConfig;
 657             nsrsData.sort(function(a, b) {
 658                 return a["create-time"] - b["create-time"];
 659             });
 660             resolve({
 661                 nsrs: nsrsData
 662             });
 663         }).catch(function(error) {
 664             reject({
 665                 statusCode: 404,
 666                 errorMessage: error
 667             })
 668         })
 669     });
 670 };
 671 // Static VNFR Cache bu VNFR ID
 672 var staticVNFRCache = {};
 673
 674 /**
 675  * [decorateWithScalingGroupDict description]
 676  * @param  {[type]} nsr [description]
 677  * @return {[type]}
 678 {vnfr-id} : {
 679     "scaling-group-name-ref": "sg1",
 680     "instance-id": 0,
 681     "op-status": "running",
 682     "is-default": "true",
 683     "create-time": 1463593760,
 684     "config-status": "configuring",
 685     "vnfrs": [
 686         "432154e3-164e-4c05-83ee-3b56e4c898e7"
 687     ]
 688 }
 689  */
 690 NSR.decorateWithScalingGroupDict = function(nsr) {
 691     var sg = nsr["scaling-group-record"];
 692     var dict = {};
 693     if(sg) {
 694         sg.map(function(s) {
 695             var sgRef = s['scaling-group-name-ref'];
 696             s.instance && s.instance.map(function(si) {
 697                 si.vnfrs && si.vnfrs.map(function(v) {
 698                     dict[v] = si;
 699                     dict[v]["scaling-group-name-ref"] = sgRef;
 700                 })
 701             })
 702         })
 703     }
 704     return nsr['vnfr-scaling-groups'] = dict;
 705 }
 706
 707
 708 NSR.addVlrDataPromise = function(req, nsrs) {
 709     var api_server = req.query['api_server'];
 710     var promises = [];
 711     nsrs.map(function(nsr) {
 712         var vlrPromises = [];
 713         var vlr = nsr['vlr'];
 714         nsr['decorated-vlrs'] = [];
 715         if (!vlr) {
 716             console.log('No VL\'s found in NS');
 717         }
 718         vlr && vlr.map(function(vlrObject) {
 719             req.params.id = vlrObject['vlr-ref'];
 720             var vlrPromise = VLR.get(req).then(function(vlr) {
 721                 try {
 722                     var vlrItem = vlr['data'][0];
 723                     decorateNSRWithVLR(nsr, vlrObject, vlrItem);
 724                 } catch (e) {
 725                     console.log('Expection caught getting VLRs and adding to NSR:', e);
 726                 }
 727             })
 728             vlrPromises.push(vlrPromise);
 729         });
 730         var NSR_Promise = new Promise(function(resolve, reject) {
 731             Promise.all(vlrPromises).then(function() {
 732                 resolve();
 733             })
 734         });
 735         promises.push(NSR_Promise);
 736     });
 737     return promises;
 738
 739     function decorateNSRWithVLR(nsr, nsrVLRObject, vlr) {
 740         var vlrObject = _.extend(nsrVLRObject, vlr);
 741         vlrObject['vnfr-connection-point-ref'] && vlrObject['vnfr-connection-point-ref'].map(function(vnfrCP) {
 742             var vnfrName = nsr['vnfrs'] && _.find(nsr['vnfrs'], {id: vnfrCP['vnfr-id']})['name'];
 743             vnfrName && (vnfrCP['vnfr-name'] = vnfrName);
 744         });
 745         nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'name'), 0, vlrObject);
 746         // nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'create-time'), 0, vlrObject);
 747     }
 748 }
 749
 750
 751 NSR.addVnfrDataPromise = function(req, nsrs) {
 752     var api_server = req.query['api_server'];
 753     var promises = [];
 754     nsrs.map(function(nsr) {
 755         var epa_params = {};
 756         var constituent_vnfr_ref = nsr["constituent-vnfr-ref"];
 757         var vnfrPromises = [];
 758         nsr["vnfrs"] = [];
 759         nsr["dashboard-urls"] = [];
 760         nsr['nfvi-metrics'] = [];
 761         if (!constituent_vnfr_ref) {
 762             console.log('Something is wrong, there are no constituent-vnfr-refs');
 763             constituent_vnfr_ref = [];
 764         }
 765         //Get VNFR Static Data
 766         constituent_vnfr_ref && constituent_vnfr_ref.map(function(constituentVnfrObj) {
 767             req.params.id = constituentVnfrObj['vnfr-id'];
 768             var vnfrPromise;
 769             vnfrPromise = VNFR.get(req).then(function(vnfr) {
 770                 try {
 771                     var vnfrItem = vnfr[0];
 772                     decorateNSRWithVNFR(nsr, vnfrItem)
 773                     staticVNFRCache[vnfrItem.id] = vnfrItem;
 774                 } catch (e) {
 775                     console.log('Exception caught:', e);
 776                 }
 777             });
 778             vnfrPromises.push(vnfrPromise);
 779         });
 780         var NSR_Promise = new Promise(function(resolve, reject) {
 781             Promise.all(vnfrPromises).then(function() {
 782                 var vnfrs = staticVNFRCache;
 783                 //Aggregate EPA Params
 784                 constituent_vnfr_ref && constituent_vnfr_ref.map(function(k) {
 785                         if (vnfrs[k['vnfr-id']]) {
 786                             epa_params = epa_aggregator(vnfrs[k['vnfr-id']].vdur, epa_params);
 787                         }
 788                     })
 789                 //Add VNFR Name to monitoring params
 790                 try {
 791                     if (nsr["monitoring-param"]) {
 792                         nsr["monitoring-param"].map(function(m) {
 793                             var vnfr = vnfrs[m["vnfr-id"]] || {};
 794                             m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR');
 795                         });
 796                     }
 797                 } catch (e) {
 798                     console.log('Exception caught:', e);
 799                 }
 800                 resolve();
 801             })
 802         })
 803         nsr["epa-params"] = epa_params;
 804         promises.push(NSR_Promise);
 805     })
 806     return promises;
 807
 808     function decorateNSRWithVDURConsoleUrls(nsr, vnfr) {
 809         nsr['console-urls'] = nsr['console-urls'] ? nsr['console-urls'] : [];
 810
 811         vnfr && vnfr['vdur'] && vnfr['vdur'].map(function(vdur) {
 812             // This console-url is what front-end will hit to generate a real console-url
 813             vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url';
 814             nsr['console-urls'].push({
 815                 id: vdur.id,
 816                 name: vnfr.name,
 817                 'console-url': vdur['console-url']
 818             });
 819         });
 820     }
 821
 822     function decorateNSRWithVNFR(nsr, vnfr) {
 823         var vnfrObj = {
 824             id: vnfr.id,
 825             "member-vnf-index-ref": vnfr["member-vnf-index-ref"],
 826             "short-name": vnfr["short-name"],
 827             "vnf-configuration": vnfr["vnf-configuration"],
 828             "nsr-id": nsr['ns-instance-config-ref'],
 829             "name": vnfr['name'],
 830             "vdur": vnfr["vdur"],
 831             "cloud-account": vnfr["cloud-account"]
 832         };
 833         var vnfrSg = nsr['vnfr-scaling-groups'];
 834         var vnfrName = vnfr["name"];
 835         if(vnfrSg) {
 836             if(vnfrSg[vnfr.id]) {
 837                 vnfrName = vnfrSg[vnfr.id]["scaling-group-name-ref"] + ':' + vnfrSg[vnfr.id][ "instance-id"] + ':' + vnfrName;
 838             }
 839         }
 840         var vnfrNfviMetrics = buildNfviGraphs(vnfr.vdur, vnfrName);
 841         if (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) {
 842             vnfrObj['service-primitives-present'] = true;
 843         } else {
 844             vnfrObj['service-primitives-present'] = false;
 845         }
 846                 transforms.mergeVnfrNfviMetrics(vnfrNfviMetrics, nsr["nfvi-metrics"]);
 847         //TODO: Should be sorted by create-time when it becomes available instead of id
 848         // nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'create-time'), 0, vnfrObj);
 849         nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'id'), 0, vnfrObj);
 850         vnfrObj["dashboard-url"] = vnfr["dashboard-url"];
 851         nsr["dashboard-urls"].push(vnfrObj);
 852
 853         decorateNSRWithVDURConsoleUrls(nsr, vnfr);
 854     }
 855 }
 856 NSR.create = function(req) {
 857     var api_server = req.query['api_server'];
 858     var data = req.body.data;
 859     console.log('Instantiating NSR on ', api_server);
 860     return new Promise(function(resolve, reject) {
 861         var requestHeaders = {};
 862         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 863             'Authorization': req.get('Authorization')
 864         });
 865         request({
 866             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config',
 867             method: 'POST',
 868             headers: requestHeaders,
 869             forever: constants.FOREVER_ON,
 870             rejectUnauthorized: false,
 871             json: data
 872         }, function(error, response, body) {
 873             if (utils.validateResponse('NSR.create', error, response, body, resolve, reject)) {
 874                 var nsr_id = null;
 875                 try {
 876                     nsr_id = data.nsr[0].id;
 877                 } catch (e) {
 878                     console.log("NSR.create unable to get nsr_id. Error: %s",
 879                     e.toString());
 880                 }
 881                 resolve({
 882                     statusCode: response.statusCode,
 883                     data: { nsr_id: nsr_id }
 884                  });
 885             };
 886         });
 887     });
 888 };
 889 NSR.delete = function(req) {
 890     var api_server = req.query["api_server"];
 891     var id = req.params.id;
 892     if (!id || !api_server) {
 893         return new Promise(function(resolve, reject) {
 894             console.log('Must specifiy api_server and id to delete NSR');
 895             return reject({
 896                 statusCode: 500,
 897                 errorMessage: {
 898                     error: 'Must specifiy api_server and id to delete NSR'
 899                 }
 900             });
 901         });
 902     };
 903     console.log('Deleting NSR with id: ' + id + 'on server: ' + api_server);
 904     return new Promise(function(resolve, reject) {
 905         var requestHeaders = {};
 906         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, {
 907             'Authorization': req.get('Authorization')
 908         });
 909         request({
 910             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id,
 911             method: 'DELETE',
 912             headers: requestHeaders,
 913             forever: constants.FOREVER_ON,
 914             rejectUnauthorized: false,
 915         }, function(error, response, body) {
 916             if (utils.validateResponse('NSR.delete', error, response, body, resolve, reject)) {
 917                 resolve({
 918                     statusCode: response.statusCode,
 919                     data: JSON.stringify(response.body)
 920                 });
 921             };
 922         });
 923     });
 924 };
 925 NSR.decorateAndTransformNFVI = function(nsr) {
 926         var toDecorate = [];
 927         // var metricsToUse = ["vcpu", "memory", "storage", "network"];
 928         var metricsToUse = ["vcpu", "memory"];
 929         try {
 930             var nfviMetrics = nsr["rw-nsr:nfvi-metrics"];
 931             if (nfviMetrics) {
 932                 metricsToUse.map(function(name) {
 933                     toDecorate.push(nfviMetrics[name])
 934                 });
 935             }
 936             nsr["nfvi-metrics"] = toDecorate;
 937             delete nsr["rw-nsr:nfvi-metrics"];
 938         } catch (e) {}
 939         return nsr;
 940     }
 941     //Not a great pattern, Need a better way of handling logging;
 942     //Refactor and move to the logging/logging.js
 943 var logCache = {
 944     decorateAndTransformWithControls: {}
 945 }
 946 NSR.decorateAndTransformWithControls = function(nsr) {
 947     var controlTypes = ["action-param", "control-param"];
 948     var nsControls = [];
 949     var Groups = {};
 950     controlTypes.map(function(control) {
 951         try {
 952             var controls = nsr["rw-nsr:" + control];
 953             // nsControls.push(controls);
 954             controls.map(function(item) {
 955                 if (!Groups[item["group-tag"]]) {
 956                     Groups[item["group-tag"]] = {};
 957                     Groups[item["group-tag"]]["action-param"] = []
 958                     Groups[item["group-tag"]]["control-param"] = []
 959                 }
 960                 Groups[item["group-tag"]][control].push(item);
 961             });
 962             delete nsr["rw-nsr:" + control];
 963         } catch (e) {
 964             var id = nsr["ns-instance-config-ref"];
 965             if (!logCache.decorateAndTransformWithControls[id]) {
 966                 logCache.decorateAndTransformWithControls[id] = {};
 967             }
 968             var log = logCache.decorateAndTransformWithControls[id];
 969             if (!log[control]) {
 970                 log[control] = true;
 971                 console.log('No controls exist for ' + control + ' at ' + nsr["ns-instance-config-ref"]);
 972             }
 973         }
 974     });
 975     for (k in Groups) {
 976         var obj = {}
 977         obj[k] = Groups[k];
 978         nsControls.push(obj)
 979     }
 980     nsr.nsControls = nsControls;
 981     return nsr;
 982 };
 983 NSR.setStatus = function(req) {
 984     var api_server = req.query['api_server'];
 985     var id = req.params.id;
 986     var status = req.body.status;
 987     console.log('Setting NSR (id: ' + id + ') status, on ' + api_server + ', to be: ' + status);
 988     return new Promise(function(resolve, reject) {
 989         var command;
 990         if (typeof(status) != "string") {
 991             reject({
 992                 'ERROR': 'NSR.setStatus Error: status is not a string type'
 993             });
 994         }
 995         command = status.toUpperCase();
 996         if (command != "ENABLED" && command != "DISABLED") {
 997             reject({
 998                 'ERROR': 'NSR.setStatus Error: status is: ' + command + '. It should be ENABLED or DISABLED'
 999             });
1000         }
1001         var requestHeaders = {};
1002         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1003             'Authorization': req.get('Authorization')
1004         });
1005         request({
1006             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/admin-status/',
1007             method: 'PUT',
1008             headers: requestHeaders,
1009             json: {
1010                 "nsr:admin-status": command
1011             },
1012             forever: constants.FOREVER_ON,
1013             rejectUnauthorized: false,
1014         }, function(error, response, body) {
1015             if (utils.validateResponse('NSR.setStatus', error, response, body, resolve, reject)) {
1016                 resolve({
1017                     statusCode: response.statusCode
1018                 });
1019             };
1020         });
1021     });
1022 };
1023
1024 NSR.createScalingGroupInstance = function(req) {
1025     var api_server = req.query['api_server'];
1026     var id = req.params.id;
1027     var scaling_group_id = req.params.scaling_group_id;
1028     if (!api_server || !id || !scaling_group_id) {
1029         return new Promise(function(resolve, reject) {
1030             return reject({
1031                 statusCode: 500,
1032                 errorMessage: {
1033                     error: 'API server/NSR id/Scaling group not provided'
1034                 }
1035             });
1036         });
1037     }
1038
1039     var instance_id = Math.floor(Math.random() * 65535);
1040
1041     var jsonData = {
1042         instance: [{
1043             // id: uuid.v1()
1044             id: instance_id
1045         }]
1046     };
1047
1048     console.log('Creating scaling group instance for NSR ', id, ', scaling group ', scaling_group_id, ' with instance id ', instance_id);
1049
1050     return new Promise(function(resolve, reject) {
1051         var requestHeaders = {};
1052         _.extend(requestHeaders,
1053             constants.HTTP_HEADERS.accept.data,
1054             constants.HTTP_HEADERS.content_type.data,
1055             {
1056                 'Authorization': req.get('Authorization')
1057             }
1058         );
1059
1060         request({
1061             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance',
1062             method: 'POST',
1063             headers: requestHeaders,
1064             json: jsonData,
1065             forever: constants.FOREVER_ON,
1066             rejectUnauthorized: false
1067         }, function (error, response, body) {
1068             if (utils.validateResponse('NSR.createScalingGroupInstance', error, response, body, resolve, reject)) {
1069                 resolve({
1070                     statusCode: response.statusCode,
1071                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1072                 })
1073             }
1074         });
1075     });
1076 };
1077
1078 NSR.deleteScalingGroupInstance = function(req) {
1079     var api_server=req.query['api_server'];
1080     var id = req.params.id;
1081     var scaling_group_id = req.params.scaling_group_id;
1082     var scaling_instance_id = req.params.scaling_instance_id;
1083
1084     if (!api_server || !id || !scaling_group_id || !scaling_instance_id) {
1085         return new Promise(function(resolve, reject) {
1086             return reject({
1087                 statusCode: 500,
1088                 errorMessage: {
1089                     error: 'API server/NSR id/Scaling group/Scaling instance id not provided'
1090                 }
1091             });
1092         });
1093     }
1094
1095     console.log('Deleting scaling group instance id ', scaling_instance_id,
1096         ' for scaling group ', scaling_group_id,
1097         ', under NSR ', id);
1098
1099     return new Promise(function(resolve, reject) {
1100         var requestHeaders = {};
1101         _.extend(requestHeaders,
1102             constants.HTTP_HEADERS.accept.data,
1103             constants.HTTP_HEADERS.content_type.data,
1104             {
1105                 'Authorization': req.get('Authorization')
1106             }
1107         );
1108
1109         request({
1110             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance/' + scaling_instance_id,
1111             method: 'DELETE',
1112             headers: requestHeaders,
1113             forever: constants.FOREVER_ON,
1114             rejectUnauthorized: false
1115         }, function (error, response, body) {
1116             if (utils.validateResponse('NSR.deleteScalingGroupInstance', error, response, body, resolve, reject)) {
1117                 resolve({
1118                     statusCode: response.statusCode,
1119                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1120                 })
1121             }
1122         });
1123     });
1124 };
1125
1126 NSR.nsd = {};
1127 NSR.nsd.vld = {};
1128
1129 NSR.nsd.vld.get = function(req) {
1130     var api_server = req.query['api_server'];
1131     var nsr_id = req.params.nsr_id;
1132     var vld_id = req.params.vld_id;
1133
1134     if (!api_server || !nsr_id) {
1135         return new Promise(function(resolve, reject) {
1136             return reject({
1137                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1138                 errorMessage: 'API server/NSR id not provided'
1139             });
1140         })
1141     }
1142     console.log('Getting VLD', vld_id ? (' ' + vld_id) : ('\'s'), ' for NSR id', nsr_id);
1143
1144     return new Promise(function(resolve, reject) {
1145         var requestHeaders = {};
1146         _.extend(requestHeaders,
1147             vld_id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection,
1148             {
1149                 'Authorization': req.get('Authorization')
1150             }
1151         );
1152
1153         request({
1154             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : '')  +'?deep',
1155             method: 'GET',
1156             headers: requestHeaders,
1157             forever: constants.FOREVER_ON,
1158             rejectUnauthorized: false
1159         }, function (error, response, body) {
1160             if (utils.validateResponse('NSR.nsd.vld.get', error, response, body, resolve, reject)) {
1161                 resolve({
1162                     statusCode: response.statusCode,
1163                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1164                 });
1165             }
1166         });
1167     });
1168 };
1169
1170 NSR.nsd.vld.create = function(req) {
1171     var api_server = req.query['api_server'];
1172     var nsr_id = req.params.nsr_id;
1173     var vld_id = req.params.vld_id;
1174     var data = req.body;
1175
1176     if (!api_server || !nsr_id) {
1177         return new Promise(function(resolve, reject) {
1178             return reject({
1179                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1180                 errorMessage: 'API server/NSR id not provided'
1181             });
1182         });
1183     }
1184
1185     console.log((vld_id ? 'Updating VLD ' + vld_id : 'Creating VLD') + ' under NSR', nsr_id);
1186
1187     var jsonData = {
1188         vld: typeof(data) == 'string' ? JSON.parse(data) : data
1189     };
1190
1191     return new Promise(function(resolve, reject) {
1192         var requestHeaders = {};
1193         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1194             'Authorization': req.get('Authorization')
1195         });
1196         request({
1197             uri: utils.confdPort(api_server) + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : ''),
1198             method: vld_id ? 'PUT' : 'POST',
1199             headers: requestHeaders,
1200             forever: constants.FOREVER_ON,
1201             rejectUnauthorized: false,
1202             json: jsonData
1203         }, function(error, response, body) {
1204             if (utils.validateResponse('NSR.nsd.vld.create/update', error, response, body, resolve, reject)) {
1205                 resolve({
1206                     statusCode: response.statusCode,
1207                     data: (typeof(response.body) == 'string') ? JSON.parse(response.body) : response.body
1208                 });
1209             }
1210         });
1211     });
1212 };
1213
1214 NSR.nsd.vld.update = NSR.nsd.vld.create;
1215
1216 NSR.nsd.vld.delete = function(req) {
1217     var api_server = req.query['api_server'];
1218     var nsr_id = req.params.nsr_id;
1219     var vld_id = req.params.vld_id;
1220
1221     if (!api_server || !nsr_id || !vld_id) {
1222         return new Promise(function(resolve, reject) {
1223             return reject({
1224                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1225                 errorMessage: 'API server/NSR id/VLD id not provided'
1226             });
1227         })
1228     }
1229     console.log('Deleting VLD', vld_id, 'for NSR id', nsr_id);
1230
1231     return new Promise(function(resolve, reject) {
1232         var requestHeaders = {};
1233         _.extend(requestHeaders,
1234             constants.HTTP_HEADERS.accept.data,
1235             {
1236                 'Authorization': req.get('Authorization')
1237             }
1238         );
1239
1240         request({
1241             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld/' + vld_id,
1242             method: 'DELETE',
1243             headers: requestHeaders,
1244             forever: constants.FOREVER_ON,
1245             rejectUnauthorized: false
1246         }, function (error, response, body) {
1247             if (utils.validateResponse('NSR.nsd.vld.delete', error, response, body, resolve, reject)) {
1248                 resolve({
1249                     statusCode: response.statusCode,
1250                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1251                 });
1252             }
1253         });
1254     });
1255 }
1256
1257 VNFR.get = function(req) {
1258     var api_server = req.query["api_server"];
1259     var id = req.params.id;
1260     var uri = utils.confdPort(api_server);
1261     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr' + (id ? '/' + id : '') + '?deep';
1262     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1263         'Authorization': req.get('Authorization')
1264     });
1265     return new Promise(function(resolve, reject) {
1266         request({
1267             url: uri,
1268             method: 'GET',
1269             headers: headers,
1270             forever: constants.FOREVER_ON,
1271             rejectUnauthorized: false,
1272         }, function(error, response, body) {
1273             if (utils.validateResponse('VNFR.get', error, response, body, resolve, reject)) {
1274                 var data = JSON.parse(response.body);
1275                 var returnData = id ? [data["vnfr:vnfr"]] : data.collection["vnfr:vnfr"];
1276                 returnData.forEach(function(vnfr) {
1277                     vnfr['nfvi-metrics'] = buildNfviGraphs(vnfr.vdur);
1278                     vnfr['epa-params'] = epa_aggregator(vnfr.vdur);
1279                     vnfr['service-primitives-present'] = (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) ? true : false;
1280                     vnfr['vdur'] && vnfr['vdur'].map(function(vdur, vdurIndex) {
1281                         // This console-url is what front-end will hit to generate a real console-url
1282                         vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url';
1283                     });
1284                 });
1285                 return resolve(returnData);
1286             };
1287         });
1288     });
1289 }
1290
1291 function buildNfviGraphs(VDURs, vnfrName){
1292         var temp = {};
1293         var toReturn = [];
1294         APIConfig.NfviMetrics.map(function(k) {
1295
1296             VDURs && VDURs.map(function(v,i) {
1297                 //Check for RIFT-12699: VDUR NFVI Metrics not fully populated
1298                 if (v["rw-vnfr:nfvi-metrics"] && v["rw-vnfr:nfvi-metrics"][k] && v["rw-vnfr:nfvi-metrics"][k].hasOwnProperty('utilization')) {
1299                     if(!temp[k]) {
1300                         temp[k] = {
1301                             title: '',
1302                             data: []
1303                         };
1304                     };
1305                     try {
1306                         var data = v["rw-vnfr:nfvi-metrics"][k];
1307                         var newData = {};
1308                         newData.name = v.name ? v.name : v.id.substring(0,6);
1309                         newData.name = vnfrName ? vnfrName + ': ' + newData.name : newData.name;
1310                         newData.id = v.id;
1311                         //converts to perentage
1312                         newData.utilization = data.utilization * 0.01;
1313                         temp[k].data.push(newData);
1314                         temp[k].title = v["rw-vnfr:nfvi-metrics"][k].label;
1315                     } catch (e) {
1316                         console.log('Something went wrong with the VNFR NFVI Metrics. Check that the data is being properly returned. ERROR: ', e);
1317                     }
1318                 }
1319             });
1320             if(temp[k]) {
1321                 toReturn.push(temp[k]);
1322             }
1323         });
1324         return toReturn;
1325     }
1326
1327
1328 //Cache NSR reference for VNFR
1329 VNFR.cachedNSR = {};
1330 VNFR.getByNSR = function(req) {
1331     var api_server = req.query["api_server"];
1332     var id = req.params.nsr_id;
1333     var uri = utils.confdPort(api_server);
1334     var reqClone = _.clone(req);
1335     delete reqClone.params.id;
1336     uri += APIVersion + '/api/operational/ns-instance-opdata/nsr/' + id + '?deep';
1337     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1338         'Authorization': req.get('Authorization')
1339     });
1340     return new Promise(function(resolve, reject) {
1341         if (VNFR.cachedNSR[id]) {
1342             var data = VNFR.cachedNSR[id];
1343             var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1344             VNFR.get(reqClone).then(function(vnfrData) {
1345                 resolve(filterVnfrByList(vnfrList, vnfrData));
1346             });
1347         } else {
1348             request({
1349                 url: uri,
1350                 method: 'GET',
1351                 headers: headers,
1352                 forever: constants.FOREVER_ON,
1353                 rejectUnauthorized: false,
1354             }, function(error, response, body) {
1355                 if (utils.validateResponse('VNFR.getByNSR', error, response, body, resolve, reject)) {
1356                     var data = JSON.parse(response.body);
1357                     data = data["nsr:nsr"];
1358                     //Cache NSR data with NSR-ID as
1359                     VNFR.cachedNSR[id] = data;
1360                     var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1361                     var returnData = [];
1362                     VNFR.get(reqClone).then(function(vnfrData) {
1363                         resolve(filterVnfrByList(vnfrList, vnfrData));
1364                     });
1365                 };
1366             });
1367         }
1368     });
1369 };
1370
1371 function filterVnfrByList(vnfrList, vnfrData) {
1372     return vnfrData.map(function(vnfr) {
1373         if (vnfrList.indexOf(vnfr.id) > -1) {
1374             return vnfr;
1375         }
1376     })
1377 };
1378
1379 VLR.get = function(req) {
1380     var api_server = req.query["api_server"];
1381     var id = req.params.id;
1382     var uri = utils.confdPort(api_server);
1383     uri += APIVersion + '/api/operational/vlr-catalog/vlr' + (id ? '/' + id : '') + '?deep';
1384     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1385         'Authorization': req.get('Authorization')
1386     });
1387     return new Promise(function(resolve, reject) {
1388         request({
1389             url: uri,
1390             method: 'GET',
1391             headers: headers,
1392             forever: constants.FOREVER_ON,
1393             rejectUnauthorized: false,
1394         }, function(error, response, body) {
1395             if (utils.validateResponse('VLR.get', error, response, body, resolve, reject)) {
1396                 var data = JSON.parse(response.body);
1397                 var returnData = id ? [data["vlr:vlr"]] : data.collection["vlr:vlr"];
1398                 return resolve({
1399                     data: returnData,
1400                     statusCode: response.statusCode
1401                 });
1402             };
1403         });
1404     });
1405 }
1406
1407 RIFT.api = function(req) {
1408     var api_server = req.query["api_server"];
1409     var uri = utils.confdPort(api_server);
1410     var url = req.path;
1411     return new Promise(function(resolve, reject) {
1412         request({
1413             url: uri + url + '?deep',
1414             method: 'GET',
1415             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1416                 'Authorization': req.get('Authorization')
1417             }),
1418             forever: constants.FOREVER_ON,
1419             rejectUnauthorized: false,
1420         }, function(error, response, body) {
1421             if (utils.validateResponse('RIFT.api', error, response, body, resolve, reject)) {
1422                 resolve(JSON.parse(response.body))
1423             };
1424         })
1425     })
1426 };
1427
1428 ComputeTopology.get = function(req) {
1429     var api_server = req.query['api_server'];
1430     var nsr_id = req.params.id;
1431     var result = {
1432         id: nsr_id, // node id
1433         name: nsr_id, // node name to display
1434         parameters: {}, // the parameters that can be used to determine size/color, etc. for the node
1435         type: 'nsr',
1436         children: [] // children for the node
1437     };
1438     return new Promise(function(resolve, reject) {
1439         var nsrPromise = new Promise(function(success, failure) {
1440             request({
1441                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr/' + nsr_id + '?deep',
1442                 method: 'GET',
1443                 headers: _.extend({},
1444                     constants.HTTP_HEADERS.accept.data, {
1445                         'Authorization': req.get('Authorization')
1446                     }),
1447                 forever: constants.FOREVER_ON,
1448                 rejectUnauthorized: false,
1449             }, function(error, response, body) {
1450                 if (utils.validateResponse('ComputeTopology.get ns-instance-opdata/nsr/:id', error, response, body, success, failure)) {
1451                     var data;
1452                     var isString = typeof(response.body) == "string";
1453                     if (isString && response.body == '') {
1454                         return success({});
1455                     }
1456                     try {
1457                         data = isString ? JSON.parse(response.body) : response.body;
1458
1459                         var nsrNFVIMetricData = data["nsr:nsr"]["rw-nsr:nfvi-metrics"];
1460                         result.parameters = nsrNFVIMetricData;
1461
1462                         result.name = data["nsr:nsr"]["name-ref"];
1463
1464                         var nsrData = data["nsr:nsr"]["constituent-vnfr-ref"];
1465                         success(nsrData);
1466                     } catch (e) {
1467                         console.log('Error parsing ns-instance-opdata for NSR ID', nsr_id, 'Exception:', e);
1468                         return failure()
1469                     }
1470                 };
1471             });
1472         }).then(function(data) {
1473
1474             try {
1475                 // got NSR data
1476                 // now get VNFR data and populate the structure
1477                 var vnfrPromises = [];
1478
1479                 // Run separately to confirm that primary structure is populated before promise resolution takes over
1480                 // and starts modifying the data
1481                 data.forEach(function(vnfrObj) {
1482
1483                     var vnfrId = vnfrObj['vnfr-id'];
1484
1485                     // If anything needs to be added to result for each vnfrId, do it here
1486
1487                     vnfrPromises.push(
1488                         new Promise(function(success, failure) {
1489                             rp({
1490                                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrId + '?deep',
1491                                 method: 'GET',
1492                                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1493                                     'Authorization': req.get('Authorization')
1494                                 }),
1495                                 forever: constants.FOREVER_ON,
1496                                 rejectUnauthorized: false,
1497                                 resolveWithFullResponse: true
1498                             }, function(error, response, body) {
1499                                 if (utils.validateResponse('ComputeTopology.get vnfr-catalaog/vnfr/:id', error, response, body, success, failure)) {
1500                                     try {
1501                                         var data = JSON.parse(response.body);
1502                                         var returnData = data["vnfr:vnfr"];
1503
1504                                         // Push VNFRs in result
1505                                         result.children.push({
1506                                             id: vnfrId,
1507                                             name: returnData.name,
1508                                             parameters: {}, // nfvi metrics here
1509                                             children: [],
1510                                             type: 'vnfr'
1511                                         });
1512
1513                                         // Push VDURs in result
1514                                         returnData.vdur.forEach(function(vdur) {
1515                                             result.children[result.children.length - 1].children.push({
1516                                                 id: vdur.id,
1517                                                 name: vdur.id,
1518                                                 parameters: {},
1519                                                 type: 'vdur'
1520                                                     // children: []
1521                                             });
1522                                         });
1523
1524                                         return success(returnData.vdur);
1525                                     } catch (e) {
1526                                         console.log('Error parsing vnfr-catalog for VNFR ID', vnfrId, 'Exception:', e);
1527                                         return failure();
1528                                     }
1529                                 };
1530                             });
1531                         })
1532                     );
1533                 });
1534
1535                 Promise.all(vnfrPromises).then(function(output) {
1536                     console.log('Resolved all VNFR requests successfully');
1537                     // By now result must be completely populated. output is moot
1538
1539                     // Sort the results as there's no order to them from RIFT-REST
1540                     result.children.sort(sortByName);
1541
1542                     result.children.forEach(function(vnfr) {
1543                         vnfr.children.sort(sortByName);
1544                     });
1545
1546                     resolve({
1547                         statusCode: 200,
1548                         data: result
1549                     });
1550                 }).catch(function(error) {
1551                     // Todo: Can this be made better?
1552                     // Right now if one of the southbound APIs fails - we just return what's populated so far in result
1553                     console.log('Problem with ComputeTopology.get vnfr-catalog/vnfr/:id', error, 'Resolving with partial data', result);
1554                     resolve({
1555                         statusCode: 200,
1556                         data: result
1557                     });
1558                 });
1559             } catch (e) {
1560                 // API came back with empty ns-instance-opdata response for NSR ID
1561                 // bail
1562                 console.log('Error iterating through ns-instance-opdata response for NSR ID', nsr_id, 'Exception:', e);
1563                 resolve({
1564                     statusCode: 200,
1565                     data: result
1566                 })
1567             }
1568         }, function(error) {
1569             // failed to get NSR data.
1570             // bail
1571             resolve({
1572                 statusCode: 200,
1573                 data: result
1574             });
1575         });
1576     });
1577 };
1578
1579 NetworkTopology.get = function(req) {
1580     var api_server = req.query["api_server"];
1581     var uri = utils.confdPort(api_server);
1582     uri += APIVersion + '/api/operational/network?deep';
1583     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1584         'Authorization': req.get('Authorization')
1585     });
1586     return new Promise(function(resolve, reject) {
1587         request({
1588             url: uri,
1589             method: 'GET',
1590             headers: headers,
1591             forever: constants.FOREVER_ON,
1592             rejectUnauthorized: false
1593         }, function(error, response, body) {
1594             if (utils.validateResponse('NetworkTopology.get', error, response, body, resolve, reject)) {
1595                 var data = JSON.parse(response.body);
1596                 var returnData = transforms.transformNetworkTopology(
1597                     data["ietf-network:network"]
1598                 );
1599                 resolve({
1600                     statusCode: 200,
1601                     data: returnData
1602                 });
1603             };
1604         });
1605     })
1606 }
1607
1608 VDUR.get = function(req) {
1609     var api_server = req.query["api_server"];
1610     var vnfrID = req.params.vnfr_id;
1611     var vdurID = req.params.vdur_id;
1612     var uri = utils.confdPort(api_server);
1613     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrID + '/vdur/' + vdurID + '?deep';
1614     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1615         'Authorization': req.get('Authorization')
1616     });
1617     return new Promise(function(resolve, reject) {
1618         request({
1619             url: uri,
1620             method: 'GET',
1621             headers: headers,
1622             forever: constants.FOREVER_ON,
1623             rejectUnauthorized: false,
1624         }, function(error, response, body) {
1625             if (utils.validateResponse('VDUR.get', error, response, body, resolve, reject)) {
1626                 var data = JSON.parse(response.body);
1627                 var returnData = data["vdur:vdur"];
1628                 return resolve(returnData);
1629             };
1630         });
1631     })
1632 }
1633
1634 VDUR.consoleUrl = {};
1635 VDUR.consoleUrl.get = function(req) {
1636     var api_server = req.query["api_server"];
1637     var vnfrID = req.params.vnfr_id;
1638     var vdurID = req.params.vdur_id;
1639     var uri = utils.confdPort(api_server);
1640     uri += APIVersion + '/api/operational/vnfr-console/vnfr/' + vnfrID + '/vdur/' + vdurID + '/console-url' + '?deep';
1641     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1642         'Authorization': req.get('Authorization')
1643     });
1644     return new Promise(function(resolve, reject) {
1645         request({
1646             url: uri,
1647             method: 'GET',
1648             headers: headers,
1649             forever: constants.FOREVER_ON,
1650             rejectUnauthorized: false,
1651         }, function(error, response, body) {
1652             if (utils.validateResponse('VDUR.consoleUrl.get', error, response, body, resolve, reject)) {
1653                 var data = JSON.parse(response.body);
1654                 var returnData = data;
1655                 return resolve({
1656                     data: returnData,
1657                     statusCode: response.statusCode
1658                 });
1659             };
1660         });
1661     })
1662 }
1663
1664 CloudAccount.get = function(req) {
1665     var api_server = req.query["api_server"];
1666     var uri = utils.confdPort(api_server);
1667     uri += APIVersion + '/api/operational/cloud/account?deep';
1668     var headers = _.extend({}, constants.HTTP_HEADERS.accept.collection, {
1669         'Authorization': req.get('Authorization')
1670     });
1671     return new Promise(function(resolve, reject) {
1672         request({
1673             url: uri,
1674             method: 'GET',
1675             headers: headers,
1676             forever: constants.FOREVER_ON,
1677             rejectUnauthorized: false,
1678         }, function(error, response, body) {
1679             if (utils.validateResponse('CloudAccount.get', error, response, body, resolve, reject)) {
1680                 var data = JSON.parse(response.body);
1681                 var returnData = data["collection"]["rw-cloud:account"];
1682                 resolve({
1683                     statusCode: 200,
1684                     data: returnData
1685                 });
1686             };
1687         });
1688     });
1689 }
1690
1691
1692 // Config-Agent Account APIs
1693 ConfigAgentAccount.get = function(req) {
1694     var self = this;
1695
1696     var api_server = req.query["api_server"];
1697     var id = req.params.id;
1698
1699     if (!id) {
1700         // Get all config accounts
1701         return new Promise(function(resolve, reject) {
1702
1703             var requestHeaders = {};
1704             _.extend(requestHeaders,
1705                 constants.HTTP_HEADERS.accept.collection, {
1706                     'Authorization': req.get('Authorization')
1707                 });
1708
1709             request({
1710                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account',
1711                     type: 'GET',
1712                     headers: requestHeaders,
1713                     forever: constants.FOREVER_ON,
1714                     rejectUnauthorized: false,
1715                 },
1716                 function(error, response, body) {
1717                     var data;
1718                     var statusCode;
1719                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1720                         try {
1721                             data = JSON.parse(response.body).collection['rw-config-agent:account'];
1722                             statusCode = response.statusCode;
1723                         } catch (e) {
1724                             console.log('Problem with "ConfigAgentAccount.get"', e);
1725                             var err = {};
1726                             err.statusCode = 500;
1727                             err.errorMessage = {
1728                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1729                             }
1730                             return reject(err);
1731                         }
1732
1733                         return resolve({
1734                             statusCode: statusCode,
1735                             data: data
1736                         });
1737                     };
1738                 });
1739         });
1740     } else {
1741         //Get a specific config account
1742         return new Promise(function(resolve, reject) {
1743             var requestHeaders = {};
1744             _.extend(requestHeaders,
1745                 constants.HTTP_HEADERS.accept.data, {
1746                     'Authorization': req.get('Authorization')
1747                 });
1748
1749             request({
1750                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account/' + id,
1751                     type: 'GET',
1752                     headers: requestHeaders,
1753                     forever: constants.FOREVER_ON,
1754                     rejectUnauthorized: false,
1755                 },
1756                 function(error, response, body) {
1757                     var data;
1758                     var statusCode;
1759                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1760                         try {
1761                             data = JSON.parse(response.body)['rw-config-agent:account'];
1762                             statusCode = response.statusCode;
1763                         } catch (e) {
1764                             console.log('Problem with "ConfigAgentAccount.get"', e);
1765                             var err = {};
1766                             err.statusCode = 500;
1767                             err.errorMessage = {
1768                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1769                             }
1770                             return reject(err);
1771                         }
1772
1773                         return resolve({
1774                             statusCode: statusCode,
1775                             data: data
1776                         });
1777                     }
1778                 });
1779         });
1780     }
1781 };
1782
1783 ConfigAgentAccount.create = function(req) {
1784
1785     var api_server = req.query["api_server"];
1786     var data = req.body;
1787
1788     return new Promise(function(resolve, reject) {
1789         var jsonData = {
1790             "account": Array.isArray(data) ? data : [data]
1791         };
1792
1793         console.log('Creating with', JSON.stringify(jsonData));
1794
1795         var requestHeaders = {};
1796         _.extend(requestHeaders,
1797             constants.HTTP_HEADERS.accept.data,
1798             constants.HTTP_HEADERS.content_type.data, {
1799                 'Authorization': req.get('Authorization')
1800             });
1801
1802         request({
1803             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent',
1804             method: 'POST',
1805             headers: requestHeaders,
1806             forever: constants.FOREVER_ON,
1807             rejectUnauthorized: false,
1808             json: jsonData,
1809         }, function(error, response, body) {
1810             if (utils.validateResponse('ConfigAgentAccount.create', error, response, body, resolve, reject)) {
1811                 return resolve({
1812                     statusCode: response.statusCode,
1813                     data: JSON.stringify(response.body),
1814                     body:response.body.body
1815                 });
1816             };
1817         });
1818     });
1819 };
1820
1821 ConfigAgentAccount.update = function(req) {
1822
1823     var api_server = req.query["api_server"];
1824     var id = req.params.id;
1825     var data = req.body;
1826
1827     return new Promise(function(resolve, reject) {
1828         var jsonData = {
1829             "rw-config-agent:account": data
1830         };
1831
1832         console.log('Updating config-agent', id, ' with', JSON.stringify(jsonData));
1833
1834         var requestHeaders = {};
1835         _.extend(requestHeaders,
1836             constants.HTTP_HEADERS.accept.data,
1837             constants.HTTP_HEADERS.content_type.data, {
1838                 'Authorization': req.get('Authorization')
1839             });
1840
1841         request({
1842             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1843             method: 'PUT',
1844             headers: requestHeaders,
1845             forever: constants.FOREVER_ON,
1846             rejectUnauthorized: false,
1847             json: jsonData,
1848         }, function(error, response, body) {
1849             if (utils.validateResponse('ConfigAgentAccount.update', error, response, body, resolve, reject)) {
1850                 return resolve({
1851                     statusCode: response.statusCode,
1852                     data: JSON.stringify(response.body)
1853                 });
1854             };
1855         });
1856     });
1857 };
1858
1859 ConfigAgentAccount.delete = function(req) {
1860
1861     var api_server = req.query["api_server"];
1862     var id = req.params.id;
1863
1864     if (!id || !api_server) {
1865         return new Promise(function(resolve, reject) {
1866             console.log('Must specifiy api_server and id to delete config-agent account');
1867             return reject({
1868                 statusCode: 500,
1869                 errorMessage: {
1870                     error: 'Must specifiy api_server and id to delete config agent account'
1871                 }
1872             });
1873         });
1874     };
1875
1876     return new Promise(function(resolve, reject) {
1877         var requestHeaders = {};
1878         _.extend(requestHeaders,
1879             constants.HTTP_HEADERS.accept.data, {
1880                 'Authorization': req.get('Authorization')
1881             });
1882         request({
1883             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1884             method: 'DELETE',
1885             headers: requestHeaders,
1886             forever: constants.FOREVER_ON,
1887             rejectUnauthorized: false,
1888         }, function(error, response, body) {
1889             if (utils.validateResponse('ConfigAgentAccount.delete', error, response, body, resolve, reject)) {
1890                 return resolve({
1891                     statusCode: response.statusCode,
1892                     data: JSON.stringify(response.body)
1893                 });
1894             };
1895         });
1896     });
1897 };
1898
1899
1900 DataCenters.get = function(req) {
1901     var api_server = req.query["api_server"];
1902     return new Promise(function(resolve, reject) {
1903         var requestHeaders = {};
1904         _.extend(requestHeaders,
1905             constants.HTTP_HEADERS.accept.data, {
1906                 'Authorization': req.get('Authorization')
1907             });
1908         request({
1909             url: utils.confdPort(api_server) + APIVersion + '/api/operational/datacenters?deep',
1910             method: 'GET',
1911             headers: requestHeaders,
1912             forever: constants.FOREVER_ON,
1913             rejectUnauthorized: false,
1914         }, function(error, response, body) {
1915             if (utils.validateResponse('DataCenters.get', error, response, body, resolve, reject)) {
1916                 var returnData = {};
1917                 try {
1918                     data = JSON.parse(response.body)["rw-launchpad:datacenters"]["ro-accounts"];
1919                     data.map(function(c) {
1920                         returnData[c.name] = c.datacenters;
1921                     })
1922                     statusCode = response.statusCode;
1923                 } catch (e) {
1924                     console.log('Problem with "DataCenters.get"', e);
1925                     var err = {};
1926                     err.statusCode = 500;
1927                     err.errorMessage = {
1928                         error: 'Problem with "DataCenters.get": ' + e.toString()
1929                     }
1930                     return reject(err);
1931                 }
1932                 return resolve({
1933                     statusCode: response.statusCode,
1934                     data: returnData
1935                 });
1936             };
1937         });
1938     });
1939 }
1940
1941 SSHkey.get  = function(req) {
1942     var api_server = req.query["api_server"];
1943     return new Promise(function(resolve, reject) {
1944         var requestHeaders = {};
1945         _.extend(requestHeaders,
1946             constants.HTTP_HEADERS.accept.data, {
1947                 'Authorization': req.get('Authorization')
1948             });
1949         request({
1950             url: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair?deep',
1951             method: 'GET',
1952             headers: requestHeaders,
1953             forever: constants.FOREVER_ON,
1954             rejectUnauthorized: false,
1955         }, function(error, response, body) {
1956             if (utils.validateResponse('SSHkey.get', error, response, body, resolve, reject)) {
1957                 var returnData = {};
1958                 try {
1959                     returnData = JSON.parse(response.body)['nsr:key-pair'];
1960                     statusCode = response.statusCode;
1961                 } catch (e) {
1962                     console.log('Problem with "SSHkey.get"', e);
1963                     var err = {};
1964                     err.statusCode = 500;
1965                     err.errorMessage = {
1966                         error: 'Problem with "SSHkey.get": ' + e.toString()
1967                     }
1968                     return reject(err);
1969                 }
1970                 return resolve({
1971                     statusCode: response.statusCode,
1972                     data: returnData
1973                 });
1974             };
1975         });
1976     });
1977 }
1978 SSHkey.delete = function(req) {
1979     var api_server = req.query['api_server'];
1980     var id = decodeURI(req.params.name);
1981     console.log('Deleting ssk-key', id);
1982     return new Promise(function(resolve, reject) {
1983         request({
1984             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/' + id,
1985             method: 'DELETE',
1986             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1987                 'Authorization': req.get('Authorization')
1988             }),
1989             forever: constants.FOREVER_ON,
1990             rejectUnauthorized: false,
1991         }, function(error, response, body) {
1992             if (utils.validateResponse('SSHkey.delete', error, response, body, resolve, reject)) {
1993                 resolve({
1994                     statusCode: response.statusCode
1995                 });
1996             }
1997         });
1998     });
1999 };
2000 SSHkey.post = function(req) {
2001     var api_server = req.query['api_server'];
2002     var data = req.body;
2003     return new Promise(function(resolve, reject) {
2004         request({
2005             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
2006             method: 'POST',
2007             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
2008                 'Authorization': req.get('Authorization')
2009             }),
2010             json: data,
2011             forever: constants.FOREVER_ON,
2012             rejectUnauthorized: false,
2013         }, function(error, response, body) {
2014             if (utils.validateResponse('SSHkey.post', error, response, body, resolve, reject)) {
2015                 resolve({
2016                     data: 'success',
2017                     statusCode: response.statusCode
2018                 });
2019             }
2020         });
2021     });
2022 };
2023 SSHkey.put = function(req) {
2024     var api_server = req.query['api_server'];
2025     var data = req.body;
2026     return new Promise(function(resolve, reject) {
2027         request({
2028             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
2029             method: 'PUT',
2030             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
2031                 'Authorization': req.get('Authorization')
2032             }),
2033             json: data,
2034             forever: constants.FOREVER_ON,
2035             rejectUnauthorized: false,
2036         }, function(error, response, body) {
2037             if (utils.validateResponse('SSHkey.put', error, response, body, resolve, reject)) {
2038                 resolve({
2039                     statusCode: response.statusCode
2040                 });
2041             }
2042         });
2043     });
2044 };
2045
2046 function sortByName(a, b) {
2047     return a.name > b.name;
2048 }
2049
2050 module.exports.catalog = Catalog;
2051 module.exports.nsr = NSR;
2052 module.exports.vnfr = VNFR;
2053 module.exports.vlr = VLR;
2054 module.exports.vdur = VDUR;
2055 module.exports.rift = RIFT;
2056 module.exports.computeTopology = ComputeTopology;
2057 module.exports.networkTopology = NetworkTopology;
2058 module.exports.config = Config;
2059 module.exports.cloud_account = CloudAccount;
2060 module.exports['config-agent-account'] = ConfigAgentAccount;
2061 module.exports.rpc = RPC;
2062 module.exports.data_centers = DataCenters;
2063 module.exports.SSHkey = SSHkey;