skyquake/plugins/launchpad/api/launchpad.js

   1 /*
   2  *
   3  *   Copyright 2016 RIFT.IO Inc
   4  *
   5  *   Licensed under the Apache License, Version 2.0 (the "License");
   6  *   you may not use this file except in compliance with the License.
   7  *   You may obtain a copy of the License at
   8  *
   9  *       http://www.apache.org/licenses/LICENSE-2.0
  10  *
  11  *   Unless required by applicable law or agreed to in writing, software
  12  *   distributed under the License is distributed on an "AS IS" BASIS,
  13  *   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
  14  *   See the License for the specific language governing permissions and
  15  *   limitations under the License.
  16  *
  17  */
  18
  19 var request = require('request');
  20 var Promise = require('bluebird');
  21 var rp = require('request-promise');
  22 var utils = require('../../../framework/core/api_utils/utils.js');
  23 var constants = require('../../../framework/core/api_utils/constants.js');
  24 var APIVersion = '/v1';
  25 var _ = require('underscore');
  26 var epa_aggregator = require('./epa_aggregator.js');
  27 var transforms = require('./transforms.js');
  28 var uuid = require('node-uuid');
  29
  30 // Revealing module pattern objects
  31 var Catalog = {};
  32 var Config = {};
  33 var NSR = {};
  34 var VNFR = {};
  35 var VLR = {};
  36 var RIFT = {};
  37 var ComputeTopology = {};
  38 var NetworkTopology = {};
  39 var VDUR = {};
  40 var CloudAccount = {};
  41 var ConfigAgentAccount = {};
  42 var RPC = {};
  43 var SSHkey = {};
  44 // API Configuration Info
  45 var APIConfig = {}
  46 APIConfig.NfviMetrics = ['vcpu', 'memory'];
  47
  48 RPC.executeNSServicePrimitive = function(req) {
  49     var api_server = req.query['api_server'];
  50     return new Promise(function(resolve, reject) {
  51         var jsonData = {
  52             "input": req.body
  53         };
  54
  55         var headers = _.extend({},
  56             constants.HTTP_HEADERS.accept.data,
  57             constants.HTTP_HEADERS.content_type.data, {
  58                 'Authorization': req.get('Authorization')
  59             }
  60         );
  61         request({
  62             url: utils.confdPort(api_server) + APIVersion + '/api/operations/exec-ns-service-primitive',
  63             method: 'POST',
  64             headers: headers,
  65             forever: constants.FOREVER_ON,
  66             rejectUnauthorized: false,
  67             json: jsonData
  68         }, function(error, response, body) {
  69             if (utils.validateResponse('RPC.executeNSServicePrimitive', error, response, body, resolve, reject)) {
  70                 return resolve({
  71                     statusCode: response.statusCode,
  72                     data: JSON.stringify(response.body)
  73                 });
  74             }
  75         })
  76     });
  77 };
  78
  79 RPC.getNSServicePrimitiveValues = function(req) {
  80     var api_server = req.query['api_server'];
  81     // var nsr_id = req.body['nsr_id_ref'];
  82     // var nsConfigPrimitiveName = req.body['name'];
  83     return new Promise(function(resolve, reject) {
  84         var jsonData = {
  85             "input": req.body
  86         };
  87
  88         var headers = _.extend({},
  89             constants.HTTP_HEADERS.accept.data,
  90             constants.HTTP_HEADERS.content_type.data, {
  91                 'Authorization': req.get('Authorization')
  92             }
  93         );
  94         request({
  95             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/get-ns-service-primitive-values',
  96             method: 'POST',
  97             headers: headers,
  98             forever: constants.FOREVER_ON,
  99             rejectUnauthorized: false,
 100             json: jsonData
 101         }, function(error, response, body) {
 102             if (utils.validateResponse('RPC.getNSServicePrimitiveValues', error, response, body, resolve, reject)) {
 103
 104                 resolve({
 105                     statusCode: response.statusCode,
 106                     data: JSON.parse(body)
 107                 });
 108             }
 109         });
 110     }).catch(function(error) {
 111         console.log('error getting primitive values');
 112     });
 113 };
 114 RPC.refreshAccountConnectionStatus = function(req) {
 115     var api_server = req.query['api_server'];
 116     var Name = req.params.name;
 117     var Type = req.params.type;
 118     var jsonData = {
 119         input: {}
 120     };
 121     var rpcInfo = {
 122         sdn: {
 123             label: 'sdn-account',
 124             rpc: 'update-sdn-status'
 125         },
 126         config: {
 127             label: 'cfg-agent-account',
 128             rpc: 'update-cfg-agent-status'
 129         },
 130         cloud: {
 131             label: 'cloud-account',
 132             rpc: 'update-cloud-status'
 133         }
 134     }
 135     jsonData.input[rpcInfo[Type].label] = Name;
 136     var headers = _.extend({},
 137         constants.HTTP_HEADERS.accept.data,
 138         constants.HTTP_HEADERS.content_type.data, {
 139             'Authorization': req.get('Authorization')
 140         }
 141     );
 142     return new Promise(function(resolve, reject) {
 143
 144         request({
 145             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/' + rpcInfo[Type].rpc,
 146             method: 'POST',
 147             headers: headers,
 148             forever: constants.FOREVER_ON,
 149             rejectUnauthorized: false,
 150             json: jsonData
 151         }, function(error, response, body) {
 152             if (utils.validateResponse('RPC.refreshAccountConnectionStatus', error, response, body, resolve, reject)) {
 153
 154                 resolve({
 155                     statusCode: response.statusCode,
 156                     data: body
 157                 });
 158             }
 159         });
 160     }).catch(function(error) {
 161         console.log('Error refreshing account info');
 162     });
 163 };
 164
 165
 166 var DataCenters = {};
 167 // Catalog module methods
 168 Catalog.get = function(req) {
 169     var api_server = req.query['api_server'];
 170     var results = {}
 171     return new Promise(function(resolve, reject) {
 172         Promise.all([
 173             rp({
 174                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 175                 method: 'GET',
 176                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 177                     'Authorization': req.get('Authorization')
 178                 }),
 179                 forever: constants.FOREVER_ON,
 180                 rejectUnauthorized: false,
 181                 resolveWithFullResponse: true
 182             }),
 183             rp({
 184                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd?deep',
 185                 method: 'GET',
 186                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 187                     'Authorization': req.get('Authorization')
 188                 }),
 189                 forever: constants.FOREVER_ON,
 190                 rejectUnauthorized: false,
 191                 resolveWithFullResponse: true
 192             }),
 193             rp({
 194                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata?deep',
 195                 method: 'GET',
 196                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 197                     'Authorization': req.get('Authorization')
 198                 }),
 199                 forever: constants.FOREVER_ON,
 200                 rejectUnauthorized: false,
 201                 resolveWithFullResponse: true
 202             })
 203             // Not enabled for now
 204             // rp({
 205             //   uri: utils.confdPort(api_server) + APIVersion + '/api/config/pnfd-catalog/pnfd?deep',
 206             //   method: 'GET',
 207             //   headers: _.extend({},
 208             //     constants.HTTP_HEADERS.accept.collection,
 209             //     {
 210             //       'Authorization': req.get('Authorization')
 211             //     }),
 212             //   forever: constants.FOREVER_ON,
 213             // rejectUnauthorized: false,
 214             //   resolveWithFullResponse: true
 215             // })
 216         ]).then(function(result) {
 217             console.log('Resolved all request promises (NSD, VNFD) successfully');
 218             var response = [{
 219                 "id": "GUID-1",
 220                 "name": "RIFT.ware™ NS Descriptors Catalog",
 221                 "short-name": "rift.ware-nsd-cat",
 222                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 223                 "vendor": "RIFT.io",
 224                 "version": "",
 225                 "created-on": "",
 226                 "type": "nsd",
 227                 "meta": {
 228                     "icon-svg": "data:image/svg+xml,%3C%3Fxml%20version%3D%221.0%22%20encoding%3D%22iso-8859-1%22%3F%3E%0A%3C!--%20Generator%3A%20Adobe%20Illustrator%2018.0.0%2C%20SVG%20Export%20Plug-In%20.%20SVG%20Version%3A%206.00%20Build%200)%20%20--%3E%0A%3C!DOCTYPE%20svg%20PUBLIC%20%22-%2F%2FW3C%2F%2FDTD%20SVG%201.1%2F%2FEN%22%20%22http%3A%2F%2Fwww.w3.org%2FGraphics%2FSVG%2F1.1%2FDTD%2Fsvg11.dtd%22%3E%0A%3Csvg%20version%3D%221.1%22%20id%3D%22connection-icon-1%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20xmlns%3Axlink%3D%22http%3A%2F%2Fwww.w3.org%2F1999%2Fxlink%22%20x%3D%220px%22%20y%3D%220px%22%0A%09%20viewBox%3D%220%200%2050%2050%22%20style%3D%22enable-background%3Anew%200%200%2050%2050%3B%22%20xml%3Aspace%3D%22preserve%22%3E%0A%09%3Cpath%20d%3D%22M15%2030c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2020c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2040c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M19.007%2025.885l12.88%206.44-.895%201.788-12.88-6.44z%22%2F%3E%3Cpath%20d%3D%22M30.993%2015.885l.894%201.79-12.88%206.438-.894-1.79z%22%2F%3E%3C%2Fsvg%3E"
 229                 },
 230                 "descriptors": []
 231             }, {
 232                 "id": "GUID-2",
 233                 "name": "RIFT.ware™ VNF Descriptors Catalog",
 234                 "short-name": "rift.ware-vnfd-cat",
 235                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 236                 "vendor": "RIFT.io",
 237                 "version": "",
 238                 "created-on": "",
 239                 "type": "vnfd",
 240                 "meta": {
 241                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_3\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <g> <path d=\"M58.852,62.447l-4.662-1.033c-0.047-3.138-0.719-6.168-1.996-9.007l3.606-2.92c0.858-0.695,0.99-1.954,0.296-2.813 l-4.521-5.584c-0.334-0.413-0.818-0.675-1.346-0.731c-0.525-0.057-1.056,0.102-1.468,0.435L45.25,43.64v0 c-2.486-1.907-5.277-3.259-8.297-4.019v-4.458c0-1.104-0.896-2-2-2H27.77c-1.104,0-2,0.896-2,2v4.461 c-3.08,0.777-5.922,2.171-8.447,4.144l-3.545-2.82c-0.415-0.33-0.94-0.479-1.472-0.422c-0.527,0.06-1.009,0.327-1.339,0.743 l-4.472,5.623c-0.688,0.864-0.544,2.123,0.32,2.81l3.642,2.896v0c-1.25,2.848-1.895,5.88-1.916,9.011l-4.666,1.078 c-1.076,0.249-1.747,1.322-1.499,2.398l1.616,7.001c0.249,1.077,1.325,1.747,2.399,1.499l4.813-1.111v0 c1.429,2.681,3.344,5.017,5.691,6.943l-2.17,4.55c-0.476,0.997-0.054,2.19,0.943,2.666l6.484,3.094 c0.271,0.129,0.566,0.195,0.861,0.195c0.226,0,0.451-0.038,0.668-0.115c0.5-0.177,0.909-0.545,1.138-1.024l2.198-4.611 c2.923,0.563,5.966,0.554,8.879-0.033l2.236,4.585c0.484,0.994,1.685,1.403,2.675,0.921l6.456-3.148 c0.992-0.484,1.405-1.682,0.921-2.674l-2.206-4.524c2.335-1.946,4.231-4.301,5.639-6.999l4.812,1.067 c1.076,0.237,2.146-0.441,2.385-1.52l1.556-7.014c0.115-0.518,0.02-1.06-0.266-1.508C59.82,62.878,59.369,62.562,58.852,62.447z M40.18,61.761c0,4.859-3.953,8.812-8.813,8.812c-4.858,0-8.811-3.953-8.811-8.812s3.952-8.812,8.811-8.812 C36.227,52.949,40.18,56.902,40.18,61.761z\"/> <path d=\"M64.268,45.324c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.826,0.353,3.736,0.345,5.551-0.021l1.07,2.195 c0.484,0.992,1.682,1.405,2.675,0.921l2.691-1.313c0.477-0.233,0.842-0.646,1.015-1.147c0.172-0.501,0.139-1.051-0.095-1.528 l-1.052-2.155c1.458-1.214,2.645-2.686,3.527-4.377l2.278,0.504c1.075,0.238,2.146-0.442,2.386-1.52l0.647-2.923 c0.238-1.078-0.442-2.146-1.521-2.385l-2.184-0.484c-0.028-1.962-0.449-3.857-1.248-5.632l1.673-1.355 c0.412-0.334,0.675-0.818,0.73-1.345s-0.102-1.056-0.436-1.468l-1.884-2.327c-0.697-0.859-1.957-0.99-2.813-0.295l-1.614,1.307 c-1.554-1.193-3.299-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.04 c-1.927,0.486-3.703,1.358-5.28,2.592l-1.634-1.298c-0.862-0.687-2.12-0.543-2.81,0.32l-1.864,2.344 c-0.33,0.416-0.481,0.945-0.422,1.472c0.061,0.527,0.327,1.009,0.743,1.339l1.69,1.345c-0.78,1.779-1.184,3.676-1.197,5.636 l-2.189,0.505c-0.517,0.119-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51l0.675,2.918 c0.249,1.076,1.323,1.747,2.398,1.498l2.28-0.527c0.892,1.676,2.089,3.137,3.559,4.343l-1.035,2.17 c-0.228,0.479-0.257,1.028-0.08,1.528c0.178,0.5,0.546,0.91,1.024,1.138l2.703,1.289C63.686,45.261,63.979,45.324,64.268,45.324z M64.334,27.961c0-3.039,2.473-5.51,5.512-5.51c3.038,0,5.51,2.472,5.51,5.51c0,3.039-2.472,5.511-5.51,5.511 C66.807,33.472,64.334,31,64.334,27.961z\"/> <path d=\"M96.107,66.441l-2.182-0.484c-0.028-1.961-0.449-3.856-1.25-5.632l1.675-1.355c0.412-0.334,0.675-0.818,0.73-1.346 c0.056-0.527-0.102-1.056-0.436-1.468l-1.885-2.327c-0.695-0.859-1.956-0.99-2.813-0.295l-1.614,1.307 c-1.555-1.193-3.3-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.041 c-1.929,0.486-3.706,1.358-5.282,2.592l-0.001,0l-1.631-1.298c-0.415-0.331-0.938-0.482-1.472-0.422 c-0.527,0.06-1.009,0.327-1.339,0.742l-1.863,2.343c-0.688,0.865-0.544,2.123,0.32,2.811l1.691,1.345 c-0.782,1.784-1.186,3.68-1.199,5.636l-2.188,0.505c-0.517,0.12-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51 l0.675,2.918c0.249,1.076,1.327,1.744,2.397,1.498l2.281-0.526c0.893,1.677,2.09,3.138,3.558,4.343h0.001l-1.035,2.168 c-0.229,0.479-0.258,1.029-0.081,1.529c0.178,0.5,0.546,0.909,1.024,1.138l2.702,1.289c0.278,0.132,0.571,0.195,0.86,0.195 c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.828,0.353,3.739,0.347,5.552-0.021l1.071,2.194 c0.484,0.992,1.682,1.405,2.675,0.921l2.69-1.312c0.477-0.233,0.842-0.645,1.014-1.147c0.173-0.501,0.14-1.051-0.093-1.528 l-1.052-2.155c1.459-1.215,2.645-2.688,3.525-4.377l2.278,0.505c0.52,0.116,1.061,0.02,1.508-0.266 c0.447-0.285,0.763-0.736,0.878-1.254l0.647-2.923C97.866,67.748,97.186,66.681,96.107,66.441z M85.162,66.174 c0,3.039-2.471,5.511-5.508,5.511c-3.039,0-5.512-2.472-5.512-5.511c0-3.039,2.473-5.511,5.512-5.511 C82.691,60.664,85.162,63.136,85.162,66.174z\"/> </g> </svg> "
 242                 },
 243                 "descriptors": []
 244             }, {
 245                 "id": "GUID-3",
 246                 "name": "RIFT.ware™ PNF Descriptors Catalog",
 247                 "short-name": "rift.ware-pnfd-cat",
 248                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 249                 "vendor": "RIFT.io",
 250                 "version": "",
 251                 "created-on": "",
 252                 "type": "pnfd",
 253                 "meta": {
 254                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_4\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <path d=\"M86.334,47.444V35.759H13.666v11.686h3.561v5.111h-3.561v11.686h72.668V52.556h-4.108v-5.111H86.334z M26.628,59.454h-5.051 v-4.941h5.051V59.454z M26.628,52.404h-5.051v-4.941h5.051V52.404z M26.628,45.486h-5.051v-4.941h5.051V45.486z M34.094,59.454 h-5.051v-4.941h5.051V59.454z M34.094,52.404h-5.051v-4.941h5.051V52.404z M34.094,45.486h-5.051v-4.941h5.051V45.486z M41.452,59.454h-5.051v-4.941h5.051V59.454z M41.452,52.404h-5.051v-4.941h5.051V52.404z M41.452,45.486h-5.051v-4.941h5.051 V45.486z M48.733,59.454h-5.051v-4.941h5.051V59.454z M48.733,52.404h-5.051v-4.941h5.051V52.404z M48.733,45.486h-5.051v-4.941 h5.051V45.486z M56.2,59.454h-5.051v-4.941H56.2V59.454z M56.2,52.404h-5.051v-4.941H56.2V52.404z M56.2,45.486h-5.051v-4.941H56.2 V45.486z M63.558,59.454h-5.05v-4.941h5.05V59.454z M63.558,52.404h-5.05v-4.941h5.05V52.404z M63.558,45.486h-5.05v-4.941h5.05 V45.486z M74.858,59.312h-6.521v-3.013h6.521V59.312z M71.572,50.854c-2.875,0-5.204-2.33-5.204-5.203s2.329-5.203,5.204-5.203 s5.204,2.33,5.204,5.203S74.446,50.854,71.572,50.854z M74.858,45.618c0,1.801-1.46,3.261-3.261,3.261 c-1.8,0-3.261-1.46-3.261-3.261s1.46-3.26,3.261-3.26C73.398,42.358,74.858,43.817,74.858,45.618z\"/> </svg>"
 255                 },
 256                 "descriptors": []
 257             }];
 258             var vnfdCatalog = null;
 259             var vnfdDict = {};
 260             if (result[1].body) {
 261                 vnfdCatalog = JSON.parse(result[1].body).collection['vnfd:vnfd'].map(function(v, i) {
 262                     vnfdDict[v.id] = v['short-name'] || v.name;
 263                 })
 264             }
 265             if (result[0].body) {
 266                 response[0].descriptors = JSON.parse(result[0].body).collection['nsd:nsd'];
 267                 if (result[2].body) {
 268                     var data = JSON.parse(result[2].body);
 269                     if (data && data["nsr:ns-instance-opdata"] && data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]) {
 270                         var nsdRefCountCollection = data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"];
 271                         response[0].descriptors.map(function(nsd) {
 272                             if (!nsd["meta"]) {
 273                                 nsd["meta"] = {};
 274                             }
 275                             if (typeof nsd['meta'] == 'string') {
 276                                 nsd['meta'] = JSON.parse(nsd['meta']);
 277                             }
 278                             nsd["meta"]["instance-ref-count"] = _.findWhere(nsdRefCountCollection, {
 279                                 "nsd-id-ref": nsd.id
 280                             })["instance-ref-count"];
 281                             nsd["constituent-vnfd"] && nsd["constituent-vnfd"].map(function(v) {
 282                                 v.name = vnfdDict[v["vnfd-id-ref"]];
 283                             })
 284                         });
 285                     }
 286                 }
 287             };
 288             if (result[1].body) {
 289                 response[1].descriptors = JSON.parse(result[1].body).collection['vnfd:vnfd'];
 290             };
 291             // if (result[2].body) {
 292             //   response[2].descriptors = JSON.parse(result[2].body).collection['pnfd:pnfd'];
 293             // };
 294             resolve({
 295                 statusCode: response.statusCode || 200,
 296                 data: JSON.stringify(response)
 297             });
 298         }).catch(function(error) {
 299             // Todo: Need better logic than all or nothing.
 300             // Right now even if one of the southbound APIs fails - all fail
 301             var res = {};
 302             console.log('Problem with Catalog.get', error);
 303             res.statusCode = error.statusCode || 500;
 304             res.errorMessage = {
 305                 error: 'Failed to get catalogs' + error
 306             };
 307             reject(res);
 308         });
 309     });
 310 };
 311 Catalog.delete = function(req) {
 312     var api_server = req.query['api_server'];
 313     var catalogType = req.params.catalogType;
 314     var id = req.params.id;
 315     console.log('Deleting', catalogType, id, 'from', api_server);
 316     return new Promise(function(resolve, reject) {
 317         request({
 318             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog/' + catalogType + '/' + id,
 319             method: 'DELETE',
 320             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 321                 'Authorization': req.get('Authorization')
 322             }),
 323             forever: constants.FOREVER_ON,
 324             rejectUnauthorized: false,
 325         }, function(error, response, body) {
 326             if (utils.validateResponse('Catalog.delete', error, response, body, resolve, reject)) {
 327                 resolve({
 328                     statusCode: response.statusCode
 329                 });
 330             }
 331         });
 332     });
 333 };
 334 Catalog.getVNFD = function(req) {
 335     var api_server = req.query['api_server'];
 336     var vnfdID = req.body.data;
 337     var authorization = req.get('Authorization');
 338     var VNFDs = [];
 339     if (typeof(vnfdID) == "object" && vnfdID.constructor.name == "Array") {
 340         vnfdID.map(function(id) {
 341             VNFDs.push(requestVNFD(id));
 342         });
 343     } else {
 344         VNFDs.push(requestVNFD(vnfdID));
 345     }
 346     return new Promise(function(resolve, reject) {
 347         Promise.all(VNFDs).then(function(data) {
 348             resolve(data)
 349         }).catch(function(error) {
 350             // Todo: Need better logic than all or nothing.
 351             // Right now even if one of the southbound APIs fails - all fail
 352             var res = {};
 353             console.log('Problem with Catalog.getVNFD', error);
 354             res.statusCode = 404;
 355             res.errorMessage = {
 356                 error: 'Failed to get VNFDs' + error
 357             };
 358             reject(res);
 359         });
 360     });
 361
 362     function requestVNFD(id) {
 363         return new Promise(function(resolve, reject) {
 364             var url = utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd' + (id ? '/' + id : '') + '?deep';
 365             request({
 366                 uri: url,
 367                 method: 'GET',
 368                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 369                     'Authorization': authorization
 370                 }),
 371                 forever: constants.FOREVER_ON,
 372                 rejectUnauthorized: false,
 373             }, function(error, response, body) {
 374                 if (utils.validateResponse('Catalog.getVNFD', error, response, body, resolve, reject)) {
 375                     var data;
 376                     //Is this still needed?
 377                     try {
 378                         data = JSON.parse(response.body)
 379                     } catch (e) {
 380                         reject({
 381                             statusCode: response ? response.statusCode : 400,
 382                             errorMessage: 'Issue parsing VNFD ' + id + 'from ' + utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd/' + id + '?deep'
 383                         });
 384                     }
 385                     resolve(data);
 386                 }
 387             });
 388         });
 389     }
 390 };
 391 Catalog.create = function(req) {
 392     var api_server = req.query['api_server'];
 393     var catalogType = req.params.catalogType;
 394     var data = req.body;
 395     console.log('Creating', catalogType, 'on', api_server);
 396     var jsonData = {};
 397     jsonData[catalogType] = [];
 398     jsonData[catalogType].push(data);
 399     return new Promise(function(resolve, reject) {
 400         var requestHeaders = {};
 401         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 402             'Authorization': req.get('Authorization')
 403         });
 404         request({
 405             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog',
 406             method: 'POST',
 407             headers: requestHeaders,
 408             forever: constants.FOREVER_ON,
 409             rejectUnauthorized: false,
 410             json: jsonData
 411         }, function(error, response, body) {
 412             if (utils.validateResponse('Catalog.create', error, response, body, resolve, reject)) {
 413                 resolve({
 414                     statusCode: response.statusCode
 415                 });
 416             }
 417         });
 418     });
 419 };
 420 Catalog.update = function(req) {
 421     var api_server = req.query['api_server'];
 422     var catalogType = req.params.catalogType;
 423     var id = req.params.id;
 424     var data = req.body;
 425     console.log('Updating', catalogType, 'id', id, 'on', api_server);
 426     var jsonData = {};
 427     jsonData[catalogType] = {};
 428     jsonData[catalogType] = data;
 429     return new Promise(function(resolve, reject) {
 430         var requestHeaders = {};
 431         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 432             'Authorization': req.get('Authorization')
 433         });
 434         request({
 435             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog' + '/' + catalogType + '/' + id,
 436             method: 'PUT',
 437             headers: requestHeaders,
 438             forever: constants.FOREVER_ON,
 439             rejectUnauthorized: false,
 440             json: jsonData
 441         }, function(error, response, body) {
 442             if (utils.validateResponse('Catalog.update', error, response, body, resolve, reject)) {
 443                 resolve({
 444                     statusCode: response.statusCode
 445                 });
 446             }
 447         });
 448     });
 449 };
 450
 451 Catalog.decorateNsdCatalogWithPlacementGroups = function decorateNsdCatalogWithPlacementGroups(catalog) {
 452     var newData = catalog;
 453     var parsedCatalog = JSON.parse(catalog.data);
 454     var nsds = parsedCatalog[0].descriptors;
 455     var vnfds = parsedCatalog[1].descriptors;
 456     var vnfdDict = (function(){
 457         var dict = {};
 458         vnfds.map(function(v, i) {
 459             dict[v.id] = v;
 460         })
 461         return dict;
 462     })(vnfds);
 463
 464     nsds.map(function(c, i) {
 465         //Rename and decorate NSD placement groups
 466         c['ns-placement-groups'] = c['placement-groups'] && c['placement-groups'].map(function(p, i) {
 467             //Adds vnfd name to member-vnfd entry
 468             p['member-vnfd'] = p['member-vnfd'].map(function(v) {
 469                 v.name = vnfdDict[v['vnfd-id-ref']].name;
 470                 return v;
 471             });
 472             p['host-aggregate'] = [];
 473             return p;
 474         });
 475
 476         //Adds vnf placement groups to nsd object for UI
 477         c['vnf-placement-groups'] = [];
 478         c['constituent-vnfd'] && c['constituent-vnfd'].map(function(v) {
 479             var vnf = vnfdDict[v['vnfd-id-ref']];
 480             // var vnfPg = {
 481             //     name: vnf.name,
 482             //     'placement-groups': vnf['placement-groups'].map(function(vp){
 483             //         vp['host-aggregate'] = [{}];
 484             //         return vp;
 485             //     })
 486             // };
 487             v['vnf-name'] = vnf.name;
 488             vnf['placement-groups'] && vnf['placement-groups'].map(function(vp) {
 489                 vp['host-aggregate'] = [];
 490                 vp['vnf-name'] = vnf.name;
 491                 vp['vnfd-id-ref'] = v['vnfd-id-ref'];
 492                 vp['member-vnf-index'] = v['member-vnf-index'];
 493                 c['vnf-placement-groups'].push(vp);
 494             })
 495         })
 496         return c;
 497     })
 498     // parsedCatalog[0].descriptors = nsds;
 499     newData.data = JSON.stringify(parsedCatalog);
 500     return newData;
 501 }
 502
 503 // NSR module methods
 504 // Spend some time refactoring this
 505 // refactor to accept only request object
 506 NSR.get = function(req) {
 507     var self = this;
 508     var nsrPromises = [];
 509     var api_server = req.query["api_server"];
 510     var id = req.params.id;
 511     var nsdInfo = new Promise(function(resolve, reject) {
 512         request({
 513             uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 514             method: 'GET',
 515             headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 516                 'Authorization': req.get('Authorization')
 517             }),
 518             forever: constants.FOREVER_ON,
 519             rejectUnauthorized: false,
 520         }, function(error, response, body) {
 521             if (utils.validateResponse('NSR.get nsd-catalog', error, response, body, resolve, reject)) {
 522                 var data;
 523                 var isString = typeof(response.body) == "string";
 524                 if (isString && response.body == '') return resolve('empty');
 525                 data = isString ? JSON.parse(response.body) : response.body;
 526                 var nsdData = data.collection["nsd:nsd"];
 527                 if (nsdData.constructor.name == "Object") {
 528                     nsdData = [nsdData];
 529                 }
 530                 resolve(nsdData);
 531             };
 532         })
 533     })
 534     var config = new Promise(function(resolve, reject) {
 535         request({
 536             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-config/nsr' + (id ? '/' + id : '') + '?deep',
 537             method: 'GET',
 538             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 539                 'Authorization': req.get('Authorization')
 540             }),
 541             forever: constants.FOREVER_ON,
 542             rejectUnauthorized: false,
 543         }, function(error, response, body) {
 544             if (utils.validateResponse('NSR.get ns-instance-config', error, response, body, resolve, reject)) {
 545                 var data;
 546                 var isString = typeof(response.body) == "string";
 547                 if (isString && response.body == '') return resolve();
 548                 data = isString ? JSON.parse(response.body) : response.body;
 549                 data = id ? data : data.collection;
 550                 var nsrData = data["nsr:nsr"];
 551                 if (nsrData.constructor.name == "Object") {
 552                     nsrData = [nsrData];
 553                 }
 554                 resolve(nsrData);
 555             };
 556         });
 557     });
 558     var opData = new Promise(function(resolve, reject) {
 559         request({
 560             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr' + (id ? '/' + id : '') + '?deep',
 561             method: 'GET',
 562             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 563                 'Authorization': req.get('Authorization')
 564             }),
 565             forever: constants.FOREVER_ON,
 566             rejectUnauthorized: false,
 567         }, function(error, response, body) {
 568             if (utils.validateResponse('NSR.get ns-instance-opdata', error, response, body, resolve, reject)) {
 569                 var data;
 570                 var isString = typeof(response.body) == "string";
 571                 if (isString && response.body == '') return resolve();
 572                 data = isString ? JSON.parse(response.body) : response.body;
 573                 data = id ? data : data.collection;
 574                 var nsrData = data["nsr:nsr"];
 575                 if (nsrData.constructor.name == "Object") {
 576                     nsrData = [nsrData];
 577                 }
 578                 nsrData.forEach(self.decorateWithScalingGroupDict);
 579                 nsrData.forEach(self.decorateAndTransformNFVI);
 580                 nsrData.forEach(self.decorateAndTransformWithControls);
 581                 Promise.all(self.addVnfrDataPromise(req, nsrData)).then(function() {
 582                     Promise.all(self.addVlrDataPromise(req, nsrData)).then(function() {
 583                         resolve(nsrData);
 584                     });
 585                 });
 586             };
 587         });
 588     }).catch(function(error) {
 589         console.log('error getting aggregated NS opdata', error)
 590         //note this will actually trigger the success callback
 591     });
 592     return new Promise(function(resolve, reject) {
 593         //Need smarter error handling here
 594         Promise.all([config, opData]).then(function(resolves) {
 595             var aggregate = {};
 596             // resolves[0] ==> ns-instance-config
 597             // resolves[1] ==> ns-instance-opdata
 598
 599             var nsInstanceConfig = resolves[0] && resolves[0];
 600             var nsInstanceOpdata = resolves[1] && resolves[1];
 601
 602             if (!nsInstanceConfig && !nsInstanceOpdata) {
 603                 return resolve({
 604                     nsrs: []
 605                 });
 606             }
 607
 608             nsInstanceConfig.forEach(function(v, k) {
 609                 v.nsd_name = v['nsd'] && v['nsd']['name'];
 610                 var scaling_group_descriptor = null;
 611
 612                 scaling_group_descriptor = v['nsd'] && v['nsd']['scaling-group-descriptor'];
 613
 614                 if (scaling_group_descriptor) {
 615                     scaling_group_descriptor.map(function(sgd, sgdi) {
 616                         sgd['vnfd-member'] && sgd['vnfd-member'].map(function(vnfd, vnfdi) {
 617                             var vnfrObj = _.findWhere(_.findWhere(nsInstanceOpdata, {
 618                                     'ns-instance-config-ref': v.id
 619                                 }).vnfrs, {
 620                                 'member-vnf-index-ref': vnfd['member-vnf-index-ref']
 621                             });
 622                             if (vnfrObj) {
 623                                 vnfd['short-name'] = vnfrObj['short-name'];
 624                             }
 625                         })
 626                     })
 627                     v['scaling-group-descriptor'] = scaling_group_descriptor;
 628                 }
 629
 630                 if (nsInstanceOpdata && nsInstanceOpdata.constructor.name == "Array") {
 631                     nsInstanceOpdata.forEach(function(w, l) {
 632                         if (v.id == w["ns-instance-config-ref"]) {
 633                             for (prop in w) {
 634                                 if (prop != "ns-instance-config-ref" && !v.hasOwnProperty(prop)) {
 635                                     v[prop] = w[prop];
 636                                 }
 637                             }
 638                         }
 639                     });
 640                 }
 641
 642                 v['scaling-group-record'] && v['scaling-group-record'].map(function(sgr) {
 643                     var scalingGroupName = sgr['scaling-group-name-ref'];
 644                     sgr['instance'] && sgr['instance'].map(function(instance) {
 645                         var scalingGroupInstanceId = instance['instance-id'];
 646                         instance['vnfrs'] && instance['vnfrs'].map(function(vnfr) {
 647                             var vnfrObj = _.findWhere(v['vnfrs'], {id: vnfr});
 648                             if (vnfrObj) {
 649                                 vnfrObj['scaling-group-name'] = scalingGroupName;
 650                                 vnfrObj['scaling-group-instance-id'] = scalingGroupInstanceId;
 651                             }
 652                         });
 653                     });
 654                 })
 655             });
 656             var nsrsData = nsInstanceConfig;
 657             nsrsData.sort(function(a, b) {
 658                 return a["create-time"] - b["create-time"];
 659             });
 660             resolve({
 661                 nsrs: nsrsData
 662             });
 663         }).catch(function(error) {
 664             reject({
 665                 statusCode: 404,
 666                 errorMessage: error
 667             })
 668         })
 669     });
 670 };
 671 // Static VNFR Cache bu VNFR ID
 672 var staticVNFRCache = {};
 673
 674 /**
 675  * [decorateWithScalingGroupDict description]
 676  * @param  {[type]} nsr [description]
 677  * @return {[type]}
 678 {vnfr-id} : {
 679     "scaling-group-name-ref": "sg1",
 680     "instance-id": 0,
 681     "op-status": "running",
 682     "is-default": "true",
 683     "create-time": 1463593760,
 684     "config-status": "configuring",
 685     "vnfrs": [
 686         "432154e3-164e-4c05-83ee-3b56e4c898e7"
 687     ]
 688 }
 689  */
 690 NSR.decorateWithScalingGroupDict = function(nsr) {
 691     var sg = nsr["scaling-group-record"];
 692     var dict = {};
 693     if(sg) {
 694         sg.map(function(s) {
 695             var sgRef = s['scaling-group-name-ref'];
 696             s.instance && s.instance.map(function(si) {
 697                 si.vnfrs && si.vnfrs.map(function(v) {
 698                     dict[v] = si;
 699                     dict[v]["scaling-group-name-ref"] = sgRef;
 700                 })
 701             })
 702         })
 703     }
 704     return nsr['vnfr-scaling-groups'] = dict;
 705 }
 706
 707
 708 NSR.addVlrDataPromise = function(req, nsrs) {
 709     var api_server = req.query['api_server'];
 710     var promises = [];
 711     nsrs.map(function(nsr) {
 712         var vlrPromises = [];
 713         var vlr = nsr['vlr'];
 714         nsr['decorated-vlrs'] = [];
 715         if (!vlr) {
 716             console.log('No VL\'s found in NS');
 717         }
 718         vlr && vlr.map(function(vlrObject) {
 719             req.params.id = vlrObject['vlr-ref'];
 720             var vlrPromise = VLR.get(req).then(function(vlr) {
 721                 try {
 722                     var vlrItem = vlr['data'][0];
 723                     decorateNSRWithVLR(nsr, vlrObject, vlrItem);
 724                 } catch (e) {
 725                     console.log('Expection caught getting VLRs and adding to NSR:', e);
 726                 }
 727             })
 728             vlrPromises.push(vlrPromise);
 729         });
 730         var NSR_Promise = new Promise(function(resolve, reject) {
 731             Promise.all(vlrPromises).then(function() {
 732                 resolve();
 733             })
 734         });
 735         promises.push(NSR_Promise);
 736     });
 737     return promises;
 738
 739     function decorateNSRWithVLR(nsr, nsrVLRObject, vlr) {
 740         var vlrObject = _.extend(nsrVLRObject, vlr);
 741         vlrObject['vnfr-connection-point-ref'] && vlrObject['vnfr-connection-point-ref'].map(function(vnfrCP) {
 742             var vnfrName = nsr['vnfrs'] && _.find(nsr['vnfrs'], {id: vnfrCP['vnfr-id']})['name'];
 743             vnfrName && (vnfrCP['vnfr-name'] = vnfrName);
 744         });
 745         nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'name'), 0, vlrObject);
 746         // nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'create-time'), 0, vlrObject);
 747     }
 748 }
 749
 750
 751 NSR.addVnfrDataPromise = function(req, nsrs) {
 752     var api_server = req.query['api_server'];
 753     var promises = [];
 754     nsrs.map(function(nsr) {
 755         var epa_params = {};
 756         var constituent_vnfr_ref = nsr["constituent-vnfr-ref"];
 757         var vnfrPromises = [];
 758         nsr["vnfrs"] = [];
 759         nsr["dashboard-urls"] = [];
 760         nsr['nfvi-metrics'] = [];
 761         if (!constituent_vnfr_ref) {
 762             console.log('Something is wrong, there are no constituent-vnfr-refs');
 763             constituent_vnfr_ref = [];
 764         }
 765         //Get VNFR Static Data
 766         constituent_vnfr_ref && constituent_vnfr_ref.map(function(constituentVnfrObj) {
 767             req.params.id = constituentVnfrObj['vnfr-id'];
 768             var vnfrPromise;
 769             vnfrPromise = VNFR.get(req).then(function(vnfr) {
 770                 try {
 771                     var vnfrItem = vnfr[0];
 772                     decorateNSRWithVNFR(nsr, vnfrItem)
 773                     staticVNFRCache[vnfrItem.id] = vnfrItem;
 774                 } catch (e) {
 775                     console.log('Exception caught:', e);
 776                 }
 777             });
 778             vnfrPromises.push(vnfrPromise);
 779         });
 780         var NSR_Promise = new Promise(function(resolve, reject) {
 781             Promise.all(vnfrPromises).then(function() {
 782                 var vnfrs = staticVNFRCache;
 783                 //Aggregate EPA Params
 784                 constituent_vnfr_ref && constituent_vnfr_ref.map(function(k) {
 785                         if (vnfrs[k['vnfr-id']]) {
 786                             epa_params = epa_aggregator(vnfrs[k['vnfr-id']].vdur, epa_params);
 787                         }
 788                     })
 789                 //Add VNFR Name to monitoring params
 790                 try {
 791                     if (nsr["monitoring-param"]) {
 792                         nsr["monitoring-param"].map(function(m) {
 793                             // var vnfr = vnfrs[m["vnfr-id"]] || {};
 794                             // m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR');
 795                             var groupTag = m['group-tag'];
 796                             var vnfrId = m['vnfr-mon-param-ref'] && m['vnfr-mon-param-ref'][0] && m['vnfr-mon-param-ref'][0]['vnfr-id-ref'];
 797                             var vnfr = vnfrs[vnfrId] || {};
 798                             m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR');
 799                             m['group-tag'] = (groupTag ? (groupTag + ' - ') : '') + m['vnfr-name'] + (vnfrId ? ' (' + vnfrId.substring(1,8) + '...)' : '');
 800
 801                         });
 802                     }
 803                 } catch (e) {
 804                     console.log('Exception caught:', e);
 805                 }
 806                 resolve();
 807             })
 808         })
 809         nsr["epa-params"] = epa_params;
 810         promises.push(NSR_Promise);
 811     })
 812     return promises;
 813
 814     function decorateNSRWithVDURConsoleUrls(nsr, vnfr) {
 815         nsr['console-urls'] = nsr['console-urls'] ? nsr['console-urls'] : [];
 816
 817         vnfr && vnfr['vdur'] && vnfr['vdur'].map(function(vdur) {
 818             // This console-url is what front-end will hit to generate a real console-url
 819             vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url';
 820             nsr['console-urls'].push({
 821                 id: vdur.id,
 822                 name: vnfr.name,
 823                 'console-url': vdur['console-url']
 824             });
 825         });
 826     }
 827
 828     function decorateNSRWithVNFR(nsr, vnfr) {
 829         var vnfrObj = {
 830             id: vnfr.id,
 831             "member-vnf-index-ref": vnfr["member-vnf-index-ref"],
 832             "short-name": vnfr["short-name"],
 833             "vnf-configuration": vnfr["vnf-configuration"],
 834             "nsr-id": nsr['ns-instance-config-ref'],
 835             "name": vnfr['name'],
 836             "vdur": vnfr["vdur"],
 837             "cloud-account": vnfr["cloud-account"]
 838         };
 839         var vnfrSg = nsr['vnfr-scaling-groups'];
 840         var vnfrName = vnfr["name"];
 841         if(vnfrSg) {
 842             if(vnfrSg[vnfr.id]) {
 843                 vnfrName = vnfrSg[vnfr.id]["scaling-group-name-ref"] + ':' + vnfrSg[vnfr.id][ "instance-id"] + ':' + vnfrName;
 844             }
 845         }
 846         var vnfrNfviMetrics = buildNfviGraphs(vnfr.vdur, vnfrName);
 847         if (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) {
 848             vnfrObj['service-primitives-present'] = true;
 849         } else {
 850             vnfrObj['service-primitives-present'] = false;
 851         }
 852                 transforms.mergeVnfrNfviMetrics(vnfrNfviMetrics, nsr["nfvi-metrics"]);
 853         //TODO: Should be sorted by create-time when it becomes available instead of id
 854         // nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'create-time'), 0, vnfrObj);
 855         nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'id'), 0, vnfrObj);
 856         vnfrObj["dashboard-url"] = vnfr["dashboard-url"];
 857         nsr["dashboard-urls"].push(vnfrObj);
 858
 859         decorateNSRWithVDURConsoleUrls(nsr, vnfr);
 860     }
 861 }
 862 NSR.create = function(req) {
 863     var api_server = req.query['api_server'];
 864     var data = req.body.data;
 865     console.log('Instantiating NSR on ', api_server);
 866     return new Promise(function(resolve, reject) {
 867         var requestHeaders = {};
 868         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 869             'Authorization': req.get('Authorization')
 870         });
 871         request({
 872             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config',
 873             method: 'POST',
 874             headers: requestHeaders,
 875             forever: constants.FOREVER_ON,
 876             rejectUnauthorized: false,
 877             json: data
 878         }, function(error, response, body) {
 879             if (utils.validateResponse('NSR.create', error, response, body, resolve, reject)) {
 880                 var nsr_id = null;
 881                 try {
 882                     nsr_id = data.nsr[0].id;
 883                 } catch (e) {
 884                     console.log("NSR.create unable to get nsr_id. Error: %s",
 885                     e.toString());
 886                 }
 887                 resolve({
 888                     statusCode: response.statusCode,
 889                     data: { nsr_id: nsr_id }
 890                  });
 891             };
 892         });
 893     });
 894 };
 895 NSR.delete = function(req) {
 896     var api_server = req.query["api_server"];
 897     var id = req.params.id;
 898     if (!id || !api_server) {
 899         return new Promise(function(resolve, reject) {
 900             console.log('Must specifiy api_server and id to delete NSR');
 901             return reject({
 902                 statusCode: 500,
 903                 errorMessage: {
 904                     error: 'Must specifiy api_server and id to delete NSR'
 905                 }
 906             });
 907         });
 908     };
 909     console.log('Deleting NSR with id: ' + id + 'on server: ' + api_server);
 910     return new Promise(function(resolve, reject) {
 911         var requestHeaders = {};
 912         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, {
 913             'Authorization': req.get('Authorization')
 914         });
 915         request({
 916             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id,
 917             method: 'DELETE',
 918             headers: requestHeaders,
 919             forever: constants.FOREVER_ON,
 920             rejectUnauthorized: false,
 921         }, function(error, response, body) {
 922             if (utils.validateResponse('NSR.delete', error, response, body, resolve, reject)) {
 923                 resolve({
 924                     statusCode: response.statusCode,
 925                     data: JSON.stringify(response.body)
 926                 });
 927             };
 928         });
 929     });
 930 };
 931 NSR.decorateAndTransformNFVI = function(nsr) {
 932         var toDecorate = [];
 933         // var metricsToUse = ["vcpu", "memory", "storage", "network"];
 934         var metricsToUse = ["vcpu", "memory"];
 935         try {
 936             var nfviMetrics = nsr["rw-nsr:nfvi-metrics"];
 937             if (nfviMetrics) {
 938                 metricsToUse.map(function(name) {
 939                     toDecorate.push(nfviMetrics[name])
 940                 });
 941             }
 942             nsr["nfvi-metrics"] = toDecorate;
 943             delete nsr["rw-nsr:nfvi-metrics"];
 944         } catch (e) {}
 945         return nsr;
 946     }
 947     //Not a great pattern, Need a better way of handling logging;
 948     //Refactor and move to the logging/logging.js
 949 var logCache = {
 950     decorateAndTransformWithControls: {}
 951 }
 952 NSR.decorateAndTransformWithControls = function(nsr) {
 953     var controlTypes = ["action-param", "control-param"];
 954     var nsControls = [];
 955     var Groups = {};
 956     controlTypes.map(function(control) {
 957         try {
 958             var controls = nsr["rw-nsr:" + control];
 959             // nsControls.push(controls);
 960             controls.map(function(item) {
 961                 if (!Groups[item["group-tag"]]) {
 962                     Groups[item["group-tag"]] = {};
 963                     Groups[item["group-tag"]]["action-param"] = []
 964                     Groups[item["group-tag"]]["control-param"] = []
 965                 }
 966                 Groups[item["group-tag"]][control].push(item);
 967             });
 968             delete nsr["rw-nsr:" + control];
 969         } catch (e) {
 970             var id = nsr["ns-instance-config-ref"];
 971             if (!logCache.decorateAndTransformWithControls[id]) {
 972                 logCache.decorateAndTransformWithControls[id] = {};
 973             }
 974             var log = logCache.decorateAndTransformWithControls[id];
 975             if (!log[control]) {
 976                 log[control] = true;
 977                 console.log('No controls exist for ' + control + ' at ' + nsr["ns-instance-config-ref"]);
 978             }
 979         }
 980     });
 981     for (k in Groups) {
 982         var obj = {}
 983         obj[k] = Groups[k];
 984         nsControls.push(obj)
 985     }
 986     nsr.nsControls = nsControls;
 987     return nsr;
 988 };
 989 NSR.setStatus = function(req) {
 990     var api_server = req.query['api_server'];
 991     var id = req.params.id;
 992     var status = req.body.status;
 993     console.log('Setting NSR (id: ' + id + ') status, on ' + api_server + ', to be: ' + status);
 994     return new Promise(function(resolve, reject) {
 995         var command;
 996         if (typeof(status) != "string") {
 997             reject({
 998                 'ERROR': 'NSR.setStatus Error: status is not a string type'
 999             });
1000         }
1001         command = status.toUpperCase();
1002         if (command != "ENABLED" && command != "DISABLED") {
1003             reject({
1004                 'ERROR': 'NSR.setStatus Error: status is: ' + command + '. It should be ENABLED or DISABLED'
1005             });
1006         }
1007         var requestHeaders = {};
1008         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1009             'Authorization': req.get('Authorization')
1010         });
1011         request({
1012             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/admin-status/',
1013             method: 'PUT',
1014             headers: requestHeaders,
1015             json: {
1016                 "nsr:admin-status": command
1017             },
1018             forever: constants.FOREVER_ON,
1019             rejectUnauthorized: false,
1020         }, function(error, response, body) {
1021             if (utils.validateResponse('NSR.setStatus', error, response, body, resolve, reject)) {
1022                 resolve({
1023                     statusCode: response.statusCode
1024                 });
1025             };
1026         });
1027     });
1028 };
1029
1030 NSR.createScalingGroupInstance = function(req) {
1031     var api_server = req.query['api_server'];
1032     var id = req.params.id;
1033     var scaling_group_id = req.params.scaling_group_id;
1034     if (!api_server || !id || !scaling_group_id) {
1035         return new Promise(function(resolve, reject) {
1036             return reject({
1037                 statusCode: 500,
1038                 errorMessage: {
1039                     error: 'API server/NSR id/Scaling group not provided'
1040                 }
1041             });
1042         });
1043     }
1044
1045     var instance_id = Math.floor(Math.random() * 65535);
1046
1047     var jsonData = {
1048         instance: [{
1049             // id: uuid.v1()
1050             id: instance_id
1051         }]
1052     };
1053
1054     console.log('Creating scaling group instance for NSR ', id, ', scaling group ', scaling_group_id, ' with instance id ', instance_id);
1055
1056     return new Promise(function(resolve, reject) {
1057         var requestHeaders = {};
1058         _.extend(requestHeaders,
1059             constants.HTTP_HEADERS.accept.data,
1060             constants.HTTP_HEADERS.content_type.data,
1061             {
1062                 'Authorization': req.get('Authorization')
1063             }
1064         );
1065
1066         request({
1067             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance',
1068             method: 'POST',
1069             headers: requestHeaders,
1070             json: jsonData,
1071             forever: constants.FOREVER_ON,
1072             rejectUnauthorized: false
1073         }, function (error, response, body) {
1074             if (utils.validateResponse('NSR.createScalingGroupInstance', error, response, body, resolve, reject)) {
1075                 resolve({
1076                     statusCode: response.statusCode,
1077                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1078                 })
1079             }
1080         });
1081     });
1082 };
1083
1084 NSR.deleteScalingGroupInstance = function(req) {
1085     var api_server=req.query['api_server'];
1086     var id = req.params.id;
1087     var scaling_group_id = req.params.scaling_group_id;
1088     var scaling_instance_id = req.params.scaling_instance_id;
1089
1090     if (!api_server || !id || !scaling_group_id || !scaling_instance_id) {
1091         return new Promise(function(resolve, reject) {
1092             return reject({
1093                 statusCode: 500,
1094                 errorMessage: {
1095                     error: 'API server/NSR id/Scaling group/Scaling instance id not provided'
1096                 }
1097             });
1098         });
1099     }
1100
1101     console.log('Deleting scaling group instance id ', scaling_instance_id,
1102         ' for scaling group ', scaling_group_id,
1103         ', under NSR ', id);
1104
1105     return new Promise(function(resolve, reject) {
1106         var requestHeaders = {};
1107         _.extend(requestHeaders,
1108             constants.HTTP_HEADERS.accept.data,
1109             constants.HTTP_HEADERS.content_type.data,
1110             {
1111                 'Authorization': req.get('Authorization')
1112             }
1113         );
1114
1115         request({
1116             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance/' + scaling_instance_id,
1117             method: 'DELETE',
1118             headers: requestHeaders,
1119             forever: constants.FOREVER_ON,
1120             rejectUnauthorized: false
1121         }, function (error, response, body) {
1122             if (utils.validateResponse('NSR.deleteScalingGroupInstance', error, response, body, resolve, reject)) {
1123                 resolve({
1124                     statusCode: response.statusCode,
1125                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1126                 })
1127             }
1128         });
1129     });
1130 };
1131
1132 NSR.nsd = {};
1133 NSR.nsd.vld = {};
1134
1135 NSR.nsd.vld.get = function(req) {
1136     var api_server = req.query['api_server'];
1137     var nsr_id = req.params.nsr_id;
1138     var vld_id = req.params.vld_id;
1139
1140     if (!api_server || !nsr_id) {
1141         return new Promise(function(resolve, reject) {
1142             return reject({
1143                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1144                 errorMessage: 'API server/NSR id not provided'
1145             });
1146         })
1147     }
1148     console.log('Getting VLD', vld_id ? (' ' + vld_id) : ('\'s'), ' for NSR id', nsr_id);
1149
1150     return new Promise(function(resolve, reject) {
1151         var requestHeaders = {};
1152         _.extend(requestHeaders,
1153             vld_id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection,
1154             {
1155                 'Authorization': req.get('Authorization')
1156             }
1157         );
1158
1159         request({
1160             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : '')  +'?deep',
1161             method: 'GET',
1162             headers: requestHeaders,
1163             forever: constants.FOREVER_ON,
1164             rejectUnauthorized: false
1165         }, function (error, response, body) {
1166             if (utils.validateResponse('NSR.nsd.vld.get', error, response, body, resolve, reject)) {
1167                 resolve({
1168                     statusCode: response.statusCode,
1169                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1170                 });
1171             }
1172         });
1173     });
1174 };
1175
1176 NSR.nsd.vld.create = function(req) {
1177     var api_server = req.query['api_server'];
1178     var nsr_id = req.params.nsr_id;
1179     var vld_id = req.params.vld_id;
1180     var data = req.body;
1181
1182     if (!api_server || !nsr_id) {
1183         return new Promise(function(resolve, reject) {
1184             return reject({
1185                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1186                 errorMessage: 'API server/NSR id not provided'
1187             });
1188         });
1189     }
1190
1191     console.log((vld_id ? 'Updating VLD ' + vld_id : 'Creating VLD') + ' under NSR', nsr_id);
1192
1193     var jsonData = {
1194         vld: typeof(data) == 'string' ? JSON.parse(data) : data
1195     };
1196
1197     return new Promise(function(resolve, reject) {
1198         var requestHeaders = {};
1199         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1200             'Authorization': req.get('Authorization')
1201         });
1202         request({
1203             uri: utils.confdPort(api_server) + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : ''),
1204             method: vld_id ? 'PUT' : 'POST',
1205             headers: requestHeaders,
1206             forever: constants.FOREVER_ON,
1207             rejectUnauthorized: false,
1208             json: jsonData
1209         }, function(error, response, body) {
1210             if (utils.validateResponse('NSR.nsd.vld.create/update', error, response, body, resolve, reject)) {
1211                 resolve({
1212                     statusCode: response.statusCode,
1213                     data: (typeof(response.body) == 'string') ? JSON.parse(response.body) : response.body
1214                 });
1215             }
1216         });
1217     });
1218 };
1219
1220 NSR.nsd.vld.update = NSR.nsd.vld.create;
1221
1222 NSR.nsd.vld.delete = function(req) {
1223     var api_server = req.query['api_server'];
1224     var nsr_id = req.params.nsr_id;
1225     var vld_id = req.params.vld_id;
1226
1227     if (!api_server || !nsr_id || !vld_id) {
1228         return new Promise(function(resolve, reject) {
1229             return reject({
1230                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1231                 errorMessage: 'API server/NSR id/VLD id not provided'
1232             });
1233         })
1234     }
1235     console.log('Deleting VLD', vld_id, 'for NSR id', nsr_id);
1236
1237     return new Promise(function(resolve, reject) {
1238         var requestHeaders = {};
1239         _.extend(requestHeaders,
1240             constants.HTTP_HEADERS.accept.data,
1241             {
1242                 'Authorization': req.get('Authorization')
1243             }
1244         );
1245
1246         request({
1247             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld/' + vld_id,
1248             method: 'DELETE',
1249             headers: requestHeaders,
1250             forever: constants.FOREVER_ON,
1251             rejectUnauthorized: false
1252         }, function (error, response, body) {
1253             if (utils.validateResponse('NSR.nsd.vld.delete', error, response, body, resolve, reject)) {
1254                 resolve({
1255                     statusCode: response.statusCode,
1256                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1257                 });
1258             }
1259         });
1260     });
1261 }
1262
1263 VNFR.get = function(req) {
1264     var api_server = req.query["api_server"];
1265     var id = req.params.id;
1266     var uri = utils.confdPort(api_server);
1267     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr' + (id ? '/' + id : '') + '?deep';
1268     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1269         'Authorization': req.get('Authorization')
1270     });
1271     return new Promise(function(resolve, reject) {
1272         request({
1273             url: uri,
1274             method: 'GET',
1275             headers: headers,
1276             forever: constants.FOREVER_ON,
1277             rejectUnauthorized: false,
1278         }, function(error, response, body) {
1279             if (utils.validateResponse('VNFR.get', error, response, body, resolve, reject)) {
1280                 var data = JSON.parse(response.body);
1281                 var returnData = id ? [data["vnfr:vnfr"]] : data.collection["vnfr:vnfr"];
1282                 returnData.forEach(function(vnfr) {
1283                     vnfr['nfvi-metrics'] = buildNfviGraphs(vnfr.vdur);
1284                     vnfr['epa-params'] = epa_aggregator(vnfr.vdur);
1285                     vnfr['service-primitives-present'] = (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) ? true : false;
1286                     vnfr['vdur'] && vnfr['vdur'].map(function(vdur, vdurIndex) {
1287                         // This console-url is what front-end will hit to generate a real console-url
1288                         vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url';
1289                     });
1290                 });
1291                 return resolve(returnData);
1292             };
1293         });
1294     });
1295 }
1296
1297 function buildNfviGraphs(VDURs, vnfrName){
1298         var temp = {};
1299         var toReturn = [];
1300         APIConfig.NfviMetrics.map(function(k) {
1301
1302             VDURs && VDURs.map(function(v,i) {
1303                 //Check for RIFT-12699: VDUR NFVI Metrics not fully populated
1304                 if (v["rw-vnfr:nfvi-metrics"] && v["rw-vnfr:nfvi-metrics"][k] && v["rw-vnfr:nfvi-metrics"][k].hasOwnProperty('utilization')) {
1305                     if(!temp[k]) {
1306                         temp[k] = {
1307                             title: '',
1308                             data: []
1309                         };
1310                     };
1311                     try {
1312                         var data = v["rw-vnfr:nfvi-metrics"][k];
1313                         var newData = {};
1314                         newData.name = v.name ? v.name : v.id.substring(0,6);
1315                         newData.name = vnfrName ? vnfrName + ': ' + newData.name : newData.name;
1316                         newData.id = v.id;
1317                         //converts to perentage
1318                         newData.utilization = data.utilization * 0.01;
1319                         temp[k].data.push(newData);
1320                         temp[k].title = v["rw-vnfr:nfvi-metrics"][k].label;
1321                     } catch (e) {
1322                         console.log('Something went wrong with the VNFR NFVI Metrics. Check that the data is being properly returned. ERROR: ', e);
1323                     }
1324                 }
1325             });
1326             if(temp[k]) {
1327                 toReturn.push(temp[k]);
1328             }
1329         });
1330         return toReturn;
1331     }
1332
1333
1334 //Cache NSR reference for VNFR
1335 VNFR.cachedNSR = {};
1336 VNFR.getByNSR = function(req) {
1337     var api_server = req.query["api_server"];
1338     var id = req.params.nsr_id;
1339     var uri = utils.confdPort(api_server);
1340     var reqClone = _.clone(req);
1341     delete reqClone.params.id;
1342     uri += APIVersion + '/api/operational/ns-instance-opdata/nsr/' + id + '?deep';
1343     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1344         'Authorization': req.get('Authorization')
1345     });
1346     return new Promise(function(resolve, reject) {
1347         if (VNFR.cachedNSR[id]) {
1348             var data = VNFR.cachedNSR[id];
1349             var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1350             VNFR.get(reqClone).then(function(vnfrData) {
1351                 resolve(filterVnfrByList(vnfrList, vnfrData));
1352             });
1353         } else {
1354             request({
1355                 url: uri,
1356                 method: 'GET',
1357                 headers: headers,
1358                 forever: constants.FOREVER_ON,
1359                 rejectUnauthorized: false,
1360             }, function(error, response, body) {
1361                 if (utils.validateResponse('VNFR.getByNSR', error, response, body, resolve, reject)) {
1362                     var data = JSON.parse(response.body);
1363                     data = data["nsr:nsr"];
1364                     //Cache NSR data with NSR-ID as
1365                     VNFR.cachedNSR[id] = data;
1366                     var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1367                     var returnData = [];
1368                     VNFR.get(reqClone).then(function(vnfrData) {
1369                         resolve(filterVnfrByList(vnfrList, vnfrData));
1370                     });
1371                 };
1372             });
1373         }
1374     });
1375 };
1376
1377 function filterVnfrByList(vnfrList, vnfrData) {
1378     return vnfrData.map(function(vnfr) {
1379         if (vnfrList.indexOf(vnfr.id) > -1) {
1380             return vnfr;
1381         }
1382     })
1383 };
1384
1385 VLR.get = function(req) {
1386     var api_server = req.query["api_server"];
1387     var id = req.params.id;
1388     var uri = utils.confdPort(api_server);
1389     uri += APIVersion + '/api/operational/vlr-catalog/vlr' + (id ? '/' + id : '') + '?deep';
1390     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1391         'Authorization': req.get('Authorization')
1392     });
1393     return new Promise(function(resolve, reject) {
1394         request({
1395             url: uri,
1396             method: 'GET',
1397             headers: headers,
1398             forever: constants.FOREVER_ON,
1399             rejectUnauthorized: false,
1400         }, function(error, response, body) {
1401             if (utils.validateResponse('VLR.get', error, response, body, resolve, reject)) {
1402                 var data = JSON.parse(response.body);
1403                 var returnData = id ? [data["vlr:vlr"]] : data.collection["vlr:vlr"];
1404                 return resolve({
1405                     data: returnData,
1406                     statusCode: response.statusCode
1407                 });
1408             };
1409         });
1410     });
1411 }
1412
1413 RIFT.api = function(req) {
1414     var api_server = req.query["api_server"];
1415     var uri = utils.confdPort(api_server);
1416     var url = req.path;
1417     return new Promise(function(resolve, reject) {
1418         request({
1419             url: uri + url + '?deep',
1420             method: 'GET',
1421             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1422                 'Authorization': req.get('Authorization')
1423             }),
1424             forever: constants.FOREVER_ON,
1425             rejectUnauthorized: false,
1426         }, function(error, response, body) {
1427             if (utils.validateResponse('RIFT.api', error, response, body, resolve, reject)) {
1428                 resolve(JSON.parse(response.body))
1429             };
1430         })
1431     })
1432 };
1433
1434 ComputeTopology.get = function(req) {
1435     var api_server = req.query['api_server'];
1436     var nsr_id = req.params.id;
1437     var result = {
1438         id: nsr_id, // node id
1439         name: nsr_id, // node name to display
1440         parameters: {}, // the parameters that can be used to determine size/color, etc. for the node
1441         type: 'nsr',
1442         children: [] // children for the node
1443     };
1444     return new Promise(function(resolve, reject) {
1445         var nsrPromise = new Promise(function(success, failure) {
1446             request({
1447                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr/' + nsr_id + '?deep',
1448                 method: 'GET',
1449                 headers: _.extend({},
1450                     constants.HTTP_HEADERS.accept.data, {
1451                         'Authorization': req.get('Authorization')
1452                     }),
1453                 forever: constants.FOREVER_ON,
1454                 rejectUnauthorized: false,
1455             }, function(error, response, body) {
1456                 if (utils.validateResponse('ComputeTopology.get ns-instance-opdata/nsr/:id', error, response, body, success, failure)) {
1457                     var data;
1458                     var isString = typeof(response.body) == "string";
1459                     if (isString && response.body == '') {
1460                         return success({});
1461                     }
1462                     try {
1463                         data = isString ? JSON.parse(response.body) : response.body;
1464
1465                         var nsrNFVIMetricData = data["nsr:nsr"]["rw-nsr:nfvi-metrics"];
1466                         result.parameters = nsrNFVIMetricData;
1467
1468                         result.name = data["nsr:nsr"]["name-ref"];
1469
1470                         var nsrData = data["nsr:nsr"]["constituent-vnfr-ref"];
1471                         success(nsrData);
1472                     } catch (e) {
1473                         console.log('Error parsing ns-instance-opdata for NSR ID', nsr_id, 'Exception:', e);
1474                         return failure()
1475                     }
1476                 };
1477             });
1478         }).then(function(data) {
1479
1480             try {
1481                 // got NSR data
1482                 // now get VNFR data and populate the structure
1483                 var vnfrPromises = [];
1484
1485                 // Run separately to confirm that primary structure is populated before promise resolution takes over
1486                 // and starts modifying the data
1487                 data.forEach(function(vnfrObj) {
1488
1489                     var vnfrId = vnfrObj['vnfr-id'];
1490
1491                     // If anything needs to be added to result for each vnfrId, do it here
1492
1493                     vnfrPromises.push(
1494                         new Promise(function(success, failure) {
1495                             rp({
1496                                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrId + '?deep',
1497                                 method: 'GET',
1498                                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1499                                     'Authorization': req.get('Authorization')
1500                                 }),
1501                                 forever: constants.FOREVER_ON,
1502                                 rejectUnauthorized: false,
1503                                 resolveWithFullResponse: true
1504                             }, function(error, response, body) {
1505                                 if (utils.validateResponse('ComputeTopology.get vnfr-catalaog/vnfr/:id', error, response, body, success, failure)) {
1506                                     try {
1507                                         var data = JSON.parse(response.body);
1508                                         var returnData = data["vnfr:vnfr"];
1509
1510                                         // Push VNFRs in result
1511                                         result.children.push({
1512                                             id: vnfrId,
1513                                             name: returnData.name,
1514                                             parameters: {}, // nfvi metrics here
1515                                             children: [],
1516                                             type: 'vnfr'
1517                                         });
1518
1519                                         // Push VDURs in result
1520                                         returnData.vdur.forEach(function(vdur) {
1521                                             result.children[result.children.length - 1].children.push({
1522                                                 id: vdur.id,
1523                                                 name: vdur.id,
1524                                                 parameters: {},
1525                                                 type: 'vdur'
1526                                                     // children: []
1527                                             });
1528                                         });
1529
1530                                         return success(returnData.vdur);
1531                                     } catch (e) {
1532                                         console.log('Error parsing vnfr-catalog for VNFR ID', vnfrId, 'Exception:', e);
1533                                         return failure();
1534                                     }
1535                                 };
1536                             });
1537                         })
1538                     );
1539                 });
1540
1541                 Promise.all(vnfrPromises).then(function(output) {
1542                     console.log('Resolved all VNFR requests successfully');
1543                     // By now result must be completely populated. output is moot
1544
1545                     // Sort the results as there's no order to them from RIFT-REST
1546                     result.children.sort(sortByName);
1547
1548                     result.children.forEach(function(vnfr) {
1549                         vnfr.children.sort(sortByName);
1550                     });
1551
1552                     resolve({
1553                         statusCode: 200,
1554                         data: result
1555                     });
1556                 }).catch(function(error) {
1557                     // Todo: Can this be made better?
1558                     // Right now if one of the southbound APIs fails - we just return what's populated so far in result
1559                     console.log('Problem with ComputeTopology.get vnfr-catalog/vnfr/:id', error, 'Resolving with partial data', result);
1560                     resolve({
1561                         statusCode: 200,
1562                         data: result
1563                     });
1564                 });
1565             } catch (e) {
1566                 // API came back with empty ns-instance-opdata response for NSR ID
1567                 // bail
1568                 console.log('Error iterating through ns-instance-opdata response for NSR ID', nsr_id, 'Exception:', e);
1569                 resolve({
1570                     statusCode: 200,
1571                     data: result
1572                 })
1573             }
1574         }, function(error) {
1575             // failed to get NSR data.
1576             // bail
1577             resolve({
1578                 statusCode: 200,
1579                 data: result
1580             });
1581         });
1582     });
1583 };
1584
1585 NetworkTopology.get = function(req) {
1586     var api_server = req.query["api_server"];
1587     var uri = utils.confdPort(api_server);
1588     uri += APIVersion + '/api/operational/network?deep';
1589     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1590         'Authorization': req.get('Authorization')
1591     });
1592     return new Promise(function(resolve, reject) {
1593         request({
1594             url: uri,
1595             method: 'GET',
1596             headers: headers,
1597             forever: constants.FOREVER_ON,
1598             rejectUnauthorized: false
1599         }, function(error, response, body) {
1600             if (utils.validateResponse('NetworkTopology.get', error, response, body, resolve, reject)) {
1601                 var data = JSON.parse(response.body);
1602                 var returnData = transforms.transformNetworkTopology(
1603                     data["ietf-network:network"]
1604                 );
1605                 resolve({
1606                     statusCode: 200,
1607                     data: returnData
1608                 });
1609             };
1610         });
1611     })
1612 }
1613
1614 VDUR.get = function(req) {
1615     var api_server = req.query["api_server"];
1616     var vnfrID = req.params.vnfr_id;
1617     var vdurID = req.params.vdur_id;
1618     var uri = utils.confdPort(api_server);
1619     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrID + '/vdur/' + vdurID + '?deep';
1620     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1621         'Authorization': req.get('Authorization')
1622     });
1623     return new Promise(function(resolve, reject) {
1624         request({
1625             url: uri,
1626             method: 'GET',
1627             headers: headers,
1628             forever: constants.FOREVER_ON,
1629             rejectUnauthorized: false,
1630         }, function(error, response, body) {
1631             if (utils.validateResponse('VDUR.get', error, response, body, resolve, reject)) {
1632                 var data = JSON.parse(response.body);
1633                 var returnData = data["vdur:vdur"];
1634                 return resolve(returnData);
1635             };
1636         });
1637     })
1638 }
1639
1640 VDUR.consoleUrl = {};
1641 VDUR.consoleUrl.get = function(req) {
1642     var api_server = req.query["api_server"];
1643     var vnfrID = req.params.vnfr_id;
1644     var vdurID = req.params.vdur_id;
1645     var uri = utils.confdPort(api_server);
1646     uri += APIVersion + '/api/operational/vnfr-console/vnfr/' + vnfrID + '/vdur/' + vdurID + '/console-url' + '?deep';
1647     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1648         'Authorization': req.get('Authorization')
1649     });
1650     return new Promise(function(resolve, reject) {
1651         request({
1652             url: uri,
1653             method: 'GET',
1654             headers: headers,
1655             forever: constants.FOREVER_ON,
1656             rejectUnauthorized: false,
1657         }, function(error, response, body) {
1658             if (utils.validateResponse('VDUR.consoleUrl.get', error, response, body, resolve, reject)) {
1659                 var data = JSON.parse(response.body);
1660                 var returnData = data;
1661                 return resolve({
1662                     data: returnData,
1663                     statusCode: response.statusCode
1664                 });
1665             };
1666         });
1667     })
1668 }
1669
1670 CloudAccount.get = function(req) {
1671     var api_server = req.query["api_server"];
1672     var uri = utils.confdPort(api_server);
1673     uri += APIVersion + '/api/operational/cloud/account?deep';
1674     var headers = _.extend({}, constants.HTTP_HEADERS.accept.collection, {
1675         'Authorization': req.get('Authorization')
1676     });
1677     return new Promise(function(resolve, reject) {
1678         request({
1679             url: uri,
1680             method: 'GET',
1681             headers: headers,
1682             forever: constants.FOREVER_ON,
1683             rejectUnauthorized: false,
1684         }, function(error, response, body) {
1685             if (utils.validateResponse('CloudAccount.get', error, response, body, resolve, reject)) {
1686                 var data = JSON.parse(response.body);
1687                 var returnData = data["collection"]["rw-cloud:account"];
1688                 resolve({
1689                     statusCode: 200,
1690                     data: returnData
1691                 });
1692             };
1693         });
1694     });
1695 }
1696
1697
1698 // Config-Agent Account APIs
1699 ConfigAgentAccount.get = function(req) {
1700     var self = this;
1701
1702     var api_server = req.query["api_server"];
1703     var id = req.params.id;
1704
1705     if (!id) {
1706         // Get all config accounts
1707         return new Promise(function(resolve, reject) {
1708
1709             var requestHeaders = {};
1710             _.extend(requestHeaders,
1711                 constants.HTTP_HEADERS.accept.collection, {
1712                     'Authorization': req.get('Authorization')
1713                 });
1714
1715             request({
1716                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account',
1717                     type: 'GET',
1718                     headers: requestHeaders,
1719                     forever: constants.FOREVER_ON,
1720                     rejectUnauthorized: false,
1721                 },
1722                 function(error, response, body) {
1723                     var data;
1724                     var statusCode;
1725                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1726                         try {
1727                             data = JSON.parse(response.body).collection['rw-config-agent:account'];
1728                             statusCode = response.statusCode;
1729                         } catch (e) {
1730                             console.log('Problem with "ConfigAgentAccount.get"', e);
1731                             var err = {};
1732                             err.statusCode = 500;
1733                             err.errorMessage = {
1734                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1735                             }
1736                             return reject(err);
1737                         }
1738
1739                         return resolve({
1740                             statusCode: statusCode,
1741                             data: data
1742                         });
1743                     };
1744                 });
1745         });
1746     } else {
1747         //Get a specific config account
1748         return new Promise(function(resolve, reject) {
1749             var requestHeaders = {};
1750             _.extend(requestHeaders,
1751                 constants.HTTP_HEADERS.accept.data, {
1752                     'Authorization': req.get('Authorization')
1753                 });
1754
1755             request({
1756                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account/' + id,
1757                     type: 'GET',
1758                     headers: requestHeaders,
1759                     forever: constants.FOREVER_ON,
1760                     rejectUnauthorized: false,
1761                 },
1762                 function(error, response, body) {
1763                     var data;
1764                     var statusCode;
1765                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1766                         try {
1767                             data = JSON.parse(response.body)['rw-config-agent:account'];
1768                             statusCode = response.statusCode;
1769                         } catch (e) {
1770                             console.log('Problem with "ConfigAgentAccount.get"', e);
1771                             var err = {};
1772                             err.statusCode = 500;
1773                             err.errorMessage = {
1774                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1775                             }
1776                             return reject(err);
1777                         }
1778
1779                         return resolve({
1780                             statusCode: statusCode,
1781                             data: data
1782                         });
1783                     }
1784                 });
1785         });
1786     }
1787 };
1788
1789 ConfigAgentAccount.create = function(req) {
1790
1791     var api_server = req.query["api_server"];
1792     var data = req.body;
1793
1794     return new Promise(function(resolve, reject) {
1795         var jsonData = {
1796             "account": Array.isArray(data) ? data : [data]
1797         };
1798
1799         console.log('Creating with', JSON.stringify(jsonData));
1800
1801         var requestHeaders = {};
1802         _.extend(requestHeaders,
1803             constants.HTTP_HEADERS.accept.data,
1804             constants.HTTP_HEADERS.content_type.data, {
1805                 'Authorization': req.get('Authorization')
1806             });
1807
1808         request({
1809             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent',
1810             method: 'POST',
1811             headers: requestHeaders,
1812             forever: constants.FOREVER_ON,
1813             rejectUnauthorized: false,
1814             json: jsonData,
1815         }, function(error, response, body) {
1816             if (utils.validateResponse('ConfigAgentAccount.create', error, response, body, resolve, reject)) {
1817                 return resolve({
1818                     statusCode: response.statusCode,
1819                     data: JSON.stringify(response.body),
1820                     body:response.body.body
1821                 });
1822             };
1823         });
1824     });
1825 };
1826
1827 ConfigAgentAccount.update = function(req) {
1828
1829     var api_server = req.query["api_server"];
1830     var id = req.params.id;
1831     var data = req.body;
1832
1833     return new Promise(function(resolve, reject) {
1834         var jsonData = {
1835             "rw-config-agent:account": data
1836         };
1837
1838         console.log('Updating config-agent', id, ' with', JSON.stringify(jsonData));
1839
1840         var requestHeaders = {};
1841         _.extend(requestHeaders,
1842             constants.HTTP_HEADERS.accept.data,
1843             constants.HTTP_HEADERS.content_type.data, {
1844                 'Authorization': req.get('Authorization')
1845             });
1846
1847         request({
1848             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1849             method: 'PUT',
1850             headers: requestHeaders,
1851             forever: constants.FOREVER_ON,
1852             rejectUnauthorized: false,
1853             json: jsonData,
1854         }, function(error, response, body) {
1855             if (utils.validateResponse('ConfigAgentAccount.update', error, response, body, resolve, reject)) {
1856                 return resolve({
1857                     statusCode: response.statusCode,
1858                     data: JSON.stringify(response.body)
1859                 });
1860             };
1861         });
1862     });
1863 };
1864
1865 ConfigAgentAccount.delete = function(req) {
1866
1867     var api_server = req.query["api_server"];
1868     var id = req.params.id;
1869
1870     if (!id || !api_server) {
1871         return new Promise(function(resolve, reject) {
1872             console.log('Must specifiy api_server and id to delete config-agent account');
1873             return reject({
1874                 statusCode: 500,
1875                 errorMessage: {
1876                     error: 'Must specifiy api_server and id to delete config agent account'
1877                 }
1878             });
1879         });
1880     };
1881
1882     return new Promise(function(resolve, reject) {
1883         var requestHeaders = {};
1884         _.extend(requestHeaders,
1885             constants.HTTP_HEADERS.accept.data, {
1886                 'Authorization': req.get('Authorization')
1887             });
1888         request({
1889             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1890             method: 'DELETE',
1891             headers: requestHeaders,
1892             forever: constants.FOREVER_ON,
1893             rejectUnauthorized: false,
1894         }, function(error, response, body) {
1895             if (utils.validateResponse('ConfigAgentAccount.delete', error, response, body, resolve, reject)) {
1896                 return resolve({
1897                     statusCode: response.statusCode,
1898                     data: JSON.stringify(response.body)
1899                 });
1900             };
1901         });
1902     });
1903 };
1904
1905
1906 DataCenters.get = function(req) {
1907     var api_server = req.query["api_server"];
1908     return new Promise(function(resolve, reject) {
1909         var requestHeaders = {};
1910         _.extend(requestHeaders,
1911             constants.HTTP_HEADERS.accept.data, {
1912                 'Authorization': req.get('Authorization')
1913             });
1914         request({
1915             url: utils.confdPort(api_server) + APIVersion + '/api/operational/datacenters?deep',
1916             method: 'GET',
1917             headers: requestHeaders,
1918             forever: constants.FOREVER_ON,
1919             rejectUnauthorized: false,
1920         }, function(error, response, body) {
1921             if (utils.validateResponse('DataCenters.get', error, response, body, resolve, reject)) {
1922                 var returnData = {};
1923                 try {
1924                     data = JSON.parse(response.body)["rw-launchpad:datacenters"]["ro-accounts"];
1925                     data.map(function(c) {
1926                         returnData[c.name] = c.datacenters;
1927                     })
1928                     statusCode = response.statusCode;
1929                 } catch (e) {
1930                     console.log('Problem with "DataCenters.get"', e);
1931                     var err = {};
1932                     err.statusCode = 500;
1933                     err.errorMessage = {
1934                         error: 'Problem with "DataCenters.get": ' + e.toString()
1935                     }
1936                     return reject(err);
1937                 }
1938                 return resolve({
1939                     statusCode: response.statusCode,
1940                     data: returnData
1941                 });
1942             };
1943         });
1944     });
1945 }
1946
1947 SSHkey.get  = function(req) {
1948     var api_server = req.query["api_server"];
1949     return new Promise(function(resolve, reject) {
1950         var requestHeaders = {};
1951         _.extend(requestHeaders,
1952             constants.HTTP_HEADERS.accept.data, {
1953                 'Authorization': req.get('Authorization')
1954             });
1955         request({
1956             url: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair?deep',
1957             method: 'GET',
1958             headers: requestHeaders,
1959             forever: constants.FOREVER_ON,
1960             rejectUnauthorized: false,
1961         }, function(error, response, body) {
1962             if (utils.validateResponse('SSHkey.get', error, response, body, resolve, reject)) {
1963                 var returnData = {};
1964                 try {
1965                     returnData = JSON.parse(response.body)['nsr:key-pair'];
1966                     statusCode = response.statusCode;
1967                 } catch (e) {
1968                     console.log('Problem with "SSHkey.get"', e);
1969                     var err = {};
1970                     err.statusCode = 500;
1971                     err.errorMessage = {
1972                         error: 'Problem with "SSHkey.get": ' + e.toString()
1973                     }
1974                     return reject(err);
1975                 }
1976                 return resolve({
1977                     statusCode: response.statusCode,
1978                     data: returnData
1979                 });
1980             };
1981         });
1982     });
1983 }
1984 SSHkey.delete = function(req) {
1985     var api_server = req.query['api_server'];
1986     var id = decodeURI(req.params.name);
1987     console.log('Deleting ssk-key', id);
1988     return new Promise(function(resolve, reject) {
1989         request({
1990             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/' + id,
1991             method: 'DELETE',
1992             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1993                 'Authorization': req.get('Authorization')
1994             }),
1995             forever: constants.FOREVER_ON,
1996             rejectUnauthorized: false,
1997         }, function(error, response, body) {
1998             if (utils.validateResponse('SSHkey.delete', error, response, body, resolve, reject)) {
1999                 resolve({
2000                     statusCode: response.statusCode
2001                 });
2002             }
2003         });
2004     });
2005 };
2006 SSHkey.post = function(req) {
2007     var api_server = req.query['api_server'];
2008     var data = req.body;
2009     return new Promise(function(resolve, reject) {
2010         request({
2011             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
2012             method: 'POST',
2013             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
2014                 'Authorization': req.get('Authorization')
2015             }),
2016             json: data,
2017             forever: constants.FOREVER_ON,
2018             rejectUnauthorized: false,
2019         }, function(error, response, body) {
2020             if (utils.validateResponse('SSHkey.post', error, response, body, resolve, reject)) {
2021                 resolve({
2022                     data: 'success',
2023                     statusCode: response.statusCode
2024                 });
2025             }
2026         });
2027     });
2028 };
2029 SSHkey.put = function(req) {
2030     var api_server = req.query['api_server'];
2031     var data = req.body;
2032     return new Promise(function(resolve, reject) {
2033         request({
2034             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
2035             method: 'PUT',
2036             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
2037                 'Authorization': req.get('Authorization')
2038             }),
2039             json: data,
2040             forever: constants.FOREVER_ON,
2041             rejectUnauthorized: false,
2042         }, function(error, response, body) {
2043             if (utils.validateResponse('SSHkey.put', error, response, body, resolve, reject)) {
2044                 resolve({
2045                     statusCode: response.statusCode
2046                 });
2047             }
2048         });
2049     });
2050 };
2051
2052 function sortByName(a, b) {
2053     return a.name > b.name;
2054 }
2055
2056 module.exports.catalog = Catalog;
2057 module.exports.nsr = NSR;
2058 module.exports.vnfr = VNFR;
2059 module.exports.vlr = VLR;
2060 module.exports.vdur = VDUR;
2061 module.exports.rift = RIFT;
2062 module.exports.computeTopology = ComputeTopology;
2063 module.exports.networkTopology = NetworkTopology;
2064 module.exports.config = Config;
2065 module.exports.cloud_account = CloudAccount;
2066 module.exports['config-agent-account'] = ConfigAgentAccount;
2067 module.exports.rpc = RPC;
2068 module.exports.data_centers = DataCenters;
2069 module.exports.SSHkey = SSHkey;