skyquake/plugins/launchpad/api/launchpad.js

   1 /*
   2  *
   3  *   Copyright 2016 RIFT.IO Inc
   4  *
   5  *   Licensed under the Apache License, Version 2.0 (the "License");
   6  *   you may not use this file except in compliance with the License.
   7  *   You may obtain a copy of the License at
   8  *
   9  *       http://www.apache.org/licenses/LICENSE-2.0
  10  *
  11  *   Unless required by applicable law or agreed to in writing, software
  12  *   distributed under the License is distributed on an "AS IS" BASIS,
  13  *   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
  14  *   See the License for the specific language governing permissions and
  15  *   limitations under the License.
  16  *
  17  */
  18
  19 var request = require('request');
  20 var Promise = require('bluebird');
  21 var rp = require('request-promise');
  22 var utils = require('../../../framework/core/api_utils/utils.js');
  23 var constants = require('../../../framework/core/api_utils/constants.js');
  24 var APIVersion = '/v1';
  25 var _ = require('underscore');
  26 var epa_aggregator = require('./epa_aggregator.js');
  27 var transforms = require('./transforms.js');
  28 var uuid = require('node-uuid');
  29
  30 // Revealing module pattern objects
  31 var Catalog = {};
  32 var Config = {};
  33 var NSR = {};
  34 var VNFR = {};
  35 var VLR = {};
  36 var RIFT = {};
  37 var ComputeTopology = {};
  38 var NetworkTopology = {};
  39 var VDUR = {};
  40 var CloudAccount = {};
  41 var ConfigAgentAccount = {};
  42 var RPC = {};
  43 var SSHkey = {};
  44 // API Configuration Info
  45 var APIConfig = {}
  46 APIConfig.NfviMetrics = ['vcpu', 'memory'];
  47
  48 RPC.executeNSServicePrimitive = function(req) {
  49     var api_server = req.query['api_server'];
  50     return new Promise(function(resolve, reject) {
  51         var jsonData = {
  52             "input": req.body
  53         };
  54
  55         var headers = _.extend({},
  56             constants.HTTP_HEADERS.accept.data,
  57             constants.HTTP_HEADERS.content_type.data, {
  58                 'Authorization': req.get('Authorization')
  59             }
  60         );
  61         request({
  62             url: utils.confdPort(api_server) + APIVersion + '/api/operations/exec-ns-service-primitive',
  63             method: 'POST',
  64             headers: headers,
  65             forever: constants.FOREVER_ON,
  66             rejectUnauthorized: false,
  67             json: jsonData
  68         }, function(error, response, body) {
  69             if (utils.validateResponse('RPC.executeNSServicePrimitive', error, response, body, resolve, reject)) {
  70                 return resolve({
  71                     statusCode: response.statusCode,
  72                     data: JSON.stringify(response.body)
  73                 });
  74             }
  75         })
  76     });
  77 };
  78
  79 RPC.getNSServicePrimitiveValues = function(req) {
  80     var api_server = req.query['api_server'];
  81     // var nsr_id = req.body['nsr_id_ref'];
  82     // var nsConfigPrimitiveName = req.body['name'];
  83     return new Promise(function(resolve, reject) {
  84         var jsonData = {
  85             "input": req.body
  86         };
  87
  88         var headers = _.extend({},
  89             constants.HTTP_HEADERS.accept.data,
  90             constants.HTTP_HEADERS.content_type.data, {
  91                 'Authorization': req.get('Authorization')
  92             }
  93         );
  94         request({
  95             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/get-ns-service-primitive-values',
  96             method: 'POST',
  97             headers: headers,
  98             forever: constants.FOREVER_ON,
  99             rejectUnauthorized: false,
 100             json: jsonData
 101         }, function(error, response, body) {
 102             if (utils.validateResponse('RPC.getNSServicePrimitiveValues', error, response, body, resolve, reject)) {
 103
 104                 resolve({
 105                     statusCode: response.statusCode,
 106                     data: JSON.parse(body)
 107                 });
 108             }
 109         });
 110     }).catch(function(error) {
 111         console.log('error getting primitive values');
 112     });
 113 };
 114 RPC.refreshAccountConnectionStatus = function(req) {
 115     var api_server = req.query['api_server'];
 116     var Name = req.params.name;
 117     var Type = req.params.type;
 118     var jsonData = {
 119         input: {}
 120     };
 121     var rpcInfo = {
 122         sdn: {
 123             label: 'sdn-account',
 124             rpc: 'update-sdn-status'
 125         },
 126         config: {
 127             label: 'cfg-agent-account',
 128             rpc: 'update-cfg-agent-status'
 129         },
 130         cloud: {
 131             label: 'cloud-account',
 132             rpc: 'update-cloud-status'
 133         }
 134     }
 135     jsonData.input[rpcInfo[Type].label] = Name;
 136     var headers = _.extend({},
 137         constants.HTTP_HEADERS.accept.data,
 138         constants.HTTP_HEADERS.content_type.data, {
 139             'Authorization': req.get('Authorization')
 140         }
 141     );
 142     return new Promise(function(resolve, reject) {
 143
 144         request({
 145             uri: utils.confdPort(api_server) + APIVersion + '/api/operations/' + rpcInfo[Type].rpc,
 146             method: 'POST',
 147             headers: headers,
 148             forever: constants.FOREVER_ON,
 149             rejectUnauthorized: false,
 150             json: jsonData
 151         }, function(error, response, body) {
 152             if (utils.validateResponse('RPC.refreshAccountConnectionStatus', error, response, body, resolve, reject)) {
 153
 154                 resolve({
 155                     statusCode: response.statusCode,
 156                     data: body
 157                 });
 158             }
 159         });
 160     }).catch(function(error) {
 161         console.log('Error refreshing account info');
 162     });
 163 };
 164
 165
 166 var DataCenters = {};
 167 // Catalog module methods
 168 Catalog.get = function(req) {
 169     var api_server = req.query['api_server'];
 170     var results = {}
 171     return new Promise(function(resolve, reject) {
 172         Promise.all([
 173             rp({
 174                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 175                 method: 'GET',
 176                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 177                     'Authorization': req.get('Authorization')
 178                 }),
 179                 forever: constants.FOREVER_ON,
 180                 rejectUnauthorized: false,
 181                 resolveWithFullResponse: true
 182             }),
 183             rp({
 184                 uri: utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd?deep',
 185                 method: 'GET',
 186                 headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 187                     'Authorization': req.get('Authorization')
 188                 }),
 189                 forever: constants.FOREVER_ON,
 190                 rejectUnauthorized: false,
 191                 resolveWithFullResponse: true
 192             }),
 193             rp({
 194                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata?deep',
 195                 method: 'GET',
 196                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 197                     'Authorization': req.get('Authorization')
 198                 }),
 199                 forever: constants.FOREVER_ON,
 200                 rejectUnauthorized: false,
 201                 resolveWithFullResponse: true
 202             })
 203             // Not enabled for now
 204             // rp({
 205             //   uri: utils.confdPort(api_server) + APIVersion + '/api/config/pnfd-catalog/pnfd?deep',
 206             //   method: 'GET',
 207             //   headers: _.extend({},
 208             //     constants.HTTP_HEADERS.accept.collection,
 209             //     {
 210             //       'Authorization': req.get('Authorization')
 211             //     }),
 212             //   forever: constants.FOREVER_ON,
 213             // rejectUnauthorized: false,
 214             //   resolveWithFullResponse: true
 215             // })
 216         ]).then(function(result) {
 217             console.log('Resolved all request promises (NSD, VNFD) successfully');
 218             var response = [{
 219                 "id": "GUID-1",
 220                 "name": "RIFT.ware™ NS Descriptors Catalog",
 221                 "short-name": "rift.ware-nsd-cat",
 222                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 223                 "vendor": "RIFT.io",
 224                 "version": "",
 225                 "created-on": "",
 226                 "type": "nsd",
 227                 "meta": {
 228                     "icon-svg": "data:image/svg+xml,%3C%3Fxml%20version%3D%221.0%22%20encoding%3D%22iso-8859-1%22%3F%3E%0A%3C!--%20Generator%3A%20Adobe%20Illustrator%2018.0.0%2C%20SVG%20Export%20Plug-In%20.%20SVG%20Version%3A%206.00%20Build%200)%20%20--%3E%0A%3C!DOCTYPE%20svg%20PUBLIC%20%22-%2F%2FW3C%2F%2FDTD%20SVG%201.1%2F%2FEN%22%20%22http%3A%2F%2Fwww.w3.org%2FGraphics%2FSVG%2F1.1%2FDTD%2Fsvg11.dtd%22%3E%0A%3Csvg%20version%3D%221.1%22%20id%3D%22connection-icon-1%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20xmlns%3Axlink%3D%22http%3A%2F%2Fwww.w3.org%2F1999%2Fxlink%22%20x%3D%220px%22%20y%3D%220px%22%0A%09%20viewBox%3D%220%200%2050%2050%22%20style%3D%22enable-background%3Anew%200%200%2050%2050%3B%22%20xml%3Aspace%3D%22preserve%22%3E%0A%09%3Cpath%20d%3D%22M15%2030c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2020c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2040c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M19.007%2025.885l12.88%206.44-.895%201.788-12.88-6.44z%22%2F%3E%3Cpath%20d%3D%22M30.993%2015.885l.894%201.79-12.88%206.438-.894-1.79z%22%2F%3E%3C%2Fsvg%3E"
 229                 },
 230                 "descriptors": []
 231             }, {
 232                 "id": "GUID-2",
 233                 "name": "RIFT.ware™ VNF Descriptors Catalog",
 234                 "short-name": "rift.ware-vnfd-cat",
 235                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 236                 "vendor": "RIFT.io",
 237                 "version": "",
 238                 "created-on": "",
 239                 "type": "vnfd",
 240                 "meta": {
 241                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_3\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <g> <path d=\"M58.852,62.447l-4.662-1.033c-0.047-3.138-0.719-6.168-1.996-9.007l3.606-2.92c0.858-0.695,0.99-1.954,0.296-2.813 l-4.521-5.584c-0.334-0.413-0.818-0.675-1.346-0.731c-0.525-0.057-1.056,0.102-1.468,0.435L45.25,43.64v0 c-2.486-1.907-5.277-3.259-8.297-4.019v-4.458c0-1.104-0.896-2-2-2H27.77c-1.104,0-2,0.896-2,2v4.461 c-3.08,0.777-5.922,2.171-8.447,4.144l-3.545-2.82c-0.415-0.33-0.94-0.479-1.472-0.422c-0.527,0.06-1.009,0.327-1.339,0.743 l-4.472,5.623c-0.688,0.864-0.544,2.123,0.32,2.81l3.642,2.896v0c-1.25,2.848-1.895,5.88-1.916,9.011l-4.666,1.078 c-1.076,0.249-1.747,1.322-1.499,2.398l1.616,7.001c0.249,1.077,1.325,1.747,2.399,1.499l4.813-1.111v0 c1.429,2.681,3.344,5.017,5.691,6.943l-2.17,4.55c-0.476,0.997-0.054,2.19,0.943,2.666l6.484,3.094 c0.271,0.129,0.566,0.195,0.861,0.195c0.226,0,0.451-0.038,0.668-0.115c0.5-0.177,0.909-0.545,1.138-1.024l2.198-4.611 c2.923,0.563,5.966,0.554,8.879-0.033l2.236,4.585c0.484,0.994,1.685,1.403,2.675,0.921l6.456-3.148 c0.992-0.484,1.405-1.682,0.921-2.674l-2.206-4.524c2.335-1.946,4.231-4.301,5.639-6.999l4.812,1.067 c1.076,0.237,2.146-0.441,2.385-1.52l1.556-7.014c0.115-0.518,0.02-1.06-0.266-1.508C59.82,62.878,59.369,62.562,58.852,62.447z M40.18,61.761c0,4.859-3.953,8.812-8.813,8.812c-4.858,0-8.811-3.953-8.811-8.812s3.952-8.812,8.811-8.812 C36.227,52.949,40.18,56.902,40.18,61.761z\"/> <path d=\"M64.268,45.324c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.826,0.353,3.736,0.345,5.551-0.021l1.07,2.195 c0.484,0.992,1.682,1.405,2.675,0.921l2.691-1.313c0.477-0.233,0.842-0.646,1.015-1.147c0.172-0.501,0.139-1.051-0.095-1.528 l-1.052-2.155c1.458-1.214,2.645-2.686,3.527-4.377l2.278,0.504c1.075,0.238,2.146-0.442,2.386-1.52l0.647-2.923 c0.238-1.078-0.442-2.146-1.521-2.385l-2.184-0.484c-0.028-1.962-0.449-3.857-1.248-5.632l1.673-1.355 c0.412-0.334,0.675-0.818,0.73-1.345s-0.102-1.056-0.436-1.468l-1.884-2.327c-0.697-0.859-1.957-0.99-2.813-0.295l-1.614,1.307 c-1.554-1.193-3.299-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.04 c-1.927,0.486-3.703,1.358-5.28,2.592l-1.634-1.298c-0.862-0.687-2.12-0.543-2.81,0.32l-1.864,2.344 c-0.33,0.416-0.481,0.945-0.422,1.472c0.061,0.527,0.327,1.009,0.743,1.339l1.69,1.345c-0.78,1.779-1.184,3.676-1.197,5.636 l-2.189,0.505c-0.517,0.119-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51l0.675,2.918 c0.249,1.076,1.323,1.747,2.398,1.498l2.28-0.527c0.892,1.676,2.089,3.137,3.559,4.343l-1.035,2.17 c-0.228,0.479-0.257,1.028-0.08,1.528c0.178,0.5,0.546,0.91,1.024,1.138l2.703,1.289C63.686,45.261,63.979,45.324,64.268,45.324z M64.334,27.961c0-3.039,2.473-5.51,5.512-5.51c3.038,0,5.51,2.472,5.51,5.51c0,3.039-2.472,5.511-5.51,5.511 C66.807,33.472,64.334,31,64.334,27.961z\"/> <path d=\"M96.107,66.441l-2.182-0.484c-0.028-1.961-0.449-3.856-1.25-5.632l1.675-1.355c0.412-0.334,0.675-0.818,0.73-1.346 c0.056-0.527-0.102-1.056-0.436-1.468l-1.885-2.327c-0.695-0.859-1.956-0.99-2.813-0.295l-1.614,1.307 c-1.555-1.193-3.3-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.041 c-1.929,0.486-3.706,1.358-5.282,2.592l-0.001,0l-1.631-1.298c-0.415-0.331-0.938-0.482-1.472-0.422 c-0.527,0.06-1.009,0.327-1.339,0.742l-1.863,2.343c-0.688,0.865-0.544,2.123,0.32,2.811l1.691,1.345 c-0.782,1.784-1.186,3.68-1.199,5.636l-2.188,0.505c-0.517,0.12-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51 l0.675,2.918c0.249,1.076,1.327,1.744,2.397,1.498l2.281-0.526c0.893,1.677,2.09,3.138,3.558,4.343h0.001l-1.035,2.168 c-0.229,0.479-0.258,1.029-0.081,1.529c0.178,0.5,0.546,0.909,1.024,1.138l2.702,1.289c0.278,0.132,0.571,0.195,0.86,0.195 c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.828,0.353,3.739,0.347,5.552-0.021l1.071,2.194 c0.484,0.992,1.682,1.405,2.675,0.921l2.69-1.312c0.477-0.233,0.842-0.645,1.014-1.147c0.173-0.501,0.14-1.051-0.093-1.528 l-1.052-2.155c1.459-1.215,2.645-2.688,3.525-4.377l2.278,0.505c0.52,0.116,1.061,0.02,1.508-0.266 c0.447-0.285,0.763-0.736,0.878-1.254l0.647-2.923C97.866,67.748,97.186,66.681,96.107,66.441z M85.162,66.174 c0,3.039-2.471,5.511-5.508,5.511c-3.039,0-5.512-2.472-5.512-5.511c0-3.039,2.473-5.511,5.512-5.511 C82.691,60.664,85.162,63.136,85.162,66.174z\"/> </g> </svg> "
 242                 },
 243                 "descriptors": []
 244             }, {
 245                 "id": "GUID-3",
 246                 "name": "RIFT.ware™ PNF Descriptors Catalog",
 247                 "short-name": "rift.ware-pnfd-cat",
 248                 "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
 249                 "vendor": "RIFT.io",
 250                 "version": "",
 251                 "created-on": "",
 252                 "type": "pnfd",
 253                 "meta": {
 254                     "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_4\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <path d=\"M86.334,47.444V35.759H13.666v11.686h3.561v5.111h-3.561v11.686h72.668V52.556h-4.108v-5.111H86.334z M26.628,59.454h-5.051 v-4.941h5.051V59.454z M26.628,52.404h-5.051v-4.941h5.051V52.404z M26.628,45.486h-5.051v-4.941h5.051V45.486z M34.094,59.454 h-5.051v-4.941h5.051V59.454z M34.094,52.404h-5.051v-4.941h5.051V52.404z M34.094,45.486h-5.051v-4.941h5.051V45.486z M41.452,59.454h-5.051v-4.941h5.051V59.454z M41.452,52.404h-5.051v-4.941h5.051V52.404z M41.452,45.486h-5.051v-4.941h5.051 V45.486z M48.733,59.454h-5.051v-4.941h5.051V59.454z M48.733,52.404h-5.051v-4.941h5.051V52.404z M48.733,45.486h-5.051v-4.941 h5.051V45.486z M56.2,59.454h-5.051v-4.941H56.2V59.454z M56.2,52.404h-5.051v-4.941H56.2V52.404z M56.2,45.486h-5.051v-4.941H56.2 V45.486z M63.558,59.454h-5.05v-4.941h5.05V59.454z M63.558,52.404h-5.05v-4.941h5.05V52.404z M63.558,45.486h-5.05v-4.941h5.05 V45.486z M74.858,59.312h-6.521v-3.013h6.521V59.312z M71.572,50.854c-2.875,0-5.204-2.33-5.204-5.203s2.329-5.203,5.204-5.203 s5.204,2.33,5.204,5.203S74.446,50.854,71.572,50.854z M74.858,45.618c0,1.801-1.46,3.261-3.261,3.261 c-1.8,0-3.261-1.46-3.261-3.261s1.46-3.26,3.261-3.26C73.398,42.358,74.858,43.817,74.858,45.618z\"/> </svg>"
 255                 },
 256                 "descriptors": []
 257             }];
 258             var vnfdCatalog = null;
 259             var vnfdDict = {};
 260             if (result[1].body) {
 261                 vnfdCatalog = JSON.parse(result[1].body).collection['vnfd:vnfd'].map(function(v, i) {
 262                     vnfdDict[v.id] = v['short-name'] || v.name;
 263                 })
 264             }
 265             if (result[0].body) {
 266                 response[0].descriptors = JSON.parse(result[0].body).collection['nsd:nsd'];
 267                 if (result[2].body) {
 268                     var data = JSON.parse(result[2].body);
 269                     if (data && data["nsr:ns-instance-opdata"] && data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]) {
 270                         var nsdRefCountCollection = data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"];
 271                         response[0].descriptors.map(function(nsd) {
 272                             if (!nsd["meta"]) {
 273                                 nsd["meta"] = {};
 274                             }
 275                             if (typeof nsd['meta'] == 'string') {
 276                                 nsd['meta'] = JSON.parse(nsd['meta']);
 277                             }
 278                             nsd["meta"]["instance-ref-count"] = _.findWhere(nsdRefCountCollection, {
 279                                 "nsd-id-ref": nsd.id
 280                             })["instance-ref-count"];
 281                             nsd["constituent-vnfd"] && nsd["constituent-vnfd"].map(function(v) {
 282                                 v.name = vnfdDict[v["vnfd-id-ref"]];
 283                             })
 284                         });
 285                     }
 286                 }
 287             };
 288             if (result[1].body) {
 289                 response[1].descriptors = JSON.parse(result[1].body).collection['vnfd:vnfd'];
 290             };
 291             // if (result[2].body) {
 292             //   response[2].descriptors = JSON.parse(result[2].body).collection['pnfd:pnfd'];
 293             // };
 294             resolve({
 295                 statusCode: response.statusCode || 200,
 296                 data: JSON.stringify(response)
 297             });
 298         }).catch(function(error) {
 299             // Todo: Need better logic than all or nothing.
 300             // Right now even if one of the southbound APIs fails - all fail
 301             var res = {};
 302             console.log('Problem with Catalog.get', error);
 303             res.statusCode = error.statusCode || 500;
 304             res.errorMessage = {
 305                 error: 'Failed to get catalogs' + error
 306             };
 307             reject(res);
 308         });
 309     });
 310 };
 311 Catalog.delete = function(req) {
 312     var api_server = req.query['api_server'];
 313     var catalogType = req.params.catalogType;
 314     var id = req.params.id;
 315     console.log('Deleting', catalogType, id, 'from', api_server);
 316     return new Promise(function(resolve, reject) {
 317         request({
 318             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog/' + catalogType + '/' + id,
 319             method: 'DELETE',
 320             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 321                 'Authorization': req.get('Authorization')
 322             }),
 323             forever: constants.FOREVER_ON,
 324             rejectUnauthorized: false,
 325         }, function(error, response, body) {
 326             if (utils.validateResponse('Catalog.delete', error, response, body, resolve, reject)) {
 327                 resolve({
 328                     statusCode: response.statusCode
 329                 });
 330             }
 331         });
 332     });
 333 };
 334 Catalog.getVNFD = function(req) {
 335     var api_server = req.query['api_server'];
 336     var vnfdID = req.body.data;
 337     var authorization = req.get('Authorization');
 338     var VNFDs = [];
 339     if (typeof(vnfdID) == "object" && vnfdID.constructor.name == "Array") {
 340         vnfdID.map(function(id) {
 341             VNFDs.push(requestVNFD(id));
 342         });
 343     } else {
 344         VNFDs.push(requestVNFD(vnfdID));
 345     }
 346     return new Promise(function(resolve, reject) {
 347         Promise.all(VNFDs).then(function(data) {
 348             resolve(data)
 349         }).catch(function(error) {
 350             // Todo: Need better logic than all or nothing.
 351             // Right now even if one of the southbound APIs fails - all fail
 352             var res = {};
 353             console.log('Problem with Catalog.getVNFD', error);
 354             res.statusCode = 404;
 355             res.errorMessage = {
 356                 error: 'Failed to get VNFDs' + error
 357             };
 358             reject(res);
 359         });
 360     });
 361
 362     function requestVNFD(id) {
 363         return new Promise(function(resolve, reject) {
 364             var url = utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd' + (id ? '/' + id : '') + '?deep';
 365             request({
 366                 uri: url,
 367                 method: 'GET',
 368                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
 369                     'Authorization': authorization
 370                 }),
 371                 forever: constants.FOREVER_ON,
 372                 rejectUnauthorized: false,
 373             }, function(error, response, body) {
 374                 if (utils.validateResponse('Catalog.getVNFD', error, response, body, resolve, reject)) {
 375                     var data;
 376                     //Is this still needed?
 377                     try {
 378                         data = JSON.parse(response.body)
 379                     } catch (e) {
 380                         reject({
 381                             statusCode: response ? response.statusCode : 400,
 382                             errorMessage: 'Issue parsing VNFD ' + id + 'from ' + utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd/' + id + '?deep'
 383                         });
 384                     }
 385                     resolve(data);
 386                 }
 387             });
 388         });
 389     }
 390 };
 391 Catalog.create = function(req) {
 392     var api_server = req.query['api_server'];
 393     var catalogType = req.params.catalogType;
 394     var data = req.body;
 395     console.log('Creating', catalogType, 'on', api_server);
 396     var jsonData = {};
 397     jsonData[catalogType] = [];
 398     jsonData[catalogType].push(data);
 399     return new Promise(function(resolve, reject) {
 400         var requestHeaders = {};
 401         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 402             'Authorization': req.get('Authorization')
 403         });
 404         request({
 405             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog',
 406             method: 'POST',
 407             headers: requestHeaders,
 408             forever: constants.FOREVER_ON,
 409             rejectUnauthorized: false,
 410             json: jsonData
 411         }, function(error, response, body) {
 412             if (utils.validateResponse('Catalog.create', error, response, body, resolve, reject)) {
 413                 resolve({
 414                     statusCode: response.statusCode
 415                 });
 416             }
 417         });
 418     });
 419 };
 420 Catalog.update = function(req) {
 421     var api_server = req.query['api_server'];
 422     var catalogType = req.params.catalogType;
 423     var id = req.params.id;
 424     var data = req.body;
 425     console.log('Updating', catalogType, 'id', id, 'on', api_server);
 426     var jsonData = {};
 427     jsonData[catalogType] = {};
 428     jsonData[catalogType] = data;
 429     return new Promise(function(resolve, reject) {
 430         var requestHeaders = {};
 431         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 432             'Authorization': req.get('Authorization')
 433         });
 434         request({
 435             uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog' + '/' + catalogType + '/' + id,
 436             method: 'PUT',
 437             headers: requestHeaders,
 438             forever: constants.FOREVER_ON,
 439             rejectUnauthorized: false,
 440             json: jsonData
 441         }, function(error, response, body) {
 442             if (utils.validateResponse('Catalog.update', error, response, body, resolve, reject)) {
 443                 resolve({
 444                     statusCode: response.statusCode
 445                 });
 446             }
 447         });
 448     });
 449 };
 450
 451 Catalog.decorateNsdCatalogWithPlacementGroups = function decorateNsdCatalogWithPlacementGroups(catalog) {
 452     var newData = catalog;
 453     var parsedCatalog = JSON.parse(catalog.data);
 454     var nsds = parsedCatalog[0].descriptors;
 455     var vnfds = parsedCatalog[1].descriptors;
 456     var vnfdDict = (function(){
 457         var dict = {};
 458         vnfds.map(function(v, i) {
 459             dict[v.id] = v;
 460         })
 461         return dict;
 462     })(vnfds);
 463
 464     nsds.map(function(c, i) {
 465         //Rename and decorate NSD placement groups
 466         c['ns-placement-groups'] = c['placement-groups'] && c['placement-groups'].map(function(p, i) {
 467             //Adds vnfd name to member-vnfd entry
 468             p['member-vnfd'] = p['member-vnfd'].map(function(v) {
 469                 v.name = vnfdDict[v['vnfd-id-ref']].name;
 470                 return v;
 471             });
 472             p['host-aggregate'] = [];
 473             return p;
 474         });
 475
 476         //Adds vnf placement groups to nsd object for UI
 477         c['vnf-placement-groups'] = [];
 478         c['constituent-vnfd'] && c['constituent-vnfd'].map(function(v) {
 479             var vnf = vnfdDict[v['vnfd-id-ref']];
 480             // var vnfPg = {
 481             //     name: vnf.name,
 482             //     'placement-groups': vnf['placement-groups'].map(function(vp){
 483             //         vp['host-aggregate'] = [{}];
 484             //         return vp;
 485             //     })
 486             // };
 487             v['vnf-name'] = vnf.name;
 488             vnf['placement-groups'] && vnf['placement-groups'].map(function(vp) {
 489                 vp['host-aggregate'] = [];
 490                 vp['vnf-name'] = vnf.name;
 491                 vp['vnfd-id-ref'] = v['vnfd-id-ref'];
 492                 vp['member-vnf-index'] = v['member-vnf-index'];
 493                 c['vnf-placement-groups'].push(vp);
 494             })
 495         })
 496         return c;
 497     })
 498     // parsedCatalog[0].descriptors = nsds;
 499     newData.data = JSON.stringify(parsedCatalog);
 500     return newData;
 501 }
 502
 503 // NSR module methods
 504 // Spend some time refactoring this
 505 // refactor to accept only request object
 506 NSR.get = function(req) {
 507     var self = this;
 508     var nsrPromises = [];
 509     var api_server = req.query["api_server"];
 510     var id = req.params.id;
 511     var nsdInfo = new Promise(function(resolve, reject) {
 512         request({
 513             uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
 514             method: 'GET',
 515             headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
 516                 'Authorization': req.get('Authorization')
 517             }),
 518             forever: constants.FOREVER_ON,
 519             rejectUnauthorized: false,
 520         }, function(error, response, body) {
 521             if (utils.validateResponse('NSR.get nsd-catalog', error, response, body, resolve, reject)) {
 522                 var data;
 523                 var isString = typeof(response.body) == "string";
 524                 if (isString && response.body == '') return resolve('empty');
 525                 data = isString ? JSON.parse(response.body) : response.body;
 526                 var nsdData = data.collection["nsd:nsd"];
 527                 if (nsdData.constructor.name == "Object") {
 528                     nsdData = [nsdData];
 529                 }
 530                 resolve(nsdData);
 531             };
 532         })
 533     })
 534     var config = new Promise(function(resolve, reject) {
 535         request({
 536             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-config/nsr' + (id ? '/' + id : '') + '?deep',
 537             method: 'GET',
 538             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 539                 'Authorization': req.get('Authorization')
 540             }),
 541             forever: constants.FOREVER_ON,
 542             rejectUnauthorized: false,
 543         }, function(error, response, body) {
 544             if (utils.validateResponse('NSR.get ns-instance-config', error, response, body, resolve, reject)) {
 545                 var data;
 546                 var isString = typeof(response.body) == "string";
 547                 if (isString && response.body == '') return resolve();
 548                 data = isString ? JSON.parse(response.body) : response.body;
 549                 data = id ? data : data.collection;
 550                 var nsrData = data["nsr:nsr"];
 551                 if (nsrData.constructor.name == "Object") {
 552                     nsrData = [nsrData];
 553                 }
 554                 resolve(nsrData);
 555             };
 556         });
 557     });
 558     var opData = new Promise(function(resolve, reject) {
 559         request({
 560             uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr' + (id ? '/' + id : '') + '?deep',
 561             method: 'GET',
 562             headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
 563                 'Authorization': req.get('Authorization')
 564             }),
 565             forever: constants.FOREVER_ON,
 566             rejectUnauthorized: false,
 567         }, function(error, response, body) {
 568             if (utils.validateResponse('NSR.get ns-instance-opdata', error, response, body, resolve, reject)) {
 569                 var data;
 570                 var isString = typeof(response.body) == "string";
 571                 if (isString && response.body == '') return resolve();
 572                 data = isString ? JSON.parse(response.body) : response.body;
 573                 data = id ? data : data.collection;
 574                 var nsrData = data["nsr:nsr"];
 575                 if (nsrData.constructor.name == "Object") {
 576                     nsrData = [nsrData];
 577                 }
 578                 nsrData.forEach(self.decorateWithScalingGroupDict);
 579                 nsrData.forEach(self.decorateAndTransformNFVI);
 580                 nsrData.forEach(self.decorateAndTransformWithControls);
 581                 Promise.all(self.addVnfrDataPromise(req, nsrData)).then(function() {
 582                     Promise.all(self.addVlrDataPromise(req, nsrData)).then(function() {
 583                         resolve(nsrData);
 584                     });
 585                 });
 586             };
 587         });
 588     }).catch(function(error) {
 589         console.log('error getting aggregated NS opdata', error)
 590         //note this will actually trigger the success callback
 591     });
 592     return new Promise(function(resolve, reject) {
 593         //Need smarter error handling here
 594         Promise.all([config, opData]).then(function(resolves) {
 595             var aggregate = {};
 596             // resolves[0] ==> ns-instance-config
 597             // resolves[1] ==> ns-instance-opdata
 598
 599             var nsInstanceConfig = resolves[0] && resolves[0];
 600             var nsInstanceOpdata = resolves[1] && resolves[1];
 601
 602             if (!nsInstanceConfig && !nsInstanceOpdata) {
 603                 return resolve({
 604                     nsrs: []
 605                 });
 606             }
 607
 608             nsInstanceConfig.forEach(function(v, k) {
 609                 v.nsd_name = v['nsd'] && v['nsd']['name'];
 610                 var scaling_group_descriptor = null;
 611
 612                 scaling_group_descriptor = v['nsd'] && v['nsd']['scaling-group-descriptor'];
 613
 614                 if (scaling_group_descriptor) {
 615                     scaling_group_descriptor.map(function(sgd, sgdi) {
 616                         sgd['vnfd-member'] && sgd['vnfd-member'].map(function(vnfd, vnfdi) {
 617                             var vnfrObj = _.findWhere(_.findWhere(nsInstanceOpdata, {
 618                                     'ns-instance-config-ref': v.id
 619                                 }).vnfrs, {
 620                                 'member-vnf-index-ref': vnfd['member-vnf-index-ref']
 621                             });
 622                             if (vnfrObj) {
 623                                 vnfd['short-name'] = vnfrObj['short-name'];
 624                             }
 625                         })
 626                     })
 627                     v['scaling-group-descriptor'] = scaling_group_descriptor;
 628                 }
 629
 630                 if (nsInstanceOpdata && nsInstanceOpdata.constructor.name == "Array") {
 631                     nsInstanceOpdata.forEach(function(w, l) {
 632                         if (v.id == w["ns-instance-config-ref"]) {
 633                             for (prop in w) {
 634                                 if (prop != "ns-instance-config-ref" && !v.hasOwnProperty(prop)) {
 635                                     v[prop] = w[prop];
 636                                 }
 637                             }
 638                         }
 639                     });
 640                 }
 641
 642                 v['scaling-group-record'] && v['scaling-group-record'].map(function(sgr) {
 643                     var scalingGroupName = sgr['scaling-group-name-ref'];
 644                     sgr['instance'] && sgr['instance'].map(function(instance) {
 645                         var scalingGroupInstanceId = instance['instance-id'];
 646                         instance['vnfrs'] && instance['vnfrs'].map(function(vnfr) {
 647                             var vnfrObj = _.findWhere(v['vnfrs'], {id: vnfr});
 648                             if (vnfrObj) {
 649                                 vnfrObj['scaling-group-name'] = scalingGroupName;
 650                                 vnfrObj['scaling-group-instance-id'] = scalingGroupInstanceId;
 651                             }
 652                         });
 653                     });
 654                 })
 655             });
 656             var nsrsData = nsInstanceConfig;
 657             nsrsData.sort(function(a, b) {
 658                 return a["create-time"] - b["create-time"];
 659             });
 660             resolve({
 661                 nsrs: nsrsData
 662             });
 663         }).catch(function(error) {
 664             reject({
 665                 statusCode: 404,
 666                 errorMessage: error
 667             })
 668         })
 669     });
 670 };
 671 // Static VNFR Cache bu VNFR ID
 672 var staticVNFRCache = {};
 673
 674 /**
 675  * [decorateWithScalingGroupDict description]
 676  * @param  {[type]} nsr [description]
 677  * @return {[type]}
 678 {vnfr-id} : {
 679     "scaling-group-name-ref": "sg1",
 680     "instance-id": 0,
 681     "op-status": "running",
 682     "is-default": "true",
 683     "create-time": 1463593760,
 684     "config-status": "configuring",
 685     "vnfrs": [
 686         "432154e3-164e-4c05-83ee-3b56e4c898e7"
 687     ]
 688 }
 689  */
 690 NSR.decorateWithScalingGroupDict = function(nsr) {
 691     var sg = nsr["scaling-group-record"];
 692     var dict = {};
 693     if(sg) {
 694         sg.map(function(s) {
 695             var sgRef = s['scaling-group-name-ref'];
 696             s.instance && s.instance.map(function(si) {
 697                 si.vnfrs && si.vnfrs.map(function(v) {
 698                     dict[v] = si;
 699                     dict[v]["scaling-group-name-ref"] = sgRef;
 700                 })
 701             })
 702         })
 703     }
 704     return nsr['vnfr-scaling-groups'] = dict;
 705 }
 706
 707
 708 NSR.addVlrDataPromise = function(req, nsrs) {
 709     var api_server = req.query['api_server'];
 710     var promises = [];
 711     nsrs.map(function(nsr) {
 712         var vlrPromises = [];
 713         var vlr = nsr['vlr'];
 714         nsr['decorated-vlrs'] = [];
 715         if (!vlr) {
 716             console.log('No VL\'s found in NS');
 717         }
 718         vlr && vlr.map(function(vlrObject) {
 719             req.params.id = vlrObject['vlr-ref'];
 720             var vlrPromise = VLR.get(req).then(function(vlr) {
 721                 try {
 722                     var vlrItem = vlr['data'][0];
 723                     decorateNSRWithVLR(nsr, vlrObject, vlrItem);
 724                 } catch (e) {
 725                     console.log('Expection caught getting VLRs and adding to NSR:', e);
 726                 }
 727             })
 728             vlrPromises.push(vlrPromise);
 729         });
 730         var NSR_Promise = new Promise(function(resolve, reject) {
 731             Promise.all(vlrPromises).then(function() {
 732                 resolve();
 733             })
 734         });
 735         promises.push(NSR_Promise);
 736     });
 737     return promises;
 738
 739     function decorateNSRWithVLR(nsr, nsrVLRObject, vlr) {
 740         var vlrObject = _.extend(nsrVLRObject, vlr);
 741         vlrObject['vnfr-connection-point-ref'] && vlrObject['vnfr-connection-point-ref'].map(function(vnfrCP) {
 742             var vnfrName = nsr['vnfrs'] && _.find(nsr['vnfrs'], {id: vnfrCP['vnfr-id']})['name'];
 743             vnfrName && (vnfrCP['vnfr-name'] = vnfrName);
 744         });
 745         nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'name'), 0, vlrObject);
 746         // nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'create-time'), 0, vlrObject);
 747     }
 748 }
 749
 750
 751 NSR.addVnfrDataPromise = function(req, nsrs) {
 752     var api_server = req.query['api_server'];
 753     var promises = [];
 754     nsrs.map(function(nsr) {
 755         var epa_params = {};
 756         var constituent_vnfr_ref = nsr["constituent-vnfr-ref"];
 757         var vnfrPromises = [];
 758         nsr["vnfrs"] = [];
 759         nsr["dashboard-urls"] = [];
 760         nsr['nfvi-metrics'] = [];
 761         if (!constituent_vnfr_ref) {
 762             console.log('Something is wrong, there are no constituent-vnfr-refs');
 763             constituent_vnfr_ref = [];
 764         }
 765         //Get VNFR Static Data
 766         constituent_vnfr_ref && constituent_vnfr_ref.map(function(constituentVnfrObj) {
 767             req.params.id = constituentVnfrObj['vnfr-id'];
 768             var vnfrPromise;
 769             vnfrPromise = VNFR.get(req).then(function(vnfr) {
 770                 try {
 771                     var vnfrItem = vnfr[0];
 772                     decorateNSRWithVNFR(nsr, vnfrItem)
 773                     staticVNFRCache[vnfrItem.id] = vnfrItem;
 774                 } catch (e) {
 775                     console.log('Exception caught:', e);
 776                 }
 777             });
 778             vnfrPromises.push(vnfrPromise);
 779         });
 780         var NSR_Promise = new Promise(function(resolve, reject) {
 781             Promise.all(vnfrPromises).then(function() {
 782                 var vnfrs = staticVNFRCache;
 783                 //Aggregate EPA Params
 784                 constituent_vnfr_ref && constituent_vnfr_ref.map(function(k) {
 785                         if (vnfrs[k['vnfr-id']]) {
 786                             epa_params = epa_aggregator(vnfrs[k['vnfr-id']].vdur, epa_params);
 787                         }
 788                     })
 789                 //Add VNFR Name to monitoring params
 790                 try {
 791                     if (nsr["monitoring-param"]) {
 792                         nsr["monitoring-param"].map(function(m) {
 793                             var vnfr = vnfrs[m["vnfr-id"]] || {};
 794                             m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR');
 795                         });
 796                     }
 797                 } catch (e) {
 798                     console.log('Exception caught:', e);
 799                 }
 800                 resolve();
 801             })
 802         })
 803         nsr["epa-params"] = epa_params;
 804         promises.push(NSR_Promise);
 805     })
 806     return promises;
 807
 808     function decorateNSRWithVDURConsoleUrls(nsr, vnfr) {
 809         nsr['console-urls'] = nsr['console-urls'] ? nsr['console-urls'] : [];
 810
 811         vnfr && vnfr['vdur'] && vnfr['vdur'].map(function(vdur) {
 812             vdur['console-url'] && nsr['console-urls'].push({
 813                 id: vdur.id,
 814                 name: vdur.name,
 815                 'console-url': vdur['console-url']
 816             });
 817         });
 818     }
 819
 820     function decorateNSRWithVNFR(nsr, vnfr) {
 821         var vnfrObj = {
 822             id: vnfr.id,
 823             "member-vnf-index-ref": vnfr["member-vnf-index-ref"],
 824             "short-name": vnfr["short-name"],
 825             "vnf-configuration": vnfr["vnf-configuration"],
 826             "nsr-id": nsr['ns-instance-config-ref'],
 827             "name": vnfr['name'],
 828             "vdur": vnfr["vdur"],
 829             "cloud-account": vnfr["cloud-account"]
 830         };
 831         var vnfrSg = nsr['vnfr-scaling-groups'];
 832         var vnfrName = vnfr["name"];
 833         if(vnfrSg) {
 834             if(vnfrSg[vnfr.id]) {
 835                 vnfrName = vnfrSg[vnfr.id]["scaling-group-name-ref"] + ':' + vnfrSg[vnfr.id][ "instance-id"] + ':' + vnfrName;
 836             }
 837         }
 838         var vnfrNfviMetrics = buildNfviGraphs(vnfr.vdur, vnfrName);
 839         if (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) {
 840             vnfrObj['service-primitives-present'] = true;
 841         } else {
 842             vnfrObj['service-primitives-present'] = false;
 843         }
 844                 transforms.mergeVnfrNfviMetrics(vnfrNfviMetrics, nsr["nfvi-metrics"]);
 845         //TODO: Should be sorted by create-time when it becomes available instead of id
 846         // nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'create-time'), 0, vnfrObj);
 847         nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'id'), 0, vnfrObj);
 848         vnfrObj["dashboard-url"] = vnfr["dashboard-url"];
 849         nsr["dashboard-urls"].push(vnfrObj);
 850
 851         decorateNSRWithVDURConsoleUrls(nsr, vnfr);
 852     }
 853 }
 854 NSR.create = function(req) {
 855     var api_server = req.query['api_server'];
 856     var data = req.body.data;
 857     console.log('Instantiating NSR on ', api_server);
 858     return new Promise(function(resolve, reject) {
 859         var requestHeaders = {};
 860         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
 861             'Authorization': req.get('Authorization')
 862         });
 863         request({
 864             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config',
 865             method: 'POST',
 866             headers: requestHeaders,
 867             forever: constants.FOREVER_ON,
 868             rejectUnauthorized: false,
 869             json: data
 870         }, function(error, response, body) {
 871             if (utils.validateResponse('NSR.create', error, response, body, resolve, reject)) {
 872                 var nsr_id = null;
 873                 try {
 874                     nsr_id = data.nsr[0].id;
 875                 } catch (e) {
 876                     console.log("NSR.create unable to get nsr_id. Error: %s",
 877                     e.toString());
 878                 }
 879                 resolve({
 880                     statusCode: response.statusCode,
 881                     data: { nsr_id: nsr_id }
 882                  });
 883             };
 884         });
 885     });
 886 };
 887 NSR.delete = function(req) {
 888     var api_server = req.query["api_server"];
 889     var id = req.params.id;
 890     if (!id || !api_server) {
 891         return new Promise(function(resolve, reject) {
 892             console.log('Must specifiy api_server and id to delete NSR');
 893             return reject({
 894                 statusCode: 500,
 895                 errorMessage: {
 896                     error: 'Must specifiy api_server and id to delete NSR'
 897                 }
 898             });
 899         });
 900     };
 901     console.log('Deleting NSR with id: ' + id + 'on server: ' + api_server);
 902     return new Promise(function(resolve, reject) {
 903         var requestHeaders = {};
 904         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, {
 905             'Authorization': req.get('Authorization')
 906         });
 907         request({
 908             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id,
 909             method: 'DELETE',
 910             headers: requestHeaders,
 911             forever: constants.FOREVER_ON,
 912             rejectUnauthorized: false,
 913         }, function(error, response, body) {
 914             if (utils.validateResponse('NSR.delete', error, response, body, resolve, reject)) {
 915                 resolve({
 916                     statusCode: response.statusCode,
 917                     data: JSON.stringify(response.body)
 918                 });
 919             };
 920         });
 921     });
 922 };
 923 NSR.decorateAndTransformNFVI = function(nsr) {
 924         var toDecorate = [];
 925         // var metricsToUse = ["vcpu", "memory", "storage", "network"];
 926         var metricsToUse = ["vcpu", "memory"];
 927         try {
 928             var nfviMetrics = nsr["rw-nsr:nfvi-metrics"];
 929             if (nfviMetrics) {
 930                 metricsToUse.map(function(name) {
 931                     toDecorate.push(nfviMetrics[name])
 932                 });
 933             }
 934             nsr["nfvi-metrics"] = toDecorate;
 935             delete nsr["rw-nsr:nfvi-metrics"];
 936         } catch (e) {}
 937         return nsr;
 938     }
 939     //Not a great pattern, Need a better way of handling logging;
 940     //Refactor and move to the logging/logging.js
 941 var logCache = {
 942     decorateAndTransformWithControls: {}
 943 }
 944 NSR.decorateAndTransformWithControls = function(nsr) {
 945     var controlTypes = ["action-param", "control-param"];
 946     var nsControls = [];
 947     var Groups = {};
 948     controlTypes.map(function(control) {
 949         try {
 950             var controls = nsr["rw-nsr:" + control];
 951             // nsControls.push(controls);
 952             controls.map(function(item) {
 953                 if (!Groups[item["group-tag"]]) {
 954                     Groups[item["group-tag"]] = {};
 955                     Groups[item["group-tag"]]["action-param"] = []
 956                     Groups[item["group-tag"]]["control-param"] = []
 957                 }
 958                 Groups[item["group-tag"]][control].push(item);
 959             });
 960             delete nsr["rw-nsr:" + control];
 961         } catch (e) {
 962             var id = nsr["ns-instance-config-ref"];
 963             if (!logCache.decorateAndTransformWithControls[id]) {
 964                 logCache.decorateAndTransformWithControls[id] = {};
 965             }
 966             var log = logCache.decorateAndTransformWithControls[id];
 967             if (!log[control]) {
 968                 log[control] = true;
 969                 console.log('No controls exist for ' + control + ' at ' + nsr["ns-instance-config-ref"]);
 970             }
 971         }
 972     });
 973     for (k in Groups) {
 974         var obj = {}
 975         obj[k] = Groups[k];
 976         nsControls.push(obj)
 977     }
 978     nsr.nsControls = nsControls;
 979     return nsr;
 980 };
 981 NSR.setStatus = function(req) {
 982     var api_server = req.query['api_server'];
 983     var id = req.params.id;
 984     var status = req.body.status;
 985     console.log('Setting NSR (id: ' + id + ') status, on ' + api_server + ', to be: ' + status);
 986     return new Promise(function(resolve, reject) {
 987         var command;
 988         if (typeof(status) != "string") {
 989             reject({
 990                 'ERROR': 'NSR.setStatus Error: status is not a string type'
 991             });
 992         }
 993         command = status.toUpperCase();
 994         if (command != "ENABLED" && command != "DISABLED") {
 995             reject({
 996                 'ERROR': 'NSR.setStatus Error: status is: ' + command + '. It should be ENABLED or DISABLED'
 997             });
 998         }
 999         var requestHeaders = {};
1000         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1001             'Authorization': req.get('Authorization')
1002         });
1003         request({
1004             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/admin-status/',
1005             method: 'PUT',
1006             headers: requestHeaders,
1007             json: {
1008                 "nsr:admin-status": command
1009             },
1010             forever: constants.FOREVER_ON,
1011             rejectUnauthorized: false,
1012         }, function(error, response, body) {
1013             if (utils.validateResponse('NSR.setStatus', error, response, body, resolve, reject)) {
1014                 resolve({
1015                     statusCode: response.statusCode
1016                 });
1017             };
1018         });
1019     });
1020 };
1021
1022 NSR.createScalingGroupInstance = function(req) {
1023     var api_server = req.query['api_server'];
1024     var id = req.params.id;
1025     var scaling_group_id = req.params.scaling_group_id;
1026     if (!api_server || !id || !scaling_group_id) {
1027         return new Promise(function(resolve, reject) {
1028             return reject({
1029                 statusCode: 500,
1030                 errorMessage: {
1031                     error: 'API server/NSR id/Scaling group not provided'
1032                 }
1033             });
1034         });
1035     }
1036
1037     var instance_id = Math.floor(Math.random() * 65535);
1038
1039     var jsonData = {
1040         instance: [{
1041             // id: uuid.v1()
1042             id: instance_id
1043         }]
1044     };
1045
1046     console.log('Creating scaling group instance for NSR ', id, ', scaling group ', scaling_group_id, ' with instance id ', instance_id);
1047
1048     return new Promise(function(resolve, reject) {
1049         var requestHeaders = {};
1050         _.extend(requestHeaders,
1051             constants.HTTP_HEADERS.accept.data,
1052             constants.HTTP_HEADERS.content_type.data,
1053             {
1054                 'Authorization': req.get('Authorization')
1055             }
1056         );
1057
1058         request({
1059             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance',
1060             method: 'POST',
1061             headers: requestHeaders,
1062             json: jsonData,
1063             forever: constants.FOREVER_ON,
1064             rejectUnauthorized: false
1065         }, function (error, response, body) {
1066             if (utils.validateResponse('NSR.createScalingGroupInstance', error, response, body, resolve, reject)) {
1067                 resolve({
1068                     statusCode: response.statusCode,
1069                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1070                 })
1071             }
1072         });
1073     });
1074 };
1075
1076 NSR.deleteScalingGroupInstance = function(req) {
1077     var api_server=req.query['api_server'];
1078     var id = req.params.id;
1079     var scaling_group_id = req.params.scaling_group_id;
1080     var scaling_instance_id = req.params.scaling_instance_id;
1081
1082     if (!api_server || !id || !scaling_group_id || !scaling_instance_id) {
1083         return new Promise(function(resolve, reject) {
1084             return reject({
1085                 statusCode: 500,
1086                 errorMessage: {
1087                     error: 'API server/NSR id/Scaling group/Scaling instance id not provided'
1088                 }
1089             });
1090         });
1091     }
1092
1093     console.log('Deleting scaling group instance id ', scaling_instance_id,
1094         ' for scaling group ', scaling_group_id,
1095         ', under NSR ', id);
1096
1097     return new Promise(function(resolve, reject) {
1098         var requestHeaders = {};
1099         _.extend(requestHeaders,
1100             constants.HTTP_HEADERS.accept.data,
1101             constants.HTTP_HEADERS.content_type.data,
1102             {
1103                 'Authorization': req.get('Authorization')
1104             }
1105         );
1106
1107         request({
1108             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance/' + scaling_instance_id,
1109             method: 'DELETE',
1110             headers: requestHeaders,
1111             forever: constants.FOREVER_ON,
1112             rejectUnauthorized: false
1113         }, function (error, response, body) {
1114             if (utils.validateResponse('NSR.deleteScalingGroupInstance', error, response, body, resolve, reject)) {
1115                 resolve({
1116                     statusCode: response.statusCode,
1117                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1118                 })
1119             }
1120         });
1121     });
1122 };
1123
1124 NSR.nsd = {};
1125 NSR.nsd.vld = {};
1126
1127 NSR.nsd.vld.get = function(req) {
1128     var api_server = req.query['api_server'];
1129     var nsr_id = req.params.nsr_id;
1130     var vld_id = req.params.vld_id;
1131
1132     if (!api_server || !nsr_id) {
1133         return new Promise(function(resolve, reject) {
1134             return reject({
1135                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1136                 errorMessage: 'API server/NSR id not provided'
1137             });
1138         })
1139     }
1140     console.log('Getting VLD', vld_id ? (' ' + vld_id) : ('\'s'), ' for NSR id', nsr_id);
1141
1142     return new Promise(function(resolve, reject) {
1143         var requestHeaders = {};
1144         _.extend(requestHeaders,
1145             vld_id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection,
1146             {
1147                 'Authorization': req.get('Authorization')
1148             }
1149         );
1150
1151         request({
1152             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : '')  +'?deep',
1153             method: 'GET',
1154             headers: requestHeaders,
1155             forever: constants.FOREVER_ON,
1156             rejectUnauthorized: false
1157         }, function (error, response, body) {
1158             if (utils.validateResponse('NSR.nsd.vld.get', error, response, body, resolve, reject)) {
1159                 resolve({
1160                     statusCode: response.statusCode,
1161                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1162                 });
1163             }
1164         });
1165     });
1166 };
1167
1168 NSR.nsd.vld.create = function(req) {
1169     var api_server = req.query['api_server'];
1170     var nsr_id = req.params.nsr_id;
1171     var vld_id = req.params.vld_id;
1172     var data = req.body;
1173
1174     if (!api_server || !nsr_id) {
1175         return new Promise(function(resolve, reject) {
1176             return reject({
1177                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1178                 errorMessage: 'API server/NSR id not provided'
1179             });
1180         });
1181     }
1182
1183     console.log((vld_id ? 'Updating VLD ' + vld_id : 'Creating VLD') + ' under NSR', nsr_id);
1184
1185     var jsonData = {
1186         vld: typeof(data) == 'string' ? JSON.parse(data) : data
1187     };
1188
1189     return new Promise(function(resolve, reject) {
1190         var requestHeaders = {};
1191         _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
1192             'Authorization': req.get('Authorization')
1193         });
1194         request({
1195             uri: utils.confdPort(api_server) + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : ''),
1196             method: vld_id ? 'PUT' : 'POST',
1197             headers: requestHeaders,
1198             forever: constants.FOREVER_ON,
1199             rejectUnauthorized: false,
1200             json: jsonData
1201         }, function(error, response, body) {
1202             if (utils.validateResponse('NSR.nsd.vld.create/update', error, response, body, resolve, reject)) {
1203                 resolve({
1204                     statusCode: response.statusCode,
1205                     data: (typeof(response.body) == 'string') ? JSON.parse(response.body) : response.body
1206                 });
1207             }
1208         });
1209     });
1210 };
1211
1212 NSR.nsd.vld.update = NSR.nsd.vld.create;
1213
1214 NSR.nsd.vld.delete = function(req) {
1215     var api_server = req.query['api_server'];
1216     var nsr_id = req.params.nsr_id;
1217     var vld_id = req.params.vld_id;
1218
1219     if (!api_server || !nsr_id || !vld_id) {
1220         return new Promise(function(resolve, reject) {
1221             return reject({
1222                 statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
1223                 errorMessage: 'API server/NSR id/VLD id not provided'
1224             });
1225         })
1226     }
1227     console.log('Deleting VLD', vld_id, 'for NSR id', nsr_id);
1228
1229     return new Promise(function(resolve, reject) {
1230         var requestHeaders = {};
1231         _.extend(requestHeaders,
1232             constants.HTTP_HEADERS.accept.data,
1233             {
1234                 'Authorization': req.get('Authorization')
1235             }
1236         );
1237
1238         request({
1239             uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld/' + vld_id,
1240             method: 'DELETE',
1241             headers: requestHeaders,
1242             forever: constants.FOREVER_ON,
1243             rejectUnauthorized: false
1244         }, function (error, response, body) {
1245             if (utils.validateResponse('NSR.nsd.vld.delete', error, response, body, resolve, reject)) {
1246                 resolve({
1247                     statusCode: response.statusCode,
1248                     data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
1249                 });
1250             }
1251         });
1252     });
1253 }
1254
1255 VNFR.get = function(req) {
1256     var api_server = req.query["api_server"];
1257     var id = req.params.id;
1258     var uri = utils.confdPort(api_server);
1259     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr' + (id ? '/' + id : '') + '?deep';
1260     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1261         'Authorization': req.get('Authorization')
1262     });
1263     return new Promise(function(resolve, reject) {
1264         request({
1265             url: uri,
1266             method: 'GET',
1267             headers: headers,
1268             forever: constants.FOREVER_ON,
1269             rejectUnauthorized: false,
1270         }, function(error, response, body) {
1271             if (utils.validateResponse('VNFR.get', error, response, body, resolve, reject)) {
1272                 var data = JSON.parse(response.body);
1273                 var returnData = id ? [data["vnfr:vnfr"]] : data.collection["vnfr:vnfr"];
1274                 returnData.forEach(function(vnfr) {
1275                     vnfr['nfvi-metrics'] = buildNfviGraphs(vnfr.vdur);
1276                     vnfr['epa-params'] = epa_aggregator(vnfr.vdur);
1277                     vnfr['service-primitives-present'] = (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) ? true : false;
1278                 })
1279                 return resolve(returnData);
1280             };
1281         });
1282     });
1283 }
1284
1285 function buildNfviGraphs(VDURs, vnfrName){
1286         var temp = {};
1287         var toReturn = [];
1288         APIConfig.NfviMetrics.map(function(k) {
1289
1290             VDURs && VDURs.map(function(v,i) {
1291                 //Check for RIFT-12699: VDUR NFVI Metrics not fully populated
1292                 if (v["rw-vnfr:nfvi-metrics"] && v["rw-vnfr:nfvi-metrics"][k] && v["rw-vnfr:nfvi-metrics"][k].hasOwnProperty('utilization')) {
1293                     if(!temp[k]) {
1294                         temp[k] = {
1295                             title: '',
1296                             data: []
1297                         };
1298                     };
1299                     try {
1300                         var data = v["rw-vnfr:nfvi-metrics"][k];
1301                         var newData = {};
1302                         newData.name = v.name ? v.name : v.id.substring(0,6);
1303                         newData.name = vnfrName ? vnfrName + ': ' + newData.name : newData.name;
1304                         newData.id = v.id;
1305                         //converts to perentage
1306                         newData.utilization = data.utilization * 0.01;
1307                         temp[k].data.push(newData);
1308                         temp[k].title = v["rw-vnfr:nfvi-metrics"][k].label;
1309                     } catch (e) {
1310                         console.log('Something went wrong with the VNFR NFVI Metrics. Check that the data is being properly returned. ERROR: ', e);
1311                     }
1312                 }
1313             });
1314             if(temp[k]) {
1315                 toReturn.push(temp[k]);
1316             }
1317         });
1318         return toReturn;
1319     }
1320
1321
1322 //Cache NSR reference for VNFR
1323 VNFR.cachedNSR = {};
1324 VNFR.getByNSR = function(req) {
1325     var api_server = req.query["api_server"];
1326     var id = req.params.nsr_id;
1327     var uri = utils.confdPort(api_server);
1328     var reqClone = _.clone(req);
1329     delete reqClone.params.id;
1330     uri += APIVersion + '/api/operational/ns-instance-opdata/nsr/' + id + '?deep';
1331     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1332         'Authorization': req.get('Authorization')
1333     });
1334     return new Promise(function(resolve, reject) {
1335         if (VNFR.cachedNSR[id]) {
1336             var data = VNFR.cachedNSR[id];
1337             var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1338             VNFR.get(reqClone).then(function(vnfrData) {
1339                 resolve(filterVnfrByList(vnfrList, vnfrData));
1340             });
1341         } else {
1342             request({
1343                 url: uri,
1344                 method: 'GET',
1345                 headers: headers,
1346                 forever: constants.FOREVER_ON,
1347                 rejectUnauthorized: false,
1348             }, function(error, response, body) {
1349                 if (utils.validateResponse('VNFR.getByNSR', error, response, body, resolve, reject)) {
1350                     var data = JSON.parse(response.body);
1351                     data = data["nsr:nsr"];
1352                     //Cache NSR data with NSR-ID as
1353                     VNFR.cachedNSR[id] = data;
1354                     var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
1355                     var returnData = [];
1356                     VNFR.get(reqClone).then(function(vnfrData) {
1357                         resolve(filterVnfrByList(vnfrList, vnfrData));
1358                     });
1359                 };
1360             });
1361         }
1362     });
1363 };
1364
1365 function filterVnfrByList(vnfrList, vnfrData) {
1366     return vnfrData.map(function(vnfr) {
1367         if (vnfrList.indexOf(vnfr.id) > -1) {
1368             return vnfr;
1369         }
1370     })
1371 };
1372
1373 VLR.get = function(req) {
1374     var api_server = req.query["api_server"];
1375     var id = req.params.id;
1376     var uri = utils.confdPort(api_server);
1377     uri += APIVersion + '/api/operational/vlr-catalog/vlr' + (id ? '/' + id : '') + '?deep';
1378     var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
1379         'Authorization': req.get('Authorization')
1380     });
1381     return new Promise(function(resolve, reject) {
1382         request({
1383             url: uri,
1384             method: 'GET',
1385             headers: headers,
1386             forever: constants.FOREVER_ON,
1387             rejectUnauthorized: false,
1388         }, function(error, response, body) {
1389             if (utils.validateResponse('VLR.get', error, response, body, resolve, reject)) {
1390                 var data = JSON.parse(response.body);
1391                 var returnData = id ? [data["vlr:vlr"]] : data.collection["vlr:vlr"];
1392                 return resolve({
1393                     data: returnData,
1394                     statusCode: response.statusCode
1395                 });
1396             };
1397         });
1398     });
1399 }
1400
1401 RIFT.api = function(req) {
1402     var api_server = req.query["api_server"];
1403     var uri = utils.confdPort(api_server);
1404     var url = req.path;
1405     return new Promise(function(resolve, reject) {
1406         request({
1407             url: uri + url + '?deep',
1408             method: 'GET',
1409             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1410                 'Authorization': req.get('Authorization')
1411             }),
1412             forever: constants.FOREVER_ON,
1413             rejectUnauthorized: false,
1414         }, function(error, response, body) {
1415             if (utils.validateResponse('RIFT.api', error, response, body, resolve, reject)) {
1416                 resolve(JSON.parse(response.body))
1417             };
1418         })
1419     })
1420 };
1421
1422 ComputeTopology.get = function(req) {
1423     var api_server = req.query['api_server'];
1424     var nsr_id = req.params.id;
1425     var result = {
1426         id: nsr_id, // node id
1427         name: nsr_id, // node name to display
1428         parameters: {}, // the parameters that can be used to determine size/color, etc. for the node
1429         type: 'nsr',
1430         children: [] // children for the node
1431     };
1432     return new Promise(function(resolve, reject) {
1433         var nsrPromise = new Promise(function(success, failure) {
1434             request({
1435                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr/' + nsr_id + '?deep',
1436                 method: 'GET',
1437                 headers: _.extend({},
1438                     constants.HTTP_HEADERS.accept.data, {
1439                         'Authorization': req.get('Authorization')
1440                     }),
1441                 forever: constants.FOREVER_ON,
1442                 rejectUnauthorized: false,
1443             }, function(error, response, body) {
1444                 if (utils.validateResponse('ComputeTopology.get ns-instance-opdata/nsr/:id', error, response, body, success, failure)) {
1445                     var data;
1446                     var isString = typeof(response.body) == "string";
1447                     if (isString && response.body == '') {
1448                         return success({});
1449                     }
1450                     try {
1451                         data = isString ? JSON.parse(response.body) : response.body;
1452
1453                         var nsrNFVIMetricData = data["nsr:nsr"]["rw-nsr:nfvi-metrics"];
1454                         result.parameters = nsrNFVIMetricData;
1455
1456                         result.name = data["nsr:nsr"]["name-ref"];
1457
1458                         var nsrData = data["nsr:nsr"]["constituent-vnfr-ref"];
1459                         success(nsrData);
1460                     } catch (e) {
1461                         console.log('Error parsing ns-instance-opdata for NSR ID', nsr_id, 'Exception:', e);
1462                         return failure()
1463                     }
1464                 };
1465             });
1466         }).then(function(data) {
1467
1468             try {
1469                 // got NSR data
1470                 // now get VNFR data and populate the structure
1471                 var vnfrPromises = [];
1472
1473                 // Run separately to confirm that primary structure is populated before promise resolution takes over
1474                 // and starts modifying the data
1475                 data.forEach(function(vnfrObj) {
1476
1477                     var vnfrId = vnfrObj['vnfr-id'];
1478
1479                     // If anything needs to be added to result for each vnfrId, do it here
1480
1481                     vnfrPromises.push(
1482                         new Promise(function(success, failure) {
1483                             rp({
1484                                 uri: utils.confdPort(api_server) + APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrId + '?deep',
1485                                 method: 'GET',
1486                                 headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1487                                     'Authorization': req.get('Authorization')
1488                                 }),
1489                                 forever: constants.FOREVER_ON,
1490                                 rejectUnauthorized: false,
1491                                 resolveWithFullResponse: true
1492                             }, function(error, response, body) {
1493                                 if (utils.validateResponse('ComputeTopology.get vnfr-catalaog/vnfr/:id', error, response, body, success, failure)) {
1494                                     try {
1495                                         var data = JSON.parse(response.body);
1496                                         var returnData = data["vnfr:vnfr"];
1497
1498                                         // Push VNFRs in result
1499                                         result.children.push({
1500                                             id: vnfrId,
1501                                             name: returnData.name,
1502                                             parameters: {}, // nfvi metrics here
1503                                             children: [],
1504                                             type: 'vnfr'
1505                                         });
1506
1507                                         // Push VDURs in result
1508                                         returnData.vdur.forEach(function(vdur) {
1509                                             result.children[result.children.length - 1].children.push({
1510                                                 id: vdur.id,
1511                                                 name: vdur.id,
1512                                                 parameters: {},
1513                                                 type: 'vdur'
1514                                                     // children: []
1515                                             });
1516                                         });
1517
1518                                         return success(returnData.vdur);
1519                                     } catch (e) {
1520                                         console.log('Error parsing vnfr-catalog for VNFR ID', vnfrId, 'Exception:', e);
1521                                         return failure();
1522                                     }
1523                                 };
1524                             });
1525                         })
1526                     );
1527                 });
1528
1529                 Promise.all(vnfrPromises).then(function(output) {
1530                     console.log('Resolved all VNFR requests successfully');
1531                     // By now result must be completely populated. output is moot
1532
1533                     // Sort the results as there's no order to them from RIFT-REST
1534                     result.children.sort(sortByName);
1535
1536                     result.children.forEach(function(vnfr) {
1537                         vnfr.children.sort(sortByName);
1538                     });
1539
1540                     resolve({
1541                         statusCode: 200,
1542                         data: result
1543                     });
1544                 }).catch(function(error) {
1545                     // Todo: Can this be made better?
1546                     // Right now if one of the southbound APIs fails - we just return what's populated so far in result
1547                     console.log('Problem with ComputeTopology.get vnfr-catalog/vnfr/:id', error, 'Resolving with partial data', result);
1548                     resolve({
1549                         statusCode: 200,
1550                         data: result
1551                     });
1552                 });
1553             } catch (e) {
1554                 // API came back with empty ns-instance-opdata response for NSR ID
1555                 // bail
1556                 console.log('Error iterating through ns-instance-opdata response for NSR ID', nsr_id, 'Exception:', e);
1557                 resolve({
1558                     statusCode: 200,
1559                     data: result
1560                 })
1561             }
1562         }, function(error) {
1563             // failed to get NSR data.
1564             // bail
1565             resolve({
1566                 statusCode: 200,
1567                 data: result
1568             });
1569         });
1570     });
1571 };
1572
1573 NetworkTopology.get = function(req) {
1574     var api_server = req.query["api_server"];
1575     var uri = utils.confdPort(api_server);
1576     uri += APIVersion + '/api/operational/network?deep';
1577     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1578         'Authorization': req.get('Authorization')
1579     });
1580     return new Promise(function(resolve, reject) {
1581         request({
1582             url: uri,
1583             method: 'GET',
1584             headers: headers,
1585             forever: constants.FOREVER_ON,
1586             rejectUnauthorized: false
1587         }, function(error, response, body) {
1588             if (utils.validateResponse('NetworkTopology.get', error, response, body, resolve, reject)) {
1589                 var data = JSON.parse(response.body);
1590                 var returnData = transforms.transformNetworkTopology(
1591                     data["ietf-network:network"]
1592                 );
1593                 resolve({
1594                     statusCode: 200,
1595                     data: returnData
1596                 });
1597             };
1598         });
1599     })
1600 }
1601
1602 VDUR.get = function(req) {
1603     var api_server = req.query["api_server"];
1604     var vnfrID = req.params.vnfr_id;
1605     var vdurID = req.params.vdur_id;
1606     var uri = utils.confdPort(api_server);
1607     uri += APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrID + '/vdur/' + vdurID + '?deep';
1608     var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
1609         'Authorization': req.get('Authorization')
1610     });
1611     return new Promise(function(resolve, reject) {
1612         request({
1613             url: uri,
1614             method: 'GET',
1615             headers: headers,
1616             forever: constants.FOREVER_ON,
1617             rejectUnauthorized: false,
1618         }, function(error, response, body) {
1619             if (utils.validateResponse('VDUR.get', error, response, body, resolve, reject)) {
1620                 var data = JSON.parse(response.body);
1621                 var returnData = data["vdur:vdur"];
1622                 return resolve(returnData);
1623             };
1624         });
1625     })
1626 }
1627
1628 CloudAccount.get = function(req) {
1629     var api_server = req.query["api_server"];
1630     var uri = utils.confdPort(api_server);
1631     uri += APIVersion + '/api/config/cloud/account?deep';
1632     var headers = _.extend({}, constants.HTTP_HEADERS.accept.collection, {
1633         'Authorization': req.get('Authorization')
1634     });
1635     return new Promise(function(resolve, reject) {
1636         request({
1637             url: uri,
1638             method: 'GET',
1639             headers: headers,
1640             forever: constants.FOREVER_ON,
1641             rejectUnauthorized: false,
1642         }, function(error, response, body) {
1643             if (utils.validateResponse('CloudAccount.get', error, response, body, resolve, reject)) {
1644                 var data = JSON.parse(response.body);
1645                 var returnData = data["collection"]["rw-cloud:account"];
1646                 resolve({
1647                     statusCode: 200,
1648                     data: returnData
1649                 });
1650             };
1651         });
1652     });
1653 }
1654
1655
1656 // Config-Agent Account APIs
1657 ConfigAgentAccount.get = function(req) {
1658     var self = this;
1659
1660     var api_server = req.query["api_server"];
1661     var id = req.params.id;
1662
1663     if (!id) {
1664         // Get all config accounts
1665         return new Promise(function(resolve, reject) {
1666
1667             var requestHeaders = {};
1668             _.extend(requestHeaders,
1669                 constants.HTTP_HEADERS.accept.collection, {
1670                     'Authorization': req.get('Authorization')
1671                 });
1672
1673             request({
1674                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account',
1675                     type: 'GET',
1676                     headers: requestHeaders,
1677                     forever: constants.FOREVER_ON,
1678                     rejectUnauthorized: false,
1679                 },
1680                 function(error, response, body) {
1681                     var data;
1682                     var statusCode;
1683                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1684                         try {
1685                             data = JSON.parse(response.body).collection['rw-config-agent:account'];
1686                             statusCode = response.statusCode;
1687                         } catch (e) {
1688                             console.log('Problem with "ConfigAgentAccount.get"', e);
1689                             var err = {};
1690                             err.statusCode = 500;
1691                             err.errorMessage = {
1692                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1693                             }
1694                             return reject(err);
1695                         }
1696
1697                         return resolve({
1698                             statusCode: statusCode,
1699                             data: data
1700                         });
1701                     };
1702                 });
1703         });
1704     } else {
1705         //Get a specific config account
1706         return new Promise(function(resolve, reject) {
1707             var requestHeaders = {};
1708             _.extend(requestHeaders,
1709                 constants.HTTP_HEADERS.accept.data, {
1710                     'Authorization': req.get('Authorization')
1711                 });
1712
1713             request({
1714                     url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account/' + id,
1715                     type: 'GET',
1716                     headers: requestHeaders,
1717                     forever: constants.FOREVER_ON,
1718                     rejectUnauthorized: false,
1719                 },
1720                 function(error, response, body) {
1721                     var data;
1722                     var statusCode;
1723                     if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
1724                         try {
1725                             data = JSON.parse(response.body)['rw-config-agent:account'];
1726                             statusCode = response.statusCode;
1727                         } catch (e) {
1728                             console.log('Problem with "ConfigAgentAccount.get"', e);
1729                             var err = {};
1730                             err.statusCode = 500;
1731                             err.errorMessage = {
1732                                 error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
1733                             }
1734                             return reject(err);
1735                         }
1736
1737                         return resolve({
1738                             statusCode: statusCode,
1739                             data: data
1740                         });
1741                     }
1742                 });
1743         });
1744     }
1745 };
1746
1747 ConfigAgentAccount.create = function(req) {
1748
1749     var api_server = req.query["api_server"];
1750     var data = req.body;
1751
1752     return new Promise(function(resolve, reject) {
1753         var jsonData = {
1754             "account": Array.isArray(data) ? data : [data]
1755         };
1756
1757         console.log('Creating with', JSON.stringify(jsonData));
1758
1759         var requestHeaders = {};
1760         _.extend(requestHeaders,
1761             constants.HTTP_HEADERS.accept.data,
1762             constants.HTTP_HEADERS.content_type.data, {
1763                 'Authorization': req.get('Authorization')
1764             });
1765
1766         request({
1767             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent',
1768             method: 'POST',
1769             headers: requestHeaders,
1770             forever: constants.FOREVER_ON,
1771             rejectUnauthorized: false,
1772             json: jsonData,
1773         }, function(error, response, body) {
1774             if (utils.validateResponse('ConfigAgentAccount.create', error, response, body, resolve, reject)) {
1775                 return resolve({
1776                     statusCode: response.statusCode,
1777                     data: JSON.stringify(response.body),
1778                     body:response.body.body
1779                 });
1780             };
1781         });
1782     });
1783 };
1784
1785 ConfigAgentAccount.update = function(req) {
1786
1787     var api_server = req.query["api_server"];
1788     var id = req.params.id;
1789     var data = req.body;
1790
1791     return new Promise(function(resolve, reject) {
1792         var jsonData = {
1793             "rw-config-agent:account": data
1794         };
1795
1796         console.log('Updating config-agent', id, ' with', JSON.stringify(jsonData));
1797
1798         var requestHeaders = {};
1799         _.extend(requestHeaders,
1800             constants.HTTP_HEADERS.accept.data,
1801             constants.HTTP_HEADERS.content_type.data, {
1802                 'Authorization': req.get('Authorization')
1803             });
1804
1805         request({
1806             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1807             method: 'PUT',
1808             headers: requestHeaders,
1809             forever: constants.FOREVER_ON,
1810             rejectUnauthorized: false,
1811             json: jsonData,
1812         }, function(error, response, body) {
1813             if (utils.validateResponse('ConfigAgentAccount.update', error, response, body, resolve, reject)) {
1814                 return resolve({
1815                     statusCode: response.statusCode,
1816                     data: JSON.stringify(response.body)
1817                 });
1818             };
1819         });
1820     });
1821 };
1822
1823 ConfigAgentAccount.delete = function(req) {
1824
1825     var api_server = req.query["api_server"];
1826     var id = req.params.id;
1827
1828     if (!id || !api_server) {
1829         return new Promise(function(resolve, reject) {
1830             console.log('Must specifiy api_server and id to delete config-agent account');
1831             return reject({
1832                 statusCode: 500,
1833                 errorMessage: {
1834                     error: 'Must specifiy api_server and id to delete config agent account'
1835                 }
1836             });
1837         });
1838     };
1839
1840     return new Promise(function(resolve, reject) {
1841         var requestHeaders = {};
1842         _.extend(requestHeaders,
1843             constants.HTTP_HEADERS.accept.data, {
1844                 'Authorization': req.get('Authorization')
1845             });
1846         request({
1847             url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
1848             method: 'DELETE',
1849             headers: requestHeaders,
1850             forever: constants.FOREVER_ON,
1851             rejectUnauthorized: false,
1852         }, function(error, response, body) {
1853             if (utils.validateResponse('ConfigAgentAccount.delete', error, response, body, resolve, reject)) {
1854                 return resolve({
1855                     statusCode: response.statusCode,
1856                     data: JSON.stringify(response.body)
1857                 });
1858             };
1859         });
1860     });
1861 };
1862
1863
1864 DataCenters.get = function(req) {
1865     var api_server = req.query["api_server"];
1866     return new Promise(function(resolve, reject) {
1867         var requestHeaders = {};
1868         _.extend(requestHeaders,
1869             constants.HTTP_HEADERS.accept.data, {
1870                 'Authorization': req.get('Authorization')
1871             });
1872         request({
1873             url: utils.confdPort(api_server) + APIVersion + '/api/operational/datacenters/cloud-accounts?deep',
1874             method: 'GET',
1875             headers: requestHeaders,
1876             forever: constants.FOREVER_ON,
1877             rejectUnauthorized: false,
1878         }, function(error, response, body) {
1879             if (utils.validateResponse('DataCenters.get', error, response, body, resolve, reject)) {
1880                 var returnData = {};
1881                 try {
1882                     data = JSON.parse(response.body)['rw-launchpad:cloud-accounts'];
1883                     data.map(function(c) {
1884                         returnData[c.name] = c.datacenters;
1885                     })
1886                     statusCode = response.statusCode;
1887                 } catch (e) {
1888                     console.log('Problem with "DataCenters.get"', e);
1889                     var err = {};
1890                     err.statusCode = 500;
1891                     err.errorMessage = {
1892                         error: 'Problem with "DataCenters.get": ' + e.toString()
1893                     }
1894                     return reject(err);
1895                 }
1896                 return resolve({
1897                     statusCode: response.statusCode,
1898                     data: returnData
1899                 });
1900             };
1901         });
1902     });
1903 }
1904
1905 SSHkey.get  = function(req) {
1906     var api_server = req.query["api_server"];
1907     return new Promise(function(resolve, reject) {
1908         var requestHeaders = {};
1909         _.extend(requestHeaders,
1910             constants.HTTP_HEADERS.accept.data, {
1911                 'Authorization': req.get('Authorization')
1912             });
1913         request({
1914             url: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair?deep',
1915             method: 'GET',
1916             headers: requestHeaders,
1917             forever: constants.FOREVER_ON,
1918             rejectUnauthorized: false,
1919         }, function(error, response, body) {
1920             if (utils.validateResponse('SSHkey.get', error, response, body, resolve, reject)) {
1921                 var returnData = {};
1922                 try {
1923                     returnData = JSON.parse(response.body)['nsr:key-pair'];
1924                     statusCode = response.statusCode;
1925                 } catch (e) {
1926                     console.log('Problem with "SSHkey.get"', e);
1927                     var err = {};
1928                     err.statusCode = 500;
1929                     err.errorMessage = {
1930                         error: 'Problem with "SSHkey.get": ' + e.toString()
1931                     }
1932                     return reject(err);
1933                 }
1934                 return resolve({
1935                     statusCode: response.statusCode,
1936                     data: returnData
1937                 });
1938             };
1939         });
1940     });
1941 }
1942 SSHkey.delete = function(req) {
1943     var api_server = req.query['api_server'];
1944     var id = decodeURI(req.params.name);
1945     console.log('Deleting ssk-key', id);
1946     return new Promise(function(resolve, reject) {
1947         request({
1948             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/' + id,
1949             method: 'DELETE',
1950             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1951                 'Authorization': req.get('Authorization')
1952             }),
1953             forever: constants.FOREVER_ON,
1954             rejectUnauthorized: false,
1955         }, function(error, response, body) {
1956             if (utils.validateResponse('SSHkey.delete', error, response, body, resolve, reject)) {
1957                 resolve({
1958                     statusCode: response.statusCode
1959                 });
1960             }
1961         });
1962     });
1963 };
1964 SSHkey.post = function(req) {
1965     var api_server = req.query['api_server'];
1966     var data = req.body;
1967     return new Promise(function(resolve, reject) {
1968         request({
1969             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
1970             method: 'POST',
1971             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1972                 'Authorization': req.get('Authorization')
1973             }),
1974             json: data,
1975             forever: constants.FOREVER_ON,
1976             rejectUnauthorized: false,
1977         }, function(error, response, body) {
1978             if (utils.validateResponse('SSHkey.post', error, response, body, resolve, reject)) {
1979                 resolve({
1980                     data: 'success',
1981                     statusCode: response.statusCode
1982                 });
1983             }
1984         });
1985     });
1986 };
1987 SSHkey.put = function(req) {
1988     var api_server = req.query['api_server'];
1989     var data = req.body;
1990     return new Promise(function(resolve, reject) {
1991         request({
1992             uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
1993             method: 'PUT',
1994             headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
1995                 'Authorization': req.get('Authorization')
1996             }),
1997             json: data,
1998             forever: constants.FOREVER_ON,
1999             rejectUnauthorized: false,
2000         }, function(error, response, body) {
2001             if (utils.validateResponse('SSHkey.put', error, response, body, resolve, reject)) {
2002                 resolve({
2003                     statusCode: response.statusCode
2004                 });
2005             }
2006         });
2007     });
2008 };
2009
2010 function sortByName(a, b) {
2011     return a.name > b.name;
2012 }
2013
2014 module.exports.catalog = Catalog;
2015 module.exports.nsr = NSR;
2016 module.exports.vnfr = VNFR;
2017 module.exports.vlr = VLR;
2018 module.exports.rift = RIFT;
2019 module.exports.computeTopology = ComputeTopology;
2020 module.exports.networkTopology = NetworkTopology;
2021 module.exports.config = Config;
2022 module.exports.cloud_account = CloudAccount;
2023 module.exports['config-agent-account'] = ConfigAgentAccount;
2024 module.exports.rpc = RPC;
2025 module.exports.data_centers = DataCenters;
2026 module.exports.SSHkey = SSHkey;