X-Git-Url: https://osm.etsi.org/gitweb/?a=blobdiff_plain;f=n2vc%2Fn2vc_juju_conn.py;h=64e338c60ddcfc1db8ba45c9bd4226372dfef878;hb=refs%2Fchanges%2F16%2F12316%2F6;hp=2d2fbdbdd8ebf8b6afcd4714ec068a60bb0d6adf;hpb=9ae4d929c2b739d146e3e27388dc4825ca046e50;p=osm%2FN2VC.git diff --git a/n2vc/n2vc_juju_conn.py b/n2vc/n2vc_juju_conn.py index 2d2fbdb..64e338c 100644 --- a/n2vc/n2vc_juju_conn.py +++ b/n2vc/n2vc_juju_conn.py @@ -20,48 +20,58 @@ # contact with: nfvlabs@tid.es ## -import logging -import os import asyncio -import time -import base64 -import binascii -import re +import logging +from n2vc.config import EnvironConfig +from n2vc.definitions import RelationEndpoint +from n2vc.exceptions import ( + N2VCBadArgumentsException, + N2VCException, + N2VCConnectionException, + N2VCExecutionException, + N2VCApplicationExists, + JujuApplicationExists, + # N2VCNotFound, + MethodNotImplemented, +) from n2vc.n2vc_conn import N2VCConnector -from n2vc.exceptions \ - import N2VCBadArgumentsException, N2VCException, N2VCConnectionException, \ - N2VCExecutionException, N2VCInvalidCertificate -from n2vc.juju_observer import JujuModelObserver - -from juju.controller import Controller -from juju.model import Model -from juju.application import Application -from juju.action import Action -from juju.machine import Machine +from n2vc.n2vc_conn import obj_to_dict, obj_to_yaml +from n2vc.libjuju import Libjuju +from n2vc.store import MotorStore +from n2vc.utils import get_ee_id_components, generate_random_alfanum_string +from n2vc.vca.connection import get_connection +from retrying_async import retry +from typing import Tuple class N2VCJujuConnector(N2VCConnector): """ - ################################################################################################## - ########################################## P U B L I C ########################################### - ################################################################################################## + #################################################################################### + ################################### P U B L I C #################################### + #################################################################################### """ + BUILT_IN_CLOUDS = ["localhost", "microk8s"] + libjuju = None + def __init__( self, db: object, fs: object, log: object = None, loop: object = None, - url: str = '127.0.0.1:17070', - username: str = 'admin', - vca_config: dict = None, on_update_db=None, - api_proxy=None ): - """Initialize juju N2VC connector + """ + Constructor + + :param: db: Database object from osm_common + :param: fs: Filesystem object from osm_common + :param: log: Logger + :param: loop: Asyncio loop + :param: on_update_db: Callback function to be called for updating the database. """ # parent class constructor @@ -71,123 +81,88 @@ class N2VCJujuConnector(N2VCConnector): fs=fs, log=log, loop=loop, - url=url, - username=username, - vca_config=vca_config, - on_update_db=on_update_db + on_update_db=on_update_db, ) # silence websocket traffic log - logging.getLogger('websockets.protocol').setLevel(logging.INFO) - logging.getLogger('juju.client.connection').setLevel(logging.WARN) - logging.getLogger('model').setLevel(logging.WARN) - - self.info('Initializing N2VC juju connector...') - - """ - ############################################################## - # check arguments - ############################################################## - """ - - # juju URL - if url is None: - raise N2VCBadArgumentsException('Argument url is mandatory', ['url']) - url_parts = url.split(':') - if len(url_parts) != 2: - raise N2VCBadArgumentsException('Argument url: bad format (localhost:port) -> {}'.format(url), ['url']) - self.hostname = url_parts[0] - try: - self.port = int(url_parts[1]) - except ValueError: - raise N2VCBadArgumentsException('url port must be a number -> {}'.format(url), ['url']) - - # juju USERNAME - if username is None: - raise N2VCBadArgumentsException('Argument username is mandatory', ['username']) + logging.getLogger("websockets.protocol").setLevel(logging.INFO) + logging.getLogger("juju.client.connection").setLevel(logging.WARN) + logging.getLogger("model").setLevel(logging.WARN) - # juju CONFIGURATION - if vca_config is None: - raise N2VCBadArgumentsException('Argument vca_config is mandatory', ['vca_config']) + self.log.info("Initializing N2VC juju connector...") - if 'secret' in vca_config: - self.secret = vca_config['secret'] - else: - raise N2VCBadArgumentsException('Argument vca_config.secret is mandatory', ['vca_config.secret']) - - # pubkey of juju client in osm machine: ~/.local/share/juju/ssh/juju_id_rsa.pub - # if exists, it will be written in lcm container: _create_juju_public_key() - if 'public_key' in vca_config: - self.public_key = vca_config['public_key'] - else: - self.public_key = None + db_uri = EnvironConfig(prefixes=["OSMLCM_", "OSMMON_"]).get("database_uri") + self._store = MotorStore(db_uri) + self.loading_libjuju = asyncio.Lock(loop=self.loop) + self.delete_namespace_locks = {} + self.log.info("N2VC juju connector initialized") - # TODO: Verify ca_cert is valid before using. VCA will crash - # if the ca_cert isn't formatted correctly. - def base64_to_cacert(b64string): - """Convert the base64-encoded string containing the VCA CACERT. + async def get_status( + self, namespace: str, yaml_format: bool = True, vca_id: str = None + ): + """ + Get status from all juju models from a VCA - The input string.... + :param namespace: we obtain ns from namespace + :param yaml_format: returns a yaml string + :param: vca_id: VCA ID from which the status will be retrieved. + """ + # TODO: Review where is this function used. It is not optimal at all to get the status + # from all the juju models of a particular VCA. Additionally, these models might + # not have been deployed by OSM, in that case we are getting information from + # deployments outside of OSM's scope. - """ - try: - cacert = base64.b64decode(b64string).decode("utf-8") + # self.log.info('Getting NS status. namespace: {}'.format(namespace)) + libjuju = await self._get_libjuju(vca_id) - cacert = re.sub( - r'\\n', - r'\n', - cacert, - ) - except binascii.Error as e: - self.debug("Caught binascii.Error: {}".format(e)) - raise N2VCInvalidCertificate(message="Invalid CA Certificate") + _nsi_id, ns_id, _vnf_id, _vdu_id, _vdu_count = self._get_namespace_components( + namespace=namespace + ) + # model name is ns_id + model_name = ns_id + if model_name is None: + msg = "Namespace {} not valid".format(namespace) + self.log.error(msg) + raise N2VCBadArgumentsException(msg, ["namespace"]) - return cacert + status = {} + models = await libjuju.list_models(contains=ns_id) - self.ca_cert = vca_config.get('ca_cert') - if self.ca_cert: - self.ca_cert = base64_to_cacert(vca_config['ca_cert']) + for m in models: + status[m] = await libjuju.get_model_status(m) - if api_proxy: - self.api_proxy = api_proxy + if yaml_format: + return obj_to_yaml(status) else: - self.warning('api_proxy is not configured. Support for native charms is disabled') - - self.debug('Arguments have been checked') - - # juju data - self.controller = None # it will be filled when connect to juju - self.juju_models = {} # model objects for every model_name - self.juju_observers = {} # model observers for every model_name - self._connecting = False # while connecting to juju (to avoid duplicate connections) - self._authenticated = False # it will be True when juju connection be stablished - self._creating_model = False # True during model creation + return obj_to_dict(status) - # create juju pub key file in lcm container at ./local/share/juju/ssh/juju_id_rsa.pub - self._create_juju_public_key() - - self.info('N2VC juju connector initialized') - - async def get_status(self, namespace: str): - self.info('Getting NS status. namespace: {}'.format(namespace)) - - if not self._authenticated: - await self._juju_login() - - nsi_id, ns_id, vnf_id, vdu_id, vdu_count = self._get_namespace_components(namespace=namespace) - # model name is ns_id - model_name = ns_id - if model_name is None: - msg = 'Namespace {} not valid'.format(namespace) - self.error(msg) - raise N2VCBadArgumentsException(msg, ['namespace']) - - # get juju model (create model if needed) - model = await self._juju_get_model(model_name=model_name) + async def update_vca_status(self, vcastatus: dict, vca_id: str = None): + """ + Add all configs, actions, executed actions of all applications in a model to vcastatus dict. - status = await model.get_status() + :param vcastatus: dict containing vcaStatus + :param: vca_id: VCA ID - return status + :return: None + """ + try: + libjuju = await self._get_libjuju(vca_id) + for model_name in vcastatus: + # Adding executed actions + vcastatus[model_name][ + "executedActions" + ] = await libjuju.get_executed_actions(model_name) + for application in vcastatus[model_name]["applications"]: + # Adding application actions + vcastatus[model_name]["applications"][application][ + "actions" + ] = await libjuju.get_actions(application, model_name) + # Adding application configs + vcastatus[model_name]["applications"][application][ + "configs" + ] = await libjuju.get_application_configs(model_name, application) + except Exception as e: + self.log.debug("Error in updating vca status: {}".format(str(e))) async def create_execution_environment( self, @@ -195,55 +170,101 @@ class N2VCJujuConnector(N2VCConnector): db_dict: dict, reuse_ee_id: str = None, progress_timeout: float = None, - total_timeout: float = None + total_timeout: float = None, + vca_id: str = None, ) -> (str, dict): + """ + Create an Execution Environment. Returns when it is created or raises an + exception on failing + + :param: namespace: Contains a dot separate string. + LCM will use: []...[-] + :param: db_dict: where to write to database when the status changes. + It contains a dictionary with {collection: str, filter: {}, path: str}, + e.g. {collection: "nsrs", filter: {_id: , path: + "_admin.deployed.VCA.3"} + :param: reuse_ee_id: ee id from an older execution. It allows us to reuse an + older environment + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param: vca_id: VCA ID + + :returns: id of the new execution environment and credentials for it + (credentials can contains hostname, username, etc depending on underlying cloud) + """ - self.info('Creating execution environment. namespace: {}, reuse_ee_id: {}'.format(namespace, reuse_ee_id)) - - if not self._authenticated: - await self._juju_login() + self.log.info( + "Creating execution environment. namespace: {}, reuse_ee_id: {}".format( + namespace, reuse_ee_id + ) + ) + libjuju = await self._get_libjuju(vca_id) machine_id = None if reuse_ee_id: - model_name, application_name, machine_id = self._get_ee_id_components(ee_id=reuse_ee_id) + model_name, application_name, machine_id = self._get_ee_id_components( + ee_id=reuse_ee_id + ) else: - nsi_id, ns_id, vnf_id, vdu_id, vdu_count = self._get_namespace_components(namespace=namespace) + ( + _nsi_id, + ns_id, + _vnf_id, + _vdu_id, + _vdu_count, + ) = self._get_namespace_components(namespace=namespace) # model name is ns_id model_name = ns_id # application name application_name = self._get_application_name(namespace=namespace) - self.debug('model name: {}, application name: {}, machine_id: {}' - .format(model_name, application_name, machine_id)) + self.log.debug( + "model name: {}, application name: {}, machine_id: {}".format( + model_name, application_name, machine_id + ) + ) # create or reuse a new juju machine try: - machine = await self._juju_create_machine( + if not await libjuju.model_exists(model_name): + await libjuju.add_model( + model_name, + libjuju.vca_connection.lxd_cloud, + ) + machine, new = await libjuju.create_machine( model_name=model_name, - application_name=application_name, machine_id=machine_id, db_dict=db_dict, progress_timeout=progress_timeout, - total_timeout=total_timeout + total_timeout=total_timeout, + ) + # id for the execution environment + ee_id = N2VCJujuConnector._build_ee_id( + model_name=model_name, + application_name=application_name, + machine_id=str(machine.entity_id), ) + self.log.debug("ee_id: {}".format(ee_id)) + + if new: + # write ee_id in database + self._write_ee_id_db(db_dict=db_dict, ee_id=ee_id) + except Exception as e: - message = 'Error creating machine on juju: {}'.format(e) - self.error(message) + message = "Error creating machine on juju: {}".format(e) + self.log.error(message) raise N2VCException(message=message) - # id for the execution environment - ee_id = N2VCJujuConnector._build_ee_id( - model_name=model_name, - application_name=application_name, - machine_id=str(machine.entity_id) - ) - self.debug('ee_id: {}'.format(ee_id)) - # new machine credentials - credentials = dict() - credentials['hostname'] = machine.dns_name + credentials = { + "hostname": machine.dns_name, + } - self.info('Execution environment created. ee_id: {}, credentials: {}'.format(ee_id, credentials)) + self.log.info( + "Execution environment created. ee_id: {}, credentials: {}".format( + ee_id, credentials + ) + ) return ee_id, credentials @@ -253,31 +274,61 @@ class N2VCJujuConnector(N2VCConnector): credentials: dict, db_dict: dict, progress_timeout: float = None, - total_timeout: float = None + total_timeout: float = None, + vca_id: str = None, ) -> str: - - if not self._authenticated: - await self._juju_login() - - self.info('Registering execution environment. namespace={}, credentials={}'.format(namespace, credentials)) + """ + Register an existing execution environment at the VCA + + :param: namespace: Contains a dot separate string. + LCM will use: []...[-] + :param: credentials: credentials to access the existing execution environment + (it can contains hostname, username, path to private key, + etc depending on underlying cloud) + :param: db_dict: where to write to database when the status changes. + It contains a dictionary with {collection: str, filter: {}, path: str}, + e.g. {collection: "nsrs", filter: {_id: , path: + "_admin.deployed.VCA.3"} + :param: reuse_ee_id: ee id from an older execution. It allows us to reuse an + older environment + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param: vca_id: VCA ID + + :returns: id of the execution environment + """ + self.log.info( + "Registering execution environment. namespace={}, credentials={}".format( + namespace, credentials + ) + ) + libjuju = await self._get_libjuju(vca_id) if credentials is None: - raise N2VCBadArgumentsException(message='credentials are mandatory', bad_args=['credentials']) - if 'hostname' in credentials: - hostname = credentials['hostname'] + raise N2VCBadArgumentsException( + message="credentials are mandatory", bad_args=["credentials"] + ) + if credentials.get("hostname"): + hostname = credentials["hostname"] else: - raise N2VCBadArgumentsException(message='hostname is mandatory', bad_args=['credentials.hostname']) - if 'username' in credentials: - username = credentials['username'] + raise N2VCBadArgumentsException( + message="hostname is mandatory", bad_args=["credentials.hostname"] + ) + if credentials.get("username"): + username = credentials["username"] else: - raise N2VCBadArgumentsException(message='username is mandatory', bad_args=['credentials.username']) - if 'private_key_path' in credentials: - private_key_path = credentials['private_key_path'] + raise N2VCBadArgumentsException( + message="username is mandatory", bad_args=["credentials.username"] + ) + if "private_key_path" in credentials: + private_key_path = credentials["private_key_path"] else: # if not passed as argument, use generated private key path private_key_path = self.private_key_path - nsi_id, ns_id, vnf_id, vdu_id, vdu_count = self._get_namespace_components(namespace=namespace) + _nsi_id, ns_id, _vnf_id, _vdu_id, _vdu_count = self._get_namespace_components( + namespace=namespace + ) # model name model_name = ns_id @@ -286,118 +337,326 @@ class N2VCJujuConnector(N2VCConnector): # register machine on juju try: - machine = await self._juju_provision_machine( + if not await libjuju.model_exists(model_name): + await libjuju.add_model( + model_name, + libjuju.vca_connection.lxd_cloud, + ) + machine_id = await libjuju.provision_machine( model_name=model_name, hostname=hostname, username=username, private_key_path=private_key_path, db_dict=db_dict, progress_timeout=progress_timeout, - total_timeout=total_timeout + total_timeout=total_timeout, ) except Exception as e: - self.error('Error registering machine: {}'.format(e)) - raise N2VCException(message='Error registering machine on juju: {}'.format(e)) - self.info('Machine registered') + self.log.error("Error registering machine: {}".format(e)) + raise N2VCException( + message="Error registering machine on juju: {}".format(e) + ) + + self.log.info("Machine registered: {}".format(machine_id)) # id for the execution environment ee_id = N2VCJujuConnector._build_ee_id( model_name=model_name, application_name=application_name, - machine_id=str(machine.entity_id) + machine_id=str(machine_id), ) - self.info('Execution environment registered. ee_id: {}'.format(ee_id)) + self.log.info("Execution environment registered. ee_id: {}".format(ee_id)) return ee_id + # In case of native_charm is being deployed, if JujuApplicationExists error happens + # it will try to add_unit + @retry(attempts=3, delay=5, retry_exceptions=(N2VCApplicationExists,), timeout=None) async def install_configuration_sw( self, ee_id: str, artifact_path: str, db_dict: dict, progress_timeout: float = None, - total_timeout: float = None + total_timeout: float = None, + config: dict = None, + num_units: int = 1, + vca_id: str = None, + scaling_out: bool = False, + vca_type: str = None, ): + """ + Install the software inside the execution environment identified by ee_id + + :param: ee_id: the id of the execution environment returned by + create_execution_environment or register_execution_environment + :param: artifact_path: where to locate the artifacts (parent folder) using + the self.fs + the final artifact path will be a combination of this + artifact_path and additional string from the config_dict + (e.g. charm name) + :param: db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param: config: Dictionary with deployment config information. + :param: num_units: Number of units to deploy of a particular charm. + :param: vca_id: VCA ID + :param: scaling_out: Boolean to indicate if it is a scaling out operation + :param: vca_type: VCA type + """ - self.info('Installing configuration sw on ee_id: {}, artifact path: {}, db_dict: {}' - .format(ee_id, artifact_path, db_dict)) - - if not self._authenticated: - await self._juju_login() + self.log.info( + ( + "Installing configuration sw on ee_id: {}, " + "artifact path: {}, db_dict: {}" + ).format(ee_id, artifact_path, db_dict) + ) + libjuju = await self._get_libjuju(vca_id) # check arguments if ee_id is None or len(ee_id) == 0: - raise N2VCBadArgumentsException(message='ee_id is mandatory', bad_args=['ee_id']) + raise N2VCBadArgumentsException( + message="ee_id is mandatory", bad_args=["ee_id"] + ) if artifact_path is None or len(artifact_path) == 0: - raise N2VCBadArgumentsException(message='artifact_path is mandatory', bad_args=['artifact_path']) + raise N2VCBadArgumentsException( + message="artifact_path is mandatory", bad_args=["artifact_path"] + ) if db_dict is None: - raise N2VCBadArgumentsException(message='db_dict is mandatory', bad_args=['db_dict']) + raise N2VCBadArgumentsException( + message="db_dict is mandatory", bad_args=["db_dict"] + ) try: - model_name, application_name, machine_id = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) - self.debug('model: {}, application: {}, machine: {}'.format(model_name, application_name, machine_id)) + ( + model_name, + application_name, + machine_id, + ) = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) + self.log.debug( + "model: {}, application: {}, machine: {}".format( + model_name, application_name, machine_id + ) + ) + except Exception: + raise N2VCBadArgumentsException( + message="ee_id={} is not a valid execution environment id".format( + ee_id + ), + bad_args=["ee_id"], + ) + + # remove // in charm path + while artifact_path.find("//") >= 0: + artifact_path = artifact_path.replace("//", "/") + + # check charm path + if not self.fs.file_exists(artifact_path): + msg = "artifact path does not exist: {}".format(artifact_path) + raise N2VCBadArgumentsException(message=msg, bad_args=["artifact_path"]) + + if artifact_path.startswith("/"): + full_path = self.fs.path + artifact_path + else: + full_path = self.fs.path + "/" + artifact_path + + try: + if vca_type == "native_charm" and await libjuju.check_application_exists( + model_name, application_name + ): + await libjuju.add_unit( + application_name=application_name, + model_name=model_name, + machine_id=machine_id, + db_dict=db_dict, + progress_timeout=progress_timeout, + total_timeout=total_timeout, + ) + else: + await libjuju.deploy_charm( + model_name=model_name, + application_name=application_name, + path=full_path, + machine_id=machine_id, + db_dict=db_dict, + progress_timeout=progress_timeout, + total_timeout=total_timeout, + config=config, + num_units=num_units, + ) + except JujuApplicationExists as e: + raise N2VCApplicationExists( + message="Error deploying charm into ee={} : {}".format(ee_id, e.message) + ) except Exception as e: + raise N2VCException( + message="Error deploying charm into ee={} : {}".format(ee_id, e) + ) + + self.log.info("Configuration sw installed") + + async def install_k8s_proxy_charm( + self, + charm_name: str, + namespace: str, + artifact_path: str, + db_dict: dict, + progress_timeout: float = None, + total_timeout: float = None, + config: dict = None, + vca_id: str = None, + ) -> str: + """ + Install a k8s proxy charm + + :param charm_name: Name of the charm being deployed + :param namespace: collection of all the uuids related to the charm. + :param str artifact_path: where to locate the artifacts (parent folder) using + the self.fs + the final artifact path will be a combination of this artifact_path and + additional string from the config_dict (e.g. charm name) + :param dict db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param config: Dictionary with additional configuration + :param vca_id: VCA ID + + :returns ee_id: execution environment id. + """ + self.log.info( + "Installing k8s proxy charm: {}, artifact path: {}, db_dict: {}".format( + charm_name, artifact_path, db_dict + ) + ) + libjuju = await self._get_libjuju(vca_id) + + if artifact_path is None or len(artifact_path) == 0: + raise N2VCBadArgumentsException( + message="artifact_path is mandatory", bad_args=["artifact_path"] + ) + if db_dict is None: raise N2VCBadArgumentsException( - message='ee_id={} is not a valid execution environment id'.format(ee_id), - bad_args=['ee_id'] + message="db_dict is mandatory", bad_args=["db_dict"] ) # remove // in charm path - while artifact_path.find('//') >= 0: - artifact_path = artifact_path.replace('//', '/') + while artifact_path.find("//") >= 0: + artifact_path = artifact_path.replace("//", "/") # check charm path - if not self.fs.file_exists(artifact_path, mode="dir"): - msg = 'artifact path does not exist: {}'.format(artifact_path) - raise N2VCBadArgumentsException(message=msg, bad_args=['artifact_path']) + if not self.fs.file_exists(artifact_path): + msg = "artifact path does not exist: {}".format(artifact_path) + raise N2VCBadArgumentsException(message=msg, bad_args=["artifact_path"]) - if artifact_path.startswith('/'): + if artifact_path.startswith("/"): full_path = self.fs.path + artifact_path else: - full_path = self.fs.path + '/' + artifact_path + full_path = self.fs.path + "/" + artifact_path + + _, ns_id, _, _, _ = self._get_namespace_components(namespace=namespace) + model_name = "{}-k8s".format(ns_id) + if not await libjuju.model_exists(model_name): + await libjuju.add_model( + model_name, + libjuju.vca_connection.k8s_cloud, + ) + application_name = self._get_application_name(namespace) try: - application, retries = await self._juju_deploy_charm( + await libjuju.deploy_charm( model_name=model_name, application_name=application_name, - charm_path=full_path, - machine_id=machine_id, + path=full_path, + machine_id=None, db_dict=db_dict, progress_timeout=progress_timeout, - total_timeout=total_timeout + total_timeout=total_timeout, + config=config, ) except Exception as e: - raise N2VCException(message='Error desploying charm into ee={} : {}'.format(ee_id, e)) + raise N2VCException(message="Error deploying charm: {}".format(e)) + + self.log.info("K8s proxy charm installed") + ee_id = N2VCJujuConnector._build_ee_id( + model_name=model_name, + application_name=application_name, + machine_id="k8s", + ) - self.info('Configuration sw installed') + self._write_ee_id_db(db_dict=db_dict, ee_id=ee_id) + + return ee_id async def get_ee_ssh_public__key( self, ee_id: str, db_dict: dict, progress_timeout: float = None, - total_timeout: float = None + total_timeout: float = None, + vca_id: str = None, ) -> str: + """ + Get Execution environment ssh public key + + :param: ee_id: the id of the execution environment returned by + create_execution_environment or register_execution_environment + :param: db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param vca_id: VCA ID + :returns: public key of the execution environment + For the case of juju proxy charm ssh-layered, it is the one + returned by 'get-ssh-public-key' primitive. + It raises a N2VC exception if fails + """ - self.info('Generating priv/pub key pair and get pub key on ee_id: {}, db_dict: {}'.format(ee_id, db_dict)) - - if not self._authenticated: - await self._juju_login() + self.log.info( + ( + "Generating priv/pub key pair and get pub key on ee_id: {}, db_dict: {}" + ).format(ee_id, db_dict) + ) + libjuju = await self._get_libjuju(vca_id) # check arguments if ee_id is None or len(ee_id) == 0: - raise N2VCBadArgumentsException(message='ee_id is mandatory', bad_args=['ee_id']) + raise N2VCBadArgumentsException( + message="ee_id is mandatory", bad_args=["ee_id"] + ) if db_dict is None: - raise N2VCBadArgumentsException(message='db_dict is mandatory', bad_args=['db_dict']) + raise N2VCBadArgumentsException( + message="db_dict is mandatory", bad_args=["db_dict"] + ) try: - model_name, application_name, machine_id = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) - self.debug('model: {}, application: {}, machine: {}'.format(model_name, application_name, machine_id)) - except Exception as e: + ( + model_name, + application_name, + machine_id, + ) = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) + self.log.debug( + "model: {}, application: {}, machine: {}".format( + model_name, application_name, machine_id + ) + ) + except Exception: raise N2VCBadArgumentsException( - message='ee_id={} is not a valid execution environment id'.format(ee_id), - bad_args=['ee_id'] + message="ee_id={} is not a valid execution environment id".format( + ee_id + ), + bad_args=["ee_id"], ) # try to execute ssh layer primitives (if exist): @@ -406,265 +665,549 @@ class N2VCJujuConnector(N2VCConnector): output = None + application_name = N2VCJujuConnector._format_app_name(application_name) + # execute action: generate-ssh-key try: - output, status = await self._juju_execute_action( + output, _status = await libjuju.execute_action( model_name=model_name, application_name=application_name, - action_name='generate-ssh-key', + action_name="generate-ssh-key", db_dict=db_dict, progress_timeout=progress_timeout, - total_timeout=total_timeout + total_timeout=total_timeout, ) except Exception as e: - self.info('Cannot execute action generate-ssh-key: {}\nContinuing...'.format(e)) + self.log.info( + "Skipping exception while executing action generate-ssh-key: {}".format( + e + ) + ) # execute action: get-ssh-public-key try: - output, status = await self._juju_execute_action( + output, _status = await libjuju.execute_action( model_name=model_name, application_name=application_name, - action_name='get-ssh-public-key', + action_name="get-ssh-public-key", db_dict=db_dict, progress_timeout=progress_timeout, - total_timeout=total_timeout + total_timeout=total_timeout, ) except Exception as e: - msg = 'Cannot execute action get-ssh-public-key: {}\n'.format(e) - self.info(msg) - raise e + msg = "Cannot execute action get-ssh-public-key: {}\n".format(e) + self.log.info(msg) + raise N2VCExecutionException(e, primitive_name="get-ssh-public-key") # return public key if exists - return output + return output["pubkey"] if "pubkey" in output else output - async def add_relation( - self, - ee_id_1: str, - ee_id_2: str, - endpoint_1: str, - endpoint_2: str - ): - - self.debug('adding new relation between {} and {}, endpoints: {}, {}' - .format(ee_id_1, ee_id_2, endpoint_1, endpoint_2)) + async def get_metrics( + self, model_name: str, application_name: str, vca_id: str = None + ) -> dict: + """ + Get metrics from application - if not self._authenticated: - await self._juju_login() + :param: model_name: Model name + :param: application_name: Application name + :param: vca_id: VCA ID - # get model, application and machines - model_1, app_1, machine_1 = self._get_ee_id_components(ee_id_1) - model_2, app_2, machine_2 = self._get_ee_id_components(ee_id_2) + :return: Dictionary with obtained metrics + """ + libjuju = await self._get_libjuju(vca_id) + return await libjuju.get_metrics(model_name, application_name) - # model must be the same - if model_1 != model_2: - message = 'EE models are not the same: {} vs {}'.format(ee_id_1, ee_id_2) - self.error(message) - raise N2VCBadArgumentsException(message=message, bad_args=['ee_id_1', 'ee_id_2']) + async def add_relation( + self, + provider: RelationEndpoint, + requirer: RelationEndpoint, + ): + """ + Add relation between two charmed endpoints - # add juju relations between two applications + :param: provider: Provider relation endpoint + :param: requirer: Requirer relation endpoint + """ + self.log.debug(f"adding new relation between {provider} and {requirer}") + cross_model_relation = ( + provider.model_name != requirer.model_name + or requirer.vca_id != requirer.vca_id + ) try: - self._juju_add_relation() + if cross_model_relation: + # Cross-model relation + provider_libjuju = await self._get_libjuju(provider.vca_id) + requirer_libjuju = await self._get_libjuju(requirer.vca_id) + offer = await provider_libjuju.offer(provider) + if offer: + saas_name = await requirer_libjuju.consume( + requirer.model_name, offer, provider_libjuju + ) + await requirer_libjuju.add_relation( + requirer.model_name, + requirer.endpoint, + saas_name, + ) + else: + # Standard relation + vca_id = provider.vca_id + model = provider.model_name + libjuju = await self._get_libjuju(vca_id) + # add juju relations between two applications + await libjuju.add_relation( + model_name=model, + endpoint_1=provider.endpoint, + endpoint_2=requirer.endpoint, + ) except Exception as e: - message = 'Error adding relation between {} and {}'.format(ee_id_1, ee_id_2) - self.error(message) + message = f"Error adding relation between {provider} and {requirer}: {e}" + self.log.error(message) raise N2VCException(message=message) - async def remove_relation( - self - ): - if not self._authenticated: - await self._juju_login() + async def remove_relation(self): # TODO - self.info('Method not implemented yet') - raise NotImplemented() + self.log.info("Method not implemented yet") + raise MethodNotImplemented() - async def deregister_execution_environments( - self - ): - if not self._authenticated: - await self._juju_login() - # TODO - self.info('Method not implemented yet') - raise NotImplemented() + async def deregister_execution_environments(self): + self.log.info("Method not implemented yet") + raise MethodNotImplemented() async def delete_namespace( self, namespace: str, db_dict: dict = None, - total_timeout: float = None + total_timeout: float = None, + vca_id: str = None, ): - self.info('Deleting namespace={}'.format(namespace)) - - if not self._authenticated: - await self._juju_login() - - # check arguments - if namespace is None: - raise N2VCBadArgumentsException(message='namespace is mandatory', bad_args=['namespace']) + """ + Remove a network scenario and its execution environments + :param: namespace: []. + :param: db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: total_timeout: Total timeout + :param: vca_id: VCA ID + """ + self.log.info("Deleting namespace={}".format(namespace)) + will_not_delete = False + if namespace not in self.delete_namespace_locks: + self.delete_namespace_locks[namespace] = asyncio.Lock(loop=self.loop) + delete_lock = self.delete_namespace_locks[namespace] + + while delete_lock.locked(): + will_not_delete = True + await asyncio.sleep(0.1) - nsi_id, ns_id, vnf_id, vdu_id, vdu_count = self._get_namespace_components(namespace=namespace) - if ns_id is not None: - self.debug('Deleting model {}'.format(ns_id)) - try: - await self._juju_destroy_model( - model_name=ns_id, - total_timeout=total_timeout - ) - except Exception as e: - raise N2VCException(message='Error deleting namespace {} : {}'.format(namespace, e)) - else: - raise N2VCBadArgumentsException(message='only ns_id is permitted to delete yet', bad_args=['namespace']) + if will_not_delete: + self.log.info("Namespace {} deleted by another worker.".format(namespace)) + return - self.info('Namespace {} deleted'.format(namespace)) + try: + async with delete_lock: + libjuju = await self._get_libjuju(vca_id) + + # check arguments + if namespace is None: + raise N2VCBadArgumentsException( + message="namespace is mandatory", bad_args=["namespace"] + ) + + ( + _nsi_id, + ns_id, + _vnf_id, + _vdu_id, + _vdu_count, + ) = self._get_namespace_components(namespace=namespace) + if ns_id is not None: + try: + models = await libjuju.list_models(contains=ns_id) + for model in models: + await libjuju.destroy_model( + model_name=model, total_timeout=total_timeout + ) + except Exception as e: + self.log.error(f"Error deleting namespace {namespace} : {e}") + raise N2VCException( + message="Error deleting namespace {} : {}".format( + namespace, e + ) + ) + else: + raise N2VCBadArgumentsException( + message="only ns_id is permitted to delete yet", + bad_args=["namespace"], + ) + except Exception as e: + self.log.error(f"Error deleting namespace {namespace} : {e}") + raise e + finally: + self.delete_namespace_locks.pop(namespace) + self.log.info("Namespace {} deleted".format(namespace)) async def delete_execution_environment( self, ee_id: str, db_dict: dict = None, - total_timeout: float = None + total_timeout: float = None, + scaling_in: bool = False, + vca_type: str = None, + vca_id: str = None, ): - self.info('Deleting execution environment ee_id={}'.format(ee_id)) - - if not self._authenticated: - await self._juju_login() + """ + Delete an execution environment + :param str ee_id: id of the execution environment to delete + :param dict db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: total_timeout: Total timeout + :param: scaling_in: Boolean to indicate if it is a scaling in operation + :param: vca_type: VCA type + :param: vca_id: VCA ID + """ + self.log.info("Deleting execution environment ee_id={}".format(ee_id)) + libjuju = await self._get_libjuju(vca_id) # check arguments if ee_id is None: - raise N2VCBadArgumentsException(message='ee_id is mandatory', bad_args=['ee_id']) - - model_name, application_name, machine_id = self._get_ee_id_components(ee_id=ee_id) + raise N2VCBadArgumentsException( + message="ee_id is mandatory", bad_args=["ee_id"] + ) - # destroy the application + model_name, application_name, machine_id = self._get_ee_id_components( + ee_id=ee_id + ) try: - await self._juju_destroy_application(model_name=model_name, application_name=application_name) + if not scaling_in: + # destroy the model + await libjuju.destroy_model( + model_name=model_name, + total_timeout=total_timeout, + ) + elif vca_type == "native_charm" and scaling_in: + # destroy the unit in the application + await libjuju.destroy_unit( + application_name=application_name, + model_name=model_name, + machine_id=machine_id, + total_timeout=total_timeout, + ) + else: + # destroy the application + await libjuju.destroy_application( + model_name=model_name, + application_name=application_name, + total_timeout=total_timeout, + ) except Exception as e: - raise N2VCException(message='Error deleting execution environment {} (application {}) : {}' - .format(ee_id, application_name, e)) - - # destroy the machine - try: - await self._juju_destroy_machine( - model_name=model_name, - machine_id=machine_id, - total_timeout=total_timeout + raise N2VCException( + message=( + "Error deleting execution environment {} (application {}) : {}" + ).format(ee_id, application_name, e) ) - except Exception as e: - raise N2VCException(message='Error deleting execution environment {} (machine {}) : {}' - .format(ee_id, machine_id, e)) - self.info('Execution environment {} deleted'.format(ee_id)) + self.log.info("Execution environment {} deleted".format(ee_id)) async def exec_primitive( - self, - ee_id: str, - primitive_name: str, - params_dict: dict, - db_dict: dict = None, - progress_timeout: float = None, - total_timeout: float = None + self, + ee_id: str, + primitive_name: str, + params_dict: dict, + db_dict: dict = None, + progress_timeout: float = None, + total_timeout: float = None, + vca_id: str = None, + vca_type: str = None, ) -> str: + """ + Execute a primitive in the execution environment + + :param: ee_id: the one returned by create_execution_environment or + register_execution_environment + :param: primitive_name: must be one defined in the software. There is one + called 'config', where, for the proxy case, the 'credentials' of VM are + provided + :param: params_dict: parameters of the action + :param: db_dict: where to write into database when the status changes. + It contains a dict with + {collection: , filter: {}, path: }, + e.g. {collection: "nsrs", filter: + {_id: , path: "_admin.deployed.VCA.3"} + :param: progress_timeout: Progress timeout + :param: total_timeout: Total timeout + :param: vca_id: VCA ID + :param: vca_type: VCA type + :returns str: primitive result, if ok. It raises exceptions in case of fail + """ - self.info('Executing primitive: {} on ee: {}, params: {}'.format(primitive_name, ee_id, params_dict)) - - if not self._authenticated: - await self._juju_login() + self.log.info( + "Executing primitive: {} on ee: {}, params: {}".format( + primitive_name, ee_id, params_dict + ) + ) + libjuju = await self._get_libjuju(vca_id) # check arguments if ee_id is None or len(ee_id) == 0: - raise N2VCBadArgumentsException(message='ee_id is mandatory', bad_args=['ee_id']) + raise N2VCBadArgumentsException( + message="ee_id is mandatory", bad_args=["ee_id"] + ) if primitive_name is None or len(primitive_name) == 0: - raise N2VCBadArgumentsException(message='action_name is mandatory', bad_args=['action_name']) + raise N2VCBadArgumentsException( + message="action_name is mandatory", bad_args=["action_name"] + ) if params_dict is None: params_dict = dict() try: - model_name, application_name, machine_id = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) + ( + model_name, + application_name, + machine_id, + ) = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) + # To run action on the leader unit in libjuju.execute_action function, + # machine_id must be set to None if vca_type is not native_charm + if vca_type != "native_charm": + machine_id = None except Exception: raise N2VCBadArgumentsException( - message='ee_id={} is not a valid execution environment id'.format(ee_id), - bad_args=['ee_id'] + message="ee_id={} is not a valid execution environment id".format( + ee_id + ), + bad_args=["ee_id"], ) - if primitive_name == 'config': + if primitive_name == "config": # Special case: config primitive try: - await self._juju_configure_application( + await libjuju.configure_application( model_name=model_name, application_name=application_name, config=params_dict, - db_dict=db_dict, - progress_timeout=progress_timeout, - total_timeout=total_timeout ) + actions = await libjuju.get_actions( + application_name=application_name, + model_name=model_name, + ) + self.log.debug( + "Application {} has these actions: {}".format( + application_name, actions + ) + ) + if "verify-ssh-credentials" in actions: + # execute verify-credentials + num_retries = 20 + retry_timeout = 15.0 + for _ in range(num_retries): + try: + self.log.debug("Executing action verify-ssh-credentials...") + output, ok = await libjuju.execute_action( + model_name=model_name, + application_name=application_name, + action_name="verify-ssh-credentials", + db_dict=db_dict, + progress_timeout=progress_timeout, + total_timeout=total_timeout, + ) + + if ok == "failed": + self.log.debug( + "Error executing verify-ssh-credentials: {}. Retrying..." + ) + await asyncio.sleep(retry_timeout) + + continue + self.log.debug("Result: {}, output: {}".format(ok, output)) + break + except asyncio.CancelledError: + raise + else: + self.log.error( + "Error executing verify-ssh-credentials after {} retries. ".format( + num_retries + ) + ) + else: + msg = "Action verify-ssh-credentials does not exist in application {}".format( + application_name + ) + self.log.debug(msg=msg) except Exception as e: - self.error('Error configuring juju application: {}'.format(e)) + self.log.error("Error configuring juju application: {}".format(e)) raise N2VCExecutionException( - message='Error configuring application into ee={} : {}'.format(ee_id, e), - primitive_name=primitive_name + message="Error configuring application into ee={} : {}".format( + ee_id, e + ), + primitive_name=primitive_name, ) - return 'CONFIG OK' + return "CONFIG OK" else: try: - output, status = await self._juju_execute_action( + output, status = await libjuju.execute_action( model_name=model_name, application_name=application_name, action_name=primitive_name, db_dict=db_dict, + machine_id=machine_id, progress_timeout=progress_timeout, total_timeout=total_timeout, - **params_dict + **params_dict, ) - if status == 'completed': + if status == "completed": return output else: - raise Exception('status is not completed: {}'.format(status)) + if "output" in output: + raise Exception(f'{status}: {output["output"]}') + else: + raise Exception( + f"{status}: No further information received from action" + ) + except Exception as e: - self.error('Error executing primitive {}: {}'.format(primitive_name, e)) + self.log.error(f"Error executing primitive {primitive_name}: {e}") raise N2VCExecutionException( - message='Error executing primitive {} into ee={} : {}'.format(primitive_name, ee_id, e), - primitive_name=primitive_name + message=f"Error executing primitive {primitive_name} in ee={ee_id}: {e}", + primitive_name=primitive_name, ) - async def disconnect(self): - self.info('closing juju N2VC...') - await self._juju_logout() + async def upgrade_charm( + self, + ee_id: str = None, + path: str = None, + charm_id: str = None, + charm_type: str = None, + timeout: float = None, + ) -> str: + """This method upgrade charms in VNFs + + Args: + ee_id: Execution environment id + path: Local path to the charm + charm_id: charm-id + charm_type: Charm type can be lxc-proxy-charm, native-charm or k8s-proxy-charm + timeout: (Float) Timeout for the ns update operation + + Returns: + The output of the update operation if status equals to "completed" + + """ + self.log.info("Upgrading charm: {} on ee: {}".format(path, ee_id)) + libjuju = await self._get_libjuju(charm_id) + + # check arguments + if ee_id is None or len(ee_id) == 0: + raise N2VCBadArgumentsException( + message="ee_id is mandatory", bad_args=["ee_id"] + ) + try: + ( + model_name, + application_name, + machine_id, + ) = N2VCJujuConnector._get_ee_id_components(ee_id=ee_id) + + except Exception: + raise N2VCBadArgumentsException( + message="ee_id={} is not a valid execution environment id".format( + ee_id + ), + bad_args=["ee_id"], + ) + + try: + + await libjuju.upgrade_charm( + application_name=application_name, + path=path, + model_name=model_name, + total_timeout=timeout, + ) + + return f"Charm upgraded with application name {application_name}" + + except Exception as e: + self.log.error("Error upgrading charm {}: {}".format(path, e)) + + raise N2VCException( + message="Error upgrading charm {} in ee={} : {}".format(path, ee_id, e) + ) + + async def disconnect(self, vca_id: str = None): + """ + Disconnect from VCA + + :param: vca_id: VCA ID + """ + self.log.info("closing juju N2VC...") + libjuju = await self._get_libjuju(vca_id) + try: + await libjuju.disconnect() + except Exception as e: + raise N2VCConnectionException( + message="Error disconnecting controller: {}".format(e), + url=libjuju.vca_connection.data.endpoints, + ) """ - ################################################################################################## - ########################################## P R I V A T E ######################################### - ################################################################################################## +#################################################################################### +################################### P R I V A T E ################################## +#################################################################################### """ - def _write_ee_id_db( - self, - db_dict: dict, - ee_id: str - ): + async def _get_libjuju(self, vca_id: str = None) -> Libjuju: + """ + Get libjuju object + + :param: vca_id: VCA ID + If None, get a libjuju object with a Connection to the default VCA + Else, geta libjuju object with a Connection to the specified VCA + """ + if not vca_id: + while self.loading_libjuju.locked(): + await asyncio.sleep(0.1) + if not self.libjuju: + async with self.loading_libjuju: + vca_connection = await get_connection(self._store) + self.libjuju = Libjuju(vca_connection, loop=self.loop, log=self.log) + return self.libjuju + else: + vca_connection = await get_connection(self._store, vca_id) + return Libjuju( + vca_connection, + loop=self.loop, + log=self.log, + n2vc=self, + ) + + def _write_ee_id_db(self, db_dict: dict, ee_id: str): # write ee_id to database: _admin.deployed.VCA.x try: - the_table = db_dict['collection'] - the_filter = db_dict['filter'] - the_path = db_dict['path'] - if not the_path[-1] == '.': - the_path = the_path + '.' - update_dict = {the_path + 'ee_id': ee_id} - self.debug('Writing ee_id to database: {}'.format(the_path)) + the_table = db_dict["collection"] + the_filter = db_dict["filter"] + the_path = db_dict["path"] + if not the_path[-1] == ".": + the_path = the_path + "." + update_dict = {the_path + "ee_id": ee_id} + # self.log.debug('Writing ee_id to database: {}'.format(the_path)) self.db.set_one( table=the_table, q_filter=the_filter, update_dict=update_dict, - fail_on_empty=True + fail_on_empty=True, ) + except asyncio.CancelledError: + raise except Exception as e: - self.error('Error writing ee_id to database: {}'.format(e)) + self.log.error("Error writing ee_id to database: {}".format(e)) @staticmethod - def _build_ee_id( - model_name: str, - application_name: str, - machine_id: str - ): + def _build_ee_id(model_name: str, application_name: str, machine_id: str): """ Build an execution environment id form model, application and machine :param model_name: @@ -673,615 +1216,299 @@ class N2VCJujuConnector(N2VCConnector): :return: """ # id for the execution environment - return '{}.{}.{}'.format(model_name, application_name, machine_id) + return "{}.{}.{}".format(model_name, application_name, machine_id) @staticmethod - def _get_ee_id_components( - ee_id: str - ) -> (str, str, str): + def _get_ee_id_components(ee_id: str) -> (str, str, str): """ Get model, application and machine components from an execution environment id :param ee_id: :return: model_name, application_name, machine_id """ - if ee_id is None: - return None, None, None - - # split components of id - parts = ee_id.split('.') - model_name = parts[0] - application_name = parts[1] - machine_id = parts[2] - return model_name, application_name, machine_id + return get_ee_id_components(ee_id) - def _get_application_name(self, namespace: str) -> str: - """ - Build application name from namespace - :param namespace: - :return: app-vnf--vdu--cnt- + @staticmethod + def _find_charm_level(vnf_id: str, vdu_id: str) -> str: + """Decides the charm level. + Args: + vnf_id (str): VNF id + vdu_id (str): VDU id + + Returns: + charm_level (str): ns-level or vnf-level or vdu-level """ + if vdu_id and not vnf_id: + raise N2VCException(message="If vdu-id exists, vnf-id should be provided.") + if vnf_id and vdu_id: + return "vdu-level" + if vnf_id and not vdu_id: + return "vnf-level" + if not vnf_id and not vdu_id: + return "ns-level" - # split namespace components - _, _, vnf_id, vdu_id, vdu_count = self._get_namespace_components(namespace=namespace) + @staticmethod + def _generate_backward_compatible_application_name( + vnf_id: str, vdu_id: str, vdu_count: str + ) -> str: + """Generate backward compatible application name + by limiting the app name to 50 characters. + Args: + vnf_id (str): VNF ID + vdu_id (str): VDU ID + vdu_count (str): vdu-count-index + + Returns: + application_name (str): generated application name + + """ if vnf_id is None or len(vnf_id) == 0: - vnf_id = '' + vnf_id = "" else: - vnf_id = 'vnf-' + vnf_id + # Shorten the vnf_id to its last twelve characters + vnf_id = "vnf-" + vnf_id[-12:] if vdu_id is None or len(vdu_id) == 0: - vdu_id = '' + vdu_id = "" else: - vdu_id = '-vdu-' + vdu_id + # Shorten the vdu_id to its last twelve characters + vdu_id = "-vdu-" + vdu_id[-12:] if vdu_count is None or len(vdu_count) == 0: - vdu_count = '' + vdu_count = "" else: - vdu_count = '-cnt-' + vdu_count - - application_name = 'app-{}{}{}'.format(vnf_id, vdu_id, vdu_count) + vdu_count = "-cnt-" + vdu_count - return N2VCJujuConnector._format_app_name(application_name) - - async def _juju_create_machine( - self, - model_name: str, - application_name: str, - machine_id: str = None, - db_dict: dict = None, - progress_timeout: float = None, - total_timeout: float = None - ) -> Machine: - - self.debug('creating machine in model: {}, existing machine id: {}'.format(model_name, machine_id)) - - # get juju model and observer (create model if needed) - model = await self._juju_get_model(model_name=model_name) - observer = self.juju_observers[model_name] - - # find machine id in model - machine = None - if machine_id is not None: - self.debug('Finding existing machine id {} in model'.format(machine_id)) - # get juju existing machines in the model - existing_machines = await model.get_machines() - if machine_id in existing_machines: - self.debug('Machine id {} found in model (reusing it)'.format(machine_id)) - machine = model.machines[machine_id] - - if machine is None: - self.debug('Creating a new machine in juju...') - # machine does not exist, create it and wait for it - machine = await model.add_machine( - spec=None, - constraints=None, - disks=None, - series='xenial' - ) - - # register machine with observer - observer.register_machine(machine=machine, db_dict=db_dict) - - # id for the execution environment - ee_id = N2VCJujuConnector._build_ee_id( - model_name=model_name, - application_name=application_name, - machine_id=str(machine.entity_id) - ) - - # write ee_id in database - self._write_ee_id_db( - db_dict=db_dict, - ee_id=ee_id - ) - - # wait for machine creation - await observer.wait_for_machine( - machine_id=str(machine.entity_id), - progress_timeout=progress_timeout, - total_timeout=total_timeout - ) - - else: - - self.debug('Reusing old machine pending') - - # register machine with observer - observer.register_machine(machine=machine, db_dict=db_dict) - - # machine does exist, but it is in creation process (pending), wait for create finalisation - await observer.wait_for_machine( - machine_id=machine.entity_id, - progress_timeout=progress_timeout, - total_timeout=total_timeout) - - self.debug("Machine ready at " + str(machine.dns_name)) - return machine - - async def _juju_provision_machine( - self, - model_name: str, - hostname: str, - username: str, - private_key_path: str, - db_dict: dict = None, - progress_timeout: float = None, - total_timeout: float = None - ) -> Machine: - - self.debug('provisioning machine. model: {}, hostname: {}'.format(model_name, hostname)) - - if not self._authenticated: - await self._juju_login() - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - observer = self.juju_observers[model_name] - - spec = 'ssh:{}@{}:{}'.format(username, hostname, private_key_path) - self.debug('provisioning machine {}'.format(spec)) - try: - machine = await model.add_machine(spec=spec) - except Exception as e: - import sys - import traceback - traceback.print_exc(file=sys.stdout) - print('-' * 60) - raise e + # Generate a random suffix with 5 characters (the default size used by K8s) + random_suffix = generate_random_alfanum_string(size=5) - # register machine with observer - observer.register_machine(machine=machine, db_dict=db_dict) - - # wait for machine creation - self.debug('waiting for provision completed... {}'.format(machine.entity_id)) - await observer.wait_for_machine( - machine=machine, - progress_timeout=progress_timeout, - total_timeout=total_timeout + application_name = "app-{}{}{}-{}".format( + vnf_id, vdu_id, vdu_count, random_suffix ) + return application_name - self.debug("Machine provisioned {}".format(machine.entity_id)) - return machine - - async def _juju_deploy_charm( - self, - model_name: str, - application_name: str, - charm_path: str, - machine_id: str, - db_dict: dict, - progress_timeout: float = None, - total_timeout: float = None - ) -> (Application, int): - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - observer = self.juju_observers[model_name] - - # check if application already exists - application = None - if application_name in model.applications: - application = model.applications[application_name] - - if application is None: - - # application does not exist, create it and wait for it - self.debug('deploying application {} to machine {}, model {}' - .format(application_name, machine_id, model_name)) - self.debug('charm: {}'.format(charm_path)) - application = await model.deploy( - entity_url=charm_path, - application_name=application_name, - channel='stable', - num_units=1, - series='xenial', - to=machine_id - ) - - # register application with observer - observer.register_application(application=application, db_dict=db_dict) - - self.debug('waiting for application deployed... {}'.format(application.entity_id)) - retries = await observer.wait_for_application( - application_id=application.entity_id, - progress_timeout=progress_timeout, - total_timeout=total_timeout) - self.debug('application deployed') - - else: - - # register application with observer - observer.register_application(application=application, db_dict=db_dict) - - # application already exists, but not finalised - self.debug('application already exists, waiting for deployed...') - retries = await observer.wait_for_application( - application_id=application.entity_id, - progress_timeout=progress_timeout, - total_timeout=total_timeout) - self.debug('application deployed') + @staticmethod + def _get_vca_record(search_key: str, vca_records: list, vdu_id: str) -> dict: + """Get the correct VCA record dict depending on the search key - return application, retries + Args: + search_key (str): keyword to find the correct VCA record + vca_records (list): All VCA records as list + vdu_id (str): VDU ID - async def _juju_execute_action( - self, - model_name: str, - application_name: str, - action_name: str, - db_dict: dict, - progress_timeout: float = None, - total_timeout: float = None, - **kwargs - ) -> Action: - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - observer = self.juju_observers[model_name] - - application = await self._juju_get_application(model_name=model_name, application_name=application_name) - - self.debug('trying to execute action {}'.format(action_name)) - unit = application.units[0] - if unit is not None: - actions = await application.get_actions() - if action_name in actions: - self.debug('executing action {} with params {}'.format(action_name, kwargs)) - action = await unit.run_action(action_name, **kwargs) - - # register action with observer - observer.register_action(action=action, db_dict=db_dict) - - self.debug(' waiting for action completed or error...') - await observer.wait_for_action( - action_id=action.entity_id, - progress_timeout=progress_timeout, - total_timeout=total_timeout) - self.debug('action completed with status: {}'.format(action.status)) - output = await model.get_action_output(action_uuid=action.entity_id) - status = await model.get_action_status(uuid_or_prefix=action.entity_id) - if action.entity_id in status: - status = status[action.entity_id] - else: - status = 'failed' - return output, status + Returns: + vca_record (dict): Dictionary which includes the correct VCA record - raise N2VCExecutionException( - message='Cannot execute action on charm', - primitive_name=action_name + """ + return next( + filter(lambda record: record[search_key] == vdu_id, vca_records), {} ) - async def _juju_configure_application( - self, - model_name: str, - application_name: str, - config: dict, - db_dict: dict, - progress_timeout: float = None, - total_timeout: float = None - ): + @staticmethod + def _generate_application_name( + charm_level: str, + vnfrs: dict, + vca_records: list, + vnf_count: str = None, + vdu_id: str = None, + vdu_count: str = None, + ) -> str: + """Generate application name to make the relevant charm of VDU/KDU + in the VNFD descriptor become clearly visible. + Limiting the app name to 50 characters. - # get juju model - model = await self._juju_get_model(model_name=model_name) + Args: + charm_level (str): level of charm + vnfrs (dict): vnf record dict + vca_records (list): db_nsr["_admin"]["deployed"]["VCA"] as list + vnf_count (str): vnf count index + vdu_id (str): VDU ID + vdu_count (str): vdu count index - # get the application - application = await self._juju_get_application(model_name=model_name, application_name=application_name) + Returns: + application_name (str): generated application name - self.debug('configuring the application {} -> {}'.format(application_name, config)) - res = await application.set_config(config) - self.debug('application {} configured. res={}'.format(application_name, res)) + """ + application_name = "" + if charm_level == "ns-level": + if len(vca_records) != 1: + raise N2VCException(message="One VCA record is expected.") + # Only one VCA record is expected if it's ns-level charm. + # Shorten the charm name to its first 40 characters. + charm_name = vca_records[0]["charm_name"][:40] + if not charm_name: + raise N2VCException(message="Charm name should be provided.") + application_name = charm_name + "-ns" + + elif charm_level == "vnf-level": + if len(vca_records) < 1: + raise N2VCException(message="One or more VCA record is expected.") + # If VNF is scaled, more than one VCA record may be included in vca_records + # but ee_descriptor_id is same. + # Shorten the ee_descriptor_id and member-vnf-index-ref + # to first 12 characters. + application_name = ( + vca_records[0]["ee_descriptor_id"][:12] + + "-" + + vnf_count + + "-" + + vnfrs["member-vnf-index-ref"][:12] + + "-vnf" + ) + elif charm_level == "vdu-level": + if len(vca_records) < 1: + raise N2VCException(message="One or more VCA record is expected.") + + # Charms are also used for deployments with Helm charts. + # If deployment unit is a Helm chart/KDU, + # vdu_profile_id and vdu_count will be empty string. + if vdu_count is None: + vdu_count = "" + + # If vnf/vdu is scaled, more than one VCA record may be included in vca_records + # but ee_descriptor_id is same. + # Shorten the ee_descriptor_id, member-vnf-index-ref and vdu_profile_id + # to first 12 characters. + if not vdu_id: + raise N2VCException(message="vdu-id should be provided.") + + vca_record = N2VCJujuConnector._get_vca_record( + "vdu_id", vca_records, vdu_id + ) - # Verify the config is set - new_conf = await application.get_config() - for key in config: - value = new_conf[key]['value'] - self.debug(' {} = {}'.format(key, value)) - if config[key] != value: - raise N2VCException( - message='key {} is not configured correctly {} != {}'.format(key, config[key], new_conf[key]) + if not vca_record: + vca_record = N2VCJujuConnector._get_vca_record( + "kdu_name", vca_records, vdu_id ) - # check if 'verify-ssh-credentials' action exists - unit = application.units[0] - actions = await application.get_actions() - if 'verify-ssh-credentials' not in actions: - msg = 'Action verify-ssh-credentials does not exist in application {}'.format(application_name) - return False - - # execute verify-credentials - num_retries = 20 - retry_timeout = 15.0 - for i in range(num_retries): - try: - self.debug('Executing action verify-ssh-credentials...') - output, ok = await self._juju_execute_action( - model_name=model_name, - application_name=application_name, - action_name='verify-ssh-credentials', - db_dict=db_dict, - progress_timeout=progress_timeout, - total_timeout=total_timeout - ) - self.debug('Result: {}, output: {}'.format(ok, output)) - return True - except Exception as e: - self.debug('Error executing verify-ssh-credentials: {}. Retrying...'.format(e)) - await asyncio.sleep(retry_timeout) - else: - self.error('Error executing verify-ssh-credentials after {} retries. '.format(num_retries)) - return False - - async def _juju_get_application( - self, - model_name: str, - application_name: str - ): - """Get the deployed application.""" + application_name = ( + vca_record["ee_descriptor_id"][:12] + + "-" + + vnf_count + + "-" + + vnfrs["member-vnf-index-ref"][:12] + + "-" + + vdu_id[:12] + + "-" + + vdu_count + + "-vdu" + ) - model = await self._juju_get_model(model_name=model_name) + return application_name - application_name = N2VCJujuConnector._format_app_name(application_name) + def _get_vnf_count_and_record( + self, charm_level: str, vnf_id_and_count: str + ) -> Tuple[str, dict]: + """Get the vnf count and VNF record depend on charm level - if model.applications and application_name in model.applications: - return model.applications[application_name] - else: - raise N2VCException(message='Cannot get application {} from model {}'.format(application_name, model_name)) + Args: + charm_level (str) + vnf_id_and_count (str) - async def _juju_get_model(self, model_name: str) -> Model: - """ Get a model object from juju controller + Returns: + (vnf_count (str), db_vnfr(dict)) as Tuple - :param str model_name: name of the model - :returns Model: model obtained from juju controller or Exception """ + vnf_count = "" + db_vnfr = {} - # format model name - model_name = N2VCJujuConnector._format_model_name(model_name) + if charm_level in ("vnf-level", "vdu-level"): + vnf_id = "-".join(vnf_id_and_count.split("-")[:-1]) + vnf_count = vnf_id_and_count.split("-")[-1] + db_vnfr = self.db.get_one("vnfrs", {"_id": vnf_id}) - if model_name in self.juju_models: - return self.juju_models[model_name] + # If the charm is ns level, it returns empty vnf_count and db_vnfr + return vnf_count, db_vnfr - if self._creating_model: - self.debug('Another coroutine is creating a model. Wait...') - while self._creating_model: - # another coroutine is creating a model, wait - await asyncio.sleep(0.1) - # retry (perhaps another coroutine has created the model meanwhile) - if model_name in self.juju_models: - return self.juju_models[model_name] + @staticmethod + def _get_vca_records(charm_level: str, db_nsr: dict, db_vnfr: dict) -> list: + """Get the VCA records from db_nsr dict - try: - self._creating_model = True + Args: + charm_level (str): level of charm + db_nsr (dict): NS record from database + db_vnfr (dict): VNF record from database - # get juju model names from juju - model_list = await self.controller.list_models() + Returns: + vca_records (list): List of VCA record dictionaries - if model_name not in model_list: - self.info('Model {} does not exist. Creating new model...'.format(model_name)) - model = await self.controller.add_model( - model_name=model_name, - config={'authorized-keys': self.public_key} + """ + vca_records = {} + if charm_level == "ns-level": + vca_records = list( + filter( + lambda vca_record: vca_record["target_element"] == "ns", + db_nsr["_admin"]["deployed"]["VCA"], ) - self.info('New model created, name={}'.format(model_name)) - else: - self.debug('Model already exists in juju. Getting model {}'.format(model_name)) - model = await self.controller.get_model(model_name) - self.debug('Existing model in juju, name={}'.format(model_name)) - - self.juju_models[model_name] = model - self.juju_observers[model_name] = JujuModelObserver(n2vc=self, model=model) - return model - - except Exception as e: - msg = 'Cannot get model {}. Exception: {}'.format(model_name, e) - self.error(msg) - raise N2VCException(msg) - finally: - self._creating_model = False - - async def _juju_add_relation( - self, - model_name: str, - application_name_1: str, - application_name_2: str, - relation_1: str, - relation_2: str - ): - - self.debug('adding relation') - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - - r1 = '{}:{}'.format(application_name_1, relation_1) - r2 = '{}:{}'.format(application_name_2, relation_2) - await model.add_relation(relation1=r1, relation2=r2) - - async def _juju_destroy_application( - self, - model_name: str, - application_name: str - ): - - self.debug('Destroying application {} in model {}'.format(application_name, model_name)) - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - - application = model.applications.get(application_name) - if application: - await application.destroy() - else: - self.debug('Application not found: {}'.format(application_name)) - - async def _juju_destroy_machine( - self, - model_name: str, - machine_id: str, - total_timeout: float = None - ): - - self.debug('Destroying machine {} in model {}'.format(machine_id, model_name)) - - if total_timeout is None: - total_timeout = 3600 - - # get juju model and observer - model = await self._juju_get_model(model_name=model_name) - - machines = await model.get_machines() - if machine_id in machines: - machine = model.machines[machine_id] - await machine.destroy(force=True) - # max timeout - end = time.time() + total_timeout - # wait for machine removal - machines = await model.get_machines() - while machine_id in machines and time.time() < end: - self.debug('Waiting for machine {} is destroyed'.format(machine_id)) - await asyncio.sleep(0.5) - machines = await model.get_machines() - self.debug('Machine destroyed: {}'.format(machine_id)) - else: - self.debug('Machine not found: {}'.format(machine_id)) - - async def _juju_destroy_model( - self, - model_name: str, - total_timeout: float = None - ): - - self.debug('Destroying model {}'.format(model_name)) + ) + elif charm_level in ["vnf-level", "vdu-level"]: + vca_records = list( + filter( + lambda vca_record: vca_record["member-vnf-index"] + == db_vnfr["member-vnf-index-ref"], + db_nsr["_admin"]["deployed"]["VCA"], + ) + ) - if total_timeout is None: - total_timeout = 3600 + return vca_records - model = await self._juju_get_model(model_name=model_name) - uuid = model.info.uuid + def _get_application_name(self, namespace: str) -> str: + """Build application name from namespace - self.debug('disconnecting model {}...'.format(model_name)) - await self._juju_disconnect_model(model_name=model_name) - self.juju_models[model_name] = None - self.juju_observers[model_name] = None + Application name structure: + NS level: -ns + VNF level: -z--vnf + VDU level: -z-- + -z-vdu - self.debug('destroying model {}...'.format(model_name)) - await self.controller.destroy_model(uuid) + Application naming for backward compatibility (old structure): + NS level: app- + VNF level: app-vnf--z- + VDU level: app-vnf--z-vdu- + -cnt--z- - # wait for model is completely destroyed - end = time.time() + total_timeout - while time.time() < end: - self.debug('waiting for model is destroyed...') - try: - await self.controller.get_model(uuid) - except Exception: - self.debug('model destroyed') - return - await asyncio.sleep(1.0) + Args: + namespace (str) - async def _juju_login(self): - """Connect to juju controller + Returns: + application_name (str) """ - - # if already authenticated, exit function - if self._authenticated: - return - - # if connecting, wait for finish - # another task could be trying to connect in parallel - while self._connecting: - await asyncio.sleep(0.1) - - # double check after other task has finished - if self._authenticated: - return - - try: - self._connecting = True - self.info( - 'connecting to juju controller: {} {}:{} ca_cert: {}' - .format(self.url, self.username, self.secret, '\n'+self.ca_cert if self.ca_cert else 'None')) - - # Create controller object - self.controller = Controller(loop=self.loop) - # Connect to controller - await self.controller.connect( - endpoint=self.url, - username=self.username, - password=self.secret, - cacert=self.ca_cert + # split namespace components + ( + nsi_id, + ns_id, + vnf_id_and_count, + vdu_id, + vdu_count, + ) = self._get_namespace_components(namespace=namespace) + + if not ns_id: + raise N2VCException(message="ns-id should be provided.") + + charm_level = self._find_charm_level(vnf_id_and_count, vdu_id) + db_nsr = self.db.get_one("nsrs", {"_id": ns_id}) + vnf_count, db_vnfr = self._get_vnf_count_and_record( + charm_level, vnf_id_and_count + ) + vca_records = self._get_vca_records(charm_level, db_nsr, db_vnfr) + + if all("charm_name" in vca_record.keys() for vca_record in vca_records): + application_name = self._generate_application_name( + charm_level, + db_vnfr, + vca_records, + vnf_count=vnf_count, + vdu_id=vdu_id, + vdu_count=vdu_count, ) - self._authenticated = True - self.info('juju controller connected') - except Exception as e: - message = 'Exception connecting to juju: {}'.format(e) - self.error(message) - raise N2VCConnectionException( - message=message, - url=self.url + else: + application_name = self._generate_backward_compatible_application_name( + vnf_id_and_count, vdu_id, vdu_count ) - finally: - self._connecting = False - - async def _juju_logout(self): - """Logout of the Juju controller.""" - if not self._authenticated: - return False - # disconnect all models - for model_name in self.juju_models: - try: - await self._juju_disconnect_model(model_name) - except Exception as e: - self.error('Error disconnecting model {} : {}'.format(model_name, e)) - # continue with next model... - - self.info("Disconnecting controller") - try: - await self.controller.disconnect() - except Exception as e: - raise N2VCConnectionException(message='Error disconnecting controller: {}'.format(e), url=self.url) - - self.controller = None - self._authenticated = False - self.info('disconnected') - - async def _juju_disconnect_model( - self, - model_name: str - ): - self.debug("Disconnecting model {}".format(model_name)) - if model_name in self.juju_models: - await self.juju_models[model_name].disconnect() - self.juju_models[model_name] = None - self.juju_observers[model_name] = None - - def _create_juju_public_key(self): - """Recreate the Juju public key on lcm container, if needed - Certain libjuju commands expect to be run from the same machine as Juju - is bootstrapped to. This method will write the public key to disk in - that location: ~/.local/share/juju/ssh/juju_id_rsa.pub - """ - - # Make sure that we have a public key before writing to disk - if self.public_key is None or len(self.public_key) == 0: - if 'OSMLCM_VCA_PUBKEY' in os.environ: - self.public_key = os.getenv('OSMLCM_VCA_PUBKEY', '') - if len(self.public_key) == 0: - return - else: - return - - pk_path = "{}/.local/share/juju/ssh".format(os.path.expanduser('~')) - file_path = "{}/juju_id_rsa.pub".format(pk_path) - self.debug('writing juju public key to file:\n{}\npublic key: {}'.format(file_path, self.public_key)) - if not os.path.exists(pk_path): - # create path and write file - os.makedirs(pk_path) - with open(file_path, 'w') as f: - self.debug('Creating juju public key file: {}'.format(file_path)) - f.write(self.public_key) - else: - self.debug('juju public key file already exists: {}'.format(file_path)) + return N2VCJujuConnector._format_app_name(application_name) @staticmethod def _format_model_name(name: str) -> str: @@ -1290,7 +1517,7 @@ class N2VCJujuConnector(N2VCConnector): Model names may only contain lowercase letters, digits and hyphens """ - return name.replace('_', '-').replace(' ', '-').lower() + return name.replace("_", "-").replace(" ", "-").lower() @staticmethod def _format_app_name(name: str) -> str: @@ -1311,24 +1538,35 @@ class N2VCJujuConnector(N2VCConnector): return False return True - new_name = name.replace('_', '-') - new_name = new_name.replace(' ', '-') + new_name = name.replace("_", "-") + new_name = new_name.replace(" ", "-") new_name = new_name.lower() - while new_name.find('--') >= 0: - new_name = new_name.replace('--', '-') - groups = new_name.split('-') + while new_name.find("--") >= 0: + new_name = new_name.replace("--", "-") + groups = new_name.split("-") # find 'all numbers' groups and prefix them with a letter - app_name = '' + app_name = "" for i in range(len(groups)): group = groups[i] if all_numbers(group): - group = 'z' + group + group = "z" + group if i > 0: - app_name += '-' + app_name += "-" app_name += group if app_name[0].isdigit(): - app_name = 'z' + app_name + app_name = "z" + app_name return app_name + + async def validate_vca(self, vca_id: str): + """ + Validate a VCA by connecting/disconnecting to/from it + + :param: vca_id: VCA ID + """ + vca_connection = await get_connection(self._store, vca_id=vca_id) + libjuju = Libjuju(vca_connection, loop=self.loop, log=self.log, n2vc=self) + controller = await libjuju.get_controller() + await libjuju.disconnect_controller(controller)