+/*
+ *
+ * Copyright 2016 RIFT.IO Inc
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ */
+
+var request = require('request');
+var Promise = require('bluebird');
+var rp = require('request-promise');
+var utils = require('../../../framework/core/api_utils/utils.js');
+var constants = require('../../../framework/core/api_utils/constants.js');
+var APIVersion = '/v1';
+var _ = require('underscore');
+var epa_aggregator = require('./epa_aggregator.js');
+var transforms = require('./transforms.js');
+var uuid = require('node-uuid');
+
+// Revealing module pattern objects
+var Catalog = {};
+var Config = {};
+var NSR = {};
+var VNFR = {};
+var VLR = {};
+var RIFT = {};
+var ComputeTopology = {};
+var NetworkTopology = {};
+var VDUR = {};
+var CloudAccount = {};
+var ConfigAgentAccount = {};
+var RPC = {};
+var SSHkey = {};
+// API Configuration Info
+var APIConfig = {}
+APIConfig.NfviMetrics = ['vcpu', 'memory'];
+
+RPC.executeNSServicePrimitive = function(req) {
+ var api_server = req.query['api_server'];
+ return new Promise(function(resolve, reject) {
+ var jsonData = {
+ "input": req.body
+ };
+
+ var headers = _.extend({},
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/operations/exec-ns-service-primitive',
+ method: 'POST',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('RPC.executeNSServicePrimitive', error, response, body, resolve, reject)) {
+ return resolve({
+ statusCode: response.statusCode,
+ data: JSON.stringify(response.body)
+ });
+ }
+ })
+ });
+};
+
+RPC.getNSServicePrimitiveValues = function(req) {
+ var api_server = req.query['api_server'];
+ // var nsr_id = req.body['nsr_id_ref'];
+ // var nsConfigPrimitiveName = req.body['name'];
+ return new Promise(function(resolve, reject) {
+ var jsonData = {
+ "input": req.body
+ };
+
+ var headers = _.extend({},
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operations/get-ns-service-primitive-values',
+ method: 'POST',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('RPC.getNSServicePrimitiveValues', error, response, body, resolve, reject)) {
+
+ resolve({
+ statusCode: response.statusCode,
+ data: JSON.parse(body)
+ });
+ }
+ });
+ }).catch(function(error) {
+ console.log('error getting primitive values');
+ });
+};
+RPC.refreshAccountConnectionStatus = function(req) {
+ var api_server = req.query['api_server'];
+ var Name = req.params.name;
+ var Type = req.params.type;
+ var jsonData = {
+ input: {}
+ };
+ var rpcInfo = {
+ sdn: {
+ label: 'sdn-account',
+ rpc: 'update-sdn-status'
+ },
+ config: {
+ label: 'cfg-agent-account',
+ rpc: 'update-cfg-agent-status'
+ },
+ cloud: {
+ label: 'cloud-account',
+ rpc: 'update-cloud-status'
+ }
+ }
+ jsonData.input[rpcInfo[Type].label] = Name;
+ var headers = _.extend({},
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+ return new Promise(function(resolve, reject) {
+
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operations/' + rpcInfo[Type].rpc,
+ method: 'POST',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('RPC.refreshAccountConnectionStatus', error, response, body, resolve, reject)) {
+
+ resolve({
+ statusCode: response.statusCode,
+ data: body
+ });
+ }
+ });
+ }).catch(function(error) {
+ console.log('Error refreshing account info');
+ });
+};
+
+
+var DataCenters = {};
+// Catalog module methods
+Catalog.get = function(req) {
+ var api_server = req.query['api_server'];
+ var results = {}
+ return new Promise(function(resolve, reject) {
+ Promise.all([
+ rp({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ resolveWithFullResponse: true
+ }),
+ rp({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ resolveWithFullResponse: true
+ }),
+ rp({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ resolveWithFullResponse: true
+ })
+ // Not enabled for now
+ // rp({
+ // uri: utils.confdPort(api_server) + APIVersion + '/api/config/pnfd-catalog/pnfd?deep',
+ // method: 'GET',
+ // headers: _.extend({},
+ // constants.HTTP_HEADERS.accept.collection,
+ // {
+ // 'Authorization': req.get('Authorization')
+ // }),
+ // forever: constants.FOREVER_ON,
+ // rejectUnauthorized: false,
+ // resolveWithFullResponse: true
+ // })
+ ]).then(function(result) {
+ console.log('Resolved all request promises (NSD, VNFD) successfully');
+ var response = [{
+ "id": "GUID-1",
+ "name": "RIFT.ware™ NS Descriptors Catalog",
+ "short-name": "rift.ware-nsd-cat",
+ "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
+ "vendor": "RIFT.io",
+ "version": "",
+ "created-on": "",
+ "type": "nsd",
+ "meta": {
+ "icon-svg": "data:image/svg+xml,%3C%3Fxml%20version%3D%221.0%22%20encoding%3D%22iso-8859-1%22%3F%3E%0A%3C!--%20Generator%3A%20Adobe%20Illustrator%2018.0.0%2C%20SVG%20Export%20Plug-In%20.%20SVG%20Version%3A%206.00%20Build%200)%20%20--%3E%0A%3C!DOCTYPE%20svg%20PUBLIC%20%22-%2F%2FW3C%2F%2FDTD%20SVG%201.1%2F%2FEN%22%20%22http%3A%2F%2Fwww.w3.org%2FGraphics%2FSVG%2F1.1%2FDTD%2Fsvg11.dtd%22%3E%0A%3Csvg%20version%3D%221.1%22%20id%3D%22connection-icon-1%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20xmlns%3Axlink%3D%22http%3A%2F%2Fwww.w3.org%2F1999%2Fxlink%22%20x%3D%220px%22%20y%3D%220px%22%0A%09%20viewBox%3D%220%200%2050%2050%22%20style%3D%22enable-background%3Anew%200%200%2050%2050%3B%22%20xml%3Aspace%3D%22preserve%22%3E%0A%09%3Cpath%20d%3D%22M15%2030c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2020c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2040c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M19.007%2025.885l12.88%206.44-.895%201.788-12.88-6.44z%22%2F%3E%3Cpath%20d%3D%22M30.993%2015.885l.894%201.79-12.88%206.438-.894-1.79z%22%2F%3E%3C%2Fsvg%3E"
+ },
+ "descriptors": []
+ }, {
+ "id": "GUID-2",
+ "name": "RIFT.ware™ VNF Descriptors Catalog",
+ "short-name": "rift.ware-vnfd-cat",
+ "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
+ "vendor": "RIFT.io",
+ "version": "",
+ "created-on": "",
+ "type": "vnfd",
+ "meta": {
+ "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_3\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <g> <path d=\"M58.852,62.447l-4.662-1.033c-0.047-3.138-0.719-6.168-1.996-9.007l3.606-2.92c0.858-0.695,0.99-1.954,0.296-2.813 l-4.521-5.584c-0.334-0.413-0.818-0.675-1.346-0.731c-0.525-0.057-1.056,0.102-1.468,0.435L45.25,43.64v0 c-2.486-1.907-5.277-3.259-8.297-4.019v-4.458c0-1.104-0.896-2-2-2H27.77c-1.104,0-2,0.896-2,2v4.461 c-3.08,0.777-5.922,2.171-8.447,4.144l-3.545-2.82c-0.415-0.33-0.94-0.479-1.472-0.422c-0.527,0.06-1.009,0.327-1.339,0.743 l-4.472,5.623c-0.688,0.864-0.544,2.123,0.32,2.81l3.642,2.896v0c-1.25,2.848-1.895,5.88-1.916,9.011l-4.666,1.078 c-1.076,0.249-1.747,1.322-1.499,2.398l1.616,7.001c0.249,1.077,1.325,1.747,2.399,1.499l4.813-1.111v0 c1.429,2.681,3.344,5.017,5.691,6.943l-2.17,4.55c-0.476,0.997-0.054,2.19,0.943,2.666l6.484,3.094 c0.271,0.129,0.566,0.195,0.861,0.195c0.226,0,0.451-0.038,0.668-0.115c0.5-0.177,0.909-0.545,1.138-1.024l2.198-4.611 c2.923,0.563,5.966,0.554,8.879-0.033l2.236,4.585c0.484,0.994,1.685,1.403,2.675,0.921l6.456-3.148 c0.992-0.484,1.405-1.682,0.921-2.674l-2.206-4.524c2.335-1.946,4.231-4.301,5.639-6.999l4.812,1.067 c1.076,0.237,2.146-0.441,2.385-1.52l1.556-7.014c0.115-0.518,0.02-1.06-0.266-1.508C59.82,62.878,59.369,62.562,58.852,62.447z M40.18,61.761c0,4.859-3.953,8.812-8.813,8.812c-4.858,0-8.811-3.953-8.811-8.812s3.952-8.812,8.811-8.812 C36.227,52.949,40.18,56.902,40.18,61.761z\"/> <path d=\"M64.268,45.324c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.826,0.353,3.736,0.345,5.551-0.021l1.07,2.195 c0.484,0.992,1.682,1.405,2.675,0.921l2.691-1.313c0.477-0.233,0.842-0.646,1.015-1.147c0.172-0.501,0.139-1.051-0.095-1.528 l-1.052-2.155c1.458-1.214,2.645-2.686,3.527-4.377l2.278,0.504c1.075,0.238,2.146-0.442,2.386-1.52l0.647-2.923 c0.238-1.078-0.442-2.146-1.521-2.385l-2.184-0.484c-0.028-1.962-0.449-3.857-1.248-5.632l1.673-1.355 c0.412-0.334,0.675-0.818,0.73-1.345s-0.102-1.056-0.436-1.468l-1.884-2.327c-0.697-0.859-1.957-0.99-2.813-0.295l-1.614,1.307 c-1.554-1.193-3.299-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.04 c-1.927,0.486-3.703,1.358-5.28,2.592l-1.634-1.298c-0.862-0.687-2.12-0.543-2.81,0.32l-1.864,2.344 c-0.33,0.416-0.481,0.945-0.422,1.472c0.061,0.527,0.327,1.009,0.743,1.339l1.69,1.345c-0.78,1.779-1.184,3.676-1.197,5.636 l-2.189,0.505c-0.517,0.119-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51l0.675,2.918 c0.249,1.076,1.323,1.747,2.398,1.498l2.28-0.527c0.892,1.676,2.089,3.137,3.559,4.343l-1.035,2.17 c-0.228,0.479-0.257,1.028-0.08,1.528c0.178,0.5,0.546,0.91,1.024,1.138l2.703,1.289C63.686,45.261,63.979,45.324,64.268,45.324z M64.334,27.961c0-3.039,2.473-5.51,5.512-5.51c3.038,0,5.51,2.472,5.51,5.51c0,3.039-2.472,5.511-5.51,5.511 C66.807,33.472,64.334,31,64.334,27.961z\"/> <path d=\"M96.107,66.441l-2.182-0.484c-0.028-1.961-0.449-3.856-1.25-5.632l1.675-1.355c0.412-0.334,0.675-0.818,0.73-1.346 c0.056-0.527-0.102-1.056-0.436-1.468l-1.885-2.327c-0.695-0.859-1.956-0.99-2.813-0.295l-1.614,1.307 c-1.555-1.193-3.3-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.041 c-1.929,0.486-3.706,1.358-5.282,2.592l-0.001,0l-1.631-1.298c-0.415-0.331-0.938-0.482-1.472-0.422 c-0.527,0.06-1.009,0.327-1.339,0.742l-1.863,2.343c-0.688,0.865-0.544,2.123,0.32,2.811l1.691,1.345 c-0.782,1.784-1.186,3.68-1.199,5.636l-2.188,0.505c-0.517,0.12-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51 l0.675,2.918c0.249,1.076,1.327,1.744,2.397,1.498l2.281-0.526c0.893,1.677,2.09,3.138,3.558,4.343h0.001l-1.035,2.168 c-0.229,0.479-0.258,1.029-0.081,1.529c0.178,0.5,0.546,0.909,1.024,1.138l2.702,1.289c0.278,0.132,0.571,0.195,0.86,0.195 c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.828,0.353,3.739,0.347,5.552-0.021l1.071,2.194 c0.484,0.992,1.682,1.405,2.675,0.921l2.69-1.312c0.477-0.233,0.842-0.645,1.014-1.147c0.173-0.501,0.14-1.051-0.093-1.528 l-1.052-2.155c1.459-1.215,2.645-2.688,3.525-4.377l2.278,0.505c0.52,0.116,1.061,0.02,1.508-0.266 c0.447-0.285,0.763-0.736,0.878-1.254l0.647-2.923C97.866,67.748,97.186,66.681,96.107,66.441z M85.162,66.174 c0,3.039-2.471,5.511-5.508,5.511c-3.039,0-5.512-2.472-5.512-5.511c0-3.039,2.473-5.511,5.512-5.511 C82.691,60.664,85.162,63.136,85.162,66.174z\"/> </g> </svg> "
+ },
+ "descriptors": []
+ }, {
+ "id": "GUID-3",
+ "name": "RIFT.ware™ PNF Descriptors Catalog",
+ "short-name": "rift.ware-pnfd-cat",
+ "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.",
+ "vendor": "RIFT.io",
+ "version": "",
+ "created-on": "",
+ "type": "pnfd",
+ "meta": {
+ "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_4\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <path d=\"M86.334,47.444V35.759H13.666v11.686h3.561v5.111h-3.561v11.686h72.668V52.556h-4.108v-5.111H86.334z M26.628,59.454h-5.051 v-4.941h5.051V59.454z M26.628,52.404h-5.051v-4.941h5.051V52.404z M26.628,45.486h-5.051v-4.941h5.051V45.486z M34.094,59.454 h-5.051v-4.941h5.051V59.454z M34.094,52.404h-5.051v-4.941h5.051V52.404z M34.094,45.486h-5.051v-4.941h5.051V45.486z M41.452,59.454h-5.051v-4.941h5.051V59.454z M41.452,52.404h-5.051v-4.941h5.051V52.404z M41.452,45.486h-5.051v-4.941h5.051 V45.486z M48.733,59.454h-5.051v-4.941h5.051V59.454z M48.733,52.404h-5.051v-4.941h5.051V52.404z M48.733,45.486h-5.051v-4.941 h5.051V45.486z M56.2,59.454h-5.051v-4.941H56.2V59.454z M56.2,52.404h-5.051v-4.941H56.2V52.404z M56.2,45.486h-5.051v-4.941H56.2 V45.486z M63.558,59.454h-5.05v-4.941h5.05V59.454z M63.558,52.404h-5.05v-4.941h5.05V52.404z M63.558,45.486h-5.05v-4.941h5.05 V45.486z M74.858,59.312h-6.521v-3.013h6.521V59.312z M71.572,50.854c-2.875,0-5.204-2.33-5.204-5.203s2.329-5.203,5.204-5.203 s5.204,2.33,5.204,5.203S74.446,50.854,71.572,50.854z M74.858,45.618c0,1.801-1.46,3.261-3.261,3.261 c-1.8,0-3.261-1.46-3.261-3.261s1.46-3.26,3.261-3.26C73.398,42.358,74.858,43.817,74.858,45.618z\"/> </svg>"
+ },
+ "descriptors": []
+ }];
+ var vnfdCatalog = null;
+ var vnfdDict = {};
+ if (result[1].body) {
+ vnfdCatalog = JSON.parse(result[1].body).collection['vnfd:vnfd'].map(function(v, i) {
+ vnfdDict[v.id] = v['short-name'] || v.name;
+ })
+ }
+ if (result[0].body) {
+ response[0].descriptors = JSON.parse(result[0].body).collection['nsd:nsd'];
+ if (result[2].body) {
+ var data = JSON.parse(result[2].body);
+ if (data && data["nsr:ns-instance-opdata"] && data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]) {
+ var nsdRefCountCollection = data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"];
+ response[0].descriptors.map(function(nsd) {
+ if (!nsd["meta"]) {
+ nsd["meta"] = {};
+ }
+ if (typeof nsd['meta'] == 'string') {
+ nsd['meta'] = JSON.parse(nsd['meta']);
+ }
+ nsd["meta"]["instance-ref-count"] = _.findWhere(nsdRefCountCollection, {
+ "nsd-id-ref": nsd.id
+ })["instance-ref-count"];
+ nsd["constituent-vnfd"] && nsd["constituent-vnfd"].map(function(v) {
+ v.name = vnfdDict[v["vnfd-id-ref"]];
+ })
+ });
+ }
+ }
+ };
+ if (result[1].body) {
+ response[1].descriptors = JSON.parse(result[1].body).collection['vnfd:vnfd'];
+ };
+ // if (result[2].body) {
+ // response[2].descriptors = JSON.parse(result[2].body).collection['pnfd:pnfd'];
+ // };
+ resolve({
+ statusCode: response.statusCode || 200,
+ data: JSON.stringify(response)
+ });
+ }).catch(function(error) {
+ // Todo: Need better logic than all or nothing.
+ // Right now even if one of the southbound APIs fails - all fail
+ var res = {};
+ console.log('Problem with Catalog.get', error);
+ res.statusCode = error.statusCode || 500;
+ res.errorMessage = {
+ error: 'Failed to get catalogs' + error
+ };
+ reject(res);
+ });
+ });
+};
+Catalog.delete = function(req) {
+ var api_server = req.query['api_server'];
+ var catalogType = req.params.catalogType;
+ var id = req.params.id;
+ console.log('Deleting', catalogType, id, 'from', api_server);
+ return new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog/' + catalogType + '/' + id,
+ method: 'DELETE',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('Catalog.delete', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+Catalog.getVNFD = function(req) {
+ var api_server = req.query['api_server'];
+ var vnfdID = req.body.data;
+ var authorization = req.get('Authorization');
+ var VNFDs = [];
+ if (typeof(vnfdID) == "object" && vnfdID.constructor.name == "Array") {
+ vnfdID.map(function(id) {
+ VNFDs.push(requestVNFD(id));
+ });
+ } else {
+ VNFDs.push(requestVNFD(vnfdID));
+ }
+ return new Promise(function(resolve, reject) {
+ Promise.all(VNFDs).then(function(data) {
+ resolve(data)
+ }).catch(function(error) {
+ // Todo: Need better logic than all or nothing.
+ // Right now even if one of the southbound APIs fails - all fail
+ var res = {};
+ console.log('Problem with Catalog.getVNFD', error);
+ res.statusCode = 404;
+ res.errorMessage = {
+ error: 'Failed to get VNFDs' + error
+ };
+ reject(res);
+ });
+ });
+
+ function requestVNFD(id) {
+ return new Promise(function(resolve, reject) {
+ var url = utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd' + (id ? '/' + id : '') + '?deep';
+ request({
+ uri: url,
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': authorization
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('Catalog.getVNFD', error, response, body, resolve, reject)) {
+ var data;
+ //Is this still needed?
+ try {
+ data = JSON.parse(response.body)
+ } catch (e) {
+ reject({
+ statusCode: response ? response.statusCode : 400,
+ errorMessage: 'Issue parsing VNFD ' + id + 'from ' + utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd/' + id + '?deep'
+ });
+ }
+ resolve(data);
+ }
+ });
+ });
+ }
+};
+Catalog.create = function(req) {
+ var api_server = req.query['api_server'];
+ var catalogType = req.params.catalogType;
+ var data = req.body;
+ console.log('Creating', catalogType, 'on', api_server);
+ var jsonData = {};
+ jsonData[catalogType] = [];
+ jsonData[catalogType].push(data);
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog',
+ method: 'POST',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('Catalog.create', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+Catalog.update = function(req) {
+ var api_server = req.query['api_server'];
+ var catalogType = req.params.catalogType;
+ var id = req.params.id;
+ var data = req.body;
+ console.log('Updating', catalogType, 'id', id, 'on', api_server);
+ var jsonData = {};
+ jsonData[catalogType] = {};
+ jsonData[catalogType] = data;
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog' + '/' + catalogType + '/' + id,
+ method: 'PUT',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('Catalog.update', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+
+Catalog.decorateNsdCatalogWithPlacementGroups = function decorateNsdCatalogWithPlacementGroups(catalog) {
+ var newData = catalog;
+ var parsedCatalog = JSON.parse(catalog.data);
+ var nsds = parsedCatalog[0].descriptors;
+ var vnfds = parsedCatalog[1].descriptors;
+ var vnfdDict = (function(){
+ var dict = {};
+ vnfds.map(function(v, i) {
+ dict[v.id] = v;
+ })
+ return dict;
+ })(vnfds);
+
+ nsds.map(function(c, i) {
+ //Rename and decorate NSD placement groups
+ c['ns-placement-groups'] = c['placement-groups'] && c['placement-groups'].map(function(p, i) {
+ //Adds vnfd name to member-vnfd entry
+ p['member-vnfd'] = p['member-vnfd'].map(function(v) {
+ v.name = vnfdDict[v['vnfd-id-ref']].name;
+ return v;
+ });
+ p['host-aggregate'] = [];
+ return p;
+ });
+
+ //Adds vnf placement groups to nsd object for UI
+ c['vnf-placement-groups'] = [];
+ c['constituent-vnfd'] && c['constituent-vnfd'].map(function(v) {
+ var vnf = vnfdDict[v['vnfd-id-ref']];
+ // var vnfPg = {
+ // name: vnf.name,
+ // 'placement-groups': vnf['placement-groups'].map(function(vp){
+ // vp['host-aggregate'] = [{}];
+ // return vp;
+ // })
+ // };
+ v['vnf-name'] = vnf.name;
+ vnf['placement-groups'] && vnf['placement-groups'].map(function(vp) {
+ vp['host-aggregate'] = [];
+ vp['vnf-name'] = vnf.name;
+ vp['vnfd-id-ref'] = v['vnfd-id-ref'];
+ vp['member-vnf-index'] = v['member-vnf-index'];
+ c['vnf-placement-groups'].push(vp);
+ })
+ })
+ return c;
+ })
+ // parsedCatalog[0].descriptors = nsds;
+ newData.data = JSON.stringify(parsedCatalog);
+ return newData;
+}
+
+// NSR module methods
+// Spend some time refactoring this
+// refactor to accept only request object
+NSR.get = function(req) {
+ var self = this;
+ var nsrPromises = [];
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+ var nsdInfo = new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.get nsd-catalog', error, response, body, resolve, reject)) {
+ var data;
+ var isString = typeof(response.body) == "string";
+ if (isString && response.body == '') return resolve('empty');
+ data = isString ? JSON.parse(response.body) : response.body;
+ var nsdData = data.collection["nsd:nsd"];
+ if (nsdData.constructor.name == "Object") {
+ nsdData = [nsdData];
+ }
+ resolve(nsdData);
+ };
+ })
+ })
+ var config = new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-config/nsr' + (id ? '/' + id : '') + '?deep',
+ method: 'GET',
+ headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.get ns-instance-config', error, response, body, resolve, reject)) {
+ var data;
+ var isString = typeof(response.body) == "string";
+ if (isString && response.body == '') return resolve();
+ data = isString ? JSON.parse(response.body) : response.body;
+ data = id ? data : data.collection;
+ var nsrData = data["nsr:nsr"];
+ if (nsrData.constructor.name == "Object") {
+ nsrData = [nsrData];
+ }
+ resolve(nsrData);
+ };
+ });
+ });
+ var opData = new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr' + (id ? '/' + id : '') + '?deep',
+ method: 'GET',
+ headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.get ns-instance-opdata', error, response, body, resolve, reject)) {
+ var data;
+ var isString = typeof(response.body) == "string";
+ if (isString && response.body == '') return resolve();
+ data = isString ? JSON.parse(response.body) : response.body;
+ data = id ? data : data.collection;
+ var nsrData = data["nsr:nsr"];
+ if (nsrData.constructor.name == "Object") {
+ nsrData = [nsrData];
+ }
+ nsrData.forEach(self.decorateWithScalingGroupDict);
+ nsrData.forEach(self.decorateAndTransformNFVI);
+ nsrData.forEach(self.decorateAndTransformWithControls);
+ Promise.all(self.addVnfrDataPromise(req, nsrData)).then(function() {
+ Promise.all(self.addVlrDataPromise(req, nsrData)).then(function() {
+ resolve(nsrData);
+ });
+ });
+ };
+ });
+ }).catch(function(error) {
+ console.log('error getting aggregated NS opdata', error)
+ //note this will actually trigger the success callback
+ });
+ return new Promise(function(resolve, reject) {
+ //Need smarter error handling here
+ Promise.all([config, opData]).then(function(resolves) {
+ var aggregate = {};
+ // resolves[0] ==> ns-instance-config
+ // resolves[1] ==> ns-instance-opdata
+
+ var nsInstanceConfig = resolves[0] && resolves[0];
+ var nsInstanceOpdata = resolves[1] && resolves[1];
+
+ if (!nsInstanceConfig && !nsInstanceOpdata) {
+ return resolve({
+ nsrs: []
+ });
+ }
+
+ nsInstanceConfig.forEach(function(v, k) {
+ v.nsd_name = v['nsd'] && v['nsd']['name'];
+ var scaling_group_descriptor = null;
+
+ scaling_group_descriptor = v['nsd'] && v['nsd']['scaling-group-descriptor'];
+
+ if (scaling_group_descriptor) {
+ scaling_group_descriptor.map(function(sgd, sgdi) {
+ sgd['vnfd-member'] && sgd['vnfd-member'].map(function(vnfd, vnfdi) {
+ var vnfrObj = _.findWhere(_.findWhere(nsInstanceOpdata, {
+ 'ns-instance-config-ref': v.id
+ }).vnfrs, {
+ 'member-vnf-index-ref': vnfd['member-vnf-index-ref']
+ });
+ if (vnfrObj) {
+ vnfd['short-name'] = vnfrObj['short-name'];
+ }
+ })
+ })
+ v['scaling-group-descriptor'] = scaling_group_descriptor;
+ }
+
+ if (nsInstanceOpdata && nsInstanceOpdata.constructor.name == "Array") {
+ nsInstanceOpdata.forEach(function(w, l) {
+ if (v.id == w["ns-instance-config-ref"]) {
+ for (prop in w) {
+ if (prop != "ns-instance-config-ref" && !v.hasOwnProperty(prop)) {
+ v[prop] = w[prop];
+ }
+ }
+ }
+ });
+ }
+
+ v['scaling-group-record'] && v['scaling-group-record'].map(function(sgr) {
+ var scalingGroupName = sgr['scaling-group-name-ref'];
+ sgr['instance'] && sgr['instance'].map(function(instance) {
+ var scalingGroupInstanceId = instance['instance-id'];
+ instance['vnfrs'] && instance['vnfrs'].map(function(vnfr) {
+ var vnfrObj = _.findWhere(v['vnfrs'], {id: vnfr});
+ if (vnfrObj) {
+ vnfrObj['scaling-group-name'] = scalingGroupName;
+ vnfrObj['scaling-group-instance-id'] = scalingGroupInstanceId;
+ }
+ });
+ });
+ })
+ });
+ var nsrsData = nsInstanceConfig;
+ nsrsData.sort(function(a, b) {
+ return a["create-time"] - b["create-time"];
+ });
+ resolve({
+ nsrs: nsrsData
+ });
+ }).catch(function(error) {
+ reject({
+ statusCode: 404,
+ errorMessage: error
+ })
+ })
+ });
+};
+// Static VNFR Cache bu VNFR ID
+var staticVNFRCache = {};
+
+/**
+ * [decorateWithScalingGroupDict description]
+ * @param {[type]} nsr [description]
+ * @return {[type]}
+{vnfr-id} : {
+ "scaling-group-name-ref": "sg1",
+ "instance-id": 0,
+ "op-status": "running",
+ "is-default": "true",
+ "create-time": 1463593760,
+ "config-status": "configuring",
+ "vnfrs": [
+ "432154e3-164e-4c05-83ee-3b56e4c898e7"
+ ]
+}
+ */
+NSR.decorateWithScalingGroupDict = function(nsr) {
+ var sg = nsr["scaling-group-record"];
+ var dict = {};
+ if(sg) {
+ sg.map(function(s) {
+ var sgRef = s['scaling-group-name-ref'];
+ s.instance && s.instance.map(function(si) {
+ si.vnfrs && si.vnfrs.map(function(v) {
+ dict[v] = si;
+ dict[v]["scaling-group-name-ref"] = sgRef;
+ })
+ })
+ })
+ }
+ return nsr['vnfr-scaling-groups'] = dict;
+}
+
+
+NSR.addVlrDataPromise = function(req, nsrs) {
+ var api_server = req.query['api_server'];
+ var promises = [];
+ nsrs.map(function(nsr) {
+ var vlrPromises = [];
+ var vlr = nsr['vlr'];
+ nsr['decorated-vlrs'] = [];
+ if (!vlr) {
+ console.log('No VL\'s found in NS');
+ }
+ vlr && vlr.map(function(vlrObject) {
+ req.params.id = vlrObject['vlr-ref'];
+ var vlrPromise = VLR.get(req).then(function(vlr) {
+ try {
+ var vlrItem = vlr['data'][0];
+ decorateNSRWithVLR(nsr, vlrObject, vlrItem);
+ } catch (e) {
+ console.log('Expection caught getting VLRs and adding to NSR:', e);
+ }
+ })
+ vlrPromises.push(vlrPromise);
+ });
+ var NSR_Promise = new Promise(function(resolve, reject) {
+ Promise.all(vlrPromises).then(function() {
+ resolve();
+ })
+ });
+ promises.push(NSR_Promise);
+ });
+ return promises;
+
+ function decorateNSRWithVLR(nsr, nsrVLRObject, vlr) {
+ var vlrObject = _.extend(nsrVLRObject, vlr);
+ vlrObject['vnfr-connection-point-ref'] && vlrObject['vnfr-connection-point-ref'].map(function(vnfrCP) {
+ var vnfrName = nsr['vnfrs'] && _.find(nsr['vnfrs'], {id: vnfrCP['vnfr-id']})['name'];
+ vnfrName && (vnfrCP['vnfr-name'] = vnfrName);
+ });
+ nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'name'), 0, vlrObject);
+ // nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'create-time'), 0, vlrObject);
+ }
+}
+
+
+NSR.addVnfrDataPromise = function(req, nsrs) {
+ var api_server = req.query['api_server'];
+ var promises = [];
+ nsrs.map(function(nsr) {
+ var epa_params = {};
+ var constituent_vnfr_ref = nsr["constituent-vnfr-ref"];
+ var vnfrPromises = [];
+ nsr["vnfrs"] = [];
+ nsr["dashboard-urls"] = [];
+ nsr['nfvi-metrics'] = [];
+ if (!constituent_vnfr_ref) {
+ console.log('Something is wrong, there are no constituent-vnfr-refs');
+ constituent_vnfr_ref = [];
+ }
+ //Get VNFR Static Data
+ constituent_vnfr_ref && constituent_vnfr_ref.map(function(constituentVnfrObj) {
+ req.params.id = constituentVnfrObj['vnfr-id'];
+ var vnfrPromise;
+ vnfrPromise = VNFR.get(req).then(function(vnfr) {
+ try {
+ var vnfrItem = vnfr[0];
+ decorateNSRWithVNFR(nsr, vnfrItem)
+ staticVNFRCache[vnfrItem.id] = vnfrItem;
+ } catch (e) {
+ console.log('Exception caught:', e);
+ }
+ });
+ vnfrPromises.push(vnfrPromise);
+ });
+ var NSR_Promise = new Promise(function(resolve, reject) {
+ Promise.all(vnfrPromises).then(function() {
+ var vnfrs = staticVNFRCache;
+ //Aggregate EPA Params
+ constituent_vnfr_ref && constituent_vnfr_ref.map(function(k) {
+ if (vnfrs[k['vnfr-id']]) {
+ epa_params = epa_aggregator(vnfrs[k['vnfr-id']].vdur, epa_params);
+ }
+ })
+ //Add VNFR Name to monitoring params
+ try {
+ if (nsr["monitoring-param"]) {
+ nsr["monitoring-param"].map(function(m) {
+ var vnfr = vnfrs[m["vnfr-id"]] || {};
+ m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR');
+ });
+ }
+ } catch (e) {
+ console.log('Exception caught:', e);
+ }
+ resolve();
+ })
+ })
+ nsr["epa-params"] = epa_params;
+ promises.push(NSR_Promise);
+ })
+ return promises;
+
+ function decorateNSRWithVDURConsoleUrls(nsr, vnfr) {
+ nsr['console-urls'] = nsr['console-urls'] ? nsr['console-urls'] : [];
+
+ vnfr && vnfr['vdur'] && vnfr['vdur'].map(function(vdur) {
+ vdur['console-url'] && nsr['console-urls'].push({
+ id: vdur.id,
+ name: vdur.name,
+ 'console-url': vdur['console-url']
+ });
+ });
+ }
+
+ function decorateNSRWithVNFR(nsr, vnfr) {
+ var vnfrObj = {
+ id: vnfr.id,
+ "member-vnf-index-ref": vnfr["member-vnf-index-ref"],
+ "short-name": vnfr["short-name"],
+ "vnf-configuration": vnfr["vnf-configuration"],
+ "nsr-id": nsr['ns-instance-config-ref'],
+ "name": vnfr['name'],
+ "vdur": vnfr["vdur"],
+ "cloud-account": vnfr["cloud-account"]
+ };
+ var vnfrSg = nsr['vnfr-scaling-groups'];
+ var vnfrName = vnfr["name"];
+ if(vnfrSg) {
+ if(vnfrSg[vnfr.id]) {
+ vnfrName = vnfrSg[vnfr.id]["scaling-group-name-ref"] + ':' + vnfrSg[vnfr.id][ "instance-id"] + ':' + vnfrName;
+ }
+ }
+ var vnfrNfviMetrics = buildNfviGraphs(vnfr.vdur, vnfrName);
+ if (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) {
+ vnfrObj['service-primitives-present'] = true;
+ } else {
+ vnfrObj['service-primitives-present'] = false;
+ }
+ transforms.mergeVnfrNfviMetrics(vnfrNfviMetrics, nsr["nfvi-metrics"]);
+ //TODO: Should be sorted by create-time when it becomes available instead of id
+ // nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'create-time'), 0, vnfrObj);
+ nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'id'), 0, vnfrObj);
+ vnfrObj["dashboard-url"] = vnfr["dashboard-url"];
+ nsr["dashboard-urls"].push(vnfrObj);
+
+ decorateNSRWithVDURConsoleUrls(nsr, vnfr);
+ }
+}
+NSR.create = function(req) {
+ var api_server = req.query['api_server'];
+ var data = req.body.data;
+ console.log('Instantiating NSR on ', api_server);
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config',
+ method: 'POST',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: data
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.create', error, response, body, resolve, reject)) {
+ var nsr_id = null;
+ try {
+ nsr_id = data.nsr[0].id;
+ } catch (e) {
+ console.log("NSR.create unable to get nsr_id. Error: %s",
+ e.toString());
+ }
+ resolve({
+ statusCode: response.statusCode,
+ data: { nsr_id: nsr_id }
+ });
+ };
+ });
+ });
+};
+NSR.delete = function(req) {
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+ if (!id || !api_server) {
+ return new Promise(function(resolve, reject) {
+ console.log('Must specifiy api_server and id to delete NSR');
+ return reject({
+ statusCode: 500,
+ errorMessage: {
+ error: 'Must specifiy api_server and id to delete NSR'
+ }
+ });
+ });
+ };
+ console.log('Deleting NSR with id: ' + id + 'on server: ' + api_server);
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id,
+ method: 'DELETE',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.delete', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: JSON.stringify(response.body)
+ });
+ };
+ });
+ });
+};
+NSR.decorateAndTransformNFVI = function(nsr) {
+ var toDecorate = [];
+ // var metricsToUse = ["vcpu", "memory", "storage", "network"];
+ var metricsToUse = ["vcpu", "memory"];
+ try {
+ var nfviMetrics = nsr["rw-nsr:nfvi-metrics"];
+ if (nfviMetrics) {
+ metricsToUse.map(function(name) {
+ toDecorate.push(nfviMetrics[name])
+ });
+ }
+ nsr["nfvi-metrics"] = toDecorate;
+ delete nsr["rw-nsr:nfvi-metrics"];
+ } catch (e) {}
+ return nsr;
+ }
+ //Not a great pattern, Need a better way of handling logging;
+ //Refactor and move to the logging/logging.js
+var logCache = {
+ decorateAndTransformWithControls: {}
+}
+NSR.decorateAndTransformWithControls = function(nsr) {
+ var controlTypes = ["action-param", "control-param"];
+ var nsControls = [];
+ var Groups = {};
+ controlTypes.map(function(control) {
+ try {
+ var controls = nsr["rw-nsr:" + control];
+ // nsControls.push(controls);
+ controls.map(function(item) {
+ if (!Groups[item["group-tag"]]) {
+ Groups[item["group-tag"]] = {};
+ Groups[item["group-tag"]]["action-param"] = []
+ Groups[item["group-tag"]]["control-param"] = []
+ }
+ Groups[item["group-tag"]][control].push(item);
+ });
+ delete nsr["rw-nsr:" + control];
+ } catch (e) {
+ var id = nsr["ns-instance-config-ref"];
+ if (!logCache.decorateAndTransformWithControls[id]) {
+ logCache.decorateAndTransformWithControls[id] = {};
+ }
+ var log = logCache.decorateAndTransformWithControls[id];
+ if (!log[control]) {
+ log[control] = true;
+ console.log('No controls exist for ' + control + ' at ' + nsr["ns-instance-config-ref"]);
+ }
+ }
+ });
+ for (k in Groups) {
+ var obj = {}
+ obj[k] = Groups[k];
+ nsControls.push(obj)
+ }
+ nsr.nsControls = nsControls;
+ return nsr;
+};
+NSR.setStatus = function(req) {
+ var api_server = req.query['api_server'];
+ var id = req.params.id;
+ var status = req.body.status;
+ console.log('Setting NSR (id: ' + id + ') status, on ' + api_server + ', to be: ' + status);
+ return new Promise(function(resolve, reject) {
+ var command;
+ if (typeof(status) != "string") {
+ reject({
+ 'ERROR': 'NSR.setStatus Error: status is not a string type'
+ });
+ }
+ command = status.toUpperCase();
+ if (command != "ENABLED" && command != "DISABLED") {
+ reject({
+ 'ERROR': 'NSR.setStatus Error: status is: ' + command + '. It should be ENABLED or DISABLED'
+ });
+ }
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/admin-status/',
+ method: 'PUT',
+ headers: requestHeaders,
+ json: {
+ "nsr:admin-status": command
+ },
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.setStatus', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ };
+ });
+ });
+};
+
+NSR.createScalingGroupInstance = function(req) {
+ var api_server = req.query['api_server'];
+ var id = req.params.id;
+ var scaling_group_id = req.params.scaling_group_id;
+ if (!api_server || !id || !scaling_group_id) {
+ return new Promise(function(resolve, reject) {
+ return reject({
+ statusCode: 500,
+ errorMessage: {
+ error: 'API server/NSR id/Scaling group not provided'
+ }
+ });
+ });
+ }
+
+ var instance_id = Math.floor(Math.random() * 65535);
+
+ var jsonData = {
+ instance: [{
+ // id: uuid.v1()
+ id: instance_id
+ }]
+ };
+
+ console.log('Creating scaling group instance for NSR ', id, ', scaling group ', scaling_group_id, ' with instance id ', instance_id);
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data,
+ {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance',
+ method: 'POST',
+ headers: requestHeaders,
+ json: jsonData,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false
+ }, function (error, response, body) {
+ if (utils.validateResponse('NSR.createScalingGroupInstance', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
+ })
+ }
+ });
+ });
+};
+
+NSR.deleteScalingGroupInstance = function(req) {
+ var api_server=req.query['api_server'];
+ var id = req.params.id;
+ var scaling_group_id = req.params.scaling_group_id;
+ var scaling_instance_id = req.params.scaling_instance_id;
+
+ if (!api_server || !id || !scaling_group_id || !scaling_instance_id) {
+ return new Promise(function(resolve, reject) {
+ return reject({
+ statusCode: 500,
+ errorMessage: {
+ error: 'API server/NSR id/Scaling group/Scaling instance id not provided'
+ }
+ });
+ });
+ }
+
+ console.log('Deleting scaling group instance id ', scaling_instance_id,
+ ' for scaling group ', scaling_group_id,
+ ', under NSR ', id);
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data,
+ {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance/' + scaling_instance_id,
+ method: 'DELETE',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false
+ }, function (error, response, body) {
+ if (utils.validateResponse('NSR.deleteScalingGroupInstance', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
+ })
+ }
+ });
+ });
+};
+
+NSR.nsd = {};
+NSR.nsd.vld = {};
+
+NSR.nsd.vld.get = function(req) {
+ var api_server = req.query['api_server'];
+ var nsr_id = req.params.nsr_id;
+ var vld_id = req.params.vld_id;
+
+ if (!api_server || !nsr_id) {
+ return new Promise(function(resolve, reject) {
+ return reject({
+ statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
+ errorMessage: 'API server/NSR id not provided'
+ });
+ })
+ }
+ console.log('Getting VLD', vld_id ? (' ' + vld_id) : ('\'s'), ' for NSR id', nsr_id);
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ vld_id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection,
+ {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : '') +'?deep',
+ method: 'GET',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false
+ }, function (error, response, body) {
+ if (utils.validateResponse('NSR.nsd.vld.get', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
+ });
+ }
+ });
+ });
+};
+
+NSR.nsd.vld.create = function(req) {
+ var api_server = req.query['api_server'];
+ var nsr_id = req.params.nsr_id;
+ var vld_id = req.params.vld_id;
+ var data = req.body;
+
+ if (!api_server || !nsr_id) {
+ return new Promise(function(resolve, reject) {
+ return reject({
+ statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
+ errorMessage: 'API server/NSR id not provided'
+ });
+ });
+ }
+
+ console.log((vld_id ? 'Updating VLD ' + vld_id : 'Creating VLD') + ' under NSR', nsr_id);
+
+ var jsonData = {
+ vld: typeof(data) == 'string' ? JSON.parse(data) : data
+ };
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ uri: utils.confdPort(api_server) + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : ''),
+ method: vld_id ? 'PUT' : 'POST',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData
+ }, function(error, response, body) {
+ if (utils.validateResponse('NSR.nsd.vld.create/update', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: (typeof(response.body) == 'string') ? JSON.parse(response.body) : response.body
+ });
+ }
+ });
+ });
+};
+
+NSR.nsd.vld.update = NSR.nsd.vld.create;
+
+NSR.nsd.vld.delete = function(req) {
+ var api_server = req.query['api_server'];
+ var nsr_id = req.params.nsr_id;
+ var vld_id = req.params.vld_id;
+
+ if (!api_server || !nsr_id || !vld_id) {
+ return new Promise(function(resolve, reject) {
+ return reject({
+ statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR,
+ errorMessage: 'API server/NSR id/VLD id not provided'
+ });
+ })
+ }
+ console.log('Deleting VLD', vld_id, 'for NSR id', nsr_id);
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data,
+ {
+ 'Authorization': req.get('Authorization')
+ }
+ );
+
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld/' + vld_id,
+ method: 'DELETE',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false
+ }, function (error, response, body) {
+ if (utils.validateResponse('NSR.nsd.vld.delete', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode,
+ data: typeof response.body == 'string' ? JSON.parse(response.body):response.body
+ });
+ }
+ });
+ });
+}
+
+VNFR.get = function(req) {
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+ var uri = utils.confdPort(api_server);
+ uri += APIVersion + '/api/operational/vnfr-catalog/vnfr' + (id ? '/' + id : '') + '?deep';
+ var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('VNFR.get', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ var returnData = id ? [data["vnfr:vnfr"]] : data.collection["vnfr:vnfr"];
+ returnData.forEach(function(vnfr) {
+ vnfr['nfvi-metrics'] = buildNfviGraphs(vnfr.vdur);
+ vnfr['epa-params'] = epa_aggregator(vnfr.vdur);
+ vnfr['service-primitives-present'] = (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) ? true : false;
+ })
+ return resolve(returnData);
+ };
+ });
+ });
+}
+
+function buildNfviGraphs(VDURs, vnfrName){
+ var temp = {};
+ var toReturn = [];
+ APIConfig.NfviMetrics.map(function(k) {
+
+ VDURs && VDURs.map(function(v,i) {
+ //Check for RIFT-12699: VDUR NFVI Metrics not fully populated
+ if (v["rw-vnfr:nfvi-metrics"] && v["rw-vnfr:nfvi-metrics"][k] && v["rw-vnfr:nfvi-metrics"][k].hasOwnProperty('utilization')) {
+ if(!temp[k]) {
+ temp[k] = {
+ title: '',
+ data: []
+ };
+ };
+ try {
+ var data = v["rw-vnfr:nfvi-metrics"][k];
+ var newData = {};
+ newData.name = v.name ? v.name : v.id.substring(0,6);
+ newData.name = vnfrName ? vnfrName + ': ' + newData.name : newData.name;
+ newData.id = v.id;
+ //converts to perentage
+ newData.utilization = data.utilization * 0.01;
+ temp[k].data.push(newData);
+ temp[k].title = v["rw-vnfr:nfvi-metrics"][k].label;
+ } catch (e) {
+ console.log('Something went wrong with the VNFR NFVI Metrics. Check that the data is being properly returned. ERROR: ', e);
+ }
+ }
+ });
+ if(temp[k]) {
+ toReturn.push(temp[k]);
+ }
+ });
+ return toReturn;
+ }
+
+
+//Cache NSR reference for VNFR
+VNFR.cachedNSR = {};
+VNFR.getByNSR = function(req) {
+ var api_server = req.query["api_server"];
+ var id = req.params.nsr_id;
+ var uri = utils.confdPort(api_server);
+ var reqClone = _.clone(req);
+ delete reqClone.params.id;
+ uri += APIVersion + '/api/operational/ns-instance-opdata/nsr/' + id + '?deep';
+ var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ if (VNFR.cachedNSR[id]) {
+ var data = VNFR.cachedNSR[id];
+ var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
+ VNFR.get(reqClone).then(function(vnfrData) {
+ resolve(filterVnfrByList(vnfrList, vnfrData));
+ });
+ } else {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('VNFR.getByNSR', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ data = data["nsr:nsr"];
+ //Cache NSR data with NSR-ID as
+ VNFR.cachedNSR[id] = data;
+ var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id');
+ var returnData = [];
+ VNFR.get(reqClone).then(function(vnfrData) {
+ resolve(filterVnfrByList(vnfrList, vnfrData));
+ });
+ };
+ });
+ }
+ });
+};
+
+function filterVnfrByList(vnfrList, vnfrData) {
+ return vnfrData.map(function(vnfr) {
+ if (vnfrList.indexOf(vnfr.id) > -1) {
+ return vnfr;
+ }
+ })
+};
+
+VLR.get = function(req) {
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+ var uri = utils.confdPort(api_server);
+ uri += APIVersion + '/api/operational/vlr-catalog/vlr' + (id ? '/' + id : '') + '?deep';
+ var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('VLR.get', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ var returnData = id ? [data["vlr:vlr"]] : data.collection["vlr:vlr"];
+ return resolve({
+ data: returnData,
+ statusCode: response.statusCode
+ });
+ };
+ });
+ });
+}
+
+RIFT.api = function(req) {
+ var api_server = req.query["api_server"];
+ var uri = utils.confdPort(api_server);
+ var url = req.path;
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri + url + '?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('RIFT.api', error, response, body, resolve, reject)) {
+ resolve(JSON.parse(response.body))
+ };
+ })
+ })
+};
+
+ComputeTopology.get = function(req) {
+ var api_server = req.query['api_server'];
+ var nsr_id = req.params.id;
+ var result = {
+ id: nsr_id, // node id
+ name: nsr_id, // node name to display
+ parameters: {}, // the parameters that can be used to determine size/color, etc. for the node
+ type: 'nsr',
+ children: [] // children for the node
+ };
+ return new Promise(function(resolve, reject) {
+ var nsrPromise = new Promise(function(success, failure) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr/' + nsr_id + '?deep',
+ method: 'GET',
+ headers: _.extend({},
+ constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('ComputeTopology.get ns-instance-opdata/nsr/:id', error, response, body, success, failure)) {
+ var data;
+ var isString = typeof(response.body) == "string";
+ if (isString && response.body == '') {
+ return success({});
+ }
+ try {
+ data = isString ? JSON.parse(response.body) : response.body;
+
+ var nsrNFVIMetricData = data["nsr:nsr"]["rw-nsr:nfvi-metrics"];
+ result.parameters = nsrNFVIMetricData;
+
+ result.name = data["nsr:nsr"]["name-ref"];
+
+ var nsrData = data["nsr:nsr"]["constituent-vnfr-ref"];
+ success(nsrData);
+ } catch (e) {
+ console.log('Error parsing ns-instance-opdata for NSR ID', nsr_id, 'Exception:', e);
+ return failure()
+ }
+ };
+ });
+ }).then(function(data) {
+
+ try {
+ // got NSR data
+ // now get VNFR data and populate the structure
+ var vnfrPromises = [];
+
+ // Run separately to confirm that primary structure is populated before promise resolution takes over
+ // and starts modifying the data
+ data.forEach(function(vnfrObj) {
+
+ var vnfrId = vnfrObj['vnfr-id'];
+
+ // If anything needs to be added to result for each vnfrId, do it here
+
+ vnfrPromises.push(
+ new Promise(function(success, failure) {
+ rp({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrId + '?deep',
+ method: 'GET',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ resolveWithFullResponse: true
+ }, function(error, response, body) {
+ if (utils.validateResponse('ComputeTopology.get vnfr-catalaog/vnfr/:id', error, response, body, success, failure)) {
+ try {
+ var data = JSON.parse(response.body);
+ var returnData = data["vnfr:vnfr"];
+
+ // Push VNFRs in result
+ result.children.push({
+ id: vnfrId,
+ name: returnData.name,
+ parameters: {}, // nfvi metrics here
+ children: [],
+ type: 'vnfr'
+ });
+
+ // Push VDURs in result
+ returnData.vdur.forEach(function(vdur) {
+ result.children[result.children.length - 1].children.push({
+ id: vdur.id,
+ name: vdur.id,
+ parameters: {},
+ type: 'vdur'
+ // children: []
+ });
+ });
+
+ return success(returnData.vdur);
+ } catch (e) {
+ console.log('Error parsing vnfr-catalog for VNFR ID', vnfrId, 'Exception:', e);
+ return failure();
+ }
+ };
+ });
+ })
+ );
+ });
+
+ Promise.all(vnfrPromises).then(function(output) {
+ console.log('Resolved all VNFR requests successfully');
+ // By now result must be completely populated. output is moot
+
+ // Sort the results as there's no order to them from RIFT-REST
+ result.children.sort(sortByName);
+
+ result.children.forEach(function(vnfr) {
+ vnfr.children.sort(sortByName);
+ });
+
+ resolve({
+ statusCode: 200,
+ data: result
+ });
+ }).catch(function(error) {
+ // Todo: Can this be made better?
+ // Right now if one of the southbound APIs fails - we just return what's populated so far in result
+ console.log('Problem with ComputeTopology.get vnfr-catalog/vnfr/:id', error, 'Resolving with partial data', result);
+ resolve({
+ statusCode: 200,
+ data: result
+ });
+ });
+ } catch (e) {
+ // API came back with empty ns-instance-opdata response for NSR ID
+ // bail
+ console.log('Error iterating through ns-instance-opdata response for NSR ID', nsr_id, 'Exception:', e);
+ resolve({
+ statusCode: 200,
+ data: result
+ })
+ }
+ }, function(error) {
+ // failed to get NSR data.
+ // bail
+ resolve({
+ statusCode: 200,
+ data: result
+ });
+ });
+ });
+};
+
+NetworkTopology.get = function(req) {
+ var api_server = req.query["api_server"];
+ var uri = utils.confdPort(api_server);
+ uri += APIVersion + '/api/operational/network?deep';
+ var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false
+ }, function(error, response, body) {
+ if (utils.validateResponse('NetworkTopology.get', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ var returnData = transforms.transformNetworkTopology(
+ data["ietf-network:network"]
+ );
+ resolve({
+ statusCode: 200,
+ data: returnData
+ });
+ };
+ });
+ })
+}
+
+VDUR.get = function(req) {
+ var api_server = req.query["api_server"];
+ var vnfrID = req.params.vnfr_id;
+ var vdurID = req.params.vdur_id;
+ var uri = utils.confdPort(api_server);
+ uri += APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrID + '/vdur/' + vdurID + '?deep';
+ var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('VDUR.get', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ var returnData = data["vdur:vdur"];
+ return resolve(returnData);
+ };
+ });
+ })
+}
+
+CloudAccount.get = function(req) {
+ var api_server = req.query["api_server"];
+ var uri = utils.confdPort(api_server);
+ uri += APIVersion + '/api/config/cloud/account?deep';
+ var headers = _.extend({}, constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ });
+ return new Promise(function(resolve, reject) {
+ request({
+ url: uri,
+ method: 'GET',
+ headers: headers,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('CloudAccount.get', error, response, body, resolve, reject)) {
+ var data = JSON.parse(response.body);
+ var returnData = data["collection"]["rw-cloud:account"];
+ resolve({
+ statusCode: 200,
+ data: returnData
+ });
+ };
+ });
+ });
+}
+
+
+// Config-Agent Account APIs
+ConfigAgentAccount.get = function(req) {
+ var self = this;
+
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+
+ if (!id) {
+ // Get all config accounts
+ return new Promise(function(resolve, reject) {
+
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.collection, {
+ 'Authorization': req.get('Authorization')
+ });
+
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account',
+ type: 'GET',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ },
+ function(error, response, body) {
+ var data;
+ var statusCode;
+ if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
+ try {
+ data = JSON.parse(response.body).collection['rw-config-agent:account'];
+ statusCode = response.statusCode;
+ } catch (e) {
+ console.log('Problem with "ConfigAgentAccount.get"', e);
+ var err = {};
+ err.statusCode = 500;
+ err.errorMessage = {
+ error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
+ }
+ return reject(err);
+ }
+
+ return resolve({
+ statusCode: statusCode,
+ data: data
+ });
+ };
+ });
+ });
+ } else {
+ //Get a specific config account
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account/' + id,
+ type: 'GET',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ },
+ function(error, response, body) {
+ var data;
+ var statusCode;
+ if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) {
+ try {
+ data = JSON.parse(response.body)['rw-config-agent:account'];
+ statusCode = response.statusCode;
+ } catch (e) {
+ console.log('Problem with "ConfigAgentAccount.get"', e);
+ var err = {};
+ err.statusCode = 500;
+ err.errorMessage = {
+ error: 'Problem with "ConfigAgentAccount.get": ' + e.toString()
+ }
+ return reject(err);
+ }
+
+ return resolve({
+ statusCode: statusCode,
+ data: data
+ });
+ }
+ });
+ });
+ }
+};
+
+ConfigAgentAccount.create = function(req) {
+
+ var api_server = req.query["api_server"];
+ var data = req.body;
+
+ return new Promise(function(resolve, reject) {
+ var jsonData = {
+ "account": Array.isArray(data) ? data : [data]
+ };
+
+ console.log('Creating with', JSON.stringify(jsonData));
+
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent',
+ method: 'POST',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData,
+ }, function(error, response, body) {
+ if (utils.validateResponse('ConfigAgentAccount.create', error, response, body, resolve, reject)) {
+ return resolve({
+ statusCode: response.statusCode,
+ data: JSON.stringify(response.body),
+ body:response.body.body
+ });
+ };
+ });
+ });
+};
+
+ConfigAgentAccount.update = function(req) {
+
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+ var data = req.body;
+
+ return new Promise(function(resolve, reject) {
+ var jsonData = {
+ "rw-config-agent:account": data
+ };
+
+ console.log('Updating config-agent', id, ' with', JSON.stringify(jsonData));
+
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data,
+ constants.HTTP_HEADERS.content_type.data, {
+ 'Authorization': req.get('Authorization')
+ });
+
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
+ method: 'PUT',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ json: jsonData,
+ }, function(error, response, body) {
+ if (utils.validateResponse('ConfigAgentAccount.update', error, response, body, resolve, reject)) {
+ return resolve({
+ statusCode: response.statusCode,
+ data: JSON.stringify(response.body)
+ });
+ };
+ });
+ });
+};
+
+ConfigAgentAccount.delete = function(req) {
+
+ var api_server = req.query["api_server"];
+ var id = req.params.id;
+
+ if (!id || !api_server) {
+ return new Promise(function(resolve, reject) {
+ console.log('Must specifiy api_server and id to delete config-agent account');
+ return reject({
+ statusCode: 500,
+ errorMessage: {
+ error: 'Must specifiy api_server and id to delete config agent account'
+ }
+ });
+ });
+ };
+
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id,
+ method: 'DELETE',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('ConfigAgentAccount.delete', error, response, body, resolve, reject)) {
+ return resolve({
+ statusCode: response.statusCode,
+ data: JSON.stringify(response.body)
+ });
+ };
+ });
+ });
+};
+
+
+DataCenters.get = function(req) {
+ var api_server = req.query["api_server"];
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/operational/datacenters/cloud-accounts?deep',
+ method: 'GET',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('DataCenters.get', error, response, body, resolve, reject)) {
+ var returnData = {};
+ try {
+ data = JSON.parse(response.body)['rw-launchpad:cloud-accounts'];
+ data.map(function(c) {
+ returnData[c.name] = c.datacenters;
+ })
+ statusCode = response.statusCode;
+ } catch (e) {
+ console.log('Problem with "DataCenters.get"', e);
+ var err = {};
+ err.statusCode = 500;
+ err.errorMessage = {
+ error: 'Problem with "DataCenters.get": ' + e.toString()
+ }
+ return reject(err);
+ }
+ return resolve({
+ statusCode: response.statusCode,
+ data: returnData
+ });
+ };
+ });
+ });
+}
+
+SSHkey.get = function(req) {
+ var api_server = req.query["api_server"];
+ return new Promise(function(resolve, reject) {
+ var requestHeaders = {};
+ _.extend(requestHeaders,
+ constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ });
+ request({
+ url: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair?deep',
+ method: 'GET',
+ headers: requestHeaders,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('SSHkey.get', error, response, body, resolve, reject)) {
+ var returnData = {};
+ try {
+ returnData = JSON.parse(response.body)['nsr:key-pair'];
+ statusCode = response.statusCode;
+ } catch (e) {
+ console.log('Problem with "SSHkey.get"', e);
+ var err = {};
+ err.statusCode = 500;
+ err.errorMessage = {
+ error: 'Problem with "SSHkey.get": ' + e.toString()
+ }
+ return reject(err);
+ }
+ return resolve({
+ statusCode: response.statusCode,
+ data: returnData
+ });
+ };
+ });
+ });
+}
+SSHkey.delete = function(req) {
+ var api_server = req.query['api_server'];
+ var id = decodeURI(req.params.name);
+ console.log('Deleting ssk-key', id);
+ return new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/' + id,
+ method: 'DELETE',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('SSHkey.delete', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+SSHkey.post = function(req) {
+ var api_server = req.query['api_server'];
+ var data = req.body;
+ return new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
+ method: 'POST',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ json: data,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('SSHkey.post', error, response, body, resolve, reject)) {
+ resolve({
+ data: 'success',
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+SSHkey.put = function(req) {
+ var api_server = req.query['api_server'];
+ var data = req.body;
+ return new Promise(function(resolve, reject) {
+ request({
+ uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/',
+ method: 'PUT',
+ headers: _.extend({}, constants.HTTP_HEADERS.accept.data, {
+ 'Authorization': req.get('Authorization')
+ }),
+ json: data,
+ forever: constants.FOREVER_ON,
+ rejectUnauthorized: false,
+ }, function(error, response, body) {
+ if (utils.validateResponse('SSHkey.put', error, response, body, resolve, reject)) {
+ resolve({
+ statusCode: response.statusCode
+ });
+ }
+ });
+ });
+};
+
+function sortByName(a, b) {
+ return a.name > b.name;
+}
+
+module.exports.catalog = Catalog;
+module.exports.nsr = NSR;
+module.exports.vnfr = VNFR;
+module.exports.vlr = VLR;
+module.exports.rift = RIFT;
+module.exports.computeTopology = ComputeTopology;
+module.exports.networkTopology = NetworkTopology;
+module.exports.config = Config;
+module.exports.cloud_account = CloudAccount;
+module.exports['config-agent-account'] = ConfigAgentAccount;
+module.exports.rpc = RPC;
+module.exports.data_centers = DataCenters;
+module.exports.SSHkey = SSHkey;