| /* |
| * |
| * Copyright 2016 RIFT.IO Inc |
| * |
| * Licensed under the Apache License, Version 2.0 (the "License"); |
| * you may not use this file except in compliance with the License. |
| * You may obtain a copy of the License at |
| * |
| * http://www.apache.org/licenses/LICENSE-2.0 |
| * |
| * Unless required by applicable law or agreed to in writing, software |
| * distributed under the License is distributed on an "AS IS" BASIS, |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| * See the License for the specific language governing permissions and |
| * limitations under the License. |
| * |
| */ |
| |
| var request = require('request'); |
| var Promise = require('bluebird'); |
| var rp = require('request-promise'); |
| var utils = require('../../../framework/core/api_utils/utils.js'); |
| var constants = require('../../../framework/core/api_utils/constants.js'); |
| var APIVersion = '/v1'; |
| var _ = require('underscore'); |
| var epa_aggregator = require('./epa_aggregator.js'); |
| var transforms = require('./transforms.js'); |
| var uuid = require('node-uuid'); |
| |
| // Revealing module pattern objects |
| var Catalog = {}; |
| var Config = {}; |
| var NSR = {}; |
| var VNFR = {}; |
| var VLR = {}; |
| var RIFT = {}; |
| var ComputeTopology = {}; |
| var NetworkTopology = {}; |
| var VDUR = {}; |
| var CloudAccount = {}; |
| var ConfigAgentAccount = {}; |
| var RPC = {}; |
| var SSHkey = {}; |
| // API Configuration Info |
| var APIConfig = {} |
| APIConfig.NfviMetrics = ['vcpu', 'memory']; |
| |
| RPC.executeNSServicePrimitive = function(req) { |
| var api_server = req.query['api_server']; |
| return new Promise(function(resolve, reject) { |
| var jsonData = { |
| "input": req.body |
| }; |
| |
| var headers = _.extend({}, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/operations/exec-ns-service-primitive', |
| method: 'POST', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('RPC.executeNSServicePrimitive', error, response, body, resolve, reject)) { |
| return resolve({ |
| statusCode: response.statusCode, |
| data: JSON.stringify(response.body) |
| }); |
| } |
| }) |
| }); |
| }; |
| |
| RPC.getNSServicePrimitiveValues = function(req) { |
| var api_server = req.query['api_server']; |
| // var nsr_id = req.body['nsr_id_ref']; |
| // var nsConfigPrimitiveName = req.body['name']; |
| return new Promise(function(resolve, reject) { |
| var jsonData = { |
| "input": req.body |
| }; |
| |
| var headers = _.extend({}, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operations/get-ns-service-primitive-values', |
| method: 'POST', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('RPC.getNSServicePrimitiveValues', error, response, body, resolve, reject)) { |
| |
| resolve({ |
| statusCode: response.statusCode, |
| data: JSON.parse(body) |
| }); |
| } |
| }); |
| }).catch(function(error) { |
| console.log('error getting primitive values'); |
| }); |
| }; |
| RPC.refreshAccountConnectionStatus = function(req) { |
| var api_server = req.query['api_server']; |
| var Name = req.params.name; |
| var Type = req.params.type; |
| var jsonData = { |
| input: {} |
| }; |
| var rpcInfo = { |
| sdn: { |
| label: 'sdn-account', |
| rpc: 'update-sdn-status' |
| }, |
| config: { |
| label: 'cfg-agent-account', |
| rpc: 'update-cfg-agent-status' |
| }, |
| cloud: { |
| label: 'cloud-account', |
| rpc: 'update-cloud-status' |
| } |
| } |
| jsonData.input[rpcInfo[Type].label] = Name; |
| var headers = _.extend({}, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| return new Promise(function(resolve, reject) { |
| |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operations/' + rpcInfo[Type].rpc, |
| method: 'POST', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('RPC.refreshAccountConnectionStatus', error, response, body, resolve, reject)) { |
| |
| resolve({ |
| statusCode: response.statusCode, |
| data: body |
| }); |
| } |
| }); |
| }).catch(function(error) { |
| console.log('Error refreshing account info'); |
| }); |
| }; |
| |
| |
| var DataCenters = {}; |
| // Catalog module methods |
| Catalog.get = function(req) { |
| var api_server = req.query['api_server']; |
| var results = {} |
| return new Promise(function(resolve, reject) { |
| Promise.all([ |
| rp({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| resolveWithFullResponse: true |
| }), |
| rp({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| resolveWithFullResponse: true |
| }), |
| rp({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| resolveWithFullResponse: true |
| }) |
| // Not enabled for now |
| // rp({ |
| // uri: utils.confdPort(api_server) + APIVersion + '/api/config/pnfd-catalog/pnfd?deep', |
| // method: 'GET', |
| // headers: _.extend({}, |
| // constants.HTTP_HEADERS.accept.collection, |
| // { |
| // 'Authorization': req.get('Authorization') |
| // }), |
| // forever: constants.FOREVER_ON, |
| // rejectUnauthorized: false, |
| // resolveWithFullResponse: true |
| // }) |
| ]).then(function(result) { |
| console.log('Resolved all request promises (NSD, VNFD) successfully'); |
| var response = [{ |
| "id": "GUID-1", |
| "name": "RIFT.ware™ NS Descriptors Catalog", |
| "short-name": "rift.ware-nsd-cat", |
| "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.", |
| "vendor": "RIFT.io", |
| "version": "", |
| "created-on": "", |
| "type": "nsd", |
| "meta": { |
| "icon-svg": "data:image/svg+xml,%3C%3Fxml%20version%3D%221.0%22%20encoding%3D%22iso-8859-1%22%3F%3E%0A%3C!--%20Generator%3A%20Adobe%20Illustrator%2018.0.0%2C%20SVG%20Export%20Plug-In%20.%20SVG%20Version%3A%206.00%20Build%200)%20%20--%3E%0A%3C!DOCTYPE%20svg%20PUBLIC%20%22-%2F%2FW3C%2F%2FDTD%20SVG%201.1%2F%2FEN%22%20%22http%3A%2F%2Fwww.w3.org%2FGraphics%2FSVG%2F1.1%2FDTD%2Fsvg11.dtd%22%3E%0A%3Csvg%20version%3D%221.1%22%20id%3D%22connection-icon-1%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20xmlns%3Axlink%3D%22http%3A%2F%2Fwww.w3.org%2F1999%2Fxlink%22%20x%3D%220px%22%20y%3D%220px%22%0A%09%20viewBox%3D%220%200%2050%2050%22%20style%3D%22enable-background%3Anew%200%200%2050%2050%3B%22%20xml%3Aspace%3D%22preserve%22%3E%0A%09%3Cpath%20d%3D%22M15%2030c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2020c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M35%2040c-2.8%200-5-2.2-5-5s2.2-5%205-5%205%202.2%205%205-2.2%205-5%205zm0-8c-1.7%200-3%201.3-3%203s1.3%203%203%203%203-1.3%203-3-1.3-3-3-3z%22%2F%3E%3Cpath%20d%3D%22M19.007%2025.885l12.88%206.44-.895%201.788-12.88-6.44z%22%2F%3E%3Cpath%20d%3D%22M30.993%2015.885l.894%201.79-12.88%206.438-.894-1.79z%22%2F%3E%3C%2Fsvg%3E" |
| }, |
| "descriptors": [] |
| }, { |
| "id": "GUID-2", |
| "name": "RIFT.ware™ VNF Descriptors Catalog", |
| "short-name": "rift.ware-vnfd-cat", |
| "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.", |
| "vendor": "RIFT.io", |
| "version": "", |
| "created-on": "", |
| "type": "vnfd", |
| "meta": { |
| "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_3\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <g> <path d=\"M58.852,62.447l-4.662-1.033c-0.047-3.138-0.719-6.168-1.996-9.007l3.606-2.92c0.858-0.695,0.99-1.954,0.296-2.813 l-4.521-5.584c-0.334-0.413-0.818-0.675-1.346-0.731c-0.525-0.057-1.056,0.102-1.468,0.435L45.25,43.64v0 c-2.486-1.907-5.277-3.259-8.297-4.019v-4.458c0-1.104-0.896-2-2-2H27.77c-1.104,0-2,0.896-2,2v4.461 c-3.08,0.777-5.922,2.171-8.447,4.144l-3.545-2.82c-0.415-0.33-0.94-0.479-1.472-0.422c-0.527,0.06-1.009,0.327-1.339,0.743 l-4.472,5.623c-0.688,0.864-0.544,2.123,0.32,2.81l3.642,2.896v0c-1.25,2.848-1.895,5.88-1.916,9.011l-4.666,1.078 c-1.076,0.249-1.747,1.322-1.499,2.398l1.616,7.001c0.249,1.077,1.325,1.747,2.399,1.499l4.813-1.111v0 c1.429,2.681,3.344,5.017,5.691,6.943l-2.17,4.55c-0.476,0.997-0.054,2.19,0.943,2.666l6.484,3.094 c0.271,0.129,0.566,0.195,0.861,0.195c0.226,0,0.451-0.038,0.668-0.115c0.5-0.177,0.909-0.545,1.138-1.024l2.198-4.611 c2.923,0.563,5.966,0.554,8.879-0.033l2.236,4.585c0.484,0.994,1.685,1.403,2.675,0.921l6.456-3.148 c0.992-0.484,1.405-1.682,0.921-2.674l-2.206-4.524c2.335-1.946,4.231-4.301,5.639-6.999l4.812,1.067 c1.076,0.237,2.146-0.441,2.385-1.52l1.556-7.014c0.115-0.518,0.02-1.06-0.266-1.508C59.82,62.878,59.369,62.562,58.852,62.447z M40.18,61.761c0,4.859-3.953,8.812-8.813,8.812c-4.858,0-8.811-3.953-8.811-8.812s3.952-8.812,8.811-8.812 C36.227,52.949,40.18,56.902,40.18,61.761z\"/> <path d=\"M64.268,45.324c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.826,0.353,3.736,0.345,5.551-0.021l1.07,2.195 c0.484,0.992,1.682,1.405,2.675,0.921l2.691-1.313c0.477-0.233,0.842-0.646,1.015-1.147c0.172-0.501,0.139-1.051-0.095-1.528 l-1.052-2.155c1.458-1.214,2.645-2.686,3.527-4.377l2.278,0.504c1.075,0.238,2.146-0.442,2.386-1.52l0.647-2.923 c0.238-1.078-0.442-2.146-1.521-2.385l-2.184-0.484c-0.028-1.962-0.449-3.857-1.248-5.632l1.673-1.355 c0.412-0.334,0.675-0.818,0.73-1.345s-0.102-1.056-0.436-1.468l-1.884-2.327c-0.697-0.859-1.957-0.99-2.813-0.295l-1.614,1.307 c-1.554-1.193-3.299-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.04 c-1.927,0.486-3.703,1.358-5.28,2.592l-1.634-1.298c-0.862-0.687-2.12-0.543-2.81,0.32l-1.864,2.344 c-0.33,0.416-0.481,0.945-0.422,1.472c0.061,0.527,0.327,1.009,0.743,1.339l1.69,1.345c-0.78,1.779-1.184,3.676-1.197,5.636 l-2.189,0.505c-0.517,0.119-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51l0.675,2.918 c0.249,1.076,1.323,1.747,2.398,1.498l2.28-0.527c0.892,1.676,2.089,3.137,3.559,4.343l-1.035,2.17 c-0.228,0.479-0.257,1.028-0.08,1.528c0.178,0.5,0.546,0.91,1.024,1.138l2.703,1.289C63.686,45.261,63.979,45.324,64.268,45.324z M64.334,27.961c0-3.039,2.473-5.51,5.512-5.51c3.038,0,5.51,2.472,5.51,5.51c0,3.039-2.472,5.511-5.51,5.511 C66.807,33.472,64.334,31,64.334,27.961z\"/> <path d=\"M96.107,66.441l-2.182-0.484c-0.028-1.961-0.449-3.856-1.25-5.632l1.675-1.355c0.412-0.334,0.675-0.818,0.73-1.346 c0.056-0.527-0.102-1.056-0.436-1.468l-1.885-2.327c-0.695-0.859-1.956-0.99-2.813-0.295l-1.614,1.307 c-1.555-1.193-3.3-2.038-5.188-2.513v-2.039c0-1.104-0.896-2-2-2h-2.994c-1.104,0-2,0.896-2,2v2.041 c-1.929,0.486-3.706,1.358-5.282,2.592l-0.001,0l-1.631-1.298c-0.415-0.331-0.938-0.482-1.472-0.422 c-0.527,0.06-1.009,0.327-1.339,0.742l-1.863,2.343c-0.688,0.865-0.544,2.123,0.32,2.811l1.691,1.345 c-0.782,1.784-1.186,3.68-1.199,5.636l-2.188,0.505c-0.517,0.12-0.965,0.439-1.246,0.889c-0.281,0.45-0.372,0.993-0.252,1.51 l0.675,2.918c0.249,1.076,1.327,1.744,2.397,1.498l2.281-0.526c0.893,1.677,2.09,3.138,3.558,4.343h0.001l-1.035,2.168 c-0.229,0.479-0.258,1.029-0.081,1.529c0.178,0.5,0.546,0.909,1.024,1.138l2.702,1.289c0.278,0.132,0.571,0.195,0.86,0.195 c0.746,0,1.463-0.42,1.806-1.139l1.054-2.208c1.828,0.353,3.739,0.347,5.552-0.021l1.071,2.194 c0.484,0.992,1.682,1.405,2.675,0.921l2.69-1.312c0.477-0.233,0.842-0.645,1.014-1.147c0.173-0.501,0.14-1.051-0.093-1.528 l-1.052-2.155c1.459-1.215,2.645-2.688,3.525-4.377l2.278,0.505c0.52,0.116,1.061,0.02,1.508-0.266 c0.447-0.285,0.763-0.736,0.878-1.254l0.647-2.923C97.866,67.748,97.186,66.681,96.107,66.441z M85.162,66.174 c0,3.039-2.471,5.511-5.508,5.511c-3.039,0-5.512-2.472-5.512-5.511c0-3.039,2.473-5.511,5.512-5.511 C82.691,60.664,85.162,63.136,85.162,66.174z\"/> </g> </svg> " |
| }, |
| "descriptors": [] |
| }, { |
| "id": "GUID-3", |
| "name": "RIFT.ware™ PNF Descriptors Catalog", |
| "short-name": "rift.ware-pnfd-cat", |
| "description": "RIFT.ware™, an open source NFV development and deployment software platform that makes it simple to create, deploy and manage hyper-scale Virtual network functions and applications.", |
| "vendor": "RIFT.io", |
| "version": "", |
| "created-on": "", |
| "type": "pnfd", |
| "meta": { |
| "icon-svg": "data:image/svg+xml,<?xml version=\"1.0\" encoding=\"utf-8\"?> <!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> <!DOCTYPE svg PUBLIC \"-//W3C//DTD SVG 1.1//EN\" \"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd\"> <svg version=\"1.1\" id=\"Layer_4\" xmlns=\"http://www.w3.org/2000/svg\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" x=\"0px\" y=\"0px\" width=\"100px\" height=\"100px\" viewBox=\"0 0 100 100\" enable-background=\"new 0 0 100 100\" xml:space=\"preserve\"> <path d=\"M86.334,47.444V35.759H13.666v11.686h3.561v5.111h-3.561v11.686h72.668V52.556h-4.108v-5.111H86.334z M26.628,59.454h-5.051 v-4.941h5.051V59.454z M26.628,52.404h-5.051v-4.941h5.051V52.404z M26.628,45.486h-5.051v-4.941h5.051V45.486z M34.094,59.454 h-5.051v-4.941h5.051V59.454z M34.094,52.404h-5.051v-4.941h5.051V52.404z M34.094,45.486h-5.051v-4.941h5.051V45.486z M41.452,59.454h-5.051v-4.941h5.051V59.454z M41.452,52.404h-5.051v-4.941h5.051V52.404z M41.452,45.486h-5.051v-4.941h5.051 V45.486z M48.733,59.454h-5.051v-4.941h5.051V59.454z M48.733,52.404h-5.051v-4.941h5.051V52.404z M48.733,45.486h-5.051v-4.941 h5.051V45.486z M56.2,59.454h-5.051v-4.941H56.2V59.454z M56.2,52.404h-5.051v-4.941H56.2V52.404z M56.2,45.486h-5.051v-4.941H56.2 V45.486z M63.558,59.454h-5.05v-4.941h5.05V59.454z M63.558,52.404h-5.05v-4.941h5.05V52.404z M63.558,45.486h-5.05v-4.941h5.05 V45.486z M74.858,59.312h-6.521v-3.013h6.521V59.312z M71.572,50.854c-2.875,0-5.204-2.33-5.204-5.203s2.329-5.203,5.204-5.203 s5.204,2.33,5.204,5.203S74.446,50.854,71.572,50.854z M74.858,45.618c0,1.801-1.46,3.261-3.261,3.261 c-1.8,0-3.261-1.46-3.261-3.261s1.46-3.26,3.261-3.26C73.398,42.358,74.858,43.817,74.858,45.618z\"/> </svg>" |
| }, |
| "descriptors": [] |
| }]; |
| var vnfdCatalog = null; |
| var vnfdDict = {}; |
| if (result[1].body) { |
| vnfdCatalog = JSON.parse(result[1].body).collection['vnfd:vnfd'].map(function(v, i) { |
| vnfdDict[v.id] = v['short-name'] || v.name; |
| }) |
| } |
| if (result[0].body) { |
| response[0].descriptors = JSON.parse(result[0].body).collection['nsd:nsd']; |
| if (result[2].body) { |
| var data = JSON.parse(result[2].body); |
| if (data && data["nsr:ns-instance-opdata"] && data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]) { |
| var nsdRefCountCollection = data["nsr:ns-instance-opdata"]["rw-nsr:nsd-ref-count"]; |
| response[0].descriptors.map(function(nsd) { |
| if (!nsd["meta"]) { |
| nsd["meta"] = {}; |
| } |
| if (typeof nsd['meta'] == 'string') { |
| nsd['meta'] = JSON.parse(nsd['meta']); |
| } |
| nsd["meta"]["instance-ref-count"] = _.findWhere(nsdRefCountCollection, { |
| "nsd-id-ref": nsd.id |
| })["instance-ref-count"]; |
| nsd["constituent-vnfd"] && nsd["constituent-vnfd"].map(function(v) { |
| v.name = vnfdDict[v["vnfd-id-ref"]]; |
| }) |
| }); |
| } |
| } |
| }; |
| if (result[1].body) { |
| response[1].descriptors = JSON.parse(result[1].body).collection['vnfd:vnfd']; |
| }; |
| // if (result[2].body) { |
| // response[2].descriptors = JSON.parse(result[2].body).collection['pnfd:pnfd']; |
| // }; |
| resolve({ |
| statusCode: response.statusCode || 200, |
| data: JSON.stringify(response) |
| }); |
| }).catch(function(error) { |
| // Todo: Need better logic than all or nothing. |
| // Right now even if one of the southbound APIs fails - all fail |
| var res = {}; |
| console.log('Problem with Catalog.get', error); |
| res.statusCode = error.statusCode || 500; |
| res.errorMessage = { |
| error: 'Failed to get catalogs' + error |
| }; |
| reject(res); |
| }); |
| }); |
| }; |
| Catalog.delete = function(req) { |
| var api_server = req.query['api_server']; |
| var catalogType = req.params.catalogType; |
| var id = req.params.id; |
| console.log('Deleting', catalogType, id, 'from', api_server); |
| return new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog/' + catalogType + '/' + id, |
| method: 'DELETE', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('Catalog.delete', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| Catalog.getVNFD = function(req) { |
| var api_server = req.query['api_server']; |
| var vnfdID = req.body.data; |
| var authorization = req.get('Authorization'); |
| var VNFDs = []; |
| if (typeof(vnfdID) == "object" && vnfdID.constructor.name == "Array") { |
| vnfdID.map(function(id) { |
| VNFDs.push(requestVNFD(id)); |
| }); |
| } else { |
| VNFDs.push(requestVNFD(vnfdID)); |
| } |
| return new Promise(function(resolve, reject) { |
| Promise.all(VNFDs).then(function(data) { |
| resolve(data) |
| }).catch(function(error) { |
| // Todo: Need better logic than all or nothing. |
| // Right now even if one of the southbound APIs fails - all fail |
| var res = {}; |
| console.log('Problem with Catalog.getVNFD', error); |
| res.statusCode = 404; |
| res.errorMessage = { |
| error: 'Failed to get VNFDs' + error |
| }; |
| reject(res); |
| }); |
| }); |
| |
| function requestVNFD(id) { |
| return new Promise(function(resolve, reject) { |
| var url = utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd' + (id ? '/' + id : '') + '?deep'; |
| request({ |
| uri: url, |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': authorization |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('Catalog.getVNFD', error, response, body, resolve, reject)) { |
| var data; |
| //Is this still needed? |
| try { |
| data = JSON.parse(response.body) |
| } catch (e) { |
| reject({ |
| statusCode: response ? response.statusCode : 400, |
| errorMessage: 'Issue parsing VNFD ' + id + 'from ' + utils.confdPort(api_server) + APIVersion + '/api/config/vnfd-catalog/vnfd/' + id + '?deep' |
| }); |
| } |
| resolve(data); |
| } |
| }); |
| }); |
| } |
| }; |
| Catalog.create = function(req) { |
| var api_server = req.query['api_server']; |
| var catalogType = req.params.catalogType; |
| var data = req.body; |
| console.log('Creating', catalogType, 'on', api_server); |
| var jsonData = {}; |
| jsonData[catalogType] = []; |
| jsonData[catalogType].push(data); |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog', |
| method: 'POST', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('Catalog.create', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| Catalog.update = function(req) { |
| var api_server = req.query['api_server']; |
| var catalogType = req.params.catalogType; |
| var id = req.params.id; |
| var data = req.body; |
| console.log('Updating', catalogType, 'id', id, 'on', api_server); |
| var jsonData = {}; |
| jsonData[catalogType] = {}; |
| jsonData[catalogType] = data; |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/' + catalogType + '-catalog' + '/' + catalogType + '/' + id, |
| method: 'PUT', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('Catalog.update', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| |
| Catalog.decorateNsdCatalogWithPlacementGroups = function decorateNsdCatalogWithPlacementGroups(catalog) { |
| var newData = catalog; |
| var parsedCatalog = JSON.parse(catalog.data); |
| var nsds = parsedCatalog[0].descriptors; |
| var vnfds = parsedCatalog[1].descriptors; |
| var vnfdDict = (function(){ |
| var dict = {}; |
| vnfds.map(function(v, i) { |
| dict[v.id] = v; |
| }) |
| return dict; |
| })(vnfds); |
| |
| nsds.map(function(c, i) { |
| //Rename and decorate NSD placement groups |
| c['ns-placement-groups'] = c['placement-groups'] && c['placement-groups'].map(function(p, i) { |
| //Adds vnfd name to member-vnfd entry |
| p['member-vnfd'] = p['member-vnfd'].map(function(v) { |
| v.name = vnfdDict[v['vnfd-id-ref']].name; |
| return v; |
| }); |
| p['host-aggregate'] = []; |
| return p; |
| }); |
| |
| //Adds vnf placement groups to nsd object for UI |
| c['vnf-placement-groups'] = []; |
| c['constituent-vnfd'] && c['constituent-vnfd'].map(function(v) { |
| var vnf = vnfdDict[v['vnfd-id-ref']]; |
| // var vnfPg = { |
| // name: vnf.name, |
| // 'placement-groups': vnf['placement-groups'].map(function(vp){ |
| // vp['host-aggregate'] = [{}]; |
| // return vp; |
| // }) |
| // }; |
| v['vnf-name'] = vnf.name; |
| vnf['placement-groups'] && vnf['placement-groups'].map(function(vp) { |
| vp['host-aggregate'] = []; |
| vp['vnf-name'] = vnf.name; |
| vp['vnfd-id-ref'] = v['vnfd-id-ref']; |
| vp['member-vnf-index'] = v['member-vnf-index']; |
| c['vnf-placement-groups'].push(vp); |
| }) |
| }) |
| return c; |
| }) |
| // parsedCatalog[0].descriptors = nsds; |
| newData.data = JSON.stringify(parsedCatalog); |
| return newData; |
| } |
| |
| // NSR module methods |
| // Spend some time refactoring this |
| // refactor to accept only request object |
| NSR.get = function(req) { |
| var self = this; |
| var nsrPromises = []; |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| var nsdInfo = new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/nsd-catalog/nsd?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.get nsd-catalog', error, response, body, resolve, reject)) { |
| var data; |
| var isString = typeof(response.body) == "string"; |
| if (isString && response.body == '') return resolve('empty'); |
| data = isString ? JSON.parse(response.body) : response.body; |
| var nsdData = data.collection["nsd:nsd"]; |
| if (nsdData.constructor.name == "Object") { |
| nsdData = [nsdData]; |
| } |
| resolve(nsdData); |
| }; |
| }) |
| }) |
| var config = new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-config/nsr' + (id ? '/' + id : '') + '?deep', |
| method: 'GET', |
| headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.get ns-instance-config', error, response, body, resolve, reject)) { |
| var data; |
| var isString = typeof(response.body) == "string"; |
| if (isString && response.body == '') return resolve(); |
| data = isString ? JSON.parse(response.body) : response.body; |
| data = id ? data : data.collection; |
| var nsrData = data["nsr:nsr"]; |
| if (nsrData.constructor.name == "Object") { |
| nsrData = [nsrData]; |
| } |
| resolve(nsrData); |
| }; |
| }); |
| }); |
| var opData = new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr' + (id ? '/' + id : '') + '?deep', |
| method: 'GET', |
| headers: _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.get ns-instance-opdata', error, response, body, resolve, reject)) { |
| var data; |
| var isString = typeof(response.body) == "string"; |
| if (isString && response.body == '') return resolve(); |
| data = isString ? JSON.parse(response.body) : response.body; |
| data = id ? data : data.collection; |
| var nsrData = data["nsr:nsr"]; |
| if (nsrData.constructor.name == "Object") { |
| nsrData = [nsrData]; |
| } |
| nsrData.forEach(self.decorateWithScalingGroupDict); |
| nsrData.forEach(self.decorateAndTransformNFVI); |
| nsrData.forEach(self.decorateAndTransformWithControls); |
| Promise.all(self.addVnfrDataPromise(req, nsrData)).then(function() { |
| Promise.all(self.addVlrDataPromise(req, nsrData)).then(function() { |
| resolve(nsrData); |
| }); |
| }); |
| }; |
| }); |
| }).catch(function(error) { |
| console.log('error getting aggregated NS opdata', error) |
| //note this will actually trigger the success callback |
| }); |
| return new Promise(function(resolve, reject) { |
| //Need smarter error handling here |
| Promise.all([config, opData]).then(function(resolves) { |
| var aggregate = {}; |
| // resolves[0] ==> ns-instance-config |
| // resolves[1] ==> ns-instance-opdata |
| |
| var nsInstanceConfig = resolves[0] && resolves[0]; |
| var nsInstanceOpdata = resolves[1] && resolves[1]; |
| |
| if (!nsInstanceConfig && !nsInstanceOpdata) { |
| return resolve({ |
| nsrs: [] |
| }); |
| } |
| |
| nsInstanceConfig.forEach(function(v, k) { |
| v.nsd_name = v['nsd'] && v['nsd']['name']; |
| var scaling_group_descriptor = null; |
| |
| scaling_group_descriptor = v['nsd'] && v['nsd']['scaling-group-descriptor']; |
| |
| if (scaling_group_descriptor) { |
| scaling_group_descriptor.map(function(sgd, sgdi) { |
| sgd['vnfd-member'] && sgd['vnfd-member'].map(function(vnfd, vnfdi) { |
| var vnfrObj = _.findWhere(_.findWhere(nsInstanceOpdata, { |
| 'ns-instance-config-ref': v.id |
| }).vnfrs, { |
| 'member-vnf-index-ref': vnfd['member-vnf-index-ref'] |
| }); |
| if (vnfrObj) { |
| vnfd['short-name'] = vnfrObj['short-name']; |
| } |
| }) |
| }) |
| v['scaling-group-descriptor'] = scaling_group_descriptor; |
| } |
| |
| if (nsInstanceOpdata && nsInstanceOpdata.constructor.name == "Array") { |
| nsInstanceOpdata.forEach(function(w, l) { |
| if (v.id == w["ns-instance-config-ref"]) { |
| for (prop in w) { |
| if (prop != "ns-instance-config-ref" && !v.hasOwnProperty(prop)) { |
| v[prop] = w[prop]; |
| } |
| } |
| } |
| }); |
| } |
| |
| v['scaling-group-record'] && v['scaling-group-record'].map(function(sgr) { |
| var scalingGroupName = sgr['scaling-group-name-ref']; |
| sgr['instance'] && sgr['instance'].map(function(instance) { |
| var scalingGroupInstanceId = instance['instance-id']; |
| instance['vnfrs'] && instance['vnfrs'].map(function(vnfr) { |
| var vnfrObj = _.findWhere(v['vnfrs'], {id: vnfr}); |
| if (vnfrObj) { |
| vnfrObj['scaling-group-name'] = scalingGroupName; |
| vnfrObj['scaling-group-instance-id'] = scalingGroupInstanceId; |
| } |
| }); |
| }); |
| }) |
| }); |
| var nsrsData = nsInstanceConfig; |
| nsrsData.sort(function(a, b) { |
| return a["create-time"] - b["create-time"]; |
| }); |
| resolve({ |
| nsrs: nsrsData |
| }); |
| }).catch(function(error) { |
| reject({ |
| statusCode: 404, |
| errorMessage: error |
| }) |
| }) |
| }); |
| }; |
| // Static VNFR Cache bu VNFR ID |
| var staticVNFRCache = {}; |
| |
| /** |
| * [decorateWithScalingGroupDict description] |
| * @param {[type]} nsr [description] |
| * @return {[type]} |
| {vnfr-id} : { |
| "scaling-group-name-ref": "sg1", |
| "instance-id": 0, |
| "op-status": "running", |
| "is-default": "true", |
| "create-time": 1463593760, |
| "config-status": "configuring", |
| "vnfrs": [ |
| "432154e3-164e-4c05-83ee-3b56e4c898e7" |
| ] |
| } |
| */ |
| NSR.decorateWithScalingGroupDict = function(nsr) { |
| var sg = nsr["scaling-group-record"]; |
| var dict = {}; |
| if(sg) { |
| sg.map(function(s) { |
| var sgRef = s['scaling-group-name-ref']; |
| s.instance && s.instance.map(function(si) { |
| si.vnfrs && si.vnfrs.map(function(v) { |
| dict[v] = si; |
| dict[v]["scaling-group-name-ref"] = sgRef; |
| }) |
| }) |
| }) |
| } |
| return nsr['vnfr-scaling-groups'] = dict; |
| } |
| |
| |
| NSR.addVlrDataPromise = function(req, nsrs) { |
| var api_server = req.query['api_server']; |
| var promises = []; |
| nsrs.map(function(nsr) { |
| var vlrPromises = []; |
| var vlr = nsr['vlr']; |
| nsr['decorated-vlrs'] = []; |
| if (!vlr) { |
| console.log('No VL\'s found in NS'); |
| } |
| vlr && vlr.map(function(vlrObject) { |
| req.params.id = vlrObject['vlr-ref']; |
| var vlrPromise = VLR.get(req).then(function(vlr) { |
| try { |
| var vlrItem = vlr['data'][0]; |
| decorateNSRWithVLR(nsr, vlrObject, vlrItem); |
| } catch (e) { |
| console.log('Expection caught getting VLRs and adding to NSR:', e); |
| } |
| }) |
| vlrPromises.push(vlrPromise); |
| }); |
| var NSR_Promise = new Promise(function(resolve, reject) { |
| Promise.all(vlrPromises).then(function() { |
| resolve(); |
| }) |
| }); |
| promises.push(NSR_Promise); |
| }); |
| return promises; |
| |
| function decorateNSRWithVLR(nsr, nsrVLRObject, vlr) { |
| var vlrObject = _.extend(nsrVLRObject, vlr); |
| vlrObject['vnfr-connection-point-ref'] && vlrObject['vnfr-connection-point-ref'].map(function(vnfrCP) { |
| var vnfrName = nsr['vnfrs'] && _.find(nsr['vnfrs'], {id: vnfrCP['vnfr-id']})['name']; |
| vnfrName && (vnfrCP['vnfr-name'] = vnfrName); |
| }); |
| nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'name'), 0, vlrObject); |
| // nsr['decorated-vlrs'].splice(_.sortedIndex(nsr['decorated-vlrs'], vlrObject, 'create-time'), 0, vlrObject); |
| } |
| } |
| |
| |
| NSR.addVnfrDataPromise = function(req, nsrs) { |
| var api_server = req.query['api_server']; |
| var promises = []; |
| nsrs.map(function(nsr) { |
| var epa_params = {}; |
| var constituent_vnfr_ref = nsr["constituent-vnfr-ref"]; |
| var vnfrPromises = []; |
| nsr["vnfrs"] = []; |
| nsr["dashboard-urls"] = []; |
| nsr['nfvi-metrics'] = []; |
| if (!constituent_vnfr_ref) { |
| console.log('Something is wrong, there are no constituent-vnfr-refs'); |
| constituent_vnfr_ref = []; |
| } |
| //Get VNFR Static Data |
| constituent_vnfr_ref && constituent_vnfr_ref.map(function(constituentVnfrObj) { |
| req.params.id = constituentVnfrObj['vnfr-id']; |
| var vnfrPromise; |
| vnfrPromise = VNFR.get(req).then(function(vnfr) { |
| try { |
| var vnfrItem = vnfr[0]; |
| decorateNSRWithVNFR(nsr, vnfrItem) |
| staticVNFRCache[vnfrItem.id] = vnfrItem; |
| } catch (e) { |
| console.log('Exception caught:', e); |
| } |
| }); |
| vnfrPromises.push(vnfrPromise); |
| }); |
| var NSR_Promise = new Promise(function(resolve, reject) { |
| Promise.all(vnfrPromises).then(function() { |
| var vnfrs = staticVNFRCache; |
| //Aggregate EPA Params |
| constituent_vnfr_ref && constituent_vnfr_ref.map(function(k) { |
| if (vnfrs[k['vnfr-id']]) { |
| epa_params = epa_aggregator(vnfrs[k['vnfr-id']].vdur, epa_params); |
| } |
| }) |
| //Add VNFR Name to monitoring params |
| try { |
| if (nsr["monitoring-param"]) { |
| nsr["monitoring-param"].map(function(m) { |
| // var vnfr = vnfrs[m["vnfr-id"]] || {}; |
| // m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR'); |
| var groupTag = m['group-tag']; |
| var vnfrId = m['vnfr-mon-param-ref'] && m['vnfr-mon-param-ref'][0] && m['vnfr-mon-param-ref'][0]['vnfr-id-ref']; |
| var vnfr = vnfrs[vnfrId] || {}; |
| m["vnfr-name"] = vnfr['name'] ? vnfr['name'] : (vnfr['short-name'] ? vnfr['short-name'] : 'VNFR'); |
| m['group-tag'] = (groupTag ? (groupTag + ' - ') : '') + m['vnfr-name'] + (vnfrId ? ' (' + vnfrId.substring(1,8) + '...)' : ''); |
| |
| }); |
| } |
| } catch (e) { |
| console.log('Exception caught:', e); |
| } |
| resolve(); |
| }) |
| }) |
| nsr["epa-params"] = epa_params; |
| promises.push(NSR_Promise); |
| }) |
| return promises; |
| |
| function decorateNSRWithVDURConsoleUrls(nsr, vnfr) { |
| nsr['console-urls'] = nsr['console-urls'] ? nsr['console-urls'] : []; |
| |
| vnfr && vnfr['vdur'] && vnfr['vdur'].map(function(vdur) { |
| // This console-url is what front-end will hit to generate a real console-url |
| vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url'; |
| nsr['console-urls'].push({ |
| id: vdur.id, |
| name: vnfr.name, |
| 'console-url': vdur['console-url'] |
| }); |
| }); |
| } |
| |
| function decorateNSRWithVNFR(nsr, vnfr) { |
| var vnfrObj = { |
| id: vnfr.id, |
| "member-vnf-index-ref": vnfr["member-vnf-index-ref"], |
| "short-name": vnfr["short-name"], |
| "vnf-configuration": vnfr["vnf-configuration"], |
| "nsr-id": nsr['ns-instance-config-ref'], |
| "name": vnfr['name'], |
| "vdur": vnfr["vdur"], |
| "cloud-account": vnfr["cloud-account"] |
| }; |
| var vnfrSg = nsr['vnfr-scaling-groups']; |
| var vnfrName = vnfr["name"]; |
| if(vnfrSg) { |
| if(vnfrSg[vnfr.id]) { |
| vnfrName = vnfrSg[vnfr.id]["scaling-group-name-ref"] + ':' + vnfrSg[vnfr.id][ "instance-id"] + ':' + vnfrName; |
| } |
| } |
| var vnfrNfviMetrics = buildNfviGraphs(vnfr.vdur, vnfrName); |
| if (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) { |
| vnfrObj['service-primitives-present'] = true; |
| } else { |
| vnfrObj['service-primitives-present'] = false; |
| } |
| transforms.mergeVnfrNfviMetrics(vnfrNfviMetrics, nsr["nfvi-metrics"]); |
| //TODO: Should be sorted by create-time when it becomes available instead of id |
| // nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'create-time'), 0, vnfrObj); |
| nsr["vnfrs"].splice(_.sortedIndex(nsr['vnfrs'], vnfrObj, 'id'), 0, vnfrObj); |
| vnfrObj["dashboard-url"] = vnfr["dashboard-url"]; |
| nsr["dashboard-urls"].push(vnfrObj); |
| |
| decorateNSRWithVDURConsoleUrls(nsr, vnfr); |
| } |
| } |
| NSR.create = function(req) { |
| var api_server = req.query['api_server']; |
| var data = req.body.data; |
| console.log('Instantiating NSR on ', api_server); |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config', |
| method: 'POST', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: data |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.create', error, response, body, resolve, reject)) { |
| var nsr_id = null; |
| try { |
| nsr_id = data.nsr[0].id; |
| } catch (e) { |
| console.log("NSR.create unable to get nsr_id. Error: %s", |
| e.toString()); |
| } |
| resolve({ |
| statusCode: response.statusCode, |
| data: { nsr_id: nsr_id } |
| }); |
| }; |
| }); |
| }); |
| }; |
| NSR.delete = function(req) { |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| if (!id || !api_server) { |
| return new Promise(function(resolve, reject) { |
| console.log('Must specifiy api_server and id to delete NSR'); |
| return reject({ |
| statusCode: 500, |
| errorMessage: { |
| error: 'Must specifiy api_server and id to delete NSR' |
| } |
| }); |
| }); |
| }; |
| console.log('Deleting NSR with id: ' + id + 'on server: ' + api_server); |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id, |
| method: 'DELETE', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.delete', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: JSON.stringify(response.body) |
| }); |
| }; |
| }); |
| }); |
| }; |
| NSR.decorateAndTransformNFVI = function(nsr) { |
| var toDecorate = []; |
| // var metricsToUse = ["vcpu", "memory", "storage", "network"]; |
| var metricsToUse = ["vcpu", "memory"]; |
| try { |
| var nfviMetrics = nsr["rw-nsr:nfvi-metrics"]; |
| if (nfviMetrics) { |
| metricsToUse.map(function(name) { |
| toDecorate.push(nfviMetrics[name]) |
| }); |
| } |
| nsr["nfvi-metrics"] = toDecorate; |
| delete nsr["rw-nsr:nfvi-metrics"]; |
| } catch (e) {} |
| return nsr; |
| } |
| //Not a great pattern, Need a better way of handling logging; |
| //Refactor and move to the logging/logging.js |
| var logCache = { |
| decorateAndTransformWithControls: {} |
| } |
| NSR.decorateAndTransformWithControls = function(nsr) { |
| var controlTypes = ["action-param", "control-param"]; |
| var nsControls = []; |
| var Groups = {}; |
| controlTypes.map(function(control) { |
| try { |
| var controls = nsr["rw-nsr:" + control]; |
| // nsControls.push(controls); |
| controls.map(function(item) { |
| if (!Groups[item["group-tag"]]) { |
| Groups[item["group-tag"]] = {}; |
| Groups[item["group-tag"]]["action-param"] = [] |
| Groups[item["group-tag"]]["control-param"] = [] |
| } |
| Groups[item["group-tag"]][control].push(item); |
| }); |
| delete nsr["rw-nsr:" + control]; |
| } catch (e) { |
| var id = nsr["ns-instance-config-ref"]; |
| if (!logCache.decorateAndTransformWithControls[id]) { |
| logCache.decorateAndTransformWithControls[id] = {}; |
| } |
| var log = logCache.decorateAndTransformWithControls[id]; |
| if (!log[control]) { |
| log[control] = true; |
| console.log('No controls exist for ' + control + ' at ' + nsr["ns-instance-config-ref"]); |
| } |
| } |
| }); |
| for (k in Groups) { |
| var obj = {} |
| obj[k] = Groups[k]; |
| nsControls.push(obj) |
| } |
| nsr.nsControls = nsControls; |
| return nsr; |
| }; |
| NSR.setStatus = function(req) { |
| var api_server = req.query['api_server']; |
| var id = req.params.id; |
| var status = req.body.status; |
| console.log('Setting NSR (id: ' + id + ') status, on ' + api_server + ', to be: ' + status); |
| return new Promise(function(resolve, reject) { |
| var command; |
| if (typeof(status) != "string") { |
| reject({ |
| 'ERROR': 'NSR.setStatus Error: status is not a string type' |
| }); |
| } |
| command = status.toUpperCase(); |
| if (command != "ENABLED" && command != "DISABLED") { |
| reject({ |
| 'ERROR': 'NSR.setStatus Error: status is: ' + command + '. It should be ENABLED or DISABLED' |
| }); |
| } |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/admin-status/', |
| method: 'PUT', |
| headers: requestHeaders, |
| json: { |
| "nsr:admin-status": command |
| }, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.setStatus', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| }; |
| }); |
| }); |
| }; |
| |
| NSR.createScalingGroupInstance = function(req) { |
| var api_server = req.query['api_server']; |
| var id = req.params.id; |
| var scaling_group_id = req.params.scaling_group_id; |
| if (!api_server || !id || !scaling_group_id) { |
| return new Promise(function(resolve, reject) { |
| return reject({ |
| statusCode: 500, |
| errorMessage: { |
| error: 'API server/NSR id/Scaling group not provided' |
| } |
| }); |
| }); |
| } |
| |
| var instance_id = Math.floor(Math.random() * 65535); |
| |
| var jsonData = { |
| instance: [{ |
| // id: uuid.v1() |
| id: instance_id |
| }] |
| }; |
| |
| console.log('Creating scaling group instance for NSR ', id, ', scaling group ', scaling_group_id, ' with instance id ', instance_id); |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, |
| { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance', |
| method: 'POST', |
| headers: requestHeaders, |
| json: jsonData, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false |
| }, function (error, response, body) { |
| if (utils.validateResponse('NSR.createScalingGroupInstance', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: typeof response.body == 'string' ? JSON.parse(response.body):response.body |
| }) |
| } |
| }); |
| }); |
| }; |
| |
| NSR.deleteScalingGroupInstance = function(req) { |
| var api_server=req.query['api_server']; |
| var id = req.params.id; |
| var scaling_group_id = req.params.scaling_group_id; |
| var scaling_instance_id = req.params.scaling_instance_id; |
| |
| if (!api_server || !id || !scaling_group_id || !scaling_instance_id) { |
| return new Promise(function(resolve, reject) { |
| return reject({ |
| statusCode: 500, |
| errorMessage: { |
| error: 'API server/NSR id/Scaling group/Scaling instance id not provided' |
| } |
| }); |
| }); |
| } |
| |
| console.log('Deleting scaling group instance id ', scaling_instance_id, |
| ' for scaling group ', scaling_group_id, |
| ', under NSR ', id); |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, |
| { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + id + '/scaling-group/' + scaling_group_id + '/instance/' + scaling_instance_id, |
| method: 'DELETE', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false |
| }, function (error, response, body) { |
| if (utils.validateResponse('NSR.deleteScalingGroupInstance', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: typeof response.body == 'string' ? JSON.parse(response.body):response.body |
| }) |
| } |
| }); |
| }); |
| }; |
| |
| NSR.nsd = {}; |
| NSR.nsd.vld = {}; |
| |
| NSR.nsd.vld.get = function(req) { |
| var api_server = req.query['api_server']; |
| var nsr_id = req.params.nsr_id; |
| var vld_id = req.params.vld_id; |
| |
| if (!api_server || !nsr_id) { |
| return new Promise(function(resolve, reject) { |
| return reject({ |
| statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR, |
| errorMessage: 'API server/NSR id not provided' |
| }); |
| }) |
| } |
| console.log('Getting VLD', vld_id ? (' ' + vld_id) : ('\'s'), ' for NSR id', nsr_id); |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| vld_id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, |
| { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : '') +'?deep', |
| method: 'GET', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false |
| }, function (error, response, body) { |
| if (utils.validateResponse('NSR.nsd.vld.get', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: typeof response.body == 'string' ? JSON.parse(response.body):response.body |
| }); |
| } |
| }); |
| }); |
| }; |
| |
| NSR.nsd.vld.create = function(req) { |
| var api_server = req.query['api_server']; |
| var nsr_id = req.params.nsr_id; |
| var vld_id = req.params.vld_id; |
| var data = req.body; |
| |
| if (!api_server || !nsr_id) { |
| return new Promise(function(resolve, reject) { |
| return reject({ |
| statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR, |
| errorMessage: 'API server/NSR id not provided' |
| }); |
| }); |
| } |
| |
| console.log((vld_id ? 'Updating VLD ' + vld_id : 'Creating VLD') + ' under NSR', nsr_id); |
| |
| var jsonData = { |
| vld: typeof(data) == 'string' ? JSON.parse(data) : data |
| }; |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, constants.HTTP_HEADERS.accept.data, constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| uri: utils.confdPort(api_server) + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld' + (vld_id ? '/' + vld_id : ''), |
| method: vld_id ? 'PUT' : 'POST', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData |
| }, function(error, response, body) { |
| if (utils.validateResponse('NSR.nsd.vld.create/update', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: (typeof(response.body) == 'string') ? JSON.parse(response.body) : response.body |
| }); |
| } |
| }); |
| }); |
| }; |
| |
| NSR.nsd.vld.update = NSR.nsd.vld.create; |
| |
| NSR.nsd.vld.delete = function(req) { |
| var api_server = req.query['api_server']; |
| var nsr_id = req.params.nsr_id; |
| var vld_id = req.params.vld_id; |
| |
| if (!api_server || !nsr_id || !vld_id) { |
| return new Promise(function(resolve, reject) { |
| return reject({ |
| statusCode: constants.HTTPS_RESPONSE_CODES.ERROR.INTERNAL_SERVER_ERROR, |
| errorMessage: 'API server/NSR id/VLD id not provided' |
| }); |
| }) |
| } |
| console.log('Deleting VLD', vld_id, 'for NSR id', nsr_id); |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, |
| { |
| 'Authorization': req.get('Authorization') |
| } |
| ); |
| |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/ns-instance-config/nsr/' + nsr_id + '/nsd/vld/' + vld_id, |
| method: 'DELETE', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false |
| }, function (error, response, body) { |
| if (utils.validateResponse('NSR.nsd.vld.delete', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode, |
| data: typeof response.body == 'string' ? JSON.parse(response.body):response.body |
| }); |
| } |
| }); |
| }); |
| } |
| |
| VNFR.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/vnfr-catalog/vnfr' + (id ? '/' + id : '') + '?deep'; |
| var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('VNFR.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = id ? [data["vnfr:vnfr"]] : data.collection["vnfr:vnfr"]; |
| returnData.forEach(function(vnfr) { |
| vnfr['nfvi-metrics'] = buildNfviGraphs(vnfr.vdur); |
| vnfr['epa-params'] = epa_aggregator(vnfr.vdur); |
| vnfr['service-primitives-present'] = (vnfr['vnf-configuration'] && vnfr['vnf-configuration']['service-primitive'] && vnfr['vnf-configuration']['service-primitive'].length > 0) ? true : false; |
| vnfr['vdur'] && vnfr['vdur'].map(function(vdur, vdurIndex) { |
| // This console-url is what front-end will hit to generate a real console-url |
| vdur['console-url'] = 'api/vnfr/' + vnfr.id + '/vdur/' + vdur.id + '/console-url'; |
| }); |
| }); |
| return resolve(returnData); |
| }; |
| }); |
| }); |
| } |
| |
| function buildNfviGraphs(VDURs, vnfrName){ |
| var temp = {}; |
| var toReturn = []; |
| APIConfig.NfviMetrics.map(function(k) { |
| |
| VDURs && VDURs.map(function(v,i) { |
| //Check for RIFT-12699: VDUR NFVI Metrics not fully populated |
| if (v["rw-vnfr:nfvi-metrics"] && v["rw-vnfr:nfvi-metrics"][k] && v["rw-vnfr:nfvi-metrics"][k].hasOwnProperty('utilization')) { |
| if(!temp[k]) { |
| temp[k] = { |
| title: '', |
| data: [] |
| }; |
| }; |
| try { |
| var data = v["rw-vnfr:nfvi-metrics"][k]; |
| var newData = {}; |
| newData.name = v.name ? v.name : v.id.substring(0,6); |
| newData.name = vnfrName ? vnfrName + ': ' + newData.name : newData.name; |
| newData.id = v.id; |
| //converts to perentage |
| newData.utilization = data.utilization * 0.01; |
| temp[k].data.push(newData); |
| temp[k].title = v["rw-vnfr:nfvi-metrics"][k].label; |
| } catch (e) { |
| console.log('Something went wrong with the VNFR NFVI Metrics. Check that the data is being properly returned. ERROR: ', e); |
| } |
| } |
| }); |
| if(temp[k]) { |
| toReturn.push(temp[k]); |
| } |
| }); |
| return toReturn; |
| } |
| |
| |
| //Cache NSR reference for VNFR |
| VNFR.cachedNSR = {}; |
| VNFR.getByNSR = function(req) { |
| var api_server = req.query["api_server"]; |
| var id = req.params.nsr_id; |
| var uri = utils.confdPort(api_server); |
| var reqClone = _.clone(req); |
| delete reqClone.params.id; |
| uri += APIVersion + '/api/operational/ns-instance-opdata/nsr/' + id + '?deep'; |
| var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| if (VNFR.cachedNSR[id]) { |
| var data = VNFR.cachedNSR[id]; |
| var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id'); |
| VNFR.get(reqClone).then(function(vnfrData) { |
| resolve(filterVnfrByList(vnfrList, vnfrData)); |
| }); |
| } else { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('VNFR.getByNSR', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| data = data["nsr:nsr"]; |
| //Cache NSR data with NSR-ID as |
| VNFR.cachedNSR[id] = data; |
| var vnfrList = _.pluck(data["constituent-vnfr-ref"], 'vnfr-id'); |
| var returnData = []; |
| VNFR.get(reqClone).then(function(vnfrData) { |
| resolve(filterVnfrByList(vnfrList, vnfrData)); |
| }); |
| }; |
| }); |
| } |
| }); |
| }; |
| |
| function filterVnfrByList(vnfrList, vnfrData) { |
| return vnfrData.map(function(vnfr) { |
| if (vnfrList.indexOf(vnfr.id) > -1) { |
| return vnfr; |
| } |
| }) |
| }; |
| |
| VLR.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/vlr-catalog/vlr' + (id ? '/' + id : '') + '?deep'; |
| var headers = _.extend({}, id ? constants.HTTP_HEADERS.accept.data : constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('VLR.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = id ? [data["vlr:vlr"]] : data.collection["vlr:vlr"]; |
| return resolve({ |
| data: returnData, |
| statusCode: response.statusCode |
| }); |
| }; |
| }); |
| }); |
| } |
| |
| RIFT.api = function(req) { |
| var api_server = req.query["api_server"]; |
| var uri = utils.confdPort(api_server); |
| var url = req.path; |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri + url + '?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('RIFT.api', error, response, body, resolve, reject)) { |
| resolve(JSON.parse(response.body)) |
| }; |
| }) |
| }) |
| }; |
| |
| ComputeTopology.get = function(req) { |
| var api_server = req.query['api_server']; |
| var nsr_id = req.params.id; |
| var result = { |
| id: nsr_id, // node id |
| name: nsr_id, // node name to display |
| parameters: {}, // the parameters that can be used to determine size/color, etc. for the node |
| type: 'nsr', |
| children: [] // children for the node |
| }; |
| return new Promise(function(resolve, reject) { |
| var nsrPromise = new Promise(function(success, failure) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operational/ns-instance-opdata/nsr/' + nsr_id + '?deep', |
| method: 'GET', |
| headers: _.extend({}, |
| constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('ComputeTopology.get ns-instance-opdata/nsr/:id', error, response, body, success, failure)) { |
| var data; |
| var isString = typeof(response.body) == "string"; |
| if (isString && response.body == '') { |
| return success({}); |
| } |
| try { |
| data = isString ? JSON.parse(response.body) : response.body; |
| |
| var nsrNFVIMetricData = data["nsr:nsr"]["rw-nsr:nfvi-metrics"]; |
| result.parameters = nsrNFVIMetricData; |
| |
| result.name = data["nsr:nsr"]["name-ref"]; |
| |
| var nsrData = data["nsr:nsr"]["constituent-vnfr-ref"]; |
| success(nsrData); |
| } catch (e) { |
| console.log('Error parsing ns-instance-opdata for NSR ID', nsr_id, 'Exception:', e); |
| return failure() |
| } |
| }; |
| }); |
| }).then(function(data) { |
| |
| try { |
| // got NSR data |
| // now get VNFR data and populate the structure |
| var vnfrPromises = []; |
| |
| // Run separately to confirm that primary structure is populated before promise resolution takes over |
| // and starts modifying the data |
| data.forEach(function(vnfrObj) { |
| |
| var vnfrId = vnfrObj['vnfr-id']; |
| |
| // If anything needs to be added to result for each vnfrId, do it here |
| |
| vnfrPromises.push( |
| new Promise(function(success, failure) { |
| rp({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrId + '?deep', |
| method: 'GET', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| resolveWithFullResponse: true |
| }, function(error, response, body) { |
| if (utils.validateResponse('ComputeTopology.get vnfr-catalaog/vnfr/:id', error, response, body, success, failure)) { |
| try { |
| var data = JSON.parse(response.body); |
| var returnData = data["vnfr:vnfr"]; |
| |
| // Push VNFRs in result |
| result.children.push({ |
| id: vnfrId, |
| name: returnData.name, |
| parameters: {}, // nfvi metrics here |
| children: [], |
| type: 'vnfr' |
| }); |
| |
| // Push VDURs in result |
| returnData.vdur.forEach(function(vdur) { |
| result.children[result.children.length - 1].children.push({ |
| id: vdur.id, |
| name: vdur.id, |
| parameters: {}, |
| type: 'vdur' |
| // children: [] |
| }); |
| }); |
| |
| return success(returnData.vdur); |
| } catch (e) { |
| console.log('Error parsing vnfr-catalog for VNFR ID', vnfrId, 'Exception:', e); |
| return failure(); |
| } |
| }; |
| }); |
| }) |
| ); |
| }); |
| |
| Promise.all(vnfrPromises).then(function(output) { |
| console.log('Resolved all VNFR requests successfully'); |
| // By now result must be completely populated. output is moot |
| |
| // Sort the results as there's no order to them from RIFT-REST |
| result.children.sort(sortByName); |
| |
| result.children.forEach(function(vnfr) { |
| vnfr.children.sort(sortByName); |
| }); |
| |
| resolve({ |
| statusCode: 200, |
| data: result |
| }); |
| }).catch(function(error) { |
| // Todo: Can this be made better? |
| // Right now if one of the southbound APIs fails - we just return what's populated so far in result |
| console.log('Problem with ComputeTopology.get vnfr-catalog/vnfr/:id', error, 'Resolving with partial data', result); |
| resolve({ |
| statusCode: 200, |
| data: result |
| }); |
| }); |
| } catch (e) { |
| // API came back with empty ns-instance-opdata response for NSR ID |
| // bail |
| console.log('Error iterating through ns-instance-opdata response for NSR ID', nsr_id, 'Exception:', e); |
| resolve({ |
| statusCode: 200, |
| data: result |
| }) |
| } |
| }, function(error) { |
| // failed to get NSR data. |
| // bail |
| resolve({ |
| statusCode: 200, |
| data: result |
| }); |
| }); |
| }); |
| }; |
| |
| NetworkTopology.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/network?deep'; |
| var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false |
| }, function(error, response, body) { |
| if (utils.validateResponse('NetworkTopology.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = transforms.transformNetworkTopology( |
| data["ietf-network:network"] |
| ); |
| resolve({ |
| statusCode: 200, |
| data: returnData |
| }); |
| }; |
| }); |
| }) |
| } |
| |
| VDUR.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var vnfrID = req.params.vnfr_id; |
| var vdurID = req.params.vdur_id; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/vnfr-catalog/vnfr/' + vnfrID + '/vdur/' + vdurID + '?deep'; |
| var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('VDUR.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = data["vdur:vdur"]; |
| return resolve(returnData); |
| }; |
| }); |
| }) |
| } |
| |
| VDUR.consoleUrl = {}; |
| VDUR.consoleUrl.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var vnfrID = req.params.vnfr_id; |
| var vdurID = req.params.vdur_id; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/vnfr-console/vnfr/' + vnfrID + '/vdur/' + vdurID + '/console-url' + '?deep'; |
| var headers = _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('VDUR.consoleUrl.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = data; |
| return resolve({ |
| data: returnData, |
| statusCode: response.statusCode |
| }); |
| }; |
| }); |
| }) |
| } |
| |
| CloudAccount.get = function(req) { |
| var api_server = req.query["api_server"]; |
| var uri = utils.confdPort(api_server); |
| uri += APIVersion + '/api/operational/cloud/account?deep'; |
| var headers = _.extend({}, constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }); |
| return new Promise(function(resolve, reject) { |
| request({ |
| url: uri, |
| method: 'GET', |
| headers: headers, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('CloudAccount.get', error, response, body, resolve, reject)) { |
| var data = JSON.parse(response.body); |
| var returnData = data["collection"]["rw-cloud:account"]; |
| resolve({ |
| statusCode: 200, |
| data: returnData |
| }); |
| }; |
| }); |
| }); |
| } |
| |
| |
| // Config-Agent Account APIs |
| ConfigAgentAccount.get = function(req) { |
| var self = this; |
| |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| |
| if (!id) { |
| // Get all config accounts |
| return new Promise(function(resolve, reject) { |
| |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.collection, { |
| 'Authorization': req.get('Authorization') |
| }); |
| |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account', |
| type: 'GET', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, |
| function(error, response, body) { |
| var data; |
| var statusCode; |
| if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) { |
| try { |
| data = JSON.parse(response.body).collection['rw-config-agent:account']; |
| statusCode = response.statusCode; |
| } catch (e) { |
| console.log('Problem with "ConfigAgentAccount.get"', e); |
| var err = {}; |
| err.statusCode = 500; |
| err.errorMessage = { |
| error: 'Problem with "ConfigAgentAccount.get": ' + e.toString() |
| } |
| return reject(err); |
| } |
| |
| return resolve({ |
| statusCode: statusCode, |
| data: data |
| }); |
| }; |
| }); |
| }); |
| } else { |
| //Get a specific config account |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/operational/config-agent/account/' + id, |
| type: 'GET', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, |
| function(error, response, body) { |
| var data; |
| var statusCode; |
| if (utils.validateResponse('ConfigAgentAccount.get', error, response, body, resolve, reject)) { |
| try { |
| data = JSON.parse(response.body)['rw-config-agent:account']; |
| statusCode = response.statusCode; |
| } catch (e) { |
| console.log('Problem with "ConfigAgentAccount.get"', e); |
| var err = {}; |
| err.statusCode = 500; |
| err.errorMessage = { |
| error: 'Problem with "ConfigAgentAccount.get": ' + e.toString() |
| } |
| return reject(err); |
| } |
| |
| return resolve({ |
| statusCode: statusCode, |
| data: data |
| }); |
| } |
| }); |
| }); |
| } |
| }; |
| |
| ConfigAgentAccount.create = function(req) { |
| |
| var api_server = req.query["api_server"]; |
| var data = req.body; |
| |
| return new Promise(function(resolve, reject) { |
| var jsonData = { |
| "account": Array.isArray(data) ? data : [data] |
| }; |
| |
| console.log('Creating with', JSON.stringify(jsonData)); |
| |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent', |
| method: 'POST', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData, |
| }, function(error, response, body) { |
| if (utils.validateResponse('ConfigAgentAccount.create', error, response, body, resolve, reject)) { |
| return resolve({ |
| statusCode: response.statusCode, |
| data: JSON.stringify(response.body), |
| body:response.body.body |
| }); |
| }; |
| }); |
| }); |
| }; |
| |
| ConfigAgentAccount.update = function(req) { |
| |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| var data = req.body; |
| |
| return new Promise(function(resolve, reject) { |
| var jsonData = { |
| "rw-config-agent:account": data |
| }; |
| |
| console.log('Updating config-agent', id, ' with', JSON.stringify(jsonData)); |
| |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, |
| constants.HTTP_HEADERS.content_type.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id, |
| method: 'PUT', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| json: jsonData, |
| }, function(error, response, body) { |
| if (utils.validateResponse('ConfigAgentAccount.update', error, response, body, resolve, reject)) { |
| return resolve({ |
| statusCode: response.statusCode, |
| data: JSON.stringify(response.body) |
| }); |
| }; |
| }); |
| }); |
| }; |
| |
| ConfigAgentAccount.delete = function(req) { |
| |
| var api_server = req.query["api_server"]; |
| var id = req.params.id; |
| |
| if (!id || !api_server) { |
| return new Promise(function(resolve, reject) { |
| console.log('Must specifiy api_server and id to delete config-agent account'); |
| return reject({ |
| statusCode: 500, |
| errorMessage: { |
| error: 'Must specifiy api_server and id to delete config agent account' |
| } |
| }); |
| }); |
| }; |
| |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/config/config-agent/account/' + id, |
| method: 'DELETE', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('ConfigAgentAccount.delete', error, response, body, resolve, reject)) { |
| return resolve({ |
| statusCode: response.statusCode, |
| data: JSON.stringify(response.body) |
| }); |
| }; |
| }); |
| }); |
| }; |
| |
| |
| DataCenters.get = function(req) { |
| var api_server = req.query["api_server"]; |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/operational/datacenters?deep', |
| method: 'GET', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('DataCenters.get', error, response, body, resolve, reject)) { |
| var returnData = {}; |
| try { |
| data = JSON.parse(response.body)["rw-launchpad:datacenters"]["ro-accounts"]; |
| data.map(function(c) { |
| returnData[c.name] = c.datacenters; |
| }) |
| statusCode = response.statusCode; |
| } catch (e) { |
| console.log('Problem with "DataCenters.get"', e); |
| var err = {}; |
| err.statusCode = 500; |
| err.errorMessage = { |
| error: 'Problem with "DataCenters.get": ' + e.toString() |
| } |
| return reject(err); |
| } |
| return resolve({ |
| statusCode: response.statusCode, |
| data: returnData |
| }); |
| }; |
| }); |
| }); |
| } |
| |
| SSHkey.get = function(req) { |
| var api_server = req.query["api_server"]; |
| return new Promise(function(resolve, reject) { |
| var requestHeaders = {}; |
| _.extend(requestHeaders, |
| constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }); |
| request({ |
| url: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair?deep', |
| method: 'GET', |
| headers: requestHeaders, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('SSHkey.get', error, response, body, resolve, reject)) { |
| var returnData = {}; |
| try { |
| returnData = JSON.parse(response.body)['nsr:key-pair']; |
| statusCode = response.statusCode; |
| } catch (e) { |
| console.log('Problem with "SSHkey.get"', e); |
| var err = {}; |
| err.statusCode = 500; |
| err.errorMessage = { |
| error: 'Problem with "SSHkey.get": ' + e.toString() |
| } |
| return reject(err); |
| } |
| return resolve({ |
| statusCode: response.statusCode, |
| data: returnData |
| }); |
| }; |
| }); |
| }); |
| } |
| SSHkey.delete = function(req) { |
| var api_server = req.query['api_server']; |
| var id = decodeURI(req.params.name); |
| console.log('Deleting ssk-key', id); |
| return new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/' + id, |
| method: 'DELETE', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('SSHkey.delete', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| SSHkey.post = function(req) { |
| var api_server = req.query['api_server']; |
| var data = req.body; |
| return new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/', |
| method: 'POST', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| json: data, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('SSHkey.post', error, response, body, resolve, reject)) { |
| resolve({ |
| data: 'success', |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| SSHkey.put = function(req) { |
| var api_server = req.query['api_server']; |
| var data = req.body; |
| return new Promise(function(resolve, reject) { |
| request({ |
| uri: utils.confdPort(api_server) + APIVersion + '/api/config/key-pair/', |
| method: 'PUT', |
| headers: _.extend({}, constants.HTTP_HEADERS.accept.data, { |
| 'Authorization': req.get('Authorization') |
| }), |
| json: data, |
| forever: constants.FOREVER_ON, |
| rejectUnauthorized: false, |
| }, function(error, response, body) { |
| if (utils.validateResponse('SSHkey.put', error, response, body, resolve, reject)) { |
| resolve({ |
| statusCode: response.statusCode |
| }); |
| } |
| }); |
| }); |
| }; |
| |
| function sortByName(a, b) { |
| return a.name > b.name; |
| } |
| |
| module.exports.catalog = Catalog; |
| module.exports.nsr = NSR; |
| module.exports.vnfr = VNFR; |
| module.exports.vlr = VLR; |
| module.exports.vdur = VDUR; |
| module.exports.rift = RIFT; |
| module.exports.computeTopology = ComputeTopology; |
| module.exports.networkTopology = NetworkTopology; |
| module.exports.config = Config; |
| module.exports.cloud_account = CloudAccount; |
| module.exports['config-agent-account'] = ConfigAgentAccount; |
| module.exports.rpc = RPC; |
| module.exports.data_centers = DataCenters; |
| module.exports.SSHkey = SSHkey; |